KR20070024650A - 당뇨병 치료에 있어서 glk 활성화제로서 사용하기 위한헤테로아릴 벤즈아미드 유도체 - Google Patents
당뇨병 치료에 있어서 glk 활성화제로서 사용하기 위한헤테로아릴 벤즈아미드 유도체 Download PDFInfo
- Publication number
- KR20070024650A KR20070024650A KR1020067027324A KR20067027324A KR20070024650A KR 20070024650 A KR20070024650 A KR 20070024650A KR 1020067027324 A KR1020067027324 A KR 1020067027324A KR 20067027324 A KR20067027324 A KR 20067027324A KR 20070024650 A KR20070024650 A KR 20070024650A
- Authority
- KR
- South Korea
- Prior art keywords
- hydroxy
- methylethoxy
- benzamide
- methyl
- pyrazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- -1 Heteroaryl Benzamide Derivatives Chemical class 0.000 title claims description 594
- 238000011282 treatment Methods 0.000 title claims description 20
- 239000012190 activator Substances 0.000 title abstract description 9
- 206010012601 diabetes mellitus Diseases 0.000 title description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 309
- 150000001875 compounds Chemical class 0.000 claims abstract description 280
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 155
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 138
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 120
- 150000003839 salts Chemical class 0.000 claims abstract description 107
- 239000000651 prodrug Substances 0.000 claims abstract description 103
- 229940002612 prodrug Drugs 0.000 claims abstract description 103
- 239000012453 solvate Substances 0.000 claims abstract description 94
- 125000001424 substituent group Chemical group 0.000 claims abstract description 92
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 91
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 72
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 71
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 71
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 68
- 125000005843 halogen group Chemical group 0.000 claims abstract description 67
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 63
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 62
- 239000001257 hydrogen Substances 0.000 claims abstract description 62
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 62
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 62
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 62
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 60
- 238000000034 method Methods 0.000 claims abstract description 56
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 53
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 47
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 47
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 43
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 37
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 25
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 23
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 21
- 238000006467 substitution reaction Methods 0.000 claims abstract description 14
- 150000001721 carbon Chemical group 0.000 claims abstract description 13
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims abstract description 12
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims abstract description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 7
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 168
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 162
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 53
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 51
- 230000008569 process Effects 0.000 claims description 31
- 150000002148 esters Chemical class 0.000 claims description 25
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 24
- 125000006239 protecting group Chemical group 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 19
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 15
- 125000006125 ethylsulfonyl group Chemical group 0.000 claims description 14
- 150000001408 amides Chemical class 0.000 claims description 12
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 11
- 125000002619 bicyclic group Chemical group 0.000 claims description 10
- 201000010099 disease Diseases 0.000 claims description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 10
- 230000001404 mediated effect Effects 0.000 claims description 10
- AKRUGLJLNYJWFQ-HNNXBMFYSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 AKRUGLJLNYJWFQ-HNNXBMFYSA-N 0.000 claims description 9
- KNTJSHYACOBPAA-INIZCTEOSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C(=O)N1CCC1 KNTJSHYACOBPAA-INIZCTEOSA-N 0.000 claims description 9
- 239000003814 drug Substances 0.000 claims description 9
- GFZFCWVETIZWEV-INIZCTEOSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(5-methylpyrazin-2-yl)benzamide Chemical compound C=1C(C(=O)NC=2N=CC(C)=NC=2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 GFZFCWVETIZWEV-INIZCTEOSA-N 0.000 claims description 8
- ZJWOGKQAEOAHBB-KRWDZBQOSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(5-methylpyrazin-2-yl)benzamide Chemical compound C=1C(C(=O)NC=2N=CC(C)=NC=2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C(=O)N1CCC1 ZJWOGKQAEOAHBB-KRWDZBQOSA-N 0.000 claims description 8
- KGFQZZJSFVPPQN-KRWDZBQOSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-n-(1-ethylpyrazol-3-yl)-5-[(2s)-1-hydroxypropan-2-yl]oxybenzamide Chemical compound CCN1C=CC(NC(=O)C=2C=C(OC=3C=CC(=CC=3)C(=O)N3CCC3)C=C(O[C@@H](C)CO)C=2)=N1 KGFQZZJSFVPPQN-KRWDZBQOSA-N 0.000 claims description 8
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 8
- RRJMMMXXXQDTSF-HNNXBMFYSA-N 3-[4-(azetidine-1-carbonyl)-2-chlorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)Cl)=CC=C1C(=O)N1CCC1 RRJMMMXXXQDTSF-HNNXBMFYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- RQTOQYDNLOSBLT-KRWDZBQOSA-N 3-[4-(azetidine-1-carbonyl)-2-chlorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-propan-2-ylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C=C2)C(C)C)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)Cl)=CC=C1C(=O)N1CCC1 RQTOQYDNLOSBLT-KRWDZBQOSA-N 0.000 claims description 6
- UKXZBZYOCILZSO-ZDUSSCGKSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide Chemical compound C=1C(C(=O)NC=2SN=C(C)N=2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 UKXZBZYOCILZSO-ZDUSSCGKSA-N 0.000 claims description 6
- TVUVLIZVLOWXNE-KRWDZBQOSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-n-(1,5-dimethylpyrazol-3-yl)-5-[(2s)-1-hydroxypropan-2-yl]oxybenzamide Chemical compound C=1C(C(=O)NC2=NN(C)C(C)=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C(=O)N1CCC1 TVUVLIZVLOWXNE-KRWDZBQOSA-N 0.000 claims description 6
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 claims description 5
- KIPZZZALTNYLEP-HNNXBMFYSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1h-pyrazol-5-yl)benzamide Chemical compound C=1C(C(=O)NC2=NNC=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C(=O)N1CCC1 KIPZZZALTNYLEP-HNNXBMFYSA-N 0.000 claims description 5
- CTQXBCRVTNZSHG-KRWDZBQOSA-N 3-[2-fluoro-4-(piperidine-1-carbonyl)phenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCCCC1 CTQXBCRVTNZSHG-KRWDZBQOSA-N 0.000 claims description 4
- HCWUMORILFVEKE-LYGPFTKASA-N 3-[4-(3-azabicyclo[2.1.1]hexane-3-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(O[C@H](CO)C)=CC(OC=2C(=CC(=CC=2)C(=O)N2C3CC(C3)C2)F)=CC=1C(=O)NC=1C=CN(C)N=1 HCWUMORILFVEKE-LYGPFTKASA-N 0.000 claims description 4
- WEGQVZGGZPAZJC-AWEZNQCLSA-N 3-[4-(azetidine-1-carbonyl)-2,5-difluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC(F)=C1C(=O)N1CCC1 WEGQVZGGZPAZJC-AWEZNQCLSA-N 0.000 claims description 4
- HYZAYNAJTQYSGX-AWEZNQCLSA-N 3-[4-(azetidine-1-carbonyl)-2-chloro-3-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1F)Cl)=CC=C1C(=O)N1CCC1 HYZAYNAJTQYSGX-AWEZNQCLSA-N 0.000 claims description 4
- NHKYBESMHZJKMA-HNNXBMFYSA-N 3-[4-(azetidine-1-carbonyl)-2-chlorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-pyrazin-2-ylbenzamide Chemical class C=1C(C(=O)NC=2N=CC=NC=2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)Cl)=CC=C1C(=O)N1CCC1 NHKYBESMHZJKMA-HNNXBMFYSA-N 0.000 claims description 4
- AKRUGLJLNYJWFQ-OAHLLOKOSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2r)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 AKRUGLJLNYJWFQ-OAHLLOKOSA-N 0.000 claims description 4
- CIJUGQBBGBEWAB-AWEZNQCLSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1h-pyrazol-5-yl)benzamide Chemical compound C=1C(C(=O)NC2=NNC=C2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 CIJUGQBBGBEWAB-AWEZNQCLSA-N 0.000 claims description 4
- XXMIGJYIQMJEBN-AWEZNQCLSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(5-methyl-1,3-thiazol-2-yl)benzamide Chemical compound C=1C(C(=O)NC=2SC(C)=CN=2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 XXMIGJYIQMJEBN-AWEZNQCLSA-N 0.000 claims description 4
- YINKJBQCZKBEJZ-HNNXBMFYSA-N 3-[4-(azetidine-1-carbonyl)-3-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1F)=CC=C1C(=O)N1CCC1 YINKJBQCZKBEJZ-HNNXBMFYSA-N 0.000 claims description 4
- DILOBVJWGKBOGH-INIZCTEOSA-N 3-[4-(azetidine-1-carbonyl)phenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-pyrazin-2-ylbenzamide Chemical compound C=1C(C(=O)NC=2N=CC=NC=2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C(=O)N1CCC1 DILOBVJWGKBOGH-INIZCTEOSA-N 0.000 claims description 4
- 241000124008 Mammalia Species 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 238000010931 ester hydrolysis Methods 0.000 claims description 4
- 125000002524 organometallic group Chemical group 0.000 claims description 4
- QGNXEGGMBKUQHH-ZDUSSCGKSA-N 2,5-difluoro-4-[3-[(2s)-1-hydroxypropan-2-yl]oxy-5-[(1-methylpyrazol-3-yl)carbamoyl]phenoxy]-n,n-dimethylbenzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC(F)=C(C(=O)N(C)C)C=C1F QGNXEGGMBKUQHH-ZDUSSCGKSA-N 0.000 claims description 3
- LBSURZAJJGLALN-ZDUSSCGKSA-N 2-chloro-5-fluoro-4-[3-[(2s)-1-hydroxypropan-2-yl]oxy-5-[(1-methylpyrazol-3-yl)carbamoyl]phenoxy]-n,n-dimethylbenzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC(Cl)=C(C(=O)N(C)C)C=C1F LBSURZAJJGLALN-ZDUSSCGKSA-N 0.000 claims description 3
- IZNGZRYGGXLKOA-LBPRGKRZSA-N 3-(2,5-difluoro-4-methylsulfonylphenoxy)-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC(F)=C(S(C)(=O)=O)C=C1F IZNGZRYGGXLKOA-LBPRGKRZSA-N 0.000 claims description 3
- JXIFNARWIANAGZ-ZDUSSCGKSA-N 3-(3-fluoro-4-methoxyphenoxy)-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C1=C(F)C(OC)=CC=C1OC1=CC(O[C@@H](C)CO)=CC(C(=O)NC2=NN(C)C=C2)=C1 JXIFNARWIANAGZ-ZDUSSCGKSA-N 0.000 claims description 3
- DRKIZKDIBUWOJL-LBPRGKRZSA-N 3-(5-chloro-2-fluoro-4-methylsulfonylphenoxy)-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC(Cl)=C(S(C)(=O)=O)C=C1F DRKIZKDIBUWOJL-LBPRGKRZSA-N 0.000 claims description 3
- WXZJALPRVRLDDJ-ZDUSSCGKSA-N 3-[(2s)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)-n-(1,3-thiazol-2-yl)benzamide Chemical compound C=1C(C(=O)NC=2SC=CN=2)=CC(O[C@H](CO)C)=CC=1OC1=CC=C(S(C)(=O)=O)C=C1 WXZJALPRVRLDDJ-ZDUSSCGKSA-N 0.000 claims description 3
- NFUMCPRLACCHPZ-ZDUSSCGKSA-N 3-[(2s)-1-hydroxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)-n-(1h-pyrazol-5-yl)benzamide Chemical compound C=1C(C(=O)NC2=NNC=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC=C(S(C)(=O)=O)C=C1 NFUMCPRLACCHPZ-ZDUSSCGKSA-N 0.000 claims description 3
- HOBZLNWZUTWPDI-AWEZNQCLSA-N 3-fluoro-4-[3-[(2s)-1-hydroxypropan-2-yl]oxy-5-[(1-methylpyrazol-3-yl)carbamoyl]phenoxy]-n,n-dimethylbenzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC=C(C(=O)N(C)C)C=C1F HOBZLNWZUTWPDI-AWEZNQCLSA-N 0.000 claims description 3
- MWLPVXQLWZMVDJ-INIZCTEOSA-N 3-fluoro-4-[3-[(2s)-1-hydroxypropan-2-yl]oxy-5-[(1-propan-2-ylpyrazol-3-yl)carbamoyl]phenoxy]-n,n-dimethylbenzamide Chemical compound C=1C(C(=O)NC2=NN(C=C2)C(C)C)=CC(O[C@H](CO)C)=CC=1OC1=CC=C(C(=O)N(C)C)C=C1F MWLPVXQLWZMVDJ-INIZCTEOSA-N 0.000 claims description 3
- 125000006317 cyclopropyl amino group Chemical group 0.000 claims description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 346
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 170
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 96
- 239000000243 solution Substances 0.000 description 93
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 90
- 239000000203 mixture Substances 0.000 description 84
- 238000005481 NMR spectroscopy Methods 0.000 description 79
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 69
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 66
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 57
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 56
- 238000006243 chemical reaction Methods 0.000 description 50
- 102000030595 Glucokinase Human genes 0.000 description 49
- 108010021582 Glucokinase Proteins 0.000 description 49
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 47
- 125000003226 pyrazolyl group Chemical group 0.000 description 46
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 45
- 125000001113 thiadiazolyl group Chemical group 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- 125000000335 thiazolyl group Chemical group 0.000 description 41
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 40
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 36
- 239000012044 organic layer Substances 0.000 description 36
- 239000011541 reaction mixture Substances 0.000 description 36
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 36
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 35
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 35
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 35
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 34
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 33
- 238000004587 chromatography analysis Methods 0.000 description 33
- 239000012267 brine Substances 0.000 description 32
- 125000000842 isoxazolyl group Chemical group 0.000 description 32
- 125000002971 oxazolyl group Chemical group 0.000 description 32
- 125000003373 pyrazinyl group Chemical group 0.000 description 31
- 125000001786 isothiazolyl group Chemical group 0.000 description 30
- 125000004076 pyridyl group Chemical group 0.000 description 30
- 125000002883 imidazolyl group Chemical group 0.000 description 28
- 125000004193 piperazinyl group Chemical group 0.000 description 28
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 28
- 238000000746 purification Methods 0.000 description 28
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000008103 glucose Substances 0.000 description 27
- 125000002098 pyridazinyl group Chemical group 0.000 description 27
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 26
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 26
- 125000002393 azetidinyl group Chemical group 0.000 description 24
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 24
- 125000000714 pyrimidinyl group Chemical group 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 239000002904 solvent Substances 0.000 description 23
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 22
- 238000004440 column chromatography Methods 0.000 description 22
- 125000003386 piperidinyl group Chemical group 0.000 description 22
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 21
- 235000017557 sodium bicarbonate Nutrition 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 20
- 229910052786 argon Inorganic materials 0.000 description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 18
- 239000010410 layer Substances 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- 235000019198 oils Nutrition 0.000 description 18
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 18
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 17
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 17
- 125000001544 thienyl group Chemical group 0.000 description 17
- UQFQONCQIQEYPJ-UHFFFAOYSA-N N-methylpyrazole Chemical compound CN1C=CC=N1 UQFQONCQIQEYPJ-UHFFFAOYSA-N 0.000 description 16
- 239000000706 filtrate Substances 0.000 description 16
- 230000002829 reductive effect Effects 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 16
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 15
- 229940050390 benzoate Drugs 0.000 description 15
- 239000012230 colorless oil Substances 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 125000001715 oxadiazolyl group Chemical group 0.000 description 15
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 15
- 208000008589 Obesity Diseases 0.000 description 14
- 125000001153 fluoro group Chemical group F* 0.000 description 14
- 125000002541 furyl group Chemical group 0.000 description 14
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 14
- 235000020824 obesity Nutrition 0.000 description 14
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000000284 extract Substances 0.000 description 13
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- 125000001309 chloro group Chemical group Cl* 0.000 description 12
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- 125000000168 pyrrolyl group Chemical group 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 239000007821 HATU Substances 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 11
- 150000001501 aryl fluorides Chemical class 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 230000007062 hydrolysis Effects 0.000 description 11
- 238000006460 hydrolysis reaction Methods 0.000 description 11
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 11
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 11
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 10
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 238000001727 in vivo Methods 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- 239000005711 Benzoic acid Substances 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 235000010233 benzoic acid Nutrition 0.000 description 9
- 239000006260 foam Substances 0.000 description 9
- 238000009472 formulation Methods 0.000 description 9
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 230000002440 hepatic effect Effects 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- BOXIOUFIIIWMMF-UHFFFAOYSA-N azetidin-1-yl-(3,4-difluorophenyl)methanone Chemical compound C1=C(F)C(F)=CC=C1C(=O)N1CCC1 BOXIOUFIIIWMMF-UHFFFAOYSA-N 0.000 description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 7
- 239000007859 condensation product Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000003205 fragrance Substances 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 239000003755 preservative agent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 235000006708 antioxidants Nutrition 0.000 description 5
- 239000007900 aqueous suspension Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 235000003599 food sweetener Nutrition 0.000 description 5
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 210000004185 liver Anatomy 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 5
- 230000036961 partial effect Effects 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- ANMVTDVBEDVFRB-UHFFFAOYSA-N 1-propan-2-ylpyrazole Chemical compound CC(C)N1C=CC=N1 ANMVTDVBEDVFRB-UHFFFAOYSA-N 0.000 description 4
- PJIAOAQBXXYLRX-ZDUSSCGKSA-N 3-[(2s)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(O[C@@H](C)COC)=CC(OCC=2C=CC=CC=2)=C1 PJIAOAQBXXYLRX-ZDUSSCGKSA-N 0.000 description 4
- ZXOMVPKFUTWYBJ-VIFPVBQESA-N 3-hydroxy-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound OC[C@H](C)OC1=CC(O)=CC(C(=O)NC2=NN(C)C=C2)=C1 ZXOMVPKFUTWYBJ-VIFPVBQESA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 description 4
- 101800000224 Glucagon-like peptide 1 Proteins 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 102100040918 Pro-glucagon Human genes 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 238000010640 amide synthesis reaction Methods 0.000 description 4
- FHRNSSUQTJBVMH-UHFFFAOYSA-N azetidin-1-yl-(3-chloro-4-fluorophenyl)methanone Chemical compound C1=C(Cl)C(F)=CC=C1C(=O)N1CCC1 FHRNSSUQTJBVMH-UHFFFAOYSA-N 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 4
- 230000037406 food intake Effects 0.000 description 4
- 235000012631 food intake Nutrition 0.000 description 4
- 230000003914 insulin secretion Effects 0.000 description 4
- ZKLLSNQJRLJIGT-UYFOZJQFSA-N keto-D-fructose 1-phosphate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)COP(O)(O)=O ZKLLSNQJRLJIGT-UYFOZJQFSA-N 0.000 description 4
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 4
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 4
- RNVFYQUEEMZKLR-UHFFFAOYSA-N methyl 3,5-dihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(O)=C1 RNVFYQUEEMZKLR-UHFFFAOYSA-N 0.000 description 4
- DDPIXQLSJXBHGF-UHFFFAOYSA-N methyl 3-hydroxy-5-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(OCC=2C=CC=CC=2)=C1 DDPIXQLSJXBHGF-UHFFFAOYSA-N 0.000 description 4
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 4
- CAWHJQAVHZEVTJ-UHFFFAOYSA-N methylpyrazine Chemical compound CC1=CN=CC=N1 CAWHJQAVHZEVTJ-UHFFFAOYSA-N 0.000 description 4
- 239000002808 molecular sieve Substances 0.000 description 4
- 210000002569 neuron Anatomy 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 210000000496 pancreas Anatomy 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 4
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- 125000004665 trialkylsilyl group Chemical group 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- BJDDRAYUVSVPPR-MRVPVSSYSA-N (2r)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol Chemical compound C[C@@H](O)CO[Si](C)(C)C(C)(C)C BJDDRAYUVSVPPR-MRVPVSSYSA-N 0.000 description 3
- YEDVSIZGMYQNOU-UHFFFAOYSA-N 1,2,4-trifluoro-5-methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC(F)=C(F)C=C1F YEDVSIZGMYQNOU-UHFFFAOYSA-N 0.000 description 3
- MOGQNVSKBCVIPW-UHFFFAOYSA-N 1-methylpyrazol-3-amine Chemical compound CN1C=CC(N)=N1 MOGQNVSKBCVIPW-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- NJEREAVXCVWZOI-KRWDZBQOSA-N 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(O[C@H](CO[Si](C)(C)C(C)(C)C)C)=CC(OCC=2C=CC=CC=2)=C1 NJEREAVXCVWZOI-KRWDZBQOSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 3
- GSXOAOHZAIYLCY-UHFFFAOYSA-N D-F6P Natural products OCC(=O)C(O)C(O)C(O)COP(O)(O)=O GSXOAOHZAIYLCY-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 125000005104 aryl silyl group Chemical group 0.000 description 3
- 235000010323 ascorbic acid Nutrition 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 239000011668 ascorbic acid Substances 0.000 description 3
- HGQULGDOROIPJN-UHFFFAOYSA-N azetidin-1-ium;chloride Chemical compound Cl.C1CNC1 HGQULGDOROIPJN-UHFFFAOYSA-N 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- BGWGXPAPYGQALX-ARQDHWQXSA-N beta-D-fructofuranose 6-phosphate Chemical compound OC[C@@]1(O)O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O BGWGXPAPYGQALX-ARQDHWQXSA-N 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 3
- 239000013058 crude material Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 235000005911 diet Nutrition 0.000 description 3
- 230000000378 dietary effect Effects 0.000 description 3
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 3
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 230000004190 glucose uptake Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 210000003494 hepatocyte Anatomy 0.000 description 3
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 3
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229940057995 liquid paraffin Drugs 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- CBYFYXMWRBQJTE-SFHVURJKSA-N methyl 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-phenylmethoxybenzoate Chemical compound CC(C)(C)[Si](C)(C)OC[C@H](C)OC1=CC(C(=O)OC)=CC(OCC=2C=CC=CC=2)=C1 CBYFYXMWRBQJTE-SFHVURJKSA-N 0.000 description 3
- JGIXKHBUAQEBSU-QMMMGPOBSA-N methyl 3-hydroxy-5-[(2s)-1-methoxypropan-2-yl]oxybenzoate Chemical compound COC[C@H](C)OC1=CC(O)=CC(C(=O)OC)=C1 JGIXKHBUAQEBSU-QMMMGPOBSA-N 0.000 description 3
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 3
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 150000003384 small molecules Chemical class 0.000 description 3
- PODWXQQNRWNDGD-UHFFFAOYSA-L sodium thiosulfate pentahydrate Chemical compound O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O PODWXQQNRWNDGD-UHFFFAOYSA-L 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- SLWKHFGJHAEQPD-UHFFFAOYSA-N tert-butyl 3-aminopyrazole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(N)=N1 SLWKHFGJHAEQPD-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000001425 triazolyl group Chemical group 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- ARXJGSRGQADJSQ-SCSAIBSYSA-N (2r)-1-methoxypropan-2-ol Chemical compound COC[C@@H](C)O ARXJGSRGQADJSQ-SCSAIBSYSA-N 0.000 description 2
- XVRHFURUJQNMAM-UHFFFAOYSA-N (3,4-difluorophenyl)-pyrrolidin-1-ylmethanone Chemical compound C1=C(F)C(F)=CC=C1C(=O)N1CCCC1 XVRHFURUJQNMAM-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 2
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- OZFVRGGLYKNIMV-UHFFFAOYSA-N 1-chloro-4,5-difluoro-2-methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC(F)=C(F)C=C1Cl OZFVRGGLYKNIMV-UHFFFAOYSA-N 0.000 description 2
- DPJHZJGAGIWXTD-UHFFFAOYSA-N 1-fluoro-4-methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC=C(F)C=C1 DPJHZJGAGIWXTD-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- MECWXEINLHIGIW-UHFFFAOYSA-N 1-propan-2-ylpyrazol-3-amine Chemical compound CC(C)N1C=CC(N)=N1 MECWXEINLHIGIW-UHFFFAOYSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical class NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- YSAACRXKFKCEDA-UHFFFAOYSA-N 3,4-difluoro-n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(F)C(F)=C1 YSAACRXKFKCEDA-UHFFFAOYSA-N 0.000 description 2
- YQWOFCFHEANFTJ-HNNXBMFYSA-N 3-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)-5-[4-(1h-pyrazol-5-yl)phenoxy]benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C=1C=CNN=1 YQWOFCFHEANFTJ-HNNXBMFYSA-N 0.000 description 2
- OGHAGYMKDVATME-LBPRGKRZSA-N 3-[(2s)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid Chemical compound OC(=O)C1=CC(O[C@@H](C)COC)=CC(OC=2C=CC(=CC=2)S(C)(=O)=O)=C1 OGHAGYMKDVATME-LBPRGKRZSA-N 0.000 description 2
- ORYWPXOUQLHFRJ-LBPRGKRZSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxybenzoic acid Chemical compound OC(=O)C1=CC(O[C@H](CO)C)=CC(OC=2C(=CC(=CC=2)C(=O)N2CCC2)F)=C1 ORYWPXOUQLHFRJ-LBPRGKRZSA-N 0.000 description 2
- ZXYMYAGGEHXBMR-UHFFFAOYSA-N 3-chloro-4-fluoro-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(F)C(Cl)=C1 ZXYMYAGGEHXBMR-UHFFFAOYSA-N 0.000 description 2
- PKTSBFXIHLYGEY-UHFFFAOYSA-N 3-chloro-4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(Cl)=C1 PKTSBFXIHLYGEY-UHFFFAOYSA-N 0.000 description 2
- YLYDMVVGZJUBDE-UHFFFAOYSA-N 4-(methoxymethyl)-1,3-thiazol-2-amine Chemical compound COCC1=CSC(N)=N1 YLYDMVVGZJUBDE-UHFFFAOYSA-N 0.000 description 2
- IBFPZZUSZPZZOX-LBPRGKRZSA-N 4-[3-[(2s)-1-hydroxypropan-2-yl]oxy-5-(1h-pyrazol-5-ylcarbamoyl)phenoxy]benzoic acid Chemical compound C=1C(C(=O)NC2=NNC=C2)=CC(O[C@H](CO)C)=CC=1OC1=CC=C(C(O)=O)C=C1 IBFPZZUSZPZZOX-LBPRGKRZSA-N 0.000 description 2
- YSKPJNBCDJOHGJ-UHFFFAOYSA-N 4-ethylsulfonyl-1,2-difluorobenzene Chemical compound CCS(=O)(=O)C1=CC=C(F)C(F)=C1 YSKPJNBCDJOHGJ-UHFFFAOYSA-N 0.000 description 2
- AEKVBBNGWBBYLL-UHFFFAOYSA-N 4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C=C1 AEKVBBNGWBBYLL-UHFFFAOYSA-N 0.000 description 2
- ZNQOALAKPLGUPH-UHFFFAOYSA-N 5-methylpyrazin-2-amine Chemical compound CC1=CN=C(N)C=N1 ZNQOALAKPLGUPH-UHFFFAOYSA-N 0.000 description 2
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 235000006491 Acacia senegal Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000003911 Arachis Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 108010011485 Aspartame Proteins 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 229930091371 Fructose Natural products 0.000 description 2
- 239000005715 Fructose Substances 0.000 description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 2
- 102000058058 Glucose Transporter Type 2 Human genes 0.000 description 2
- 229920002527 Glycogen Polymers 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 description 2
- 208000013016 Hypoglycemia Diseases 0.000 description 2
- 102000004877 Insulin Human genes 0.000 description 2
- 108090001061 Insulin Proteins 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 108090000189 Neuropeptides Proteins 0.000 description 2
- 102000023984 PPAR alpha Human genes 0.000 description 2
- 102000000536 PPAR gamma Human genes 0.000 description 2
- 108010016731 PPAR gamma Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 2
- 108091006299 SLC2A2 Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 229940127218 antiplatelet drug Drugs 0.000 description 2
- 230000036528 appetite Effects 0.000 description 2
- 235000019789 appetite Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 2
- 239000000605 aspartame Substances 0.000 description 2
- 229960003438 aspartame Drugs 0.000 description 2
- 235000010357 aspartame Nutrition 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 210000000227 basophil cell of anterior lobe of hypophysis Anatomy 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000011284 combination treatment Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 230000006806 disease prevention Effects 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 210000003890 endocrine cell Anatomy 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229940096919 glycogen Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000002471 hydroxymethylglutaryl coenzyme A reductase inhibitor Substances 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 201000001421 hyperglycemia Diseases 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- 230000002267 hypothalamic effect Effects 0.000 description 2
- MGXWVYUBJRZYPE-YUGYIWNOSA-N incretin Chemical class C([C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1C=CC(O)=CC=1)[C@@H](C)O)[C@@H](C)CC)C1=CC=C(O)C=C1 MGXWVYUBJRZYPE-YUGYIWNOSA-N 0.000 description 2
- 239000000859 incretin Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 229940125396 insulin Drugs 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 230000002262 irrigation Effects 0.000 description 2
- 238000003973 irrigation Methods 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- SWKWYHIDRFJNOI-UHFFFAOYSA-N methyl 3-(4-methylsulfonylphenoxy)-5-phenylmethoxybenzoate Chemical compound C=1C(OC=2C=CC(=CC=2)S(C)(=O)=O)=CC(C(=O)OC)=CC=1OCC1=CC=CC=C1 SWKWYHIDRFJNOI-UHFFFAOYSA-N 0.000 description 2
- OJSDHHPLMKAABC-LBPRGKRZSA-N methyl 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(O[C@@H](C)CO[Si](C)(C)C(C)(C)C)=C1 OJSDHHPLMKAABC-LBPRGKRZSA-N 0.000 description 2
- JCTASGQIZHOHNP-AWEZNQCLSA-N methyl 3-[(2s)-1-methoxypropan-2-yl]oxy-5-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(O[C@@H](C)COC)=CC(OCC=2C=CC=CC=2)=C1 JCTASGQIZHOHNP-AWEZNQCLSA-N 0.000 description 2
- HUEGYHYYJDUQKQ-ZETCQYMHSA-N methyl 3-hydroxy-5-[(2s)-1-hydroxypropan-2-yl]oxybenzoate Chemical compound COC(=O)C1=CC(O)=CC(O[C@@H](C)CO)=C1 HUEGYHYYJDUQKQ-ZETCQYMHSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 108091008725 peroxisome proliferator-activated receptors alpha Proteins 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 125000005633 phthalidyl group Chemical group 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- FBZULTVJWVCJQV-UHFFFAOYSA-N propan-2-yl n-(propan-2-yloxycarbonylamino)carbamate Chemical compound CC(C)OC(=O)NNC(=O)OC(C)C FBZULTVJWVCJQV-UHFFFAOYSA-N 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- HSINOMROUCMIEA-FGVHQWLLSA-N (2s,4r)-4-[(3r,5s,6r,7r,8s,9s,10s,13r,14s,17r)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid Chemical compound C([C@@]12C)C[C@@H](O)C[C@H]1[C@@H](CC)[C@@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C[C@H](C)C(O)=O)CC[C@H]21 HSINOMROUCMIEA-FGVHQWLLSA-N 0.000 description 1
- QWQBQRYFWNIDOC-UHFFFAOYSA-N (3,5-difluorophenyl)boronic acid Chemical compound OB(O)C1=CC(F)=CC(F)=C1 QWQBQRYFWNIDOC-UHFFFAOYSA-N 0.000 description 1
- DPKSCZZZWASXQJ-UHFFFAOYSA-N (3-chloro-4-fluorophenyl)-pyrrolidin-1-ylmethanone Chemical compound C1=C(Cl)C(F)=CC=C1C(=O)N1CCCC1 DPKSCZZZWASXQJ-UHFFFAOYSA-N 0.000 description 1
- IILGLPAJXQMKGQ-UHFFFAOYSA-N (3-fluoro-4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1F IILGLPAJXQMKGQ-UHFFFAOYSA-N 0.000 description 1
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- GQIRIWDEZSKOCN-UHFFFAOYSA-N 1-chloro-n,n,2-trimethylprop-1-en-1-amine Chemical compound CN(C)C(Cl)=C(C)C GQIRIWDEZSKOCN-UHFFFAOYSA-N 0.000 description 1
- PZJGLURDALTFPQ-UHFFFAOYSA-N 1-ethylpyrazol-3-amine Chemical compound CCN1C=CC(N)=N1 PZJGLURDALTFPQ-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- LBQKIARPNRNHHQ-UHFFFAOYSA-N 1-tert-butyl-5-methylpyrazol-3-amine Chemical compound CC1=CC(N)=NN1C(C)(C)C LBQKIARPNRNHHQ-UHFFFAOYSA-N 0.000 description 1
- VLQPUERRGYFDSR-UHFFFAOYSA-N 1-tert-butylpyrazol-3-amine Chemical compound CC(C)(C)N1C=CC(N)=N1 VLQPUERRGYFDSR-UHFFFAOYSA-N 0.000 description 1
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- STCZWXXRRTWRSK-UHFFFAOYSA-N 2,4,5-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC(F)=C(S(Cl)(=O)=O)C=C1F STCZWXXRRTWRSK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- FPENCTDAQQQKNY-UHFFFAOYSA-N 3,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C(F)=C1 FPENCTDAQQQKNY-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- SMKOZNYBWLZTLF-INIZCTEOSA-N 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoic acid Chemical compound OC(=O)C1=CC(O[C@H](CO[Si](C)(C)C(C)(C)C)C)=CC(OC=2C=CC(=CC=2)S(C)(=O)=O)=C1 SMKOZNYBWLZTLF-INIZCTEOSA-N 0.000 description 1
- IGPFWRDLUFBZNJ-AWEZNQCLSA-N 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound CC(C)(C)[Si](C)(C)OC[C@H](C)OC1=CC(O)=CC(C(=O)NC2=NN(C)C=C2)=C1 IGPFWRDLUFBZNJ-AWEZNQCLSA-N 0.000 description 1
- DCJSZJUYLABCRZ-HNNXBMFYSA-N 3-[(2s)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-n-(1-ethylpyrazol-3-yl)-5-hydroxybenzamide Chemical compound CCN1C=CC(NC(=O)C=2C=C(O[C@@H](C)CO[Si](C)(C)C(C)(C)C)C=C(O)C=2)=N1 DCJSZJUYLABCRZ-HNNXBMFYSA-N 0.000 description 1
- WUKXSLWVYVHMHR-AWEZNQCLSA-N 3-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)-5-[4-(1,2,4-oxadiazol-3-yl)phenoxy]benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@H](CO)C)=CC=1OC(C=C1)=CC=C1C=1N=CON=1 WUKXSLWVYVHMHR-AWEZNQCLSA-N 0.000 description 1
- XWEKDFNXXGQPMU-AWEZNQCLSA-N 3-[(2s)-1-hydroxypropan-2-yl]oxy-n-[4-(methoxymethyl)-1,3-thiazol-2-yl]-5-(4-methylsulfonylphenoxy)benzamide Chemical compound COCC1=CSC(NC(=O)C=2C=C(OC=3C=CC(=CC=3)S(C)(=O)=O)C=C(O[C@@H](C)CO)C=2)=N1 XWEKDFNXXGQPMU-AWEZNQCLSA-N 0.000 description 1
- YLSJWVQMXSNSQT-KRWDZBQOSA-N 3-[(2s)-1-methoxypropan-2-yl]oxy-n-(5-methylpyrazin-2-yl)-5-phenylmethoxybenzamide Chemical compound C=1C(C(=O)NC=2N=CC(C)=NC=2)=CC(O[C@@H](C)COC)=CC=1OCC1=CC=CC=C1 YLSJWVQMXSNSQT-KRWDZBQOSA-N 0.000 description 1
- ZCWLUBMFYJXAHQ-AWEZNQCLSA-N 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(1,3-thiazol-2-yl)benzamide Chemical compound C=1C(C(=O)NC=2SC=CN=2)=CC(O[C@H](CO)C)=CC=1OC(C(=C1)F)=CC=C1C(=O)N1CCC1 ZCWLUBMFYJXAHQ-AWEZNQCLSA-N 0.000 description 1
- HKCKWPADGVGWMB-AWEZNQCLSA-N 3-[4-(n'-hydroxycarbamimidoyl)phenoxy]-5-[(2s)-1-methoxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound C=1C(C(=O)NC2=NN(C)C=C2)=CC(O[C@@H](C)COC)=CC=1OC1=CC=C(C(=N)NO)C=C1 HKCKWPADGVGWMB-AWEZNQCLSA-N 0.000 description 1
- NVOQRUVWUJKHLJ-UHFFFAOYSA-N 3-amino-4-benzoylpyridine-2-carboxylic acid Chemical class C1=CN=C(C(O)=O)C(N)=C1C(=O)C1=CC=CC=C1 NVOQRUVWUJKHLJ-UHFFFAOYSA-N 0.000 description 1
- DXFXNSNBZNELII-UHFFFAOYSA-N 3-chloro-4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1Cl DXFXNSNBZNELII-UHFFFAOYSA-N 0.000 description 1
- IHDUYWKRFWZPTQ-JTQLQIEISA-N 3-hydroxy-5-[(2s)-1-hydroxypropan-2-yl]oxy-n-(5-methylpyrazin-2-yl)benzamide Chemical compound OC[C@H](C)OC1=CC(O)=CC(C(=O)NC=2N=CC(C)=NC=2)=C1 IHDUYWKRFWZPTQ-JTQLQIEISA-N 0.000 description 1
- QHHJDJYERISQPI-JTQLQIEISA-N 3-hydroxy-5-[(2s)-1-methoxypropan-2-yl]oxy-n-(1-methylpyrazol-3-yl)benzamide Chemical compound COC[C@H](C)OC1=CC(O)=CC(C(=O)NC2=NN(C)C=C2)=C1 QHHJDJYERISQPI-JTQLQIEISA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- IBANRDPEOYZVGW-UHFFFAOYSA-N 3-methyl-1,2,4-thiadiazole Chemical compound CC=1N=CSN=1 IBANRDPEOYZVGW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QYKUGBMFPFOPNE-UHFFFAOYSA-N 4-(chloromethyl)-1,3-thiazol-2-amine Chemical compound NC1=NC(CCl)=CS1 QYKUGBMFPFOPNE-UHFFFAOYSA-N 0.000 description 1
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 1
- BNNODOKIFBGTSK-UHFFFAOYSA-N 4-ethylsulfanyl-1,2-difluorobenzene Chemical compound CCSC1=CC=C(F)C(F)=C1 BNNODOKIFBGTSK-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- FYTLHYRDGXRYEY-UHFFFAOYSA-N 5-Methyl-3-pyrazolamine Chemical compound CC=1C=C(N)NN=1 FYTLHYRDGXRYEY-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241001514645 Agonis Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005552 B01AC04 - Clopidogrel Substances 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 239000002053 C09CA06 - Candesartan Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- NBSCHQHZLSJFNQ-GASJEMHNSA-N D-Glucose 6-phosphate Chemical compound OC1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]1O NBSCHQHZLSJFNQ-GASJEMHNSA-N 0.000 description 1
- 229940124213 Dipeptidyl peptidase 4 (DPP IV) inhibitor Drugs 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 102000018711 Facilitative Glucose Transport Proteins Human genes 0.000 description 1
- 229940082863 Factor VIIa inhibitor Drugs 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 102000012195 Fructose-1,6-bisphosphatases Human genes 0.000 description 1
- 108010017464 Fructose-Bisphosphatase Proteins 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical compound CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 1
- VFRROHXSMXFLSN-UHFFFAOYSA-N Glc6P Natural products OP(=O)(O)OCC(O)C(O)C(O)C(O)C=O VFRROHXSMXFLSN-UHFFFAOYSA-N 0.000 description 1
- 102000051325 Glucagon Human genes 0.000 description 1
- 108060003199 Glucagon Proteins 0.000 description 1
- FAEKWTJYAYMJKF-QHCPKHFHSA-N GlucoNorm Chemical compound C1=C(C(O)=O)C(OCC)=CC(CC(=O)N[C@@H](CC(C)C)C=2C(=CC=CC=2)N2CCCCC2)=C1 FAEKWTJYAYMJKF-QHCPKHFHSA-N 0.000 description 1
- 208000002705 Glucose Intolerance Diseases 0.000 description 1
- 108091052347 Glucose transporter family Proteins 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 102000007390 Glycogen Phosphorylase Human genes 0.000 description 1
- 108010046163 Glycogen Phosphorylase Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 102000007625 Hirudins Human genes 0.000 description 1
- 108010007267 Hirudins Proteins 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010060378 Hyperinsulinaemia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022489 Insulin Resistance Diseases 0.000 description 1
- 229940122199 Insulin secretagogue Drugs 0.000 description 1
- 229940122355 Insulin sensitizer Drugs 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000017170 Lipid metabolism disease Diseases 0.000 description 1
- 108010007859 Lisinopril Proteins 0.000 description 1
- 208000001145 Metabolic Syndrome Diseases 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- PLBWRBFQDKZHCJ-QMMMGPOBSA-N N-[(2S)-1-hydroxypropan-2-yl]oxybenzamide Chemical compound C(C1=CC=CC=C1)(=O)NO[C@H](CO)C PLBWRBFQDKZHCJ-QMMMGPOBSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 102000000070 Sodium-Glucose Transport Proteins Human genes 0.000 description 1
- 108010080361 Sodium-Glucose Transport Proteins Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- WXIONIWNXBAHRU-UHFFFAOYSA-N [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium Chemical compound C1=CN=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 WXIONIWNXBAHRU-UHFFFAOYSA-N 0.000 description 1
- 201000000690 abdominal obesity-metabolic syndrome Diseases 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 229960002632 acarbose Drugs 0.000 description 1
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000012382 advanced drug delivery Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- VFRROHXSMXFLSN-KCDKBNATSA-N aldehydo-D-galactose 6-phosphate Chemical compound OP(=O)(O)OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O VFRROHXSMXFLSN-KCDKBNATSA-N 0.000 description 1
- 239000003288 aldose reductase inhibitor Substances 0.000 description 1
- 229940090865 aldose reductase inhibitors used in diabetes Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940127282 angiotensin receptor antagonist Drugs 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 230000001458 anti-acid effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 150000001500 aryl chlorides Chemical class 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960002274 atenolol Drugs 0.000 description 1
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- NDTSRXAMMQDVSW-UHFFFAOYSA-N benzthiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(S(N2)(=O)=O)=C1N=C2CSCC1=CC=CC=C1 NDTSRXAMMQDVSW-UHFFFAOYSA-N 0.000 description 1
- 229960001541 benzthiazide Drugs 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229940097320 beta blocking agent Drugs 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 229920000080 bile acid sequestrant Polymers 0.000 description 1
- 229940096699 bile acid sequestrants Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- SGZAIDDFHDDFJU-UHFFFAOYSA-N candesartan Chemical compound CCOC1=NC2=CC=CC(C(O)=O)=C2N1CC(C=C1)=CC=C1C1=CC=CC=C1C1=NN=N[N]1 SGZAIDDFHDDFJU-UHFFFAOYSA-N 0.000 description 1
- 229960000932 candesartan Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 125000006244 carboxylic acid protecting group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000001906 cholesterol absorption Effects 0.000 description 1
- GKTWGGQPFAXNFI-HNNXBMFYSA-N clopidogrel Chemical compound C1([C@H](N2CC=3C=CSC=3CC2)C(=O)OC)=CC=CC=C1Cl GKTWGGQPFAXNFI-HNNXBMFYSA-N 0.000 description 1
- 229960003009 clopidogrel Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229960004544 cortisone Drugs 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical group CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 239000003603 dipeptidyl peptidase IV inhibitor Substances 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 125000000600 disaccharide group Chemical class 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- BGNSWUCREVARSU-UHFFFAOYSA-N ethyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(=O)CCC1=O BGNSWUCREVARSU-UHFFFAOYSA-N 0.000 description 1
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 239000003527 fibrinolytic agent Substances 0.000 description 1
- 230000003480 fibrinolytic effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 229960003627 gemfibrozil Drugs 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 102000034356 gene-regulatory proteins Human genes 0.000 description 1
- 108091006104 gene-regulatory proteins Proteins 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 1
- 229960001381 glipizide Drugs 0.000 description 1
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
- 229960004666 glucagon Drugs 0.000 description 1
- 150000002303 glucose derivatives Chemical class 0.000 description 1
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 1
- 229960005150 glycerol Drugs 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- WQPDUTSPKFMPDP-OUMQNGNKSA-N hirudin Chemical compound C([C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC(OS(O)(=O)=O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]1NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N2)=O)CSSC1)C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)CSSC1)C(C)C)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 WQPDUTSPKFMPDP-OUMQNGNKSA-N 0.000 description 1
- 229940006607 hirudin Drugs 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- ILULYDJFTJKQAP-UHFFFAOYSA-N hydron;propan-2-ylhydrazine;chloride Chemical compound [Cl-].CC(C)N[NH3+] ILULYDJFTJKQAP-UHFFFAOYSA-N 0.000 description 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 1
- 230000003451 hyperinsulinaemic effect Effects 0.000 description 1
- 201000008980 hyperinsulinism Diseases 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229940095990 inderal Drugs 0.000 description 1
- 230000000053 inderal effect Effects 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002485 inorganic esters Chemical class 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000007914 intraventricular administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000366 juvenile effect Effects 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000008263 liquid aerosol Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 description 1
- 229960002394 lisinopril Drugs 0.000 description 1
- 210000005229 liver cell Anatomy 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 230000004777 loss-of-function mutation Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- ZYYDVWUALSSRDW-ZDUSSCGKSA-N methyl 3-[(2s)-1-methoxypropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoate Chemical compound COC(=O)C1=CC(O[C@@H](C)COC)=CC(OC=2C=CC(=CC=2)S(C)(=O)=O)=C1 ZYYDVWUALSSRDW-ZDUSSCGKSA-N 0.000 description 1
- HTKUIHPYPLZQON-ZDUSSCGKSA-N methyl 3-[4-(azetidine-1-carbonyl)-2-fluorophenoxy]-5-[(2s)-1-hydroxypropan-2-yl]oxybenzoate Chemical compound COC(=O)C1=CC(O[C@@H](C)CO)=CC(OC=2C(=CC(=CC=2)C(=O)N2CCC2)F)=C1 HTKUIHPYPLZQON-ZDUSSCGKSA-N 0.000 description 1
- NVEUIWIHJJUPMD-UHFFFAOYSA-N methyl 3-hydroxy-5-(4-methylsulfonylphenoxy)benzoate Chemical compound COC(=O)C1=CC(O)=CC(OC=2C=CC(=CC=2)S(C)(=O)=O)=C1 NVEUIWIHJJUPMD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 125000004373 methylthiopropyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- HKXMYFNBGJSFMG-UHFFFAOYSA-N n-(1-methylpyrazol-3-yl)benzamide Chemical compound CN1C=CC(NC(=O)C=2C=CC=CC=2)=N1 HKXMYFNBGJSFMG-UHFFFAOYSA-N 0.000 description 1
- IDEDTPHLJITHKG-UHFFFAOYSA-N n-(5-methylpyrazin-2-yl)benzamide Chemical compound C1=NC(C)=CN=C1NC(=O)C1=CC=CC=C1 IDEDTPHLJITHKG-UHFFFAOYSA-N 0.000 description 1
- IFYDWYVPVAMGRO-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]tetradecanamide Chemical compound CCCCCCCCCCCCCC(=O)NCCCN(C)C IFYDWYVPVAMGRO-UHFFFAOYSA-N 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- OELFLUMRDSZNSF-BRWVUGGUSA-N nateglinide Chemical compound C1C[C@@H](C(C)C)CC[C@@H]1C(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 OELFLUMRDSZNSF-BRWVUGGUSA-N 0.000 description 1
- 229960000698 nateglinide Drugs 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 1
- BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- 150000002829 nitrogen Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- VWBWQOUWDOULQN-UHFFFAOYSA-N nmp n-methylpyrrolidone Chemical compound CN1CCCC1=O.CN1CCCC1=O VWBWQOUWDOULQN-UHFFFAOYSA-N 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 231100000822 oral exposure Toxicity 0.000 description 1
- 238000007410 oral glucose tolerance test Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical compound CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 description 1
- 229960001243 orlistat Drugs 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 210000004738 parenchymal cell Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 229940096701 plain lipid modifying drug hmg coa reductase inhibitors Drugs 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 230000000291 postprandial effect Effects 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 201000009104 prediabetes syndrome Diseases 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 125000004673 propylcarbonyl group Chemical group 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- WHYQCQRHPQBZHM-UHFFFAOYSA-N pyrazole-1-carboxylic acid Chemical compound OC(=O)N1C=CC=N1 WHYQCQRHPQBZHM-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 229960002354 repaglinide Drugs 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229960004586 rosiglitazone Drugs 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- UNAANXDKBXWMLN-UHFFFAOYSA-N sibutramine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CC(C)C)CCC1 UNAANXDKBXWMLN-UHFFFAOYSA-N 0.000 description 1
- 229960004425 sibutramine Drugs 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 229960002920 sorbitol Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000003637 steroidlike Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000012622 synthetic inhibitor Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- HCMCWVXJLJLBBH-LBPRGKRZSA-N tert-butyl 3-[[3-hydroxy-5-[(2s)-1-methoxypropan-2-yl]oxybenzoyl]amino]pyrazole-1-carboxylate Chemical compound COC[C@H](C)OC1=CC(O)=CC(C(=O)NC2=NN(C=C2)C(=O)OC(C)(C)C)=C1 HCMCWVXJLJLBBH-LBPRGKRZSA-N 0.000 description 1
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 231100000440 toxicity profile Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229960005080 warfarin Drugs 0.000 description 1
- PJVWKTKQMONHTI-UHFFFAOYSA-N warfarin Chemical compound OC=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 PJVWKTKQMONHTI-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/415—1,2-Diazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Diabetes (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Epidemiology (AREA)
- Endocrinology (AREA)
- Emergency Medicine (AREA)
- Child & Adolescent Psychology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0412602.5A GB0412602D0 (en) | 2004-06-05 | 2004-06-05 | Compounds |
| GB0412602.5 | 2004-06-05 | ||
| GB0423041.3 | 2004-10-16 | ||
| GB0423041A GB0423041D0 (en) | 2004-10-16 | 2004-10-16 | Chemical compounds |
| GB0502961A GB0502961D0 (en) | 2005-02-12 | 2005-02-12 | Chemical compounds |
| GB0502961.6 | 2005-02-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20070024650A true KR20070024650A (ko) | 2007-03-02 |
Family
ID=34969165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020067027324A Ceased KR20070024650A (ko) | 2004-06-05 | 2005-06-01 | 당뇨병 치료에 있어서 glk 활성화제로서 사용하기 위한헤테로아릴 벤즈아미드 유도체 |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US7745475B2 (https=) |
| EP (2) | EP1756076B1 (https=) |
| JP (1) | JP4860606B2 (https=) |
| KR (1) | KR20070024650A (https=) |
| AR (1) | AR049139A1 (https=) |
| AT (1) | ATE477249T1 (https=) |
| AU (1) | AU2005251990B2 (https=) |
| BR (1) | BRPI0511808A (https=) |
| CA (1) | CA2566951A1 (https=) |
| DE (1) | DE602005022859D1 (https=) |
| ES (1) | ES2347451T3 (https=) |
| IL (1) | IL179389A0 (https=) |
| MX (1) | MXPA06014128A (https=) |
| MY (1) | MY144048A (https=) |
| NO (1) | NO20070032L (https=) |
| NZ (1) | NZ551623A (https=) |
| TW (1) | TW200600086A (https=) |
| UY (1) | UY28936A1 (https=) |
| WO (1) | WO2005121110A1 (https=) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE0102299D0 (sv) | 2001-06-26 | 2001-06-26 | Astrazeneca Ab | Compounds |
| SE0102764D0 (sv) | 2001-08-17 | 2001-08-17 | Astrazeneca Ab | Compounds |
| GB0226931D0 (en) | 2002-11-19 | 2002-12-24 | Astrazeneca Ab | Chemical compounds |
| DE602005013491D1 (de) * | 2004-02-18 | 2009-05-07 | Astrazeneca Ab | Benzamidderivate und deren verwendung als glucokinaseaktivierende mittel |
| TW200600086A (en) * | 2004-06-05 | 2006-01-01 | Astrazeneca Ab | Chemical compound |
| KR20070085371A (ko) * | 2004-10-16 | 2007-08-27 | 아스트라제네카 아베 | 페녹시 벤즈아미드 화합물의 제조 방법 |
| GB0423043D0 (en) * | 2004-10-16 | 2004-11-17 | Astrazeneca Ab | Compounds |
| GB0423044D0 (en) * | 2004-10-16 | 2004-11-17 | Astrazeneca Ab | Compounds |
| TW200714597A (en) * | 2005-05-27 | 2007-04-16 | Astrazeneca Ab | Chemical compounds |
| CA2614746C (en) | 2005-07-09 | 2011-05-10 | Astrazeneca Ab | Heteroaryl benzamide derivatives for use as glk activators in the treatment of diabetes |
| JP2009509988A (ja) | 2005-09-29 | 2009-03-12 | サノフィ−アベンティス | フェニル−及びピリジニル−1,2,4−オキサジアゾロン誘導体、その製造方法、及び医薬品としてのその使用 |
| TW200738621A (en) * | 2005-11-28 | 2007-10-16 | Astrazeneca Ab | Chemical process |
| JP5190448B2 (ja) * | 2006-04-20 | 2013-04-24 | ファイザー・プロダクツ・インク | グルコキナーゼ仲介疾患を予防および治療するための縮合フェニルアミド複素環化合物 |
| PE20110235A1 (es) | 2006-05-04 | 2011-04-14 | Boehringer Ingelheim Int | Combinaciones farmaceuticas que comprenden linagliptina y metmorfina |
| US7910747B2 (en) | 2006-07-06 | 2011-03-22 | Bristol-Myers Squibb Company | Phosphonate and phosphinate pyrazolylamide glucokinase activators |
| BRPI0715531A2 (pt) | 2006-07-24 | 2014-06-24 | Hoffmann La Roche | Composto, composição farmacêutica, método para o tratamento de uma enfermidade e/ou distúrbio metabólico, processo para a preparação de compostos e uso do composto |
| TW200825063A (en) * | 2006-10-23 | 2008-06-16 | Astrazeneca Ab | Chemical compounds |
| SA07280576B1 (ar) * | 2006-10-26 | 2011-06-22 | استرازينيكا ايه بي | مركبات بنزويل أمينو سيكليل غير متجانسة بأعتبارها عوامل منشطة للجلوكوكيناز |
| TW200827346A (en) | 2006-11-03 | 2008-07-01 | Astrazeneca Ab | Chemical compounds |
| TW200836719A (en) | 2007-02-12 | 2008-09-16 | Astrazeneca Ab | Chemical compounds |
| CN101808995A (zh) | 2007-07-27 | 2010-08-18 | 百时美施贵宝公司 | 新颖的葡糖激酶激活剂及其使用方法 |
| WO2009022179A2 (en) * | 2007-08-14 | 2009-02-19 | Astrazeneca Ab | Glucokinase activators in the treatment of osteoarthritis |
| AR068540A1 (es) * | 2007-09-28 | 2009-11-18 | Merck & Co Inc | Metodos de produccion de un derivado de pirazol-3-il-benzamida. |
| EP2197849B1 (en) | 2007-10-09 | 2013-02-27 | Merck Patent GmbH | N- ( pyrazole- 3 -yl) -benzamide derivatives as glucokinase activators |
| US7741327B2 (en) | 2008-04-16 | 2010-06-22 | Hoffmann-La Roche Inc. | Pyrrolidinone glucokinase activators |
| US8258134B2 (en) | 2008-04-16 | 2012-09-04 | Hoffmann-La Roche Inc. | Pyridazinone glucokinase activators |
| CA2732165A1 (en) | 2008-08-04 | 2010-02-11 | Astrazeneca Ab | Therapeutic agents 414 |
| GB0902406D0 (en) * | 2009-02-13 | 2009-04-01 | Astrazeneca Ab | Crystalline polymorphic form |
| GB0902434D0 (en) * | 2009-02-13 | 2009-04-01 | Astrazeneca Ab | Chemical process |
| US20110319379A1 (en) | 2009-03-11 | 2011-12-29 | Corbett Jeffrey W | Substituted Indazole Amides And Their Use As Glucokinase Activators |
| AR076221A1 (es) * | 2009-04-09 | 2011-05-26 | Astrazeneca Ab | Derivado de pirazol [4,5-e] pirimidina y su uso para tratar diabetes y obesidad |
| AR076220A1 (es) | 2009-04-09 | 2011-05-26 | Astrazeneca Ab | Derivados de pirazol [4,5 - e] pirimidina |
| WO2010150280A1 (en) | 2009-06-22 | 2010-12-29 | Cadila Healthcare Limited | Disubstituted benzamide derivatives as glucokinase (gk) activators |
| MY156175A (en) * | 2009-07-31 | 2016-01-15 | Cadila Healthcare Ltd | Substituted benzamide derivatives as glucokinase (gk) activators |
| EP2511265A1 (en) * | 2009-12-11 | 2012-10-17 | Astellas Pharma Inc. | Benzamide compound |
| US8222416B2 (en) | 2009-12-14 | 2012-07-17 | Hoffmann-La Roche Inc. | Azaindole glucokinase activators |
| WO2011095997A1 (en) * | 2010-02-08 | 2011-08-11 | Advinus Therapeutics Private Limited | Benzamide compounds as glucokinase activators and their pharmaceutical application |
| US8178689B2 (en) | 2010-06-17 | 2012-05-15 | Hoffman-La Roche Inc. | Tricyclic compounds |
| WO2011158149A1 (en) | 2010-06-18 | 2011-12-22 | Pfizer Inc. | 2-(3,5-disubstitutedphenyl)pyrimidin-4(3h)-one derivatives |
| EP2727920B1 (en) | 2011-07-29 | 2016-11-02 | FUJIFILM Corporation | 1,5-naphthyridine derivative or salt thereof |
Family Cites Families (100)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2750393A (en) * | 1954-12-01 | 1956-06-12 | Sterling Drug Inc | Iodinated 5-henzamidotetrazoles and preparation thereof |
| US2967194A (en) * | 1958-05-15 | 1961-01-03 | Pennsalt Chemicals Corp | 4-trifluoromethylsalicylamides |
| FR1526074A (fr) | 1967-03-22 | 1968-05-24 | Rech S Ind S O R I Soc D | Méthoxy-phényl-amino-2-thiazoles, leurs amides et leurs procédés de préparation |
| FR2088019A1 (en) | 1970-05-08 | 1972-01-07 | Rabot Ets David | Esters of 2 and 6-substituted nicotinic acids - with vasomotor active |
| GB1352415A (en) | 1970-05-03 | 1974-05-08 | Boots Co Ltd | Esters of substituted nicotine acids |
| CS173097B1 (https=) | 1972-12-01 | 1977-02-28 | ||
| GB1400540A (en) | 1972-12-06 | 1975-07-16 | Smith Kline French Lab | Salicylamides and compositions thereof |
| US4009174A (en) * | 1972-12-08 | 1977-02-22 | The Boots Company Limited | Esters of substituted nicotinic acids |
| GB1437800A (en) * | 1973-08-08 | 1976-06-03 | Phavic Sprl | Derivatives of 2-benzamido-5-nitro-thiazoles |
| GB1561350A (en) | 1976-11-05 | 1980-02-20 | May & Baker Ltd | Benzamide derivatives |
| FR2344284A1 (fr) * | 1976-03-17 | 1977-10-14 | Cerm Cent Europ Rech Mauvernay | Nouveaux composes tricycliques a cycle furannique et leur application comme antidepresseurs |
| GB1588242A (en) | 1977-10-28 | 1981-04-23 | May & Baker Ltd | N-(tetrazol-5-yl)-salicylamide derivatives |
| US4474792A (en) * | 1979-06-18 | 1984-10-02 | Riker Laboratories, Inc. | N-Tetrazolyl benzamides and anti-allergic use thereof |
| FR2493848B2 (fr) * | 1980-11-07 | 1986-05-16 | Delalande Sa | Nouveaux derives des nor-tropane et granatane, leur procede de preparation et leur application en therapeutique |
| JPS59139357A (ja) * | 1983-01-28 | 1984-08-10 | Torii Yakuhin Kk | アミジン誘導体 |
| JPS62142168A (ja) | 1985-10-16 | 1987-06-25 | Mitsubishi Chem Ind Ltd | チアゾ−ル誘導体及びそれを有効成分とするロイコトリエンきつ抗剤 |
| CA1327358C (en) | 1987-11-17 | 1994-03-01 | Morio Fujiu | Fluoro cytidine derivatives |
| JP2852659B2 (ja) | 1988-03-03 | 1999-02-03 | 富山化学工業株式会社 | ピペラジン誘導体およびその塩 |
| DE3822449A1 (de) | 1988-07-02 | 1990-01-04 | Henkel Kgaa | Oxidationshaarfaerbemittel mit neuen kupplern |
| US5466715A (en) * | 1991-12-31 | 1995-11-14 | Sterling Winthrop Inc. | 3,4-disubstituted phenols-immunomodulating agents |
| US5258407A (en) * | 1991-12-31 | 1993-11-02 | Sterling Winthrop Inc. | 3,4-disubstituted phenols-immunomodulating agents |
| US5273986A (en) * | 1992-07-02 | 1993-12-28 | Hoffmann-La Roche Inc. | Cycloalkylthiazoles |
| EP0619116A3 (en) | 1993-04-05 | 1994-11-23 | Hoechst Japan | Use of synthetic retinoids for osteopathy. |
| GB9307527D0 (en) | 1993-04-13 | 1993-06-02 | Fujisawa Pharmaceutical Co | New venzamide derivatives,processes for the preparation thereof and pharmaceutical composition comprising the same |
| US5661153A (en) * | 1994-07-19 | 1997-08-26 | Japan Energy Corporation | 1-arylpyrimidine derivatives and pharmaceutical use thereof |
| US5510478A (en) * | 1994-11-30 | 1996-04-23 | American Home Products Corporation | 2-arylamidothiazole derivatives with CNS activity |
| US5672750A (en) * | 1994-12-16 | 1997-09-30 | Eastman Chemical Company | Preparation of aromatic amides from carbon monoxide, an amine and an aromatic chloride |
| US5849735A (en) * | 1995-01-17 | 1998-12-15 | American Cyanamid Company | Tricyclic benzazepine vasopressin antagonists |
| US5712270A (en) * | 1995-11-06 | 1998-01-27 | American Home Products Corporation | 2-arylamidothiazole derivatives with CNS activity |
| AUPO395396A0 (en) * | 1996-12-02 | 1997-01-02 | Fujisawa Pharmaceutical Co., Ltd. | Benzamide derivatives |
| FR2757852B1 (fr) * | 1996-12-31 | 1999-02-19 | Cird Galderma | Composes stilbeniques a groupement adamantyl, compositions les contenant et utilisations |
| DE69826286T2 (de) | 1997-06-27 | 2005-11-24 | Fujisawa Pharmaceutical Co., Ltd. | Derivate mit einem aromatischen ring |
| IL133575A0 (en) | 1997-06-27 | 2001-04-30 | Fujisawa Pharmaceutical Co | Sulfonamide compounds, a method for producing same and pharmaceutical compositions containing same |
| US6613942B1 (en) * | 1997-07-01 | 2003-09-02 | Novo Nordisk A/S | Glucagon antagonists/inverse agonists |
| US6114483A (en) | 1997-08-27 | 2000-09-05 | E. I. Du Pont De Nemours And Company | Polymerization of olefins |
| JP4398585B2 (ja) | 1997-11-12 | 2010-01-13 | 有限会社ケムフィズ | レチノイドレセプター作用剤 |
| GB9725298D0 (en) | 1997-11-28 | 1998-01-28 | Zeneca Ltd | Insecticidal thiazole derivatives |
| CA2318731C (en) * | 1998-01-29 | 2012-05-29 | Tularik Inc. | Ppar-gamma modulators |
| DE19816780A1 (de) | 1998-04-16 | 1999-10-21 | Bayer Ag | Substituierte 2-Oxo-alkansäure-[2-(indol-3-yl)-ethyl]amide |
| GB9811969D0 (en) * | 1998-06-03 | 1998-07-29 | Celltech Therapeutics Ltd | Chemical compounds |
| US6197798B1 (en) * | 1998-07-21 | 2001-03-06 | Novartis Ag | Amino-benzocycloalkane derivatives |
| JP4191825B2 (ja) | 1998-09-10 | 2008-12-03 | あすか製薬株式会社 | 5−アミノイソキサゾール誘導体 |
| US6610846B1 (en) * | 1999-03-29 | 2003-08-26 | Hoffman-La Roche Inc. | Heteroaromatic glucokinase activators |
| RU2242469C2 (ru) * | 1999-03-29 | 2004-12-20 | Ф.Хоффманн-Ля Рош Аг | Активаторы глюкокиназы |
| SI1169312T1 (en) | 1999-03-29 | 2005-02-28 | F. Hoffmann-La Roche Ag | Glucokinase activators |
| US6320050B1 (en) * | 1999-03-29 | 2001-11-20 | Hoffmann-La Roche Inc. | Heteroaromatic glucokinase activators |
| AU1917201A (en) * | 1999-11-18 | 2001-05-30 | Centaur Pharmaceuticals, Inc. | Amide therapeutics and methods for treating inflammatory bowel disease |
| US6353111B1 (en) | 1999-12-15 | 2002-03-05 | Hoffmann-La Roche Inc. | Trans olefinic glucokinase activators |
| AU2001250783A1 (en) * | 2000-02-29 | 2001-09-12 | Cor Therapeutics, Inc. | Benzamides and related inhibitors of factor xa |
| EP1132381A1 (en) | 2000-03-08 | 2001-09-12 | Cermol S.A. | Ester derivatives of dimethylpropionic acid and pharmaceutical compositions containing them |
| US6534651B2 (en) * | 2000-04-06 | 2003-03-18 | Inotek Pharmaceuticals Corp. | 7-Substituted isoindolinone inhibitors of inflammation and reperfusion injury and methods of use thereof |
| KR100502033B1 (ko) * | 2000-05-03 | 2005-07-25 | 에프. 호프만-라 로슈 아게 | 알키닐 페닐 헤테로방향족 글루코키나제 활성제 |
| IL153303A0 (en) * | 2000-06-13 | 2003-07-06 | Wyeth Corp | Analgesic and anti-inflammatory compositions conaining cox-2 inhibitors |
| PT1336605E (pt) | 2000-11-22 | 2006-06-30 | Astellas Pharma Inc | Derivados de fenol substituidos ou seus sais como inibidores do factor x de coagulacao |
| WO2002046173A1 (en) * | 2000-12-06 | 2002-06-13 | F. Hoffmann-La Roche Ag | Fused heteroaromatic glucokinase activators |
| KR20030064852A (ko) | 2000-12-22 | 2003-08-02 | 이시하라 산교 가부시끼가이샤 | 아닐린 유도체 또는 그의 염 및 이들을 함유하는사이토카인 생산 억제제 |
| JPWO2002062775A1 (ja) | 2001-02-02 | 2004-06-10 | 山之内製薬株式会社 | 2−アシルアミノチアゾール誘導体又はその塩 |
| SE0102300D0 (sv) | 2001-06-26 | 2001-06-26 | Astrazeneca Ab | Compounds |
| SE0102299D0 (sv) | 2001-06-26 | 2001-06-26 | Astrazeneca Ab | Compounds |
| MXPA04001253A (es) | 2001-08-09 | 2004-06-03 | Ono Pharmaceutical Co | Derivados de acidos carboxilicos y agente farmaceutico que comprende los mismos como ingrediente activo. |
| SE0102764D0 (sv) * | 2001-08-17 | 2001-08-17 | Astrazeneca Ab | Compounds |
| EP1336607A1 (en) | 2002-02-19 | 2003-08-20 | Novo Nordisk A/S | Amide derivatives as glucokinase activators |
| DE10161765A1 (de) * | 2001-12-15 | 2003-07-03 | Bayer Cropscience Gmbh | Substituierte Phenylderivate |
| US6911545B2 (en) | 2001-12-19 | 2005-06-28 | Hoffman-La Roche Inc. | Crystals of glucokinase and methods of growing them |
| WO2003055482A1 (en) | 2001-12-21 | 2003-07-10 | Novo Nordisk A/S | Amide derivatives as gk activators |
| WO2003080585A1 (en) | 2002-03-26 | 2003-10-02 | Banyu Pharmaceutical Co., Ltd. | Novel aminobenzamide derivative |
| EP1501815B1 (en) | 2002-04-26 | 2006-11-22 | F. Hoffmann-La Roche Ag | Substituted phenylacetamides and their use as glucokinase activators |
| BR0312023A (pt) | 2002-06-27 | 2005-03-22 | Novo Nordisk As | Composto, composto ativador da glicose cinase, método para evitar a hipoglicemia, uso de um composto, e, composição farmacêutica |
| US20060004010A1 (en) | 2002-07-10 | 2006-01-05 | Hiromu Habashita | Ccr4 antagonist and medical use thereof |
| GB0226931D0 (en) | 2002-11-19 | 2002-12-24 | Astrazeneca Ab | Chemical compounds |
| GB0226930D0 (en) * | 2002-11-19 | 2002-12-24 | Astrazeneca Ab | Chemical compounds |
| NZ541824A (en) * | 2003-02-26 | 2010-04-30 | Banyu Pharma Co Ltd | Heteroarylcarbamoylbenzene derivatives as glucokinase activators |
| WO2004080966A1 (ja) * | 2003-03-14 | 2004-09-23 | Ono Pharmaceutical Co., Ltd. | 含窒素複素環誘導体およびそれらを有効成分とする薬剤 |
| US20050192314A1 (en) | 2003-11-13 | 2005-09-01 | Ambit Biosciences Corporation | Urea derivatives as C-kit modulators |
| GB0327760D0 (en) * | 2003-11-29 | 2003-12-31 | Astrazeneca Ab | Compounds |
| GB0327761D0 (en) * | 2003-11-29 | 2003-12-31 | Astrazeneca Ab | Compounds |
| GB0328178D0 (en) * | 2003-12-05 | 2004-01-07 | Astrazeneca Ab | Compounds |
| CA2553160C (en) | 2003-12-29 | 2010-09-28 | Banyu Pharmaceutical Co., Ltd. | 2-heteroaryl-substituted benzimidazole derivative |
| DE602005013491D1 (de) * | 2004-02-18 | 2009-05-07 | Astrazeneca Ab | Benzamidderivate und deren verwendung als glucokinaseaktivierende mittel |
| KR20070007104A (ko) * | 2004-02-18 | 2007-01-12 | 아스트라제네카 아베 | 화합물 |
| TW200600086A (en) * | 2004-06-05 | 2006-01-01 | Astrazeneca Ab | Chemical compound |
| EP1790637B1 (en) | 2004-09-13 | 2014-01-29 | Ono Pharmaceutical Co., Ltd. | Derivatives of N-4-piperidyl urea and medicaments containing them as active ingredient |
| KR20070085371A (ko) * | 2004-10-16 | 2007-08-27 | 아스트라제네카 아베 | 페녹시 벤즈아미드 화합물의 제조 방법 |
| GB0423043D0 (en) * | 2004-10-16 | 2004-11-17 | Astrazeneca Ab | Compounds |
| GB0423044D0 (en) * | 2004-10-16 | 2004-11-17 | Astrazeneca Ab | Compounds |
| JP5033119B2 (ja) | 2005-04-25 | 2012-09-26 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフツング | キナーゼ阻害剤としての新規アザ複素環化合物 |
| TW200714597A (en) * | 2005-05-27 | 2007-04-16 | Astrazeneca Ab | Chemical compounds |
| CA2614746C (en) * | 2005-07-09 | 2011-05-10 | Astrazeneca Ab | Heteroaryl benzamide derivatives for use as glk activators in the treatment of diabetes |
| US20080234273A1 (en) * | 2005-07-09 | 2008-09-25 | Mckerrecher Darren | Heteroaryl Benzamide Derivatives for Use as Glk Activators in the Treatment of Diabetes |
| EP1928874A1 (en) * | 2005-09-16 | 2008-06-11 | AstraZeneca AB | Heterobicyclic compounds as glucokinase activators |
| TW200738621A (en) * | 2005-11-28 | 2007-10-16 | Astrazeneca Ab | Chemical process |
| KR20090008217A (ko) * | 2006-03-10 | 2009-01-21 | 오노 야꾸힝 고교 가부시키가이샤 | 질소 함유 복소환 유도체 및 이들을 유효 성분으로 하는 약제 |
| TW200825063A (en) * | 2006-10-23 | 2008-06-16 | Astrazeneca Ab | Chemical compounds |
| SA07280576B1 (ar) * | 2006-10-26 | 2011-06-22 | استرازينيكا ايه بي | مركبات بنزويل أمينو سيكليل غير متجانسة بأعتبارها عوامل منشطة للجلوكوكيناز |
| UY30822A1 (es) * | 2006-12-21 | 2008-07-31 | Astrazeneca Ab | Fnueva forma cristalina de 3-{[5-azetidin-1-ylcabonyl)pyrazin-2-yl]oxy}-5-[1-methylethyloxy]-n-1h-pyrazol-3-ylbenzamida, composiciones conteniéndola, procesos de preparacion y aplicaciones |
| CA2732165A1 (en) * | 2008-08-04 | 2010-02-11 | Astrazeneca Ab | Therapeutic agents 414 |
| GB0902406D0 (en) * | 2009-02-13 | 2009-04-01 | Astrazeneca Ab | Crystalline polymorphic form |
| GB0902434D0 (en) * | 2009-02-13 | 2009-04-01 | Astrazeneca Ab | Chemical process |
| AR076221A1 (es) * | 2009-04-09 | 2011-05-26 | Astrazeneca Ab | Derivado de pirazol [4,5-e] pirimidina y su uso para tratar diabetes y obesidad |
| AR076220A1 (es) * | 2009-04-09 | 2011-05-26 | Astrazeneca Ab | Derivados de pirazol [4,5 - e] pirimidina |
-
2005
- 2005-05-25 TW TW094117058A patent/TW200600086A/zh unknown
- 2005-06-01 AT AT05747241T patent/ATE477249T1/de not_active IP Right Cessation
- 2005-06-01 BR BRPI0511808-5A patent/BRPI0511808A/pt not_active IP Right Cessation
- 2005-06-01 NZ NZ551623A patent/NZ551623A/en unknown
- 2005-06-01 EP EP05747241A patent/EP1756076B1/en not_active Expired - Lifetime
- 2005-06-01 MX MXPA06014128A patent/MXPA06014128A/es active IP Right Grant
- 2005-06-01 WO PCT/GB2005/002166 patent/WO2005121110A1/en not_active Ceased
- 2005-06-01 KR KR1020067027324A patent/KR20070024650A/ko not_active Ceased
- 2005-06-01 CA CA002566951A patent/CA2566951A1/en not_active Abandoned
- 2005-06-01 ES ES05747241T patent/ES2347451T3/es not_active Expired - Lifetime
- 2005-06-01 DE DE602005022859T patent/DE602005022859D1/de not_active Expired - Lifetime
- 2005-06-01 EP EP08154684A patent/EP1992623A1/en not_active Withdrawn
- 2005-06-01 AU AU2005251990A patent/AU2005251990B2/en not_active Ceased
- 2005-06-01 US US11/628,448 patent/US7745475B2/en not_active Expired - Fee Related
- 2005-06-01 JP JP2007514127A patent/JP4860606B2/ja not_active Expired - Fee Related
- 2005-06-02 AR ARP050102265A patent/AR049139A1/es not_active Application Discontinuation
- 2005-06-02 MY MYPI20052532A patent/MY144048A/en unknown
- 2005-06-02 UY UY28936A patent/UY28936A1/es not_active Application Discontinuation
-
2006
- 2006-11-19 IL IL179389A patent/IL179389A0/en unknown
-
2007
- 2007-01-03 NO NO20070032A patent/NO20070032L/no not_active Application Discontinuation
-
2008
- 2008-12-16 US US12/336,170 patent/US20090253676A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| TW200600086A (en) | 2006-01-01 |
| EP1992623A1 (en) | 2008-11-19 |
| BRPI0511808A (pt) | 2008-01-15 |
| HK1102091A1 (en) | 2007-11-02 |
| AU2005251990A1 (en) | 2005-12-22 |
| NZ551623A (en) | 2009-11-27 |
| JP2008501673A (ja) | 2008-01-24 |
| DE602005022859D1 (de) | 2010-09-23 |
| NO20070032L (no) | 2007-02-27 |
| US7745475B2 (en) | 2010-06-29 |
| ES2347451T3 (es) | 2010-10-29 |
| CA2566951A1 (en) | 2005-12-22 |
| US20080015203A1 (en) | 2008-01-17 |
| ATE477249T1 (de) | 2010-08-15 |
| EP1756076B1 (en) | 2010-08-11 |
| UY28936A1 (es) | 2006-01-31 |
| AR049139A1 (es) | 2006-06-28 |
| WO2005121110A1 (en) | 2005-12-22 |
| JP4860606B2 (ja) | 2012-01-25 |
| IL179389A0 (en) | 2007-03-08 |
| MXPA06014128A (es) | 2007-01-31 |
| AU2005251990B2 (en) | 2008-11-20 |
| MY144048A (en) | 2011-07-29 |
| US20090253676A1 (en) | 2009-10-08 |
| EP1756076A1 (en) | 2007-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20070024650A (ko) | 당뇨병 치료에 있어서 glk 활성화제로서 사용하기 위한헤테로아릴 벤즈아미드 유도체 | |
| EP1718624B1 (en) | Benzamide derivatives and their use as glucokinase activating agents | |
| JP2007523905A (ja) | 化合物 | |
| US7964725B2 (en) | Heteroarylbenzamide derivatives for use in the treatment of diabetes | |
| US20090105214A1 (en) | Heteroaryl Benzamide Derivatives for Use as Glk Activators in the Treatment of Diabetes | |
| JP2009500444A (ja) | 糖尿病の治療においてglkアクチベータとして使用するためのヘテロアリールベンズアミド誘導体 | |
| JP2009500442A (ja) | 2型糖尿病を処置するためのグルコキナーゼのモジュレーターとしての2−ヘテロシクリルオキシベンゾイルアミノヘテロシクリル化合物 | |
| CA2667435A1 (en) | Chemical compounds | |
| WO2007017649A1 (en) | Heteroarylcarbamoylbenzene derivatives for the treatment of diabetes | |
| BRPI0622261A2 (pt) | composto, composição farmacêutica, uso de um composto ou um sal farmaceuticamente aceitável do mesmo, e, processo para a preparação de um composto | |
| JP2008516937A (ja) | グルコキナーゼ酵素に作用するベンズアミド誘導体 | |
| CN101218236A (zh) | 作为治疗2型糖尿病的葡萄糖激酶调节剂的2-杂环基氧基苯甲酰基氨基杂环化合物 | |
| CN101218230A (zh) | 在糖尿病治疗中用作glk激活剂的杂芳基苯甲酰胺衍生物 | |
| HK1125102A (en) | Heteroaryl benzamide derivative for use as glk activator in the treatment of diabetes | |
| HK1102091B (en) | Hetroaryl benzamide derivatives for use as glk activators in the treatment of diabetes | |
| CN101018773A (zh) | 在糖尿病治疗中用作glk激活剂的杂芳基苯甲酰胺衍生物 | |
| HK1096092B (en) | Benzamide derivatives and their use as glucokinase activating agents | |
| HK1129222A (en) | Benzamide derivatives and their use as glucokinase activating agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20061226 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| A201 | Request for examination | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20100527 Comment text: Request for Examination of Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20111107 Patent event code: PE09021S01D |
|
| E601 | Decision to refuse application | ||
| PE0601 | Decision on rejection of patent |
Patent event date: 20120629 Comment text: Decision to Refuse Application Patent event code: PE06012S01D Patent event date: 20111107 Comment text: Notification of reason for refusal Patent event code: PE06011S01I |