HU200355B - Process for producing thiophene dyes - Google Patents
Process for producing thiophene dyes Download PDFInfo
- Publication number
- HU200355B HU200355B HU861974A HU197486A HU200355B HU 200355 B HU200355 B HU 200355B HU 861974 A HU861974 A HU 861974A HU 197486 A HU197486 A HU 197486A HU 200355 B HU200355 B HU 200355B
- Authority
- HU
- Hungary
- Prior art keywords
- alkoxy
- alkyl
- cyano
- formula
- blue
- Prior art date
Links
- 239000000975 dye Substances 0.000 title claims description 40
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 title claims description 30
- 238000000034 method Methods 0.000 title claims description 17
- 229930192474 thiophene Natural products 0.000 title claims description 15
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 104
- -1 phenoxy, phenylthio Chemical group 0.000 claims description 66
- 150000001875 compounds Chemical class 0.000 claims description 52
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 29
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 29
- 239000000460 chlorine Substances 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- 238000005859 coupling reaction Methods 0.000 claims description 21
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 16
- 239000012954 diazonium Substances 0.000 claims description 16
- 150000001989 diazonium salts Chemical class 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 13
- 230000008878 coupling Effects 0.000 claims description 11
- 238000010168 coupling process Methods 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000003577 thiophenes Chemical class 0.000 claims 5
- 239000007858 starting material Substances 0.000 claims 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 125000004760 (C1-C4) alkylsulfonylamino group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000003830 C1- C4 alkylcarbonylamino group Chemical group 0.000 claims 1
- 125000005236 alkanoylamino group Chemical group 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims 1
- 210000003734 kidney Anatomy 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 58
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 40
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 39
- 229920000728 polyester Polymers 0.000 description 33
- 239000002904 solvent Substances 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 230000007935 neutral effect Effects 0.000 description 14
- 239000000835 fiber Substances 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 239000010981 turquoise Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 9
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 9
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 244000172533 Viola sororia Species 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 235000005811 Viola adunca Nutrition 0.000 description 6
- 235000013487 Viola odorata Nutrition 0.000 description 6
- 235000002254 Viola papilionacea Nutrition 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 238000004040 coloring Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- XIZSUYSWKGAOCN-UHFFFAOYSA-N 2-amino-4-chloro-5-formylthiophene-3-carbonitrile Chemical compound NC=1SC(C=O)=C(Cl)C=1C#N XIZSUYSWKGAOCN-UHFFFAOYSA-N 0.000 description 4
- 244000154870 Viola adunca Species 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000000987 azo dye Substances 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 150000002440 hydroxy compounds Chemical class 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 3
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 3
- 235000019239 indanthrene blue RS Nutrition 0.000 description 3
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 3
- 238000010409 ironing Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- SOCAXRLFGRNEPK-IFZYUDKTSA-N (1r,3s,5r)-2-n-[1-carbamoyl-5-(cyanomethoxy)indol-3-yl]-3-n-[(3-chloro-2-fluorophenyl)methyl]-2-azabicyclo[3.1.0]hexane-2,3-dicarboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)NC1=CN(C2=CC=C(OCC#N)C=C21)C(=O)N)NCC1=CC=CC(Cl)=C1F SOCAXRLFGRNEPK-IFZYUDKTSA-N 0.000 description 2
- BRFNXVWZHLIPSR-UHFFFAOYSA-N (3-amino-4-anilino-4-oxobutyl) acetate Chemical compound C(C)(=O)OCCC(C(=O)NC1=CC=CC=C1)N BRFNXVWZHLIPSR-UHFFFAOYSA-N 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- MFRQKYMUZZIFRF-UHFFFAOYSA-N 1-amino-7-(7-amino-4-hydroxyheptoxy)heptan-4-ol Chemical compound NCCCC(O)CCCOCCCC(O)CCCN MFRQKYMUZZIFRF-UHFFFAOYSA-N 0.000 description 2
- GLPGCRHJWSLGPH-UHFFFAOYSA-N 2-amino-4-(benzenesulfonyl)-5-formylthiophene-3-carbonitrile Chemical compound N#CC1=C(N)SC(C=O)=C1S(=O)(=O)C1=CC=CC=C1 GLPGCRHJWSLGPH-UHFFFAOYSA-N 0.000 description 2
- XNINAOUGJUYOQX-UHFFFAOYSA-N 2-cyanobutanoic acid Chemical compound CCC(C#N)C(O)=O XNINAOUGJUYOQX-UHFFFAOYSA-N 0.000 description 2
- DETXZQGDWUJKMO-UHFFFAOYSA-N 2-hydroxymethanesulfonic acid Chemical compound OCS(O)(=O)=O DETXZQGDWUJKMO-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- AORAGQDTUKSAOP-UHFFFAOYSA-N N',N'-dibutyl-N-phenylacetohydrazide Chemical compound C(CCC)N(N(C1=CC=CC=C1)C(C)=O)CCCC AORAGQDTUKSAOP-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 240000009038 Viola odorata Species 0.000 description 2
- DJACTCNGCHPGOI-UHFFFAOYSA-N butyl 2-cyanoacetate Chemical compound CCCCOC(=O)CC#N DJACTCNGCHPGOI-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- LZDSILRDTDCIQT-UHFFFAOYSA-N dinitrogen trioxide Chemical compound [O-][N+](=O)N=O LZDSILRDTDCIQT-UHFFFAOYSA-N 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- UIMIQJVANYZMKL-UHFFFAOYSA-N n-phenylacetohydrazide Chemical compound CC(=O)N(N)C1=CC=CC=C1 UIMIQJVANYZMKL-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- BNJMRELGMDUDDB-UHFFFAOYSA-N $l^{1}-sulfanylbenzene Chemical compound [S]C1=CC=CC=C1 BNJMRELGMDUDDB-UHFFFAOYSA-N 0.000 description 1
- RBSQDXIVISSZSM-UHFFFAOYSA-N 2-amino-4-ethoxy-5-formylthiophene-3-carbonitrile Chemical compound CCOC1=C(C=O)SC(N)=C1C#N RBSQDXIVISSZSM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ODMRBRUDPUNEHF-UHFFFAOYSA-N 6-amino-2-chloro-4-methylpyridine-3-carbonitrile Chemical compound CC1=CC(N)=NC(Cl)=C1C#N ODMRBRUDPUNEHF-UHFFFAOYSA-N 0.000 description 1
- 244000153158 Ammi visnaga Species 0.000 description 1
- 235000010585 Ammi visnaga Nutrition 0.000 description 1
- 241000974482 Aricia saepiolus Species 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- LVDRREOUMKACNJ-BKMJKUGQSA-N N-[(2R,3S)-2-(4-chlorophenyl)-1-(1,4-dimethyl-2-oxoquinolin-7-yl)-6-oxopiperidin-3-yl]-2-methylpropane-1-sulfonamide Chemical compound CC(C)CS(=O)(=O)N[C@H]1CCC(=O)N([C@@H]1c1ccc(Cl)cc1)c1ccc2c(C)cc(=O)n(C)c2c1 LVDRREOUMKACNJ-BKMJKUGQSA-N 0.000 description 1
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 1
- 241000083869 Polyommatus dorylas Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 235000003095 Vaccinium corymbosum Nutrition 0.000 description 1
- 240000000851 Vaccinium corymbosum Species 0.000 description 1
- 235000017537 Vaccinium myrtillus Nutrition 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 235000021014 blueberries Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical class [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylphenylamine Natural products CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- NSWXAQTZQHOPHG-UHFFFAOYSA-N ethyl 3-(5-amino-3-chloro-4-cyanothiophen-2-yl)-2-cyanoprop-2-enoate Chemical compound CCOC(=O)C(C#N)=CC=1SC(N)=C(C#N)C=1Cl NSWXAQTZQHOPHG-UHFFFAOYSA-N 0.000 description 1
- ZTAIRJQXUBNKLT-UHFFFAOYSA-N ethyl 3-(5-amino-4-cyano-3-ethoxythiophen-2-yl)-2-cyanoprop-2-enoate Chemical compound CCOC(=O)C(C#N)=CC=1SC(N)=C(C#N)C=1OCC ZTAIRJQXUBNKLT-UHFFFAOYSA-N 0.000 description 1
- LFVPBERIVUNMGV-UHFFFAOYSA-N fasudil hydrochloride Chemical compound Cl.C=1C=CC2=CN=CC=C2C=1S(=O)(=O)N1CCCNCC1 LFVPBERIVUNMGV-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- JLMZCIJWDPOEDN-UHFFFAOYSA-N methyl 2-acetamido-4,5-dibromothiophene-3-carboxylate Chemical compound COC(=O)C1=C(NC(C)=O)SC(Br)=C1Br JLMZCIJWDPOEDN-UHFFFAOYSA-N 0.000 description 1
- FPUKYOSOAAPHTN-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]acetamide Chemical compound CCN(CC)C1=CC=CC(NC(C)=O)=C1 FPUKYOSOAAPHTN-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical group NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- CHLCPTJLUJHDBO-UHFFFAOYSA-M sodium;benzenesulfinate Chemical compound [Na+].[O-]S(=O)C1=CC=CC=C1 CHLCPTJLUJHDBO-UHFFFAOYSA-M 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- YXZRCLVVNRLPTP-UHFFFAOYSA-J turquoise blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Cu+2].NC1=NC(Cl)=NC(NC=2C=C(NS(=O)(=O)C3=CC=4C(=C5NC=4NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)NC=4NC(=C6C=C(C=CC6=4)S([O-])(=O)=O)NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)N5)C=C3)C(=CC=2)S([O-])(=O)=O)=N1 YXZRCLVVNRLPTP-UHFFFAOYSA-J 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0059—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing only sulfur as heteroatom
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/02—Monoazo dyes prepared by diazotising and coupling from diazotised o-amino-hydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853517365 DE3517365A1 (de) | 1985-05-14 | 1985-05-14 | Farbstoffe mit thiophenresten |
| DE19853533546 DE3533546A1 (de) | 1985-09-20 | 1985-09-20 | Heterocyclische azofarbstoffe |
| DE19853535133 DE3535133A1 (de) | 1985-10-02 | 1985-10-02 | Farbstoffe mit thiophenresten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT42795A HUT42795A (en) | 1987-08-28 |
| HU200355B true HU200355B (en) | 1990-05-28 |
Family
ID=27193111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU861974A HU200355B (en) | 1985-05-14 | 1986-05-13 | Process for producing thiophene dyes |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5352774A (member.php) |
| EP (1) | EP0201896B1 (member.php) |
| KR (1) | KR940000659B1 (member.php) |
| AU (1) | AU594338B2 (member.php) |
| BR (1) | BR8602155A (member.php) |
| CA (1) | CA1269656A (member.php) |
| DE (1) | DE3670857D1 (member.php) |
| ES (1) | ES8705010A1 (member.php) |
| HU (1) | HU200355B (member.php) |
| IN (1) | IN167384B (member.php) |
| PT (1) | PT82579B (member.php) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH664762A5 (de) * | 1984-08-30 | 1988-03-31 | Sandoz Ag | Thiophen-azofarbstoffe. |
| DE3528759A1 (de) * | 1985-08-10 | 1987-02-19 | Basf Ag | Heterocyclische azofarbstoffe |
| DE3718565A1 (de) * | 1987-06-03 | 1988-12-15 | Basf Ag | Verfahren zur herstellung von aetzdrucken |
| DE3734586A1 (de) * | 1987-10-13 | 1989-05-03 | Basf Ag | Marineblaue und schwarze farbstoffmischungen |
| DE3738374A1 (de) * | 1987-11-12 | 1989-05-24 | Basf Ag | Thien-3-ylazofarbstoffe und ihre verwendung |
| DE3818404A1 (de) * | 1988-05-31 | 1989-12-07 | Basf Ag | Verfahren zur uebertragung von azofarbstoffen |
| DE3833442A1 (de) * | 1988-10-01 | 1990-04-12 | Basf Ag | Thiophenazofarbstoffe mit einer kupplungskomponente aus der thiazolreihe |
| US5216139A (en) * | 1988-10-01 | 1993-06-01 | Basf Aktiengesellschaft | Thiopheneazo dye based on a coupling component of the thiazole series |
| DE3902005A1 (de) * | 1989-01-25 | 1990-07-26 | Basf Ag | Thiophenazofarbstoffe mit einer kupplungskomponente auf basis von m-phenylendiamin |
| DE3906632A1 (de) * | 1989-03-02 | 1990-09-06 | Basf Ag | Verfahren zur abtrennung von thiaminmonophosphat aus einer loesung von thiaminphosphaten |
| DE3911950A1 (de) * | 1989-04-12 | 1990-10-18 | Basf Ag | Marineblaue und schwarze farbstoffmischungen |
| DE3911949A1 (de) * | 1989-04-12 | 1990-10-18 | Basf Ag | Neue marineblaue und schwarze farbstoffmischungen |
| DE4021960A1 (de) * | 1990-07-10 | 1992-01-16 | Basf Ag | Thiophenazofarbstoffe |
| DE69209725T2 (de) * | 1991-06-11 | 1996-10-31 | Dystar Japan Ltd | Monoazofarbstoff |
| DE4132685A1 (de) * | 1991-10-01 | 1993-04-08 | Basf Ag | Azofarbstoffe enthaltende polymerisate |
| DE4138550A1 (de) * | 1991-11-23 | 1993-05-27 | Basf Ag | Thiophenazofarbstoffe mit einer kupplungskomponente aus der diaminopyridinreihe |
| DE4215495A1 (de) * | 1992-05-12 | 1993-11-18 | Basf Ag | Azofarbstoffe mit einer acetalisierten Diazokomponente aus der Thiophen- oder Thiazolreihe |
| JP3165745B2 (ja) * | 1992-07-13 | 2001-05-14 | ダイスタージャパン株式会社 | モノアゾ分散染料およびその混合物 |
| DE4232557A1 (de) | 1992-09-29 | 1994-03-31 | Basf Ag | Verwendung von Pyridinfarbstoffen im textilen Bereich, Farbstoffmischungen, enthaltend Pyridinfarbstoffe, sowie Triazolopyridinfarbstoffe mit einem Thienylrest |
| EP0601439B1 (de) * | 1992-12-07 | 1999-07-07 | BASF Aktiengesellschaft | Farbstoffmischungen, enthaltend Azofarbstoffe mit einer Kupplungskomponente aus der Diaminopyridinreihe |
| DE4305650C1 (de) * | 1993-02-25 | 1994-07-28 | Basf Ag | Verfahren zur Herstellung von (3-Cyano-4-chlor-5-formylthien-2-ylazo)anilinen |
| DE4321166A1 (de) * | 1993-06-25 | 1995-01-05 | Basf Ag | Verknüpfte Azofarbstoffe |
| DE4335496A1 (de) * | 1993-10-19 | 1995-04-20 | Basf Ag | Diphenylaminverbindungen |
| DE4432833A1 (de) * | 1994-09-15 | 1996-03-21 | Basf Ag | Verfahren zum Färben von Melamin-Formaldehyd-Kondensationsprodukten |
| KR960031548A (ko) * | 1995-02-20 | 1996-09-17 | 고사이 아키오 | 모노아조 화합물 및 이 화합물을 사용하는 소수성 섬유재료의 염색 또는 날염방법 |
| EP0794068A1 (en) * | 1996-03-09 | 1997-09-10 | Agfa-Gevaert N.V. | Dyes and dye-donor elements for thermal dye transfer recording |
| DE19611351A1 (de) | 1996-03-22 | 1997-09-25 | Basf Ag | Farbstoffmischungen, enthaltend Thienyl- und/oder Thiazolazofarbstoffe |
| DE19638797A1 (de) * | 1996-09-20 | 1998-03-26 | Basf Ag | Verfahren zur Herstellung von Pigmentteilchen definierter Form und Größe |
| CN1245516A (zh) | 1996-11-27 | 2000-02-23 | 伊斯曼化学公司 | 制备吸光聚合物组合物的方法 |
| DE19754025A1 (de) | 1997-12-05 | 1999-06-10 | Basf Ag | Farbstoffzubereitungen, enthaltend Azofarbstoffe |
| ES2491104T3 (es) | 2010-04-29 | 2014-09-05 | Unilever N.V. | Colorantes azoicos bis heterocíclicos |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3998802A (en) * | 1970-12-19 | 1976-12-21 | Basf Aktiengesellschaft | Azo dye with a 3-cyano- or 3-carbamoyl-4-methyl-2,6-diamino-pyridine coupling component |
| GB1394364A (en) * | 1971-06-15 | 1975-05-14 | Energy Equipment Co Ltd Burrow | Hydrocarbon fuel combustion appliances and safety devices therefor |
| CH596263A5 (member.php) * | 1972-03-10 | 1978-03-15 | Basf Ag | |
| US4264495A (en) * | 1972-05-15 | 1981-04-28 | Eastman Kodak Company | 2-Thienyl azo dyestuff compounds |
| NL7309098A (member.php) * | 1972-07-04 | 1974-01-08 | ||
| US4092329A (en) * | 1972-12-01 | 1978-05-30 | Sandoz Ltd. | Process for the synthesis of certain 2-amino-5-cyanothiophenes |
| GB1436176A (en) * | 1973-07-10 | 1976-05-19 | Sandoz Ltd | Mono-azo compounds useful as disperse dyestuffs |
| GB1578733A (en) * | 1977-05-23 | 1980-11-05 | Ici Ltd | Halogen- and cyano-containing mono-azo dyestuff compositions |
| GB2011937B (en) * | 1977-12-29 | 1982-03-24 | Ici Ltd | Disperse monoazo dyestuffs |
| US4255326A (en) * | 1979-03-30 | 1981-03-10 | Eastman Kodak Company | Nitrogen and/or sulfur containing heterocyclic azo dyes with aniline, tetrahydroquinoline and benzomorpholine couplers having sulfate group |
| JPS56143245A (en) * | 1980-04-10 | 1981-11-07 | Nippon Kayaku Co Ltd | Water-insoluble azo compound, production thereof and dyeing method employing the same |
| GB2125424A (en) * | 1982-08-05 | 1984-03-07 | Kodak Ltd | Acid dyes from acid substituted 2-aminothiophenes and aniline, tetrahydroquinoline, and benzomorpholine couplers |
| JPS59204658A (ja) | 1983-05-09 | 1984-11-20 | Gosei Senriyou Gijutsu Kenkyu Kumiai | 水不溶性モノアゾ化合物及びそれを用いる疎水性繊維の染色又は捺染法 |
| JPS60166345A (ja) * | 1984-02-08 | 1985-08-29 | Mitsui Toatsu Chem Inc | 合成繊維用モノアゾ分散染料 |
| JPS60226556A (ja) * | 1984-04-24 | 1985-11-11 | Nippon Kayaku Co Ltd | 水不溶性モノアゾ化合物及びそれを用いる染色法 |
| US4507407A (en) * | 1984-06-25 | 1985-03-26 | Milliken Research Corporation | Process for in situ coloration of thermosetting resins |
| DE3427200A1 (de) * | 1984-07-24 | 1986-01-30 | Basf Ag, 6700 Ludwigshafen | Methinfarbstoffe |
| CH664762A5 (de) * | 1984-08-30 | 1988-03-31 | Sandoz Ag | Thiophen-azofarbstoffe. |
| DE3528759A1 (de) * | 1985-08-10 | 1987-02-19 | Basf Ag | Heterocyclische azofarbstoffe |
| DE3615093A1 (de) * | 1986-05-03 | 1987-11-05 | Basf Ag | Diaminopyridin-azofarbstoffe mit acyloxy-resten |
| DE3622136A1 (de) * | 1986-07-02 | 1988-01-07 | Basf Ag | Thienothiophenfarbstoffe |
| DE3622297A1 (de) * | 1986-07-03 | 1988-01-07 | Basf Ag | Disazothiophenfarbstoffe |
| DE3637438A1 (de) * | 1986-11-04 | 1988-05-05 | Basf Ag | Thiophengruppenhaltige azofarbstoffe |
| DE3738374A1 (de) * | 1987-11-12 | 1989-05-24 | Basf Ag | Thien-3-ylazofarbstoffe und ihre verwendung |
-
1986
- 1986-05-05 IN IN349/MAS/86A patent/IN167384B/en unknown
- 1986-05-12 EP EP86106413A patent/EP0201896B1/de not_active Expired - Lifetime
- 1986-05-12 AU AU57342/86A patent/AU594338B2/en not_active Ceased
- 1986-05-12 DE DE8686106413T patent/DE3670857D1/de not_active Expired - Lifetime
- 1986-05-13 BR BR8602155A patent/BR8602155A/pt unknown
- 1986-05-13 PT PT82579A patent/PT82579B/pt not_active IP Right Cessation
- 1986-05-13 CA CA000508974A patent/CA1269656A/en not_active Expired - Lifetime
- 1986-05-13 HU HU861974A patent/HU200355B/hu not_active IP Right Cessation
- 1986-05-14 ES ES554943A patent/ES8705010A1/es not_active Expired
- 1986-05-14 KR KR1019860003757A patent/KR940000659B1/ko not_active Expired - Fee Related
-
1993
- 1993-09-23 US US08/125,666 patent/US5352774A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| CA1269656A (en) | 1990-05-29 |
| HUT42795A (en) | 1987-08-28 |
| PT82579A (en) | 1986-06-01 |
| ES554943A0 (es) | 1987-04-16 |
| ES8705010A1 (es) | 1987-04-16 |
| KR860009004A (ko) | 1986-12-19 |
| PT82579B (pt) | 1988-07-01 |
| US5352774A (en) | 1994-10-04 |
| EP0201896A1 (de) | 1986-11-20 |
| DE3670857D1 (en) | 1990-06-07 |
| KR940000659B1 (ko) | 1994-01-26 |
| IN167384B (member.php) | 1990-10-20 |
| BR8602155A (pt) | 1987-01-13 |
| EP0201896B1 (de) | 1990-05-02 |
| AU5734286A (en) | 1986-11-20 |
| AU594338B2 (en) | 1990-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU200355B (en) | Process for producing thiophene dyes | |
| US4855413A (en) | Heterocyclic azo dyes containing cyanothiophene derivatives as diazo components and diaminopyridines as coupling components | |
| US5132411A (en) | Azo compounds having 2,4-disubstituted-3-halothienyl-5-diazo component radicals, dyeing processes therewith and substrates dyed therewith | |
| US3097198A (en) | Azo dyestuffs | |
| JPH07108954B2 (ja) | アシルオキシ基を有するジアミノピリジンアゾ染料 | |
| US4652634A (en) | Water-soluble monoazo compounds containing a N-(sulfoalkyl)-aniline coupling component and a fiber-reactive group of the vinylsulfonyl series in the phenyl or benzothiazole diazo component, suitable as fiber-reactive dyestuffs | |
| US4313731A (en) | Mono-azo compound, mono-azo dye and dyeing process for polyester fibers | |
| US4259237A (en) | Azo dyestuffs containing phenolic coupling group | |
| US4083844A (en) | Phenylazo orthocyano phenylazo or orthocyano phenylazo phenylazo containing dyestuffs | |
| US4874392A (en) | Monoazo dyes having a substituted 1,4-phenylene coupling component radical having one C8-14 alkyl group or moiety | |
| US4439362A (en) | Azo compounds having one or two 1,4-dioxanylmethoxycarbonyl-alkyl or -alkoxyalkyl groups | |
| US4465628A (en) | Azo dyes comprising a heterocyclic diazo component | |
| US4229345A (en) | (2-Chloro-4-cyanophenyl) (4-dialkylaminophenyl)-diazine dye useful for transfer printing | |
| US5691459A (en) | Disazo dyes containing two carbonylamino groups processes for their preparation and their use | |
| US4065447A (en) | Azo compounds having a 3-arylthio- or aliphaticthio-4-cyano- or alkoxycarbonyl-pyrazolyl-5 diazo component radical | |
| US5101021A (en) | 4-(5',6'- and 6',7'-dihalobenzothiazol-2'-ylazo)-3-methyl-N-methyl-N-[(acetoxy or methoxycarbonyloxy)-C2-3 alkyl]anilines and mixtures thereof | |
| US5179207A (en) | Substituted 2-amino-5-maleimido thiophenes and substituted 2-amino-maleimido thiazoles | |
| US4419290A (en) | Diazo dyes having a coupler component attached to a sulfaphenyl-azo-phenyl-azo-radical | |
| US4221711A (en) | Brown to violet substituted phenyl-substituted anilino azo dyes | |
| US4711954A (en) | 3-thienylazo dyes with a gamma-acid coupler | |
| US5028701A (en) | Monazo compounds containing a 1-phenyl-2-pyrazoline coupling component | |
| US4271303A (en) | Heterocyclic compounds | |
| US4035143A (en) | Water-insoluble azo dyestuffs | |
| KR960007936B1 (ko) | 분산 염료 | |
| US5723586A (en) | Disperse dyes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |