KR20020087383A - 카르본산 유도체 및 그 유도체로 이루어지는 의약 - Google Patents
카르본산 유도체 및 그 유도체로 이루어지는 의약 Download PDFInfo
- Publication number
- KR20020087383A KR20020087383A KR1020027004232A KR20027004232A KR20020087383A KR 20020087383 A KR20020087383 A KR 20020087383A KR 1020027004232 A KR1020027004232 A KR 1020027004232A KR 20027004232 A KR20027004232 A KR 20027004232A KR 20020087383 A KR20020087383 A KR 20020087383A
- Authority
- KR
- South Korea
- Prior art keywords
- group
- carbon atoms
- methyl
- ylthio
- yloxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001732 carboxylic acid derivatives Chemical class 0.000 title claims abstract description 35
- 239000003814 drug Substances 0.000 title claims description 34
- 229940079593 drug Drugs 0.000 title claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 316
- 125000001424 substituent group Chemical group 0.000 claims abstract description 104
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 64
- 150000003839 salts Chemical class 0.000 claims abstract description 49
- 150000002148 esters Chemical class 0.000 claims abstract description 37
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 35
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 29
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims abstract description 23
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 22
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims abstract description 21
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 20
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 19
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 18
- 206010022489 Insulin Resistance Diseases 0.000 claims abstract description 16
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 16
- 150000004677 hydrates Chemical class 0.000 claims abstract description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 12
- -1 2,4-dioxothiazolidine-5-yl group Chemical group 0.000 claims description 1406
- 150000001875 compounds Chemical class 0.000 claims description 322
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 57
- 125000003118 aryl group Chemical group 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 27
- 125000002252 acyl group Chemical group 0.000 claims description 26
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 24
- 125000000304 alkynyl group Chemical group 0.000 claims description 22
- 230000009471 action Effects 0.000 claims description 21
- 125000003342 alkenyl group Chemical group 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 19
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 18
- 125000004414 alkyl thio group Chemical group 0.000 claims description 17
- 102000023984 PPAR alpha Human genes 0.000 claims description 16
- 125000001931 aliphatic group Chemical group 0.000 claims description 16
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 16
- 108091008725 peroxisome proliferator-activated receptors alpha Proteins 0.000 claims description 16
- 125000004419 alkynylene group Chemical group 0.000 claims description 15
- 229910052717 sulfur Inorganic materials 0.000 claims description 15
- 125000004434 sulfur atom Chemical group 0.000 claims description 15
- 125000004429 atom Chemical group 0.000 claims description 14
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- 206010012601 diabetes mellitus Diseases 0.000 claims description 9
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 8
- 238000006467 substitution reaction Methods 0.000 claims description 8
- 201000010099 disease Diseases 0.000 claims description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 7
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 6
- 125000005110 aryl thio group Chemical group 0.000 claims description 6
- 230000009977 dual effect Effects 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- 125000002723 alicyclic group Chemical group 0.000 claims description 5
- 125000005108 alkenylthio group Chemical group 0.000 claims description 5
- 125000005248 alkyl aryloxy group Chemical group 0.000 claims description 5
- 125000005109 alkynylthio group Chemical group 0.000 claims description 5
- 125000002431 aminoalkoxy group Chemical group 0.000 claims description 5
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 5
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 5
- 125000005366 cycloalkylthio group Chemical group 0.000 claims description 5
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 5
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 4
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 230000002265 prevention Effects 0.000 claims description 3
- 229940125542 dual agonist Drugs 0.000 claims description 2
- 230000006872 improvement Effects 0.000 claims description 2
- 208000011580 syndromic disease Diseases 0.000 claims description 2
- 239000013559 triple agonist Substances 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 255
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 166
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 155
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 147
- 239000002904 solvent Substances 0.000 description 138
- 238000005160 1H NMR spectroscopy Methods 0.000 description 136
- 238000006243 chemical reaction Methods 0.000 description 135
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 111
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 109
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 101
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 90
- 238000002360 preparation method Methods 0.000 description 86
- 239000000243 solution Substances 0.000 description 83
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 81
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 74
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 72
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 62
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 61
- 239000003960 organic solvent Substances 0.000 description 59
- 235000019441 ethanol Nutrition 0.000 description 54
- 125000006239 protecting group Chemical group 0.000 description 54
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 48
- 239000012044 organic layer Substances 0.000 description 47
- 238000004519 manufacturing process Methods 0.000 description 46
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 45
- 238000010898 silica gel chromatography Methods 0.000 description 42
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 38
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 37
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 37
- 239000000203 mixture Substances 0.000 description 34
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 34
- 235000019260 propionic acid Nutrition 0.000 description 33
- 125000003277 amino group Chemical group 0.000 description 32
- 238000001816 cooling Methods 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 29
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 28
- 238000003756 stirring Methods 0.000 description 28
- 239000003054 catalyst Substances 0.000 description 26
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 25
- 238000010828 elution Methods 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 238000010992 reflux Methods 0.000 description 24
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 23
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 22
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 22
- 239000012312 sodium hydride Substances 0.000 description 22
- 229910000104 sodium hydride Inorganic materials 0.000 description 22
- 150000007529 inorganic bases Chemical class 0.000 description 20
- 229920006395 saturated elastomer Polymers 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 238000010438 heat treatment Methods 0.000 description 18
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 239000008280 blood Substances 0.000 description 17
- 210000004369 blood Anatomy 0.000 description 17
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 17
- 150000007530 organic bases Chemical class 0.000 description 17
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 description 15
- 230000003301 hydrolyzing effect Effects 0.000 description 15
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 14
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 14
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 241001122767 Theaceae Species 0.000 description 13
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 12
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 12
- 229960004132 diethyl ether Drugs 0.000 description 12
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 12
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 12
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 12
- 229910000105 potassium hydride Inorganic materials 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 11
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 11
- GWPIHVNYZNVNLH-UHFFFAOYSA-N ethyl 3-[2-(aminomethyl)pyridin-4-yl]-2-propan-2-yloxypropanoate;hydrochloride Chemical compound Cl.CCOC(=O)C(OC(C)C)CC1=CC=NC(CN)=C1 GWPIHVNYZNVNLH-UHFFFAOYSA-N 0.000 description 11
- 238000000605 extraction Methods 0.000 description 11
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 108010016731 PPAR gamma Proteins 0.000 description 10
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 description 10
- IPGWVGWWRJXEKY-UHFFFAOYSA-N ethyl 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CN)=C1 IPGWVGWWRJXEKY-UHFFFAOYSA-N 0.000 description 10
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 10
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 9
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 9
- 238000012545 processing Methods 0.000 description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 9
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 8
- 239000012230 colorless oil Substances 0.000 description 8
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 8
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 8
- 239000010977 jade Substances 0.000 description 8
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 150000007524 organic acids Chemical class 0.000 description 8
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 8
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 8
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 7
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 7
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 7
- 125000005843 halogen group Chemical group 0.000 description 7
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 7
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 229960003975 potassium Drugs 0.000 description 7
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 235000000346 sugar Nutrition 0.000 description 7
- 229930192474 thiophene Natural products 0.000 description 7
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 7
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 6
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 6
- FHNCCAGEZMNIHZ-UHFFFAOYSA-N 3,4,5,5a,6,7,8,9-octahydro-2h-1,2-benzodiazepine Chemical compound N1CCCC2CCCCC2=N1 FHNCCAGEZMNIHZ-UHFFFAOYSA-N 0.000 description 6
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 description 6
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 description 6
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 6
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 6
- 239000000556 agonist Substances 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 6
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 6
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 150000002244 furazanes Chemical class 0.000 description 6
- 239000008103 glucose Substances 0.000 description 6
- 239000004312 hexamethylene tetramine Substances 0.000 description 6
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 6
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 6
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 6
- 150000002632 lipids Chemical class 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 6
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 6
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 6
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 6
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 6
- 150000003852 triazoles Chemical class 0.000 description 6
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 6
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 6
- 125000005810 2,5-xylyl group Chemical group [H]C1=C([H])C(=C(*)C([H])=C1C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 210000001789 adipocyte Anatomy 0.000 description 5
- WOBLPDAWNVAVAS-UHFFFAOYSA-N butyl carboxy carbonate Chemical group CCCCOC(=O)OC(O)=O WOBLPDAWNVAVAS-UHFFFAOYSA-N 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 239000012156 elution solvent Substances 0.000 description 5
- 125000005290 ethynyloxy group Chemical group C(#C)O* 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 125000004706 n-propylthio group Chemical group C(CC)S* 0.000 description 5
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 5
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 125000006410 propenylene group Chemical group 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 125000005504 styryl group Chemical group 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000003944 tolyl group Chemical group 0.000 description 5
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 4
- 125000004814 1,1-dimethylethylene group Chemical group [H]C([H])([H])C([*:1])(C([H])([H])[H])C([H])([H])[*:2] 0.000 description 4
- 125000004815 1,2-dimethylethylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([*:2])C([H])([H])[H] 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 4
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 4
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 4
- MWDCBSZUHUONCE-UHFFFAOYSA-N 2-propan-2-yloxypropanoic acid Chemical compound CC(C)OC(C)C(O)=O MWDCBSZUHUONCE-UHFFFAOYSA-N 0.000 description 4
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 4
- 125000005977 3-phenylpropyloxy group Chemical group 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 4
- 102100024321 Alkaline phosphatase, placental type Human genes 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 102000004877 Insulin Human genes 0.000 description 4
- 108090001061 Insulin Proteins 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 229940024606 amino acid Drugs 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000012295 chemical reaction liquid Substances 0.000 description 4
- 238000007796 conventional method Methods 0.000 description 4
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 4
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 4
- MCJYSFOYYFNTBT-UHFFFAOYSA-N ethyl 2-propan-2-yloxy-3-pyridin-4-ylpropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=NC=C1 MCJYSFOYYFNTBT-UHFFFAOYSA-N 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 235000021588 free fatty acids Nutrition 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 229940125396 insulin Drugs 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 239000012046 mixed solvent Substances 0.000 description 4
- 125000006606 n-butoxy group Chemical group 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 4
- 108010031345 placental alkaline phosphatase Proteins 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 125000005920 sec-butoxy group Chemical group 0.000 description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000001308 synthesis method Methods 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 125000005023 xylyl group Chemical group 0.000 description 4
- 125000004719 1,1-dimethylpropylthio group Chemical group CC(CC)(S*)C 0.000 description 3
- FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical compound C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 3
- 125000005923 1,2-dimethylpropyloxy group Chemical group 0.000 description 3
- 125000004720 1,2-dimethylpropylthio group Chemical group CC(C(C)C)S* 0.000 description 3
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 3
- 125000004713 1-methylbutylthio group Chemical group CC(CCC)S* 0.000 description 3
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QWRIRBUKLBWVNF-UHFFFAOYSA-N 2-methoxy-4-(trifluoromethyl)benzoic acid Chemical compound COC1=CC(C(F)(F)F)=CC=C1C(O)=O QWRIRBUKLBWVNF-UHFFFAOYSA-N 0.000 description 3
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 3
- 125000004924 2-naphthylethyl group Chemical group C1=C(C=CC2=CC=CC=C12)CC* 0.000 description 3
- CPCVNVLTHQVAPE-UHFFFAOYSA-N 2-propoxypropanoic acid Chemical compound CCCOC(C)C(O)=O CPCVNVLTHQVAPE-UHFFFAOYSA-N 0.000 description 3
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- 229940123208 Biguanide Drugs 0.000 description 3
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 3
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 108010044210 PPAR-beta Proteins 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229940100389 Sulfonylurea Drugs 0.000 description 3
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 3
- QKNDAUTYSODFJV-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;sodium Chemical compound [Na].C[Si](C)(C)N[Si](C)(C)C QKNDAUTYSODFJV-UHFFFAOYSA-N 0.000 description 3
- 125000004054 acenaphthylenyl group Chemical group C1(=CC2=CC=CC3=CC=CC1=C23)* 0.000 description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 125000005569 butenylene group Chemical group 0.000 description 3
- 125000005622 butynylene group Chemical group 0.000 description 3
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 3
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 3
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 3
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 3
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- BJDMEWXODPZJFY-UHFFFAOYSA-N ethyl 2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(C)OC(C)C BJDMEWXODPZJFY-UHFFFAOYSA-N 0.000 description 3
- 239000013604 expression vector Substances 0.000 description 3
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000003914 insulin secretion Effects 0.000 description 3
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 3
- 125000003935 n-pentoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004712 n-pentylthio group Chemical group C(CCCC)S* 0.000 description 3
- 125000005484 neopentoxy group Chemical group 0.000 description 3
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 3
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 3
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- VBQCHPIMZGQLAZ-UHFFFAOYSA-N phosphorane Chemical compound [PH5] VBQCHPIMZGQLAZ-UHFFFAOYSA-N 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- SVOOVMQUISJERI-UHFFFAOYSA-K rhodium(3+);triacetate Chemical compound [Rh+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SVOOVMQUISJERI-UHFFFAOYSA-K 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 150000003548 thiazolidines Chemical class 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 230000002103 transcriptional effect Effects 0.000 description 3
- 208000035408 type 1 diabetes mellitus 1 Diseases 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- DRCWOKJLSQUJPZ-DZGCQCFKSA-N (4ar,9as)-n-ethyl-1,4,9,9a-tetrahydrofluoren-4a-amine Chemical compound C1C2=CC=CC=C2[C@]2(NCC)[C@H]1CC=CC2 DRCWOKJLSQUJPZ-DZGCQCFKSA-N 0.000 description 2
- HAOOGRLZVQWDBY-UHFFFAOYSA-N (5-bromo-2-methoxyphenyl)methanol Chemical compound COC1=CC=C(Br)C=C1CO HAOOGRLZVQWDBY-UHFFFAOYSA-N 0.000 description 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- ODFJWAIYJNLCFY-UHFFFAOYSA-N 1-(methoxymethyl)-5-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde Chemical compound COCC1(C=O)CC(C(F)(F)F)=CC=C1 ODFJWAIYJNLCFY-UHFFFAOYSA-N 0.000 description 2
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- 125000005978 1-naphthyloxy group Chemical group 0.000 description 2
- DCTOHCCUXLBQMS-UHFFFAOYSA-N 1-undecene Chemical compound CCCCCCCCCC=C DCTOHCCUXLBQMS-UHFFFAOYSA-N 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- XWIYUCRMWCHYJR-UHFFFAOYSA-N 1h-pyrrolo[3,2-b]pyridine Chemical compound C1=CC=C2NC=CC2=N1 XWIYUCRMWCHYJR-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- VHWRSBFHVFCAMN-UHFFFAOYSA-N 2,4-dichloro-n-[(2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=CC=C(Cl)C=C1Cl VHWRSBFHVFCAMN-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- WAGHXEROZBJBOG-UHFFFAOYSA-N 2-(2-methoxyphenyl)-n-[4-(trifluoromethyl)phenyl]acetamide Chemical compound COC1=CC=CC=C1CC(=O)NC1=CC=C(C(F)(F)F)C=C1 WAGHXEROZBJBOG-UHFFFAOYSA-N 0.000 description 2
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- YHYNJGHMBMXAFB-UHFFFAOYSA-N 2-hydroxy-4-(trifluoromethyl)benzaldehyde Chemical compound OC1=CC(C(F)(F)F)=CC=C1C=O YHYNJGHMBMXAFB-UHFFFAOYSA-N 0.000 description 2
- KKESHHUPAFNMPH-UHFFFAOYSA-N 2-methoxy-4-(trifluoromethyl)benzaldehyde Chemical compound COC1=CC(C(F)(F)F)=CC=C1C=O KKESHHUPAFNMPH-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- 125000004714 2-methylbutylthio group Chemical group CC(CS*)CC 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- 125000005979 2-naphthyloxy group Chemical group 0.000 description 2
- UMZCLZPXPCNKML-UHFFFAOYSA-N 2h-imidazo[4,5-d][1,3]thiazole Chemical compound C1=NC2=NCSC2=N1 UMZCLZPXPCNKML-UHFFFAOYSA-N 0.000 description 2
- MBGBWSXARYAXPR-UHFFFAOYSA-N 3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1Cl MBGBWSXARYAXPR-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 2
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 2
- AGHGHLJWSIJBGH-UHFFFAOYSA-N 4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxymethyl]benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1COCC1=CC=C(C(F)(F)F)C=C1 AGHGHLJWSIJBGH-UHFFFAOYSA-N 0.000 description 2
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 2
- SWKPKONEIZGROQ-UHFFFAOYSA-N 4-trifluoromethylbenzoic acid Chemical compound OC(=O)C1=CC=C(C(F)(F)F)C=C1 SWKPKONEIZGROQ-UHFFFAOYSA-N 0.000 description 2
- ALBXNHUULIWEHC-UHFFFAOYSA-N 5-(2-ethoxycarbonylbutyl)-2-methoxybenzoic acid Chemical compound CCOC(=O)C(CC)CC1=CC=C(OC)C(C(O)=O)=C1 ALBXNHUULIWEHC-UHFFFAOYSA-N 0.000 description 2
- KDOPAZIWBAHVJB-UHFFFAOYSA-N 5h-pyrrolo[3,2-d]pyrimidine Chemical compound C1=NC=C2NC=CC2=N1 KDOPAZIWBAHVJB-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ABISBEBXFJKCPA-UHFFFAOYSA-N C(C)C1OCCC1.C(C)O Chemical compound C(C)C1OCCC1.C(C)O ABISBEBXFJKCPA-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 2
- 239000004129 EU approved improving agent Substances 0.000 description 2
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 2
- 102100039556 Galectin-4 Human genes 0.000 description 2
- 101000608765 Homo sapiens Galectin-4 Proteins 0.000 description 2
- 101001008429 Homo sapiens Nucleobindin-2 Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010020710 Hyperphagia Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical class NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 229910010082 LiAlH Inorganic materials 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 102100027441 Nucleobindin-2 Human genes 0.000 description 2
- 208000008589 Obesity Diseases 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229940123464 Thiazolidinedione Drugs 0.000 description 2
- 102000040945 Transcription factor Human genes 0.000 description 2
- 108091023040 Transcription factor Proteins 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- PRDBLLIPPDOICK-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=C(C(F)(F)F)C=C1 PRDBLLIPPDOICK-UHFFFAOYSA-N 0.000 description 2
- CDZHZLQKNAKKEC-UHFFFAOYSA-N [bis(hydroxymethylamino)methylamino]methanol Chemical class OCNC(NCO)NCO CDZHZLQKNAKKEC-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- DETXZQGDWUJKMO-UHFFFAOYSA-N alpha-hydroxymethanesulfonic acid Natural products OCS(O)(=O)=O DETXZQGDWUJKMO-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003472 antidiabetic agent Substances 0.000 description 2
- 150000001483 arginine derivatives Chemical class 0.000 description 2
- 150000001507 asparagine derivatives Chemical class 0.000 description 2
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 2
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical class C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 2
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 2
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- SUAVNZMIOODRBR-UHFFFAOYSA-N bis(trifluoromethylsulfonyloxy)boranyl trifluoromethanesulfonate Chemical compound FC(F)(F)S(=O)(=O)OB(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F SUAVNZMIOODRBR-UHFFFAOYSA-N 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000002651 drug therapy Methods 0.000 description 2
- PBEVIHFBBLEYKN-UHFFFAOYSA-N ethyl 2-[[3-(aminomethyl)-4-methoxyphenyl]methyl]butanoate Chemical compound CCOC(=O)C(CC)CC1=CC=C(OC)C(CN)=C1 PBEVIHFBBLEYKN-UHFFFAOYSA-N 0.000 description 2
- WGXAWUNKGKCZEM-UHFFFAOYSA-N ethyl 2-[[3-(hydroxymethyl)-4-methoxyphenyl]methyl]butanoate Chemical compound CCOC(=O)C(CC)CC1=CC=C(OC)C(CO)=C1 WGXAWUNKGKCZEM-UHFFFAOYSA-N 0.000 description 2
- UFWXMYPSLKUPJB-UHFFFAOYSA-N ethyl 2-[[4-methoxy-3-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methylidene]butanoate Chemical compound CCC(=CC1=CC(=C(C=C1)OC)CC(=O)C2=CC=C(C=C2)C(F)(F)F)C(=O)OCC UFWXMYPSLKUPJB-UHFFFAOYSA-N 0.000 description 2
- UTUVIKZNQWNGIM-UHFFFAOYSA-N ethyl 2-phenylpropanoate Chemical compound CCOC(=O)C(C)C1=CC=CC=C1 UTUVIKZNQWNGIM-UHFFFAOYSA-N 0.000 description 2
- JVZGNCFHTBQLHR-UHFFFAOYSA-N ethyl 3-(2-cyanopyridin-4-yl)-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=NC(C#N)=C1 JVZGNCFHTBQLHR-UHFFFAOYSA-N 0.000 description 2
- UKUVICMGVBMNLU-UHFFFAOYSA-N ethyl 3-[3-[[(2-diethoxyphosphorylacetyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CNC(=O)CP(=O)(OCC)OCC)=C1 UKUVICMGVBMNLU-UHFFFAOYSA-N 0.000 description 2
- LUJFGGIKSKUAQZ-UHFFFAOYSA-N ethyl 3-[3-bromo-4-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC(Br)=C(OC)C(CNC(=O)OC(C)(C)C)=C1 LUJFGGIKSKUAQZ-UHFFFAOYSA-N 0.000 description 2
- WYTBCKWHSNGPLU-UHFFFAOYSA-N ethyl 5-[4-methoxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypentanoate Chemical compound CCOC(=O)C(OC(C)C)CCCC1=CC=C(OC)C(CNC(=O)OC(C)(C)C)=C1 WYTBCKWHSNGPLU-UHFFFAOYSA-N 0.000 description 2
- 238000009207 exercise therapy Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 150000002306 glutamic acid derivatives Chemical class 0.000 description 2
- 150000002332 glycine derivatives Chemical class 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- DETXZQGDWUJKMO-UHFFFAOYSA-M hydroxymethanesulfonate Chemical compound OCS([O-])(=O)=O DETXZQGDWUJKMO-UHFFFAOYSA-M 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000003893 lactate salts Chemical class 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 108020001756 ligand binding domains Proteins 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 150000002688 maleic acid derivatives Chemical class 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- IZYBEMGNIUSSAX-UHFFFAOYSA-N methyl benzenecarboperoxoate Chemical compound COOC(=O)C1=CC=CC=C1 IZYBEMGNIUSSAX-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- ACJIDGKIFXDEJF-UHFFFAOYSA-N n-[(2-methoxyphenyl)methyl]-4-(trifluoromethyl)benzamide Chemical compound COC1=CC=CC=C1CNC(=O)C1=CC=C(C(F)(F)F)C=C1 ACJIDGKIFXDEJF-UHFFFAOYSA-N 0.000 description 2
- 125000004718 n-hexylthio group Chemical group C(CCCCC)S* 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 235000020824 obesity Nutrition 0.000 description 2
- 229940049964 oleate Drugs 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- 235000020830 overeating Nutrition 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 210000002824 peroxisome Anatomy 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 2
- 229960005095 pioglitazone Drugs 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- BWESROVQGZSBRX-UHFFFAOYSA-N pyrido[3,2-d]pyrimidine Chemical compound C1=NC=NC2=CC=CN=C21 BWESROVQGZSBRX-UHFFFAOYSA-N 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229960004586 rosiglitazone Drugs 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 150000003354 serine derivatives Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 2
- 229960002218 sodium chlorite Drugs 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical class NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- ZNVOGTFCORVTFD-UHFFFAOYSA-N tert-butyl n-[(5-bromo-2-methoxyphenyl)methyl]carbamate Chemical compound COC1=CC=C(Br)C=C1CNC(=O)OC(C)(C)C ZNVOGTFCORVTFD-UHFFFAOYSA-N 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- ONCNIMLKGZSAJT-UHFFFAOYSA-N thieno[3,2-b]furan Chemical compound S1C=CC2=C1C=CO2 ONCNIMLKGZSAJT-UHFFFAOYSA-N 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 125000005505 thiomorpholino group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 2
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 2
- 229960001641 troglitazone Drugs 0.000 description 2
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 2
- HJGIKVGJRJOEOH-UHFFFAOYSA-N (1-ethoxy-1-oxobutan-2-yl)phosphonic acid Chemical compound CCOC(=O)C(CC)P(O)(O)=O HJGIKVGJRJOEOH-UHFFFAOYSA-N 0.000 description 1
- WYLYBQSHRJMURN-UHFFFAOYSA-N (2-methoxyphenyl)methanol Chemical compound COC1=CC=CC=C1CO WYLYBQSHRJMURN-UHFFFAOYSA-N 0.000 description 1
- OTDKUOMBIVRHSV-UHFFFAOYSA-N (5-bromo-2,3-dimethoxyphenyl)methanol Chemical compound COC1=CC(Br)=CC(CO)=C1OC OTDKUOMBIVRHSV-UHFFFAOYSA-N 0.000 description 1
- RCAIQHGMFADOEX-UHFFFAOYSA-N (5-bromo-2,3-dimethoxyphenyl)methoxy-tert-butyl-diphenylsilane Chemical compound COC1=CC(Br)=CC(CO[Si](C=2C=CC=CC=2)(C=2C=CC=CC=2)C(C)(C)C)=C1OC RCAIQHGMFADOEX-UHFFFAOYSA-N 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000006766 (C2-C6) alkynyloxy group Chemical group 0.000 description 1
- HEVMDQBCAHEHDY-UHFFFAOYSA-N (Dimethoxymethyl)benzene Chemical compound COC(OC)C1=CC=CC=C1 HEVMDQBCAHEHDY-UHFFFAOYSA-N 0.000 description 1
- PYHRZPFZZDCOPH-QXGOIDDHSA-N (S)-amphetamine sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C[C@H](N)CC1=CC=CC=C1.C[C@H](N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-QXGOIDDHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000004733 1,1,2-trimethylpropylthio group Chemical group CC(C(C)C)(S*)C 0.000 description 1
- 125000004725 1,1-dimethylbutylthio group Chemical group CC(CCC)(S*)C 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000005927 1,2,2-trimethylpropyloxy group Chemical group 0.000 description 1
- 125000004734 1,2,2-trimethylpropylthio group Chemical group CC(C(C)(C)C)S* 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- 125000005926 1,2-dimethylbutyloxy group Chemical group 0.000 description 1
- 125000004726 1,2-dimethylbutylthio group Chemical group CC(C(CC)C)S* 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 1
- IKSNDOVDVVPSMA-UHFFFAOYSA-N 1-(bromomethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CBr)C=C1 IKSNDOVDVVPSMA-UHFFFAOYSA-N 0.000 description 1
- SYNGSIMIBZUBSQ-UHFFFAOYSA-N 1-(methoxymethyl)-3-(trifluoromethyl)benzene Chemical compound COCC1=CC=CC(C(F)(F)F)=C1 SYNGSIMIBZUBSQ-UHFFFAOYSA-N 0.000 description 1
- AWNXKZVIZARMME-UHFFFAOYSA-N 1-[[5-[2-[(2-chloropyridin-4-yl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-yl]amino]-2-methylpropan-2-ol Chemical compound N=1C(NCC(C)(O)C)=NC=C(C=2N=C(NC=3C=C(Cl)N=CC=3)N=CC=2)C=1CC1CC1 AWNXKZVIZARMME-UHFFFAOYSA-N 0.000 description 1
- PVSPTVQNQJFQMP-UHFFFAOYSA-N 1-but-1-ynoxybut-1-yne Chemical compound CCC#COC#CCC PVSPTVQNQJFQMP-UHFFFAOYSA-N 0.000 description 1
- 125000004735 1-ethyl-1-methylpropylthio group Chemical group C(C)C(CC)(S*)C 0.000 description 1
- 125000004736 1-ethyl-2-methylpropylthio group Chemical group C(C)C(C(C)C)S* 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004731 1-ethylbutylthio group Chemical group C(C)C(CCC)S* 0.000 description 1
- 125000004790 1-fluoroethoxy group Chemical group FC(C)O* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- MPECCIUGBOPNTK-UHFFFAOYSA-N 1-methoxy-2-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzene Chemical compound COC1=CC=CC=C1CCOC1=CC=C(C(F)(F)F)C=C1 MPECCIUGBOPNTK-UHFFFAOYSA-N 0.000 description 1
- 125000004721 1-methylpentylthio group Chemical group CC(CCCC)S* 0.000 description 1
- 125000004728 2,2-dimethylbutylthio group Chemical group CC(CS*)(CC)C 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- HTNOTRIVGNUMKZ-UHFFFAOYSA-N 2,3-dimethyl-3-propan-2-ylnonane Chemical compound CCCCCCC(C)(C(C)C)C(C)C HTNOTRIVGNUMKZ-UHFFFAOYSA-N 0.000 description 1
- 125000004729 2,3-dimethylbutylthio group Chemical group CC(CS*)C(C)C 0.000 description 1
- HWFJASHZZFMLQF-UHFFFAOYSA-N 2,4-dichloro-n-[(5-formyl-2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=C(C=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1Cl HWFJASHZZFMLQF-UHFFFAOYSA-N 0.000 description 1
- CEOCVKWBUWKBKA-UHFFFAOYSA-N 2,4-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1Cl CEOCVKWBUWKBKA-UHFFFAOYSA-N 0.000 description 1
- RKVODRDSBPTJCZ-UHFFFAOYSA-N 2,4-dichlorooxolane Chemical compound ClC1COC(Cl)C1 RKVODRDSBPTJCZ-UHFFFAOYSA-N 0.000 description 1
- SDJQZCSCHUIITF-UHFFFAOYSA-N 2,6-dimethoxypyridine-3-carboxylic acid Chemical compound COC1=CC=C(C(O)=O)C(OC)=N1 SDJQZCSCHUIITF-UHFFFAOYSA-N 0.000 description 1
- IVEWTCACRDEAOB-UHFFFAOYSA-N 2-(2-methoxyphenyl)acetic acid Chemical compound COC1=CC=CC=C1CC(O)=O IVEWTCACRDEAOB-UHFFFAOYSA-N 0.000 description 1
- XLDRDNQLEMMNNH-UHFFFAOYSA-N 2-(2-methoxyphenyl)ethanol Chemical compound COC1=CC=CC=C1CCO XLDRDNQLEMMNNH-UHFFFAOYSA-N 0.000 description 1
- IWEXZPCPGIJITP-UHFFFAOYSA-N 2-(4-methoxyphenyl)-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(C(C)(OC(C)C)C(O)=O)C=C1 IWEXZPCPGIJITP-UHFFFAOYSA-N 0.000 description 1
- YFOPDHWQXJZJAZ-UHFFFAOYSA-N 2-(5-formyl-2-methoxyphenyl)-n-[4-(trifluoromethyl)phenyl]acetamide Chemical compound COC1=CC=C(C=O)C=C1CC(=O)NC1=CC=C(C(F)(F)F)C=C1 YFOPDHWQXJZJAZ-UHFFFAOYSA-N 0.000 description 1
- CQCAYWAIRTVXIY-UHFFFAOYSA-N 2-(triphenyl-$l^{5}-phosphanylidene)acetaldehyde Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC=O)C1=CC=CC=C1 CQCAYWAIRTVXIY-UHFFFAOYSA-N 0.000 description 1
- HNORVZDAANCHAY-UHFFFAOYSA-N 2-[4-(trifluoromethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(C(F)(F)F)C=C1 HNORVZDAANCHAY-UHFFFAOYSA-N 0.000 description 1
- QWARQCPFOUCFQX-UHFFFAOYSA-N 2-[[3-[[2-[3-fluoro-2-(trifluoromethyl)phenyl]acetyl]amino]-4-methoxyphenyl]methyl]butanoic acid Chemical compound CCC(CC1=CC(=C(C=C1)OC)NC(=O)CC2=C(C(=CC=C2)F)C(F)(F)F)C(=O)O QWARQCPFOUCFQX-UHFFFAOYSA-N 0.000 description 1
- VLVSKDIFTHTTCS-UHFFFAOYSA-N 2-[[4-methoxy-3-[[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]amino]phenyl]methyl]butanoic acid Chemical compound CCC(C(O)=O)CC1=CC=C(OC)C(NC(=O)CC2=C(OC(=N2)C=2C=CC=CC=2)C)=C1 VLVSKDIFTHTTCS-UHFFFAOYSA-N 0.000 description 1
- FHZWTFZZCRTHNU-UHFFFAOYSA-N 2-[[4-methoxy-3-[[[2-methoxy-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]methyl]butanoic acid Chemical compound CCC(C(O)=O)CC1=CC=C(OC)C(CNC(=O)C=2C(=CC(=CC=2)C(F)(F)F)OC)=C1 FHZWTFZZCRTHNU-UHFFFAOYSA-N 0.000 description 1
- PFMGKNXOXIEXRB-UHFFFAOYSA-N 2-[[4-methoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]methyl]butanoic acid Chemical compound CCC(C(O)=O)CC1=CC=C(OC)C(CNC(=O)C=2C=CC(=CC=2)C(F)(F)F)=C1 PFMGKNXOXIEXRB-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- RKAJPUMAMCIKLF-UHFFFAOYSA-N 2-butoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]propanoic acid Chemical compound CCCCOC(C(O)=O)CC1=CC=C(OC)C(C(=O)NCC=2C=CC(=CC=2)C(F)(F)F)=C1 RKAJPUMAMCIKLF-UHFFFAOYSA-N 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N 2-butyne Chemical compound CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- VQGJFXYTWXPKHV-UHFFFAOYSA-N 2-diethoxyphosphorylpropanoic acid Chemical compound CCOP(=O)(OCC)C(C)C(O)=O VQGJFXYTWXPKHV-UHFFFAOYSA-N 0.000 description 1
- NQOUIDSNIJVHLI-UHFFFAOYSA-N 2-ethoxy-3-[4-methoxy-3-[(1-methylindol-2-yl)methylcarbamoyl]phenyl]propanoic acid Chemical compound CCOC(C(O)=O)CC1=CC=C(OC)C(C(=O)NCC=2N(C3=CC=CC=C3C=2)C)=C1 NQOUIDSNIJVHLI-UHFFFAOYSA-N 0.000 description 1
- 125000003858 2-ethylbutoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])O*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004732 2-ethylbutylthio group Chemical group C(C)C(CS*)CC 0.000 description 1
- BQNZIRSNAKWERJ-UHFFFAOYSA-N 2-fluoro-4-(trifluoromethyl)benzamide Chemical compound NC(=O)C1=CC=C(C(F)(F)F)C=C1F BQNZIRSNAKWERJ-UHFFFAOYSA-N 0.000 description 1
- OCIYTBZXTFPSPI-UHFFFAOYSA-N 2-fluoro-4-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(C(F)(F)F)C=C1F OCIYTBZXTFPSPI-UHFFFAOYSA-N 0.000 description 1
- 125000004791 2-fluoroethoxy group Chemical group FCCO* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- ZBDDDPGZYWHJFK-UHFFFAOYSA-N 2-hydroxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]propanoic acid Chemical compound COC1=CC=C(CC(O)C(O)=O)C=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 ZBDDDPGZYWHJFK-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CLNDEEXLZYTRKR-UHFFFAOYSA-N 2-methoxy-6-methylpyridine-3-carboxylic acid Chemical compound COC1=NC(C)=CC=C1C(O)=O CLNDEEXLZYTRKR-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- JMMZCWZIJXAGKW-UHFFFAOYSA-N 2-methylpent-2-ene Chemical compound CCC=C(C)C JMMZCWZIJXAGKW-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000005924 2-methylpentyloxy group Chemical group 0.000 description 1
- 125000004722 2-methylpentylthio group Chemical group CC(CS*)CCC 0.000 description 1
- OAIRTVZAAFZBMR-UHFFFAOYSA-N 2-propan-2-yloxyacetic acid Chemical compound CC(C)OCC(O)=O OAIRTVZAAFZBMR-UHFFFAOYSA-N 0.000 description 1
- JWVIUKBQMRPURK-UHFFFAOYSA-N 2-propan-2-yloxybutanoic acid Chemical compound CCC(C(O)=O)OC(C)C JWVIUKBQMRPURK-UHFFFAOYSA-N 0.000 description 1
- MAWNIZMTEBNXCZ-UHFFFAOYSA-N 2-propan-2-yloxypentanoic acid Chemical compound CCCC(C(O)=O)OC(C)C MAWNIZMTEBNXCZ-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- PFHXAFJZVIKUGY-UHFFFAOYSA-N 3-[2-[[(2,4-dichlorobenzoyl)amino]methyl]pyridin-4-yl]-2-propan-2-yloxypropanoic acid Chemical compound CC(C)OC(C(O)=O)CC1=CC=NC(CNC(=O)C=2C(=CC(Cl)=CC=2)Cl)=C1 PFHXAFJZVIKUGY-UHFFFAOYSA-N 0.000 description 1
- ORENJMLCDBSOEP-UHFFFAOYSA-N 3-[2-[[(2-chloro-4-cyclopentyloxybenzoyl)amino]methyl]pyridin-4-yl]-2-propan-2-yloxypropanoic acid Chemical compound CC(C)OC(C(O)=O)CC1=CC=NC(CNC(=O)C=2C(=CC(OC3CCCC3)=CC=2)Cl)=C1 ORENJMLCDBSOEP-UHFFFAOYSA-N 0.000 description 1
- WWDJJULBWMFVGQ-UHFFFAOYSA-N 3-[2-[[(2-chloro-4-propoxybenzoyl)amino]methyl]pyridin-4-yl]-2-propan-2-yloxypropanoic acid Chemical compound ClC1=CC(OCCC)=CC=C1C(=O)NCC1=CC(CC(OC(C)C)C(O)=O)=CC=N1 WWDJJULBWMFVGQ-UHFFFAOYSA-N 0.000 description 1
- HZHNGLHOZVLVJK-UHFFFAOYSA-N 3-[2-[[[2-(2,4-dichlorophenyl)-5-methyl-1,3-thiazole-4-carbonyl]amino]methyl]pyridin-4-yl]-2-propan-2-yloxypropanoic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC(C)OC(C(O)=O)CC1=CC=NC(CNC(=O)C2=C(SC(=N2)C=2C(=CC(Cl)=CC=2)Cl)C)=C1 HZHNGLHOZVLVJK-UHFFFAOYSA-N 0.000 description 1
- ZATBCWOOHNDQTN-UHFFFAOYSA-N 3-[2-[[[2-(2-chlorophenyl)-5-methyl-1,3-thiazole-4-carbonyl]amino]methyl]pyridin-4-yl]-2-propan-2-yloxypropanoic acid Chemical compound CC(C)OC(C(O)=O)CC1=CC=NC(CNC(=O)C2=C(SC(=N2)C=2C(=CC=CC=2)Cl)C)=C1 ZATBCWOOHNDQTN-UHFFFAOYSA-N 0.000 description 1
- SYCQQBXUKCMKOA-UHFFFAOYSA-N 3-[3-(aminomethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1CN SYCQQBXUKCMKOA-UHFFFAOYSA-N 0.000 description 1
- QBFAOFWGNMVOIA-UHFFFAOYSA-N 3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4,5-dimethoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC(CC(OC(C)C)C(O)=O)=CC(CNC(=O)C=2C(=CC(Cl)=CC=2)Cl)=C1OC QBFAOFWGNMVOIA-UHFFFAOYSA-N 0.000 description 1
- JANYSLZDQMFYTO-UHFFFAOYSA-N 3-[3-[[(2,6-dimethoxypyridine-3-carbonyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=NC(OC)=CC=C1C(=O)NCC1=CC(CC(OC(C)C)C(O)=O)=CC=C1OC JANYSLZDQMFYTO-UHFFFAOYSA-N 0.000 description 1
- NJDDQMJBKYJNEF-UHFFFAOYSA-N 3-[3-[[(4-chloro-2-fluorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1F NJDDQMJBKYJNEF-UHFFFAOYSA-N 0.000 description 1
- AELRPEDGWPMLFS-UHFFFAOYSA-N 3-[3-[[(4-chloro-2-methoxybenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1OC AELRPEDGWPMLFS-UHFFFAOYSA-N 0.000 description 1
- DRWCYVNXSDTSAQ-UHFFFAOYSA-N 3-[3-bromo-5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=C(Br)C=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1Cl DRWCYVNXSDTSAQ-UHFFFAOYSA-N 0.000 description 1
- CFEIWTTWCOVFNJ-UHFFFAOYSA-N 3-[3-cyano-5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound C1=C(CC(OC(C)C)C(O)=O)C=C(C#N)C(OC)=C1CNC(=O)C1=CC=C(Cl)C=C1Cl CFEIWTTWCOVFNJ-UHFFFAOYSA-N 0.000 description 1
- MFFZEIBJBUCSQR-UHFFFAOYSA-N 3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]-2-(2-methylpropoxy)propanoic acid Chemical compound COC1=CC=C(CC(OCC(C)C)C(O)=O)C=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 MFFZEIBJBUCSQR-UHFFFAOYSA-N 0.000 description 1
- JJCLHMORHMHOBK-UHFFFAOYSA-N 3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]-2-[(2-methylpropan-2-yl)oxy]propanoic acid Chemical compound COC1=CC=C(CC(OC(C)(C)C)C(O)=O)C=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 JJCLHMORHMHOBK-UHFFFAOYSA-N 0.000 description 1
- RTGOXXKFOWMUHM-UHFFFAOYSA-N 3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 RTGOXXKFOWMUHM-UHFFFAOYSA-N 0.000 description 1
- OPNLJSCRNOGSIM-UHFFFAOYSA-N 3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]propanoic acid Chemical compound COC1=CC=C(CCC(O)=O)C=C1C(=O)NCC1=CC=C(C(F)(F)F)C=C1 OPNLJSCRNOGSIM-UHFFFAOYSA-N 0.000 description 1
- DUKSMZNFIRQHIE-UHFFFAOYSA-N 3-[4-methoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(C(F)(F)F)C=C1 DUKSMZNFIRQHIE-UHFFFAOYSA-N 0.000 description 1
- WDDMMVXWIUDBEB-UHFFFAOYSA-N 3-[5-[[(2,4-dichlorobenzoyl)amino]methyl]-2,4-dimethoxyphenyl]-2-propan-2-yloxypropanoic acid Chemical compound COC1=CC(OC)=C(CC(OC(C)C)C(O)=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1Cl WDDMMVXWIUDBEB-UHFFFAOYSA-N 0.000 description 1
- CTZDPLCWTYHSOR-UHFFFAOYSA-N 3-bromo-2,6-dimethoxybenzaldehyde Chemical compound COC1=CC=C(Br)C(OC)=C1C=O CTZDPLCWTYHSOR-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 125000005925 3-methylpentyloxy group Chemical group 0.000 description 1
- 125000004723 3-methylpentylthio group Chemical group CC(CCS*)CC 0.000 description 1
- QDSFNOHWQKVVEB-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)morpholine Chemical compound CCOP(=O)(OCC)CN1CCOCC1 QDSFNOHWQKVVEB-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- WEJHBEDHLLBJFW-UHFFFAOYSA-N 4-(trifluoromethyl)benzamide Chemical compound NC(=O)C1=CC=C(C(F)(F)F)C=C1 WEJHBEDHLLBJFW-UHFFFAOYSA-N 0.000 description 1
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- VUSAZEHQNZGXLA-UHFFFAOYSA-N 4-bromo-1-methoxy-2-[[4-(trifluoromethyl)phenyl]methoxymethyl]benzene Chemical compound COC1=CC=C(Br)C=C1COCC1=CC=C(C(F)(F)F)C=C1 VUSAZEHQNZGXLA-UHFFFAOYSA-N 0.000 description 1
- ZLPXBWMVZANJJQ-UHFFFAOYSA-N 4-chloro-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1F ZLPXBWMVZANJJQ-UHFFFAOYSA-N 0.000 description 1
- UFEYMXHWIHFRBX-UHFFFAOYSA-N 4-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(Cl)=CC=C1C(O)=O UFEYMXHWIHFRBX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- ICCIKEDPCSPHNG-UHFFFAOYSA-N 4-methoxy-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1CCOC1=CC=C(C(F)(F)F)C=C1 ICCIKEDPCSPHNG-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- CNBHLZLAEZRKNK-UHFFFAOYSA-N 5-(2,3-diethoxy-3-oxopropyl)-2-methoxybenzoic acid Chemical compound CCOC(=O)C(OCC)CC1=CC=C(OC)C(C(O)=O)=C1 CNBHLZLAEZRKNK-UHFFFAOYSA-N 0.000 description 1
- JQVXPQRPTBHUIB-UHFFFAOYSA-N 5-(3-ethoxy-2-hydroxy-3-oxopropyl)-2-methoxybenzoic acid Chemical compound CCOC(=O)C(O)CC1=CC=C(OC)C(C(O)=O)=C1 JQVXPQRPTBHUIB-UHFFFAOYSA-N 0.000 description 1
- GFMPPJORHKBRPT-UHFFFAOYSA-N 5-(3-ethoxy-3-oxo-2-propan-2-yloxypropyl)-2-methoxybenzoic acid Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(C(O)=O)=C1 GFMPPJORHKBRPT-UHFFFAOYSA-N 0.000 description 1
- ZBZXXKVWAZSUIR-UHFFFAOYSA-N 5-(3-ethoxy-3-oxopropyl)-2-methoxybenzoic acid Chemical compound CCOC(=O)CCC1=CC=C(OC)C(C(O)=O)=C1 ZBZXXKVWAZSUIR-UHFFFAOYSA-N 0.000 description 1
- DYGGAKPRUMOLCC-UHFFFAOYSA-N 5-[3-ethoxy-2-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2-methoxybenzoic acid Chemical compound CCOC(=O)C(OC(C)(C)C)CC1=CC=C(OC)C(C(O)=O)=C1 DYGGAKPRUMOLCC-UHFFFAOYSA-N 0.000 description 1
- PXDIELLGFUEAIX-UHFFFAOYSA-N 5-bromo-2,4-dimethoxybenzaldehyde Chemical compound COC1=CC(OC)=C(C=O)C=C1Br PXDIELLGFUEAIX-UHFFFAOYSA-N 0.000 description 1
- JFDUXZIRWBYBAQ-UHFFFAOYSA-N 5-bromo-2-methoxybenzoic acid Chemical compound COC1=CC=C(Br)C=C1C(O)=O JFDUXZIRWBYBAQ-UHFFFAOYSA-N 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- MEQYZLVMLXTKEV-UHFFFAOYSA-N CC(=O)NC1C(CN2CCC(Cl)C12)OC(=O)NCC1C2CN3CCC(O2)C13 Chemical compound CC(=O)NC1C(CN2CCC(Cl)C12)OC(=O)NCC1C2CN3CCC(O2)C13 MEQYZLVMLXTKEV-UHFFFAOYSA-N 0.000 description 1
- GXZICVWCFLTZRN-UHFFFAOYSA-N CC(C(O)=O)C1=CC(CNC(C2=C(C)SC(C3=CC=C(C)C=C3)=N2)=O)=NC=C1 Chemical compound CC(C(O)=O)C1=CC(CNC(C2=C(C)SC(C3=CC=C(C)C=C3)=N2)=O)=NC=C1 GXZICVWCFLTZRN-UHFFFAOYSA-N 0.000 description 1
- FOEFLCPRQDMYQP-LDADJPATSA-N CC(C)OC(CC1=CC(=C(C=C1)OC)CNC/C(=C/C2=CC=CC=C2)/C)C(=O)O Chemical compound CC(C)OC(CC1=CC(=C(C=C1)OC)CNC/C(=C/C2=CC=CC=C2)/C)C(=O)O FOEFLCPRQDMYQP-LDADJPATSA-N 0.000 description 1
- BYVBUAQNOTVFCU-YRNVUSSQSA-N CC(C)OC(CC1=CC(=C(C=C1)OC)CNC/C=C/C2=CC=CC3=CC=CC=C32)C(=O)O Chemical compound CC(C)OC(CC1=CC(=C(C=C1)OC)CNC/C=C/C2=CC=CC3=CC=CC=C32)C(=O)O BYVBUAQNOTVFCU-YRNVUSSQSA-N 0.000 description 1
- BEKDXDPTSKLNQU-UHFFFAOYSA-N CCC(CC1=CC(CNC(C(C=CC(C(F)(F)F)=C2)=C2F)=O)=NC=C1)(C(O)=O)OC(C)C Chemical compound CCC(CC1=CC(CNC(C(C=CC(C(F)(F)F)=C2)=C2F)=O)=NC=C1)(C(O)=O)OC(C)C BEKDXDPTSKLNQU-UHFFFAOYSA-N 0.000 description 1
- JUHDVWOHNUMVCQ-NTEUORMPSA-N CCOC(=O)C(\OC(C)C)=C/C1=CC=C(OC)C(C(O)=O)=C1 Chemical compound CCOC(=O)C(\OC(C)C)=C/C1=CC=C(OC)C(C(O)=O)=C1 JUHDVWOHNUMVCQ-NTEUORMPSA-N 0.000 description 1
- XQKJUBMNRSAMJC-UHFFFAOYSA-N CCOC(C(O)=O)CC1=CC=C(OC)C(C(=O)NCC2CCCCC2)=C1 Chemical compound CCOC(C(O)=O)CC1=CC=C(OC)C(C(=O)NCC2CCCCC2)=C1 XQKJUBMNRSAMJC-UHFFFAOYSA-N 0.000 description 1
- GUIKNSMSPBWGPL-UHFFFAOYSA-N CCP(=O)(CC)C(C(C)C)C(=O)O Chemical compound CCP(=O)(CC)C(C(C)C)C(=O)O GUIKNSMSPBWGPL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 101000904460 Encephalitozoon cuniculi (strain GB-M1) Probable glycerol-3-phosphate dehydrogenase Proteins 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- AXISYYRBXTVTFY-UHFFFAOYSA-N Isopropyl tetradecanoate Chemical group CCCCCCCCCCCCCC(=O)OC(C)C AXISYYRBXTVTFY-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- 102000016267 Leptin Human genes 0.000 description 1
- 108010092277 Leptin Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229940080774 Peroxisome proliferator-activated receptor gamma agonist Drugs 0.000 description 1
- 241000577218 Phenes Species 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108700008625 Reporter Genes Proteins 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 1
- MQHYGMPCZGDEOU-UHFFFAOYSA-N [5-(dimethoxymethyl)-2-phenylmethoxyphenyl]methanol Chemical compound OCC1=CC(C(OC)OC)=CC=C1OCC1=CC=CC=C1 MQHYGMPCZGDEOU-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- MOQOOKGPCBQMCY-UHFFFAOYSA-N acetic acid;hexane Chemical compound CC(O)=O.CCCCCC MOQOOKGPCBQMCY-UHFFFAOYSA-N 0.000 description 1
- GLRAHDCHUZLKKC-UHFFFAOYSA-N acetonitrile;2,2,2-trifluoroacetic acid;hydrate Chemical compound O.CC#N.OC(=O)C(F)(F)F GLRAHDCHUZLKKC-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000005205 alkoxycarbonyloxyalkyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 125000003275 alpha amino acid group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 230000002058 anti-hyperglycaemic effect Effects 0.000 description 1
- 230000001315 anti-hyperlipaemic effect Effects 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000005127 aryl alkoxy alkyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000002908 as-indacenyl group Chemical group C1(=CC=C2C=CC3=CC=CC3=C12)* 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- RREZCLLAWSVSAV-UHFFFAOYSA-N benzyl 5-(2,3-diethoxy-3-oxoprop-1-enyl)-2-methoxybenzoate Chemical compound CCOC(=O)C(OCC)=CC1=CC=C(OC)C(C(=O)OCC=2C=CC=CC=2)=C1 RREZCLLAWSVSAV-UHFFFAOYSA-N 0.000 description 1
- VCFZBJOTEWVWPM-UHFFFAOYSA-N benzyl 5-formyl-2-methoxybenzoate Chemical compound COC1=CC=C(C=O)C=C1C(=O)OCC1=CC=CC=C1 VCFZBJOTEWVWPM-UHFFFAOYSA-N 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229960004111 buformin Drugs 0.000 description 1
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- GTXRYQGMNAPQDP-UHFFFAOYSA-N butyl-chloro-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](Cl)(CCCC)C1=CC=CC=C1 GTXRYQGMNAPQDP-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000019577 caloric intake Nutrition 0.000 description 1
- 125000005242 carbamoyl alkyl group Chemical group 0.000 description 1
- 150000005323 carbonate salts Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000008614 cellular interaction Effects 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 229960001761 chlorpropamide Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 206010009887 colitis Diseases 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000012228 culture supernatant Substances 0.000 description 1
- UCDHYFZYUGDETN-UHFFFAOYSA-N cyanophosphonic acid Chemical compound OP(O)(=O)C#N UCDHYFZYUGDETN-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001352 cyclobutyloxy group Chemical group C1(CCC1)O* 0.000 description 1
- 125000003113 cycloheptyloxy group Chemical group C1(CCCCCC1)O* 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 125000000131 cyclopropyloxy group Chemical group C1(CC1)O* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 1
- OVVMHZRGSHTZDB-UHFFFAOYSA-N dibutylboron Chemical compound CCCC[B]CCCC OVVMHZRGSHTZDB-UHFFFAOYSA-N 0.000 description 1
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- VDCSGNNYCFPWFK-UHFFFAOYSA-N diphenylsilane Chemical compound C=1C=CC=CC=1[SiH2]C1=CC=CC=C1 VDCSGNNYCFPWFK-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- CBMPTFJVXNIWHP-UHFFFAOYSA-L disodium;hydrogen phosphate;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound [Na+].[Na+].OP([O-])([O-])=O.OC(=O)CC(O)(C(O)=O)CC(O)=O CBMPTFJVXNIWHP-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 239000010696 ester oil Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- HDNYZUSXOLHBHX-BKUYFWCQSA-N ethyl (z)-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]-2-propan-2-yloxyprop-2-enoate Chemical compound CCOC(=O)C(\OC(C)C)=C\C1=CC=C(OC)C(C(=O)NCC=2C=CC(=CC=2)C(F)(F)F)=C1 HDNYZUSXOLHBHX-BKUYFWCQSA-N 0.000 description 1
- JYZSCOVQLQDMEF-UHFFFAOYSA-N ethyl 2-[(4-methoxy-3-nitrophenyl)methylidene]butanoate Chemical compound CCOC(=O)C(CC)=CC1=CC=C(OC)C([N+]([O-])=O)=C1 JYZSCOVQLQDMEF-UHFFFAOYSA-N 0.000 description 1
- OCBMRLANLQWLAO-UHFFFAOYSA-N ethyl 2-[[4-methoxy-3-[[[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]methyl]butanoate Chemical compound CCOC(=O)C(CC)CC1=CC=C(OC)C(CNC(=O)C=2C=CC(=CC=2)C(F)(F)F)=C1 OCBMRLANLQWLAO-UHFFFAOYSA-N 0.000 description 1
- XGRQEFWHDFSHQT-UHFFFAOYSA-N ethyl 2-diethylphosphoryl-3-methylbutanoate Chemical compound CCOC(=O)C(C(C)C)P(=O)(CC)CC XGRQEFWHDFSHQT-UHFFFAOYSA-N 0.000 description 1
- DAGAYULAAMQDSJ-UHFFFAOYSA-N ethyl 2-diethylphosphorylbutanoate Chemical compound CCOC(=O)C(CC)P(=O)(CC)CC DAGAYULAAMQDSJ-UHFFFAOYSA-N 0.000 description 1
- SJFNQFSYMGNQHP-UHFFFAOYSA-N ethyl 2-ethoxy-3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]propanoate Chemical compound CCOC(=O)C(OCC)CC1=CC=C(OC)C(C(=O)NCC=2C=CC(=CC=2)C(F)(F)F)=C1 SJFNQFSYMGNQHP-UHFFFAOYSA-N 0.000 description 1
- UZYHOPBXMRFDIL-UHFFFAOYSA-N ethyl 3-(3-amino-4-methoxyphenyl)-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(N)=C1 UZYHOPBXMRFDIL-UHFFFAOYSA-N 0.000 description 1
- UZMRPUCLEXKNJA-UHFFFAOYSA-N ethyl 3-[2,4-dimethoxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CNC(=O)OC(C)(C)C)=C1OC UZMRPUCLEXKNJA-UHFFFAOYSA-N 0.000 description 1
- ALALOCIISPQXPK-UHFFFAOYSA-N ethyl 3-[2,4-dimethoxy-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC(CNC(=O)OC(C)(C)C)=C(OC)C=C1OC ALALOCIISPQXPK-UHFFFAOYSA-N 0.000 description 1
- KLMULKDDWKXFAG-UHFFFAOYSA-N ethyl 3-[3,4-dimethoxy-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC(CNC(=O)OC(C)(C)C)=C(OC)C(OC)=C1 KLMULKDDWKXFAG-UHFFFAOYSA-N 0.000 description 1
- BJTKUMPDJRPYDO-UHFFFAOYSA-N ethyl 3-[3-(cyclohexylmethylcarbamoyl)-4-methoxyphenyl]-2-ethoxypropanoate Chemical compound CCOC(=O)C(OCC)CC1=CC=C(OC)C(C(=O)NCC2CCCCC2)=C1 BJTKUMPDJRPYDO-UHFFFAOYSA-N 0.000 description 1
- IXCCSMIQQZBXFH-UHFFFAOYSA-N ethyl 3-[3-(hydroxymethyl)-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CO)=C1 IXCCSMIQQZBXFH-UHFFFAOYSA-N 0.000 description 1
- OFVZMNGAKJLVAL-UHFFFAOYSA-N ethyl 3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CNC(=O)C=2C(=CC(Cl)=CC=2)Cl)=C1 OFVZMNGAKJLVAL-UHFFFAOYSA-N 0.000 description 1
- UMSWSWBEVLMUOV-UHFFFAOYSA-N ethyl 3-[3-[[(4-chloro-2-fluorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(CNC(=O)C=2C(=CC(Cl)=CC=2)F)=C1 UMSWSWBEVLMUOV-UHFFFAOYSA-N 0.000 description 1
- IVEBCLYJDCEVHL-UHFFFAOYSA-N ethyl 3-[3-cyano-4-methoxy-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC(CNC(=O)OC(C)(C)C)=C(OC)C(C#N)=C1 IVEBCLYJDCEVHL-UHFFFAOYSA-N 0.000 description 1
- YIXDIHHIGSFWEK-UHFFFAOYSA-N ethyl 3-[4-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(O)C(CNC(=O)OC(C)(C)C)=C1 YIXDIHHIGSFWEK-UHFFFAOYSA-N 0.000 description 1
- DPRIJCQQSDBQTC-UHFFFAOYSA-N ethyl 3-[4-methoxy-3-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)CC1=CC=C(OC)C(NC(=O)CC=2C=CC(=CC=2)C(F)(F)F)=C1 DPRIJCQQSDBQTC-UHFFFAOYSA-N 0.000 description 1
- OBSCXAJTKQUWOI-UHFFFAOYSA-N ethyl 3-hydroxy-3-[4-methoxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-2-propan-2-yloxypropanoate Chemical compound CCOC(=O)C(OC(C)C)C(O)C1=CC=C(OC)C(CNC(=O)OC(C)(C)C)=C1 OBSCXAJTKQUWOI-UHFFFAOYSA-N 0.000 description 1
- PPCXFTKZPBHXIW-UHFFFAOYSA-N ethyl ethanesulfonate Chemical compound CCOS(=O)(=O)CC PPCXFTKZPBHXIW-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000006005 fluoroethoxy group Chemical group 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 230000010030 glucose lowering effect Effects 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 231100000304 hepatotoxicity Toxicity 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- UBHWBODXJBSFLH-UHFFFAOYSA-N hexadecan-1-ol;octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCO UBHWBODXJBSFLH-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 230000003345 hyperglycaemic effect Effects 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000028709 inflammatory response Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 210000004153 islets of langerhan Anatomy 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M isovalerate Chemical compound CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 208000006443 lactic acidosis Diseases 0.000 description 1
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 description 1
- 229940039781 leptin Drugs 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 230000037356 lipid metabolism Effects 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 208000019423 liver disease Diseases 0.000 description 1
- 230000007056 liver toxicity Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229960004329 metformin hydrochloride Drugs 0.000 description 1
- OETHQSJEHLVLGH-UHFFFAOYSA-N metformin hydrochloride Chemical compound Cl.CN(C)C(=N)N=C(N)N OETHQSJEHLVLGH-UHFFFAOYSA-N 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin hydrochloride Natural products CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- CFYFHHUNOMYZRE-UHFFFAOYSA-N methyl 3-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]-2-propoxypropanoate Chemical compound CCCOC(C(=O)OC)CC1=CC=C(OC)C(C(=O)NCC=2C=CC(=CC=2)C(F)(F)F)=C1 CFYFHHUNOMYZRE-UHFFFAOYSA-N 0.000 description 1
- WAMCRGOGJAIEPO-UHFFFAOYSA-N methyl 5-(dimethoxymethyl)-2-phenylmethoxybenzoate Chemical compound COC(=O)C1=CC(C(OC)OC)=CC=C1OCC1=CC=CC=C1 WAMCRGOGJAIEPO-UHFFFAOYSA-N 0.000 description 1
- CXBOMPGGRIMBEE-UHFFFAOYSA-N methyl 5-formyl-2-phenylmethoxybenzoate Chemical class COC(=O)C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 CXBOMPGGRIMBEE-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PQSOLLURQXDZSZ-UHFFFAOYSA-N n,n-diethylethanamine;ethyl acetate;methanol Chemical compound OC.CCOC(C)=O.CCN(CC)CC PQSOLLURQXDZSZ-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical group CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- FGLLHCCYXMYNML-UHFFFAOYSA-N n-[(5-formyl-2-methoxyphenyl)methyl]-4-(trifluoromethyl)benzamide Chemical compound COC1=CC=C(C=O)C=C1CNC(=O)C1=CC=C(C(F)(F)F)C=C1 FGLLHCCYXMYNML-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 101150015886 nuc-1 gene Proteins 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000005824 oxyalkoxy group Chemical group 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- VUXHKWWEQBAEAF-UHFFFAOYSA-N pentanoic acid;silver Chemical compound [Ag].CCCCC(O)=O VUXHKWWEQBAEAF-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002503 polyoxyethylene-polyoxypropylene Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- OYXJBXRTVVLLSJ-UHFFFAOYSA-N prop-2-enoxyboronic acid Chemical class OB(O)OCC=C OYXJBXRTVVLLSJ-UHFFFAOYSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- APBWDYIHOULCGI-UHFFFAOYSA-M sodium;3-[3-[[(2,4-dichlorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound [Na+].COC1=CC=C(CC(OC(C)C)C([O-])=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1Cl APBWDYIHOULCGI-UHFFFAOYSA-M 0.000 description 1
- AZBFXRWUDRHTLH-UHFFFAOYSA-M sodium;3-[3-[[(4-chloro-2-fluorobenzoyl)amino]methyl]-4-methoxyphenyl]-2-propan-2-yloxypropanoate Chemical compound [Na+].COC1=CC=C(CC(OC(C)C)C([O-])=O)C=C1CNC(=O)C1=CC=C(Cl)C=C1F AZBFXRWUDRHTLH-UHFFFAOYSA-M 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ORVIGUGINAOSMZ-UHFFFAOYSA-N tert-butyl 5-(3-ethoxy-3-oxo-2-propan-2-yloxyprop-1-enyl)-2-methoxybenzoate Chemical compound CCOC(=O)C(OC(C)C)=CC1=CC=C(OC)C(C(=O)OC(C)(C)C)=C1 ORVIGUGINAOSMZ-UHFFFAOYSA-N 0.000 description 1
- QEZBTIHIKXFGKV-UHFFFAOYSA-N tert-butyl 5-formyl-2-methoxybenzoate Chemical compound COC1=CC=C(C=O)C=C1C(=O)OC(C)(C)C QEZBTIHIKXFGKV-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 1
- 229960002277 tolazamide Drugs 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 239000012096 transfection reagent Substances 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- GRGCWBWNLSTIEN-UHFFFAOYSA-N trifluoromethanesulfonyl chloride Chemical compound FC(F)(F)S(Cl)(=O)=O GRGCWBWNLSTIEN-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N trihydridoboron Substances B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 150000003672 ureas Chemical group 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- WJUFSDZVCOTFON-UHFFFAOYSA-N veratraldehyde Chemical compound COC1=CC=C(C=O)C=C1OC WJUFSDZVCOTFON-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/46—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/51—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/53—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/55—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a carbon atom of an unsaturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/81—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/82—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/87—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/38—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/52—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/60—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/72—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms
- C07C235/76—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton
- C07C235/78—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton the carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/84—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/57—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and carboxyl groups, other than cyano groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/56—Amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/24—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/16—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/18—Oxygen atoms
- C07D263/20—Oxygen atoms attached in position 2
- C07D263/26—Oxygen atoms attached in position 2 with hetero atoms or acyl radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/30—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Diabetes (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Endocrinology (AREA)
- Emergency Medicine (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Abstract
Description
혈당 저하율(%) | 혈중트리글리세라이드저하율 (%) | 혈중유리 지방산저하율(%) | |
실시예 2d) | 44.6 | 71.6 | 46.7 |
실시예 3d) | 27.5 | 63.8 | 47 |
실시예 5d) | 53.6 | 58.8 | 65.5 |
실시예 9b) | 46.1 | 80.4 | 62.9 |
실시예 36g)* | 51.5 | 55.2 | 54.0 |
실시예 37e)* | 48.1 | 68.3 | 70.2 |
PPARα | PPARβ | PPARγ | |
실시예 2d) | 0.08 | 2.513 | 0.382 |
실시예 3d) | 0.087 | 5.072 | 0.217 |
실시예 5d) | 0.394 | 0.789 | 0.254 |
실시예 9b) | 0.701 | >30 | 0.746 |
실시예 18d) | 0.162 | 8.054 | >10 |
실시예 36g) | 0.012 | 0.037 | 0.047 |
실시예 37e) | 0.028 | 0.432 | 0.016 |
Claims (18)
- 일반식〔식 중에서, R1은 수소원자, 수산기, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는, 탄소수 1 내지 6의 알킬기, 탄소수 1 내지 6의 알콕시기, 탄소수 1 내지 6의 알킬티오기, 탄소수 1 내지 6의 하이드록시알킬기, 탄소수 1 내지 6의 하이드록시알콕시기, 탄소수 1 내지 6의 하이드록시알킬티오기, 탄소수 1 내지 6의 아미노알킬기, 탄소수 1 내지 6의 아미노알콕시기, 탄소수 1 내지 6의 아미노알킬티오기, 탄소수 1 내지 6의 할로겐화 알킬기, 탄소수 1 내지 6의 할로겐화 알콕시기, 탄소수 1 내지 6의 할로겐화 알킬티오기, 탄소수 2 내지 12의 알콕시알킬기, 탄소수 2 내지 12의 알콕시알콕시기, 탄소수 2 내지 12의 알콕시알킬티오기, 탄소수 3 내지 7의 사이클로알킬기, 탄소수 3 내지 7의 사이클로알킬옥시기, 탄소수 3 내지 7의 사이클로알킬티오기, 탄소수 2 내지 6의 알케닐기, 탄소수 2 내지 6의 알케닐옥시기, 탄소수 2 내지 6의 알케닐티오기, 탄소수 2 내지 6의 알키닐기, 탄소수 2 내지 6의 알키닐옥시기, 탄소수 2 내지 6의 알키닐티오기, 탄소수 6 내지 12의 아릴기, 탄소수 6 내지 12의 아릴옥시기, 탄소수 6 내지 12의 아릴티오기, 탄소수 7 내지 18의 알킬아릴기, 탄소수 7 내지 18의 알킬아릴옥시기, 탄소수 7 내지 18의 알킬아릴티오기, 탄소수 7 내지 18의 아랄킬기, 탄소수 7 내지 18의 아랄킬옥시기 또는 탄소수 7 내지 18의 아랄킬티오기를; L은 단결합 또는 이중결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는, 탄소수 1 내지 6의 알킬렌기, 탄소수 2 내지 6의 알케닐렌기 또는 탄소수 2 내지 6의 알키닐렌기를; M은 단결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는, 탄소수 2 내지 6의 알킬렌기, 탄소수 2 내지 6의 알케닐렌기 또는 탄소수 2 내지 6의 알키닐렌기를; T는 단결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는, 탄소수 1 내지 3의 알킬렌기, 탄소수 2 내지 3의 알케닐렌기 또는 탄소수 2 내지 3의 알키닐렌기를; W는 2,4-디옥소티아졸리딘-5-일기, 2.4-디옥소티아졸리딘-5-일리덴기, 카르복시기, 또는 -C0N(Rw1)Rw2(여기서 Rw1, Rw2는 각각 동일하거나 다르고 수소원자, 포르밀기, 또는 각각 하나 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각 나타냄)로 표기되는 기를 나타내고, 단, 상기의 정의에 있어서, T가 단결합이며, W가 2,4-디옥소티아졸리딘-5-일기, 또는 2,4-디옥소티아졸리딘-5-일리덴기인 경우를 제외하고;는, 단결합 또는 이중결합을; X는 산소원자, 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 2 내지 6의 알케닐렌기, 또는 하이드록시메틸렌기, 또는 일반식 -CQ-(여기서 Q는 산소원자 또는 황원자를 나타냄), -CQNRx-(여기서 Q는 상기 정의와 동일한 기를, Rx는 수소원자, 포르밀기, 또는 각각 하나 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각 나타냄),-NRxCQ-(여기서 Q, Rx는 각각 상기 정의와 동일한 기를 나타냄), -SO2NRx-(여기서 Rx는 상기 정의와 동일한 기를 나타냄), -NRxSO2-(Rx는 상기 정의와 동일한 기를 나타냄), 또는 -NRx1CQNRx2-(여기서 Q는 상기 정의와 동일한 기를, Rx1또는 Rx2은 각각 동일하거나 다르고 수소원자, 포르밀기, 또는 각각 l 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각 나타냄)로 표기되는 기를 나타내고, 단, 상기의 정의에 있어서, T가 단결합이며, X가 산소원자인 경우를 제외하고; Y는 하나 이상의 치환기를 가지고 있을 수도 있고, 하나 이상의 헤테로원자를 가지고 있을 수도 있는 탄소수 5 내지 12의 방향족 탄화수소기, 또는 탄소수 3 내지 7의 지환식 탄화수소기를; 환 Z는 추가로 0 내지 4의 치환기를 가지고 있을 수도 있고, 하나 이상의 헤테로원자를 가지고 있을 수도 있는 탄소수 5 내지 6의 방향족 탄화수소기를 각각 나타내고; 일반식(여기서 식 중의 기호는 상기 정의와 동일한 기를 나타냄)로 표기되는 기와, 일반식(여기서 식 중의 기호는 상기 정의와 동일한 기를 나타냄)로 표기되는 기는,환 Z 상에서 3개의 원자를 사이에 두고 서로 결합하는 것으로 함〕로 표시되는 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항에 있어서,상기 일반식(I)에서, W가 카르본산인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, R1이 각각 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 1 내지 6의 알콕시기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, 환 Z가 추가로 0 내지 4의 치환기를 가지고 있을 수도 있는 벤젠환인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, X가 일반식 -CQNRx-(여기서 Q, Rx는 상기 정의와 동일한 기를 나타냄) 또는 -NRxCQ-(여기서 Q, Rx는 상기 정의와 동일한 기를 나타냄)로 표기되는 기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, Y가 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 5 내지 12의 방향족 탄화수소기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, L 또는 M이 탄소수 1 내지 6의 알킬렌기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, T가 탄소수 1 내지 3의 알킬렌기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 제1항 또는 제2항에 있어서,상기 일반식(I)에서, R1이 각각 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 1 내지 6의 알콕시기이며, 환 Z가 추가로 O에서 4의 치환기를 가지고 있을 수도 있는 벤젠환인 카르본산 유도체, 그 염 또는그 에스테르 또는 그들의 수화물.
- 제1항 또는 제9항에 있어서,상기 일반식(I)에서, X는 일반식 -CQNRx-(여기서 Q, Rx는 상기 정의와 동일한 기를 나타냄) 또는 -NRxCQ-(여기서 Q, Rx는 상기 정의와 동일한 기를 나타냄)로 표기되는 기이며, Y는 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 5 내지 12의 방향족 탄화수소기인 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물.
- 일반식〔식 중에서, R1은 수소원자, 수산기, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는, 탄소수 1 내지 6의 알킬기, 탄소수 1 내지 6의 알콕시기, 탄소수 1 내지 6의 알킬티오기, 탄소수 1 내지 6의 하이드록시알킬기, 탄소수 1 내지 6의 하이드록시알콕시기, 탄소수 1 내지 6의 하이드록시알킬티오기, 탄소수 1 내지 6의 아미노알킬기, 탄소수 1 내지 6의 아미노알콕시기, 탄소수 1 내지 6의 아미노알킬티오기, 탄소수 1 내지, 6의 할로겐화 알킬기, 탄소수 1 내지 6의 할로겐화 알콕시기, 탄소수 1 내지 6의 할로겐화 알킬티오기, 탄소수 2 내지 12의 알콕시알킬기, 탄소수 2 내지 12의 알콕시알콕시기, 탄소수 2 내지 12의 알콕시알킬티오기, 탄소수 3 내지 7의 사이클로알킬기, 탄소수 3 내지 7의 사이클로알킬옥시기, 탄소수 3 내지 7의 사이클로알킬티오기, 탄소수 2 내지 6의 알케닐기, 탄소수 2 내지 6의 알케닐옥시기, 탄소수 2 내지 6의 알케닐티오기, 탄소수 2 내지 6의 알키닐기, 탄소수 2 내지 6의 알키닐옥시기, 탄소수 2 내지 6의 알키닐티오기, 탄소수 6 내지 12의 아릴기, 탄소수 6 내지 12의 아릴옥시기, 탄소수 6 내지 12의 아릴티오기, 탄소수 7 내지 18의 알킬아릴기, 탄소수 7 내지 18의 알킬아릴옥시기, 탄소수 7 내지 18의 알킬아릴티오기, 탄소수 7 내지 18의 아랄킬기, 탄소수 7 내지 18의 아랄킬옥시기 또는 탄소수 7 내지 18의 아랄킬티오기를; L은 단결합 또는 이중결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬렌기, 탄소수 2 내지 6의 알케닐렌기 또는 탄소수 2 내지 6의 알키닐렌기를; M은 단결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬렌기, 탄소수 2 내지 6의 알케닐렌기 또는 탄소수 2 내지 6의 알키닐렌기를; T는 단결합, 또는 각각 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 1 내지 3의 알킬렌기, 탄소수 2 내지 3의 알케닐렌기 또는 탄소수 2 내지 3의 알키닐렌기를; W는 2,4-디옥소티아졸리딘-5-일기, 2,4-디옥소티아졸리딘-5-일리덴기, 카르복시기, 또는 -CON(Rw1)Rw2(여기서 Rw1, Rw2는 각각 동일하거나 다르고 수소원자, 포르밀기, 또는 각각 하나 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각나타냄)로 표기되는 기를 나타내고, 단, 상기의 정의에 있어서, T가 단결합이며, W가 2,4-디옥소티아졸리딘-5-일기, 또는 2,4-디옥소티아졸리딘-5-일리덴기인 경우를 제외하고;는, 단결합 또는 이중결합을; X는 산소원자, 하나 이상의 치환기를 가지고 있을 수도 있는 탄소수 2 내지 6의 알케닐렌기, 또는 하이드록시메틸렌기, 또는 일반식 -CQ-(여기서 Q는 산소원자 또는 황원자를 나타냄), -CQNRx-(여기서 Q는 상기 정의와 동일한 기를, Rx는 수소원자, 포르밀기, 또는 각각 하나 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각 나타냄), -NRxCQ-(여기서 Q, Rx는 각각 상기 정의와 동일한 기를 나타냄), -SO2NRx-(여기서 Rx는 상기 정의와 동일한 기를 나타냄), -NRxSO2-(Rx는 상기 정의와 동일한 기를 나타냄), 또는 -NRx1CQNRx2-(여기서 Q는 상기 정의와 동일한 기를, Rx1또는 Rx2는 각각 동일하거나 다르고 수소원자, 포르밀기, 또는 각각 하나 이상의 치환을 가지고 있을 수도 있는 탄소수 1 내지 6의 알킬기, 탄소수 2 내지 7의 지방족 아실기, 또는 탄소수 7 내지 19의 방향족 아실기를 각각 나타냄)로 표기되는 기를 나타내고, 단, 상기의 정의에 있어서, T가 단결합이며, X가 산소원자인 경우를 제외하고; Y는 하나 이상의 치환기를 가지고 있을 수도 있고, 하나 이상의 헤테로원자를 가지고 있을 수도 있는 탄소수 5 내지 12의 방향족 탄화수소기, 또는 탄소수 3 내지 7의 지환식 탄화수소기를; 환 Z는 추가로 0 내지 4의 치환기를 가지고 있을 수도 있고, 하나 이상의 헤테로원자를 가지고 있을 수도 있는 탄소수 5 내지 6의 방향족 탄화수소기를 각각 나타내고; 일반식(여기서 식 중의 기호는 상기 정의와 동일한 기를 나타냄)로 표기되는 기와, 일반식(여기서 식 중의 기호는 상기 정의와 동일한 기를 나타냄)로 표기되는 기는, 환 Z 상에서 3개의 원자를 사이에 두고 서로 결합하는 것으로 함〕로 표시되는 카르본산 유도체, 그 염 또는 그 에스테르 또는 그들의 수화물로 이루어지는 의약(醫藥).
- 제11항에 있어서,PPARα 및 γ의 이중작용제(dual agonist) 작용에 기초하는 의약인 의약.
- 제11항에 있어서,PPARα, β 및 γ의 삼중작용제(triple agonist) 작용에 기초하는 의약인 의약.
- 제11항 내지 제13항 중 어느 한 항에 있어서,인슐린 저항성 개선제인 의약.
- 제11항 내지 제13항 중 어느 한 항에 있어서,당뇨병의 예방·치료제인 의약.
- 제11항 내지 제13항 중 어느 한 항에 있어서,X 증후군의 예방ㆍ치료제인 의약.
- 제1항의 화합물, 그 염 또는 그 에스테르 또는 그들의 수화물의 약리학상 유효량을 환자에게 투여하여 PPARα 및 γ의 이중작용제 작용 또는 PPARα, β 및 γ의 삼중작용제 작용이 유효한 질환을 예방ㆍ치료ㆍ개선하는 방법.
- PPARα 및 γ의 이중작용제의 작용 또는 PPARα, β 및 r의 삼중작용제의 작용이 유효한 질환의 예방ㆍ치료ㆍ개선제의 제조에 이용하는, 제1항의 화합물, 그 염 또는 그 에스테르 또는 그들의 수화물의 용도.
Applications Claiming Priority (8)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP28207999 | 1999-10-01 | ||
JPJP-P-1999-00282079 | 1999-10-01 | ||
JPJP-P-1999-00369442 | 1999-12-27 | ||
JP36944299 | 1999-12-27 | ||
JPJP-P-2000-00038795 | 2000-02-16 | ||
JP2000038795 | 2000-02-16 | ||
JP2000104260 | 2000-04-06 | ||
JPJP-P-2000-00104260 | 2000-04-06 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20020087383A true KR20020087383A (ko) | 2002-11-22 |
KR100694686B1 KR100694686B1 (ko) | 2007-04-23 |
Family
ID=27479266
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020027004232A Expired - Fee Related KR100694686B1 (ko) | 1999-10-01 | 2000-09-29 | 카르본산 유도체 및 그 유도체로 이루어지는 의약 |
Country Status (10)
Country | Link |
---|---|
US (1) | US6884821B1 (ko) |
EP (1) | EP1216980A4 (ko) |
JP (1) | JP4571766B2 (ko) |
KR (1) | KR100694686B1 (ko) |
CN (1) | CN1228327C (ko) |
AU (1) | AU776267B2 (ko) |
CA (1) | CA2385081C (ko) |
NZ (1) | NZ517719A (ko) |
TW (1) | TWI262185B (ko) |
WO (1) | WO2001025181A1 (ko) |
Families Citing this family (99)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
PT1285908E (pt) * | 2000-05-29 | 2008-12-04 | Kyorin Seiyaku Kk | Derivados do ácido fenilpropiónico substituídos |
US7049342B2 (en) | 2000-05-29 | 2006-05-23 | Kyorin Pharmaceutical Co., Ltd. | Substituted phenylpropionic acid derivatives |
WO2002044130A1 (fr) * | 2000-11-29 | 2002-06-06 | Kyorin Pharmaceutical Co., Ltd. | Dérivés d'acide carboxylique substitués |
JPWO2002044131A1 (ja) * | 2000-11-29 | 2004-04-02 | 杏林製薬株式会社 | 置換カルボン酸誘導体 |
JPWO2002044129A1 (ja) * | 2000-11-29 | 2004-04-02 | 杏林製薬株式会社 | 置換カルボン酸誘導体 |
JPWO2002044127A1 (ja) * | 2000-11-29 | 2004-04-02 | 杏林製薬株式会社 | 置換カルボン酸誘導体 |
AU2002222574A1 (en) | 2000-12-05 | 2002-06-18 | Kyorin Pharmaceutical Co. Ltd. | Substituted carboxylic acid derivatives |
WO2002080899A1 (fr) * | 2001-03-30 | 2002-10-17 | Eisai Co., Ltd. | Agent de traitement de maladie digestive |
US7244861B2 (en) | 2001-03-30 | 2007-07-17 | Eisai Co., Ltd. | Benzene compound and salt thereof |
TWI311133B (en) | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
WO2002098840A1 (fr) * | 2001-06-04 | 2002-12-12 | Eisai Co., Ltd. | Derive de l'acide carboxylique et medicament comprenant un sel ou un ester dudit derive |
BR0210167A (pt) * | 2001-06-07 | 2004-04-06 | Lilly Co Eli | Composto, composição farmacêutica, métodos para modular um receptor ativado com proliferador de peroxissoma, para tratar ou prevenir uma doença ou condição e para abaixar a glicose no sangue, e, uso de um composto |
JP2005509590A (ja) | 2001-06-07 | 2005-04-14 | イーライ・リリー・アンド・カンパニー | ペルオキシソーム増殖因子活性化受容体の調節物質 |
WO2003016265A1 (fr) | 2001-08-17 | 2003-02-27 | Eisai Co., Ltd. | Compose cyclique et agoniste du recepteur ppar |
UA82835C2 (en) * | 2001-12-03 | 2008-05-26 | Reddys Lab Ltd Dr | ?-aryl-?-oxysubstituted propionuc acid derivatives and pharmaceutical composition based thereon |
JP4424728B2 (ja) | 2001-12-11 | 2010-03-03 | 杏林製薬株式会社 | 置換フェニルプロピオン酸誘導体の新規な安定結晶とその製法 |
GB0314079D0 (en) * | 2003-06-18 | 2003-07-23 | Astrazeneca Ab | Therapeutic agents |
SE0104334D0 (sv) * | 2001-12-19 | 2001-12-19 | Astrazeneca Ab | Therapeutic agents |
GB0229931D0 (en) * | 2002-12-21 | 2003-01-29 | Astrazeneca Ab | Therapeutic agents |
SE0104333D0 (sv) * | 2001-12-19 | 2001-12-19 | Astrazeneca Ab | Therapeutic agents |
AU2003241173A1 (en) * | 2002-05-24 | 2003-12-12 | Takeda Pharmaceutical Company Limited | 1,2-azole derivatives with hypoglycemic and hypolipidemic activity |
MXPA05001642A (es) * | 2002-08-13 | 2005-04-25 | Warner Lambert Co | Derivados de naftaleno como inhibidores de metaloproteinasas de matriz. |
WO2004022533A1 (en) | 2002-09-05 | 2004-03-18 | Novo Nordisk A/S | Novel vinyl carboxylic acid derivatives and their therapeutical use |
EP1558571B1 (en) | 2002-10-28 | 2010-06-02 | High Point Pharmaceuticals, LLC | Novel compounds useful in treating ppar mediated diseases |
US7129268B2 (en) | 2002-10-28 | 2006-10-31 | Novo Nordisk A/S | Peroxisome proliferator activated receptor-active arylene acetic acid derivatives |
US20050080115A1 (en) | 2002-10-28 | 2005-04-14 | Lone Jeppesen | Novel compounds, their preparation and use |
WO2004037776A2 (en) | 2002-10-28 | 2004-05-06 | Novo Nordisk A/S | Novel compounds and their use as prar-modulators |
AU2002953533A0 (en) | 2002-12-24 | 2003-01-16 | Arthron Limited | Fc receptor modulating compounds and compositions |
CN1751037A (zh) | 2003-02-14 | 2006-03-22 | 伊莱利利公司 | 作为ppar调节剂的磺酰胺衍生物 |
DE60329831D1 (de) * | 2003-06-10 | 2009-12-10 | Biondi Ricardo Miguel | Verwendung einer Verbingung gemäss Formel I zur Herstellung einer pharmazeutischen Zubereitung |
GB0314131D0 (en) * | 2003-06-18 | 2003-07-23 | Astrazeneca Ab | Therapeutic agents |
FR2856401B1 (fr) * | 2003-06-20 | 2010-02-12 | Galderma Res & Dev | Nouveaux composes modulateurs des recepteurs de type ppargamma et leur utilisation dans des compositions cosmetiques ou pharmaceutiques |
EP1638964B1 (en) | 2003-06-20 | 2011-07-27 | Galderma Research & Development | Novel compounds that modulate ppar-gamma type receptors, and use thereof in cosmetic or pharmaceutical compositions |
JP4795022B2 (ja) | 2003-09-30 | 2011-10-19 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | ヘテロ環化合物を含有する新規な抗真菌剤 |
US20050149414A1 (en) * | 2003-12-30 | 2005-07-07 | Kimberly-Clark Worldwide, Inc. | RFID system and method for managing out-of-stock items |
US20080125403A1 (en) | 2004-04-02 | 2008-05-29 | Merck & Co., Inc. | Method of Treating Men with Metabolic and Anthropometric Disorders |
JP2007536343A (ja) | 2004-05-05 | 2007-12-13 | ノボ ノルディスク アクティーゼルスカブ | Pparアゴニストとしてのフェノキシ酢酸誘導体 |
JP4981662B2 (ja) | 2004-05-05 | 2012-07-25 | ハイ・ポイント・ファーマスーティカルズ、エルエルシー | 新規の化合物、その製法と使用 |
ITMI20041032A1 (it) | 2004-05-24 | 2004-08-24 | Neuroscienze S C A R L | Compositi farmaceutici |
CA2575039A1 (en) | 2004-08-11 | 2006-02-16 | Kyorin Pharmaceutical Co., Ltd. | Novel cyclic amino benzoic acid derivative |
CA2575466A1 (en) * | 2004-08-13 | 2006-02-23 | Genentech, Inc. | Thiazole based inhibitors of atp-utilizing enzymes |
US7622491B2 (en) * | 2004-08-13 | 2009-11-24 | Metabolex Inc. | Modulators of PPAR and methods of their preparation |
US7829585B2 (en) | 2005-03-30 | 2010-11-09 | Eisai R&D Management Co., Ltd. | Antifungal agent containing pyridine derivative |
ES2449618T3 (es) | 2005-06-30 | 2014-03-20 | High Point Pharmaceuticals, Llc | Ácidos fenoxiacéticos como activadores de PPAR-delta |
ITRM20050389A1 (it) | 2005-07-22 | 2007-01-23 | Giuliani Spa | Composti e loro sali specifici per i recettori ppar ed i recettori per l'egf e loro uso in campo medico. |
WO2007030567A2 (en) * | 2005-09-07 | 2007-03-15 | Plexxikon, Inc. | Pparactive compounds |
TWI385169B (zh) | 2005-10-31 | 2013-02-11 | Eisai R&D Man Co Ltd | 經雜環取代之吡啶衍生物及含有彼之抗真菌劑 |
EA201101085A1 (ru) | 2005-12-22 | 2012-05-30 | ХАЙ ПОЙНТ ФАРМАСЬЮТИКАЛЗ, ЭлЭлСи | Феноксиуксусные кислоты в качестве активаторов ppar дельта |
KR101394245B1 (ko) * | 2005-12-30 | 2014-05-14 | 에스케이바이오팜 주식회사 | 아이속사졸 유도체 및 이의 용도 |
EP1999098A2 (en) | 2006-03-09 | 2008-12-10 | High Point Pharmaceuticals, LLC | Compounds that modulate ppar activity, their preparation and use |
WO2007147336A1 (en) * | 2006-06-13 | 2007-12-27 | Shanghai Institue Of Materia Medica, Chinese Academy Of Sciences | Heterocyclic non-nucleoside compounds, their peparation, pharmaceutical composition and their use as antiviral agents |
WO2008004341A1 (fr) * | 2006-07-03 | 2008-01-10 | The University Of Tokyo | DÉRIVÉS DE L'ACIDE PHÉNYLPROPIONIQUE SUBSTITUÉS EN α |
WO2008035726A1 (fr) | 2006-09-21 | 2008-03-27 | Eisai R & D Management Co., Ltd. | Dérivé de pyridine substitué par un cycle hétéroaryle, et agent antifongique le comprenant |
US7846953B2 (en) * | 2007-03-07 | 2010-12-07 | Janssen Pharmaceutica, Nv | Substituted phenoxy thiazolidinediones as estrogen related receptor-α modulators |
US20110021534A1 (en) * | 2007-03-08 | 2011-01-27 | Albireo Ab | 2 -substituted- 3 -phenylpropionic acid derivatives and their use in the treatment of inflammatory bowel disease |
TW200841879A (en) | 2007-04-27 | 2008-11-01 | Eisai R&D Man Co Ltd | Pyridine derivatives substituted by heterocyclic ring and phosphonoamino group, and anti-fungal agent containing same |
CN102702185A (zh) | 2007-04-27 | 2012-10-03 | 卫材R&D管理有限公司 | 杂环取代吡啶衍生物的盐的结晶 |
IE20070928A1 (en) * | 2007-12-21 | 2009-09-30 | Giuliani Int Ltd | Multi target ligands |
US8513287B2 (en) | 2007-12-27 | 2013-08-20 | Eisai R&D Management Co., Ltd. | Heterocyclic ring and phosphonoxymethyl group substituted pyridine derivatives and antifungal agent containing same |
DE102008018675A1 (de) * | 2008-04-14 | 2009-10-15 | Bayer Schering Pharma Aktiengesellschaft | Oxo-heterocyclisch substituierte Carbonsäure-Derivate und ihre Verwendung |
EA022417B1 (ru) * | 2008-10-21 | 2015-12-30 | Саймабэй Терапевтикс, Инк. | Арильные агонисты рецептора gpr120 и их применение |
CN102264228A (zh) | 2008-10-22 | 2011-11-30 | 默沙东公司 | 用于抗糖尿病药的新的环状苯并咪唑衍生物 |
US8188119B2 (en) | 2008-10-24 | 2012-05-29 | Eisai R&D Management Co., Ltd | Pyridine derivatives substituted with heterocyclic ring and γ-glutamylamino group, and antifungal agents containing same |
CA2741672A1 (en) | 2008-10-31 | 2010-05-06 | Merck Sharp & Dohme Corp. | Novel cyclic benzimidazole derivatives useful anti-diabetic agents |
ES2549005T3 (es) * | 2008-11-21 | 2015-10-22 | Raqualia Pharma Inc | Nuevo derivado de pirazol-3-carboxamida que tiene actividad antagonista del receptor 5-HT2B |
UA107562C2 (uk) | 2008-12-05 | 2015-01-26 | Спосіб лікування псоріазу | |
DK2396081T3 (en) | 2009-02-16 | 2017-07-10 | Nogra Pharma Ltd | Alkylamide compounds and applications |
DE102009012314A1 (de) | 2009-03-09 | 2010-09-16 | Bayer Schering Pharma Aktiengesellschaft | Oxo-heterocyclisch substituierte Alkylcarbonsäuren und ihre Verwendung |
JP2012162460A (ja) * | 2009-05-27 | 2012-08-30 | Nippon Soda Co Ltd | 含窒素ヘテロアリール誘導体および農園芸用殺菌剤 |
DE102009046115A1 (de) | 2009-10-28 | 2011-09-08 | Bayer Schering Pharma Aktiengesellschaft | Substituierte 3-Phenylpropansäuren und ihre Verwendung |
JP2013520502A (ja) | 2010-02-25 | 2013-06-06 | メルク・シャープ・エンド・ドーム・コーポレイション | 有用な抗糖尿病薬である新規な環状ベンズイミダゾール誘導体 |
WO2012027331A1 (en) | 2010-08-27 | 2012-03-01 | Ironwood Pharmaceuticals, Inc. | Compositions and methods for treating or preventing metabolic syndrome and related diseases and disorders |
DE202011111014U1 (de) | 2010-11-05 | 2018-05-02 | Senomyx, Inc. | Verbindungen, die als Modulatoren von TRPM8 nützlich sind |
DE102011006974A1 (de) | 2011-04-07 | 2012-10-11 | Bayer Pharma Aktiengesellschaft | Substituierte 1-Benzylcycloalkylcarbonsäuren und ihre Verwendung |
AU2011340721A1 (en) | 2010-12-07 | 2013-06-20 | Bayer Intellectual Property Gmbh | Substituted 1-benzylcycloalkylcarboxlic acids and use thereof |
DE102010062544A1 (de) | 2010-12-07 | 2012-06-14 | Bayer Schering Pharma Aktiengesellschaft | Substituierte 1-Benzylcycloalkylcarbonsäuren und ihre Verwendung |
EA201690035A1 (ru) | 2011-02-25 | 2016-05-31 | Мерк Шарп Энд Домэ Корп. | Новые циклические производные азабензимидазола, используемые в качестве антидиабетических агентов |
DE102011007272A1 (de) | 2011-04-13 | 2012-10-18 | Bayer Pharma Aktiengesellschaft | Verzweigte 3-Phenylpropionsäure-Derivate und ihre Verwendung |
JP2014517032A (ja) * | 2011-06-13 | 2014-07-17 | パナセア バイオテック リミテッド | 新規のsglt阻害剤 |
BR112014019399A2 (pt) | 2012-02-09 | 2017-07-04 | Nogra Pharma Ltd | métodos de tratamento da fibrose |
WO2013156413A1 (en) | 2012-04-18 | 2013-10-24 | Nogra Pharma Limited | Methods of treating lactose intolerance |
DE102012208530A1 (de) | 2012-05-22 | 2013-11-28 | Bayer Pharma AG | Substituierte Piperidinoacetamide und ihre Verwendung |
AU2013296470B2 (en) | 2012-08-02 | 2016-03-17 | Merck Sharp & Dohme Corp. | Antidiabetic tricyclic compounds |
MX2015010935A (es) | 2013-02-22 | 2015-10-29 | Merck Sharp & Dohme | Compuestos biciclicos antidiabeticos. |
WO2014139388A1 (en) | 2013-03-14 | 2014-09-18 | Merck Sharp & Dohme Corp. | Novel indole derivatives useful as anti-diabetic agents |
CA2923422C (en) | 2013-09-09 | 2021-09-07 | Vtv Therapeutics Llc | Use of a ppar-delta agonist for treating muscle atrophy |
WO2015046317A1 (ja) * | 2013-09-30 | 2015-04-02 | 国立大学法人岡山大学 | 新規アセチレンアミド誘導体 |
WO2015051496A1 (en) | 2013-10-08 | 2015-04-16 | Merck Sharp & Dohme Corp. | Antidiabetic tricyclic compounds |
MX370410B (es) | 2013-12-18 | 2019-12-11 | Glaxosmithkline Ip Dev Ltd | Reguladores de nrf2. |
JP6786527B2 (ja) | 2015-06-15 | 2020-11-18 | グラクソスミスクライン、インテレクチュアル、プロパティー、ディベロップメント、リミテッドGlaxosmithkline Intellectual Property Development Limited | Nrf2レギュレーター |
HRP20240666T1 (hr) | 2015-06-15 | 2024-08-16 | Glaxosmithkline Intellectual Property Development Limited | Nrf2 regulatori |
EP3356356B1 (en) | 2015-10-01 | 2021-05-26 | Firmenich Incorporated | Compounds useful as modulators of trpm8 |
EP3359532A1 (en) | 2015-10-06 | 2018-08-15 | GlaxoSmithKline Intellectual Property Development Limited | Biaryl pyrazoles as nrf2 regulators |
US11072602B2 (en) | 2016-12-06 | 2021-07-27 | Merck Sharp & Dohme Corp. | Antidiabetic heterocyclic compounds |
EP3558298A4 (en) | 2016-12-20 | 2020-08-05 | Merck Sharp & Dohme Corp. | ANTIDIABETIC SPIROCHROMAN COMPOUNDS |
US10905667B2 (en) | 2018-07-24 | 2021-02-02 | Bayer Pharma Aktiengesellschaft | Orally administrable modified-release pharmaceutical dosage form |
MA54823A (fr) | 2019-01-24 | 2022-04-27 | Takeda Pharmaceuticals Co | Composé hétérocyclique et son utilisation |
DK3921299T3 (da) | 2019-02-08 | 2025-01-27 | Nogra Pharma Ltd | Proces til fremstilling af 3-(4'-aminophenyl)-2-methoxypropionsyre samt analoger og intermediater deraf |
WO2023147309A1 (en) | 2022-01-25 | 2023-08-03 | Reneo Pharmaceuticals, Inc. | Use of ppar-delta agonists in the treatment of disease |
Family Cites Families (29)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CH480070A (de) * | 1967-03-01 | 1969-10-31 | Eprova Ag | Röntgenkontrastmittel |
ES419319A1 (es) * | 1973-10-04 | 1976-03-01 | Gallardo Antonio Sa | Un procedimiento para la obtencion de derivados de acidos 3-benzoilfenilalcanoicos. |
JPS5111748A (en) * | 1974-07-16 | 1976-01-30 | Taisho Pharmaceutical Co Ltd | Suchirubenjudotaino seizoho |
JPS51149240A (en) * | 1975-06-17 | 1976-12-22 | Mitsubishi Yuka Yakuhin Kk | Process for preparing new 3-substituted aminophenylacetic acid derivat ives |
DE3026402A1 (de) * | 1980-07-11 | 1982-02-04 | Syntex Corp., Palo Alto, Calif. | Die verwendung analgetischer und nicht-hormonaler, entzuendungshemmender mittel bei der behandlung von mikrovaskulaeren erkrankungen |
JPS5764655A (en) * | 1980-10-04 | 1982-04-19 | Nippon Zoki Pharmaceut Co Ltd | Novel benzoylaminophenylcarboxylic acid derivative, its preparation, and drug composition comprising it |
FR2653119B1 (fr) * | 1989-10-18 | 1994-08-05 | Lipha | Nouveaux aryloxy alcoyl benzenes, leurs procedes de preparation et les compositions pharmaceutiques en renfermant. |
TW204343B (ko) | 1991-05-31 | 1993-04-21 | Sumitomo Pharmaceutics Co Ltd | |
US5783593A (en) * | 1993-11-04 | 1998-07-21 | Abbott Laboratories | Inhibitors of squalene synthetase and protein farnesyltransferase |
ES2103181B1 (es) * | 1994-08-01 | 1998-04-01 | Menarini Lab | Amidas naftalenicas con accion antagonista de los leucotrienos. |
CN1130355C (zh) * | 1995-04-04 | 2003-12-10 | 德州生物科技公司 | 调理内皮肽活性的噻吩基-、呋喃基-、吡咯基-与联苯磺酰胺及其衍生物 |
JP3144624B2 (ja) | 1995-06-02 | 2001-03-12 | 杏林製薬株式会社 | N−ベンジルジオキソチアゾリジルベンズアミド誘導体及びその製造法 |
FR2736914B1 (fr) * | 1995-07-21 | 1997-08-22 | Adir | Nouveaux derives d'acide aminophenylphosphonique, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
AU712467B2 (en) * | 1995-09-18 | 1999-11-04 | Sankyo Company Limited | New urea derivatives having ACAT inhibitory activity, their preparation and their therapeutic and prophylactic use |
ATE204857T1 (de) | 1996-03-29 | 2001-09-15 | Searle & Co | Meta-substituierte phenylenderivate und ihre verwendung als alphavbeta3 intergrin-antagonisten oder inhibitoren |
SK286662B6 (sk) * | 1996-04-23 | 2009-03-05 | Vertex Pharmaceuticals Incorporated | Deriváty močoviny, farmaceutické prostriedky, ktoré ich obsahujú, a ich použitie ako inhibítorov aktivity IMPDH enzýmu |
ES2320181T3 (es) | 1997-07-24 | 2009-05-19 | Astellas Pharma Inc. | Composiciones farmaceuticas que tienen un efecto reductor del colesterol. |
WO1999018066A1 (fr) | 1997-10-02 | 1999-04-15 | Sankyo Company, Limited | Derives d'acide amidocarboxylique |
UA67754C2 (uk) | 1997-10-10 | 2004-07-15 | Пфайзер, Інк. | Агоністи простагландину, фармацевтична композиція на їх основі (варіанти), спосіб нарощення та збереження кісткової маси у хребетних та спосіб лікування (варіанти) |
CN1302206A (zh) * | 1997-10-17 | 2001-07-04 | 阿温蒂斯药物制品公司 | 喹啉衍生物的治疗用途 |
TW577758B (en) | 1997-10-27 | 2004-03-01 | Ssp Co Ltd | Intra-articular preparation for the treatment of arthropathy |
WO1999046232A1 (fr) * | 1998-03-10 | 1999-09-16 | Ono Pharmaceutical Co., Ltd. | Derives d'acide carboxylique et medicaments contenant ces derives comme principe actif |
IT1311923B1 (it) * | 1999-04-13 | 2002-03-20 | Nicox Sa | Composti farmaceutici. |
DK1177187T3 (da) * | 1999-04-28 | 2007-10-15 | Sanofi Aventis Deutschland | Diarylsyrederivater som PPAR-receptorligander |
JP4618845B2 (ja) * | 1999-06-09 | 2011-01-26 | 杏林製薬株式会社 | ヒトペルオキシゾーム増殖薬活性化受容体(PPAR)αアゴニストとしての置換フェニルプロピオン酸誘導体 |
DE60020381T2 (de) * | 1999-08-23 | 2006-01-26 | Kyorin Pharmaceutical Co., Ltd. | Substituierte benzylthiazolidin-2,4-dion-derivate |
CN1167691C (zh) * | 1999-08-23 | 2004-09-22 | 杏林制药株式会社 | 取代的苄基噻唑烷-2,4-二酮衍生物 |
WO2001016097A1 (en) * | 1999-08-27 | 2001-03-08 | Sugen, Inc. | Phosphate mimics and methods of treatment using phosphatase inhibitors |
EP1219595B1 (en) * | 1999-09-17 | 2006-01-18 | Kyorin Pharmaceutical Co., Ltd. | O-anisamide derivatives |
-
2000
- 2000-09-28 TW TW089120087A patent/TWI262185B/zh not_active IP Right Cessation
- 2000-09-29 JP JP2001528131A patent/JP4571766B2/ja not_active Expired - Fee Related
- 2000-09-29 AU AU74499/00A patent/AU776267B2/en not_active Ceased
- 2000-09-29 NZ NZ517719A patent/NZ517719A/en not_active IP Right Cessation
- 2000-09-29 CN CNB008137218A patent/CN1228327C/zh not_active Expired - Fee Related
- 2000-09-29 WO PCT/JP2000/006788 patent/WO2001025181A1/ja active IP Right Grant
- 2000-09-29 CA CA2385081A patent/CA2385081C/en not_active Expired - Fee Related
- 2000-09-29 EP EP00962993A patent/EP1216980A4/en not_active Withdrawn
- 2000-09-29 KR KR1020027004232A patent/KR100694686B1/ko not_active Expired - Fee Related
- 2000-09-29 US US10/088,916 patent/US6884821B1/en not_active Expired - Fee Related
Also Published As
Publication number | Publication date |
---|---|
CA2385081C (en) | 2010-02-16 |
EP1216980A1 (en) | 2002-06-26 |
CA2385081A1 (en) | 2001-04-12 |
AU7449900A (en) | 2001-05-10 |
CN1228327C (zh) | 2005-11-23 |
CN1377336A (zh) | 2002-10-30 |
NZ517719A (en) | 2004-10-29 |
JP4571766B2 (ja) | 2010-10-27 |
AU776267B2 (en) | 2004-09-02 |
US6884821B1 (en) | 2005-04-26 |
WO2001025181A1 (fr) | 2001-04-12 |
TWI262185B (en) | 2006-09-21 |
KR100694686B1 (ko) | 2007-04-23 |
EP1216980A4 (en) | 2010-12-08 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR100694686B1 (ko) | 카르본산 유도체 및 그 유도체로 이루어지는 의약 | |
US7687664B2 (en) | Carboxylic acid derivative, a salt thereof or an ester of them, and medicament comprising it | |
JPWO2002080899A1 (ja) | 消化器疾患治療剤 | |
CA2442319C (en) | Carboxylic acid derivative and salt thereof | |
DE60216094T2 (de) | Modulatoren der peroxisom-proliferator-aktivierten rezeptoren (ppar) | |
US7371777B2 (en) | Cyclic compound and PPAR agonist | |
JP3490704B2 (ja) | チアゾールおよびオキサゾール誘導体ならびにそれらの医薬的使用 | |
US6506757B1 (en) | Carboxylic acid derivatives and drugs containing the same as the active ingredient | |
JP4549021B2 (ja) | ベンゼン化合物およびその塩 | |
AU758758B2 (en) | Substituted oxazoles and thiazoles derivatives as HPPAR alpha activators | |
CN101007804B (zh) | 1,3-苯并间二氧杂环戊烯-2,2-二羧酸衍生物、其制备方法和医疗用途 | |
WO2003004458A1 (en) | New compounds | |
KR20080040046A (ko) | 티아졸 유도체 | |
JP2004182657A (ja) | Hdlレベル上昇促進剤 | |
JPWO2002046176A1 (ja) | ペルオキシソーム増殖剤応答性受容体の活性化剤 | |
JP3491635B2 (ja) | ジヒドロナフタレン誘導体化合物およびその化合物を有効成分とする薬剤 | |
KR20090077091A (ko) | 신규 퍼옥시좀 증식자-활성화 수용체 효능제인 화합물 및그 제조방법 | |
ES2352071T3 (es) | Derivados de tirosina sustituidos con n-fenilacroloilo como agonostas de hppar alfa y de hppar gama. | |
JP4062204B2 (ja) | ジヒドロナフタレン誘導体化合物およびその化合物を有効成分とする薬剤 | |
AU2002316105A1 (en) | Modulators of peroxisome proliferator activated receptors (PPAR) |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PA0105 | International application |
Patent event date: 20020401 Patent event code: PA01051R01D Comment text: International Patent Application |
|
PG1501 | Laying open of application | ||
A201 | Request for examination | ||
PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20050412 Comment text: Request for Examination of Application |
|
E902 | Notification of reason for refusal | ||
PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20060718 Patent event code: PE09021S01D |
|
E701 | Decision to grant or registration of patent right | ||
PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20061213 |
|
N231 | Notification of change of applicant | ||
PN2301 | Change of applicant |
Patent event date: 20070221 Comment text: Notification of Change of Applicant Patent event code: PN23011R01D |
|
GRNT | Written decision to grant | ||
PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20070307 Patent event code: PR07011E01D |
|
PR1002 | Payment of registration fee |
Payment date: 20070308 End annual number: 3 Start annual number: 1 |
|
PG1601 | Publication of registration | ||
PR1001 | Payment of annual fee |
Payment date: 20100303 Start annual number: 4 End annual number: 4 |
|
FPAY | Annual fee payment |
Payment date: 20110302 Year of fee payment: 5 |
|
PR1001 | Payment of annual fee |
Payment date: 20110302 Start annual number: 5 End annual number: 5 |
|
LAPS | Lapse due to unpaid annual fee | ||
PC1903 | Unpaid annual fee |
Termination category: Default of registration fee Termination date: 20130209 |