HU197871B - Process for producing 3-hydroxy-phenoxy derivatives of leucotrien-antagonistic activity - Google Patents
Process for producing 3-hydroxy-phenoxy derivatives of leucotrien-antagonistic activity Download PDFInfo
- Publication number
- HU197871B HU197871B HU833787A HU378783A HU197871B HU 197871 B HU197871 B HU 197871B HU 833787 A HU833787 A HU 833787A HU 378783 A HU378783 A HU 378783A HU 197871 B HU197871 B HU 197871B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- hydroxy
- acetyl
- propyl
- Prior art date
Links
- -1 3-hydroxy-phenoxy Chemical class 0.000 title claims abstract description 65
- 238000000034 method Methods 0.000 title claims abstract description 31
- 230000008569 process Effects 0.000 title claims abstract description 7
- 230000000694 effects Effects 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 143
- 238000002360 preparation method Methods 0.000 claims abstract description 37
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 28
- 239000001257 hydrogen Substances 0.000 claims abstract description 27
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims abstract description 19
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 14
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 8
- 235000019270 ammonium chloride Nutrition 0.000 claims abstract description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical group C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 18
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 206010029897 Obsessive thoughts Diseases 0.000 claims description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 11
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 claims description 9
- PTUDHOYOERFHEX-UHFFFAOYSA-N 5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC(O)=O PTUDHOYOERFHEX-UHFFFAOYSA-N 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- IDHWYUOMJUYSQI-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[5-(2h-tetrazol-5-yl)pentoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCC1=NN=NN1 IDHWYUOMJUYSQI-UHFFFAOYSA-N 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- BNQMUKPUYBDCAY-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCC(O)=O BNQMUKPUYBDCAY-UHFFFAOYSA-N 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 230000003301 hydrolyzing effect Effects 0.000 claims description 3
- MWYHLEQJTQJHSS-UHFFFAOYSA-N tomelukast Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCC1=NNN=N1 MWYHLEQJTQJHSS-UHFFFAOYSA-N 0.000 claims description 3
- WOXRHRBPWQWPSP-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[6-(2h-tetrazol-5-yl)hexoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCC1=NNN=N1 WOXRHRBPWQWPSP-UHFFFAOYSA-N 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 23
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 8
- 239000003199 leukotriene receptor blocking agent Substances 0.000 abstract description 4
- TZJQUAPAYQHQLO-UHFFFAOYSA-N 4-(4-acetyl-3-hydroxy-2-propylphenoxy)butanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCC(O)=O TZJQUAPAYQHQLO-UHFFFAOYSA-N 0.000 abstract description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 abstract 2
- 235000010290 biphenyl Nutrition 0.000 abstract 1
- 239000004305 biphenyl Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 114
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- 239000000243 solution Substances 0.000 description 69
- 238000004458 analytical method Methods 0.000 description 61
- 239000000047 product Substances 0.000 description 45
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 40
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 31
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical group [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 27
- 239000000543 intermediate Substances 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 21
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 229910000027 potassium carbonate Inorganic materials 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 239000003921 oil Substances 0.000 description 14
- 235000019198 oils Nutrition 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- 229910052938 sodium sulfate Inorganic materials 0.000 description 13
- 235000011152 sodium sulphate Nutrition 0.000 description 13
- 150000002825 nitriles Chemical group 0.000 description 11
- SULYEHHGGXARJS-UHFFFAOYSA-N 2',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1O SULYEHHGGXARJS-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 150000002617 leukotrienes Chemical class 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000005557 antagonist Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 150000003536 tetrazoles Chemical class 0.000 description 8
- QGGRBWUQXAFYEC-UHFFFAOYSA-N 1-(2,4-dihydroxy-3-propylphenyl)ethanone Chemical compound CCCC1=C(O)C=CC(C(C)=O)=C1O QGGRBWUQXAFYEC-UHFFFAOYSA-N 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- VLDMVBPLPZYQKX-UHFFFAOYSA-N 1-[4-(4-bromobutoxy)-2-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCBr VLDMVBPLPZYQKX-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 210000003405 ileum Anatomy 0.000 description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- KLAKIAVEMQMVBT-UHFFFAOYSA-N p-hydroxy-phenacyl alcohol Natural products OCC(=O)C1=CC=C(O)C=C1 KLAKIAVEMQMVBT-UHFFFAOYSA-N 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- PKHCJJIDKHCSBE-UHFFFAOYSA-N 5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC#N PKHCJJIDKHCSBE-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 208000006673 asthma Diseases 0.000 description 4
- 150000001649 bromium compounds Chemical class 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000012467 final product Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 208000026935 allergic disease Diseases 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 230000008485 antagonism Effects 0.000 description 3
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- MENJXZZFHKDQSA-UHFFFAOYSA-N ethyl 6-(4-benzylphenyl)-6-bromohexanoate Chemical compound C1=CC(C(Br)CCCCC(=O)OCC)=CC=C1CC1=CC=CC=C1 MENJXZZFHKDQSA-UHFFFAOYSA-N 0.000 description 3
- YEBVZCIKZSZGIS-UHFFFAOYSA-N ethyl 6-bromoheptanoate Chemical compound CCOC(=O)CCCCC(C)Br YEBVZCIKZSZGIS-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- SWHFVJFGFDNELR-UHFFFAOYSA-N methyl 6-bromo-2,2-dimethylhexanoate Chemical compound COC(=O)C(C)(C)CCCCBr SWHFVJFGFDNELR-UHFFFAOYSA-N 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical group [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 2
- KGGQPZKQXRBWOH-UHFFFAOYSA-N 1-(2-hydroxy-4-pentoxy-3-propylphenyl)ethanone thiocyanic acid Chemical compound SC#N.CCCCCOC1=CC=C(C(C)=O)C(O)=C1CCC KGGQPZKQXRBWOH-UHFFFAOYSA-N 0.000 description 2
- ISKWXLIBKKIKQE-UHFFFAOYSA-N 1-[2-hydroxy-4-(6-morpholin-4-ylhexoxy)-3-propylphenyl]ethanone;hydrochloride Chemical compound Cl.CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCN1CCOCC1 ISKWXLIBKKIKQE-UHFFFAOYSA-N 0.000 description 2
- QAIKGCGEXYDRAK-UHFFFAOYSA-N 1-[2-hydroxy-4-[5-methyl-5-(2h-tetrazol-5-yl)hexoxy]-3-propylphenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCC(C)(C)C1=NN=NN1 QAIKGCGEXYDRAK-UHFFFAOYSA-N 0.000 description 2
- YMRIDJQAEZFTSC-UHFFFAOYSA-N 2,3-dihydro-1h-tetrazole Chemical compound N1NC=NN1 YMRIDJQAEZFTSC-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NTZXJIFRMQIYFB-UHFFFAOYSA-N 5-(4-acetyl-3-hydroxy-2-propylphenoxy)-n-hydroxypentanamide Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC(=O)NO NTZXJIFRMQIYFB-UHFFFAOYSA-N 0.000 description 2
- QVEZTQGWUHMLLT-UHFFFAOYSA-N 5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentanamide Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC(N)=O QVEZTQGWUHMLLT-UHFFFAOYSA-N 0.000 description 2
- QYCNUTSSSMMIPH-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dimethylhexanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC(C)(C)C(O)=O QYCNUTSSSMMIPH-UHFFFAOYSA-N 0.000 description 2
- NSZSTNPKCOTUEP-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)hexanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCC#N NSZSTNPKCOTUEP-UHFFFAOYSA-N 0.000 description 2
- TZJDAXNUCHTZMH-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)nonanoic acid Chemical compound OC(=O)CCCCC(CCC)OC1=CC=C(C(C)=O)C(O)=C1CCC TZJDAXNUCHTZMH-UHFFFAOYSA-N 0.000 description 2
- KDQYPEHRTSBKGB-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)-6-(4-benzylphenyl)hexanoic acid Chemical compound C1=C(O)C(C(=O)C)=CC=C1OC(CCCCC(O)=O)C(C=C1)=CC=C1CC1=CC=CC=C1 KDQYPEHRTSBKGB-UHFFFAOYSA-N 0.000 description 2
- NVRVNSHHLPQGCU-UHFFFAOYSA-N 6-bromohexanoic acid Chemical compound OC(=O)CCCCCBr NVRVNSHHLPQGCU-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 206010006458 Bronchitis chronic Diseases 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 201000003883 Cystic fibrosis Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 102000003820 Lipoxygenases Human genes 0.000 description 2
- 108090000128 Lipoxygenases Proteins 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229940008126 aerosol Drugs 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical class CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 206010006451 bronchitis Diseases 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 208000007451 chronic bronchitis Diseases 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000008121 dextrose Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- DMSZRAVQPGVLFN-UHFFFAOYSA-N ethyl 6-(4-benzylphenyl)-6-hydroxyhexanoate Chemical compound C1=CC(C(O)CCCCC(=O)OCC)=CC=C1CC1=CC=CC=C1 DMSZRAVQPGVLFN-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 2
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- RBIOPXXYZJIVLG-UHFFFAOYSA-N methyl 6-(4-acetyl-3-hydroxy-2-propylphenoxy)-2,2-dimethylhexanoate Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCC(C)(C)C(=O)OC RBIOPXXYZJIVLG-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- BHIWKHZACMWKOJ-UHFFFAOYSA-N methyl isobutyrate Chemical compound COC(=O)C(C)C BHIWKHZACMWKOJ-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- HUANUVQIZOISIE-UHFFFAOYSA-N (2,4-dihydroxy-3-propylphenyl)-phenylmethanone Chemical compound CCCC1=C(O)C=CC(C(=O)C=2C=CC=CC=2)=C1O HUANUVQIZOISIE-UHFFFAOYSA-N 0.000 description 1
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 1
- MSBXRWAEWZKQTJ-UHFFFAOYSA-N 1-(2-hydroxy-4-octoxy-3-propylphenyl)ethanone thiocyanic acid Chemical compound SC#N.CCCCCCCCOC1=CC=C(C(C)=O)C(O)=C1CCC MSBXRWAEWZKQTJ-UHFFFAOYSA-N 0.000 description 1
- IICBROQPXGFITJ-UHFFFAOYSA-N 1-(4-butoxy-2-hydroxy-3-propylphenyl)ethanone Chemical compound CCCCOC1=CC=C(C(C)=O)C(O)=C1CCC IICBROQPXGFITJ-UHFFFAOYSA-N 0.000 description 1
- CNYZPSHWTPCOMM-UHFFFAOYSA-N 1-(4-butoxy-2-hydroxy-3-propylphenyl)ethanone thiocyanic acid Chemical compound SC#N.CCCCOC1=CC=C(C(C)=O)C(O)=C1CCC CNYZPSHWTPCOMM-UHFFFAOYSA-N 0.000 description 1
- FSKXAEINNCQVRZ-UHFFFAOYSA-N 1-(4-heptoxy-2-hydroxy-3-propylphenyl)ethanone thiocyanic acid Chemical compound SC#N.CCCCCCCOC1=CC=C(C(C)=O)C(O)=C1CCC FSKXAEINNCQVRZ-UHFFFAOYSA-N 0.000 description 1
- JDDSSCKRIDDDQR-UHFFFAOYSA-N 1-(4-hexoxy-2-hydroxy-3-propylphenyl)ethanone thiocyanic acid Chemical compound SC#N.CCCCCCOC1=CC=C(C(C)=O)C(O)=C1CCC JDDSSCKRIDDDQR-UHFFFAOYSA-N 0.000 description 1
- CNPHGZGUVMSESF-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[10-(2h-tetrazol-5-yl)decoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCCCCCC1=NNN=N1 CNPHGZGUVMSESF-UHFFFAOYSA-N 0.000 description 1
- JGQAWGJHYGZILZ-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[12-(2h-tetrazol-5-yl)dodecoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCCCCCCCC1=NN=NN1 JGQAWGJHYGZILZ-UHFFFAOYSA-N 0.000 description 1
- JZRLSWGKMGJUJV-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[3-(2h-tetrazol-5-yl)propoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCC1=NNN=N1 JZRLSWGKMGJUJV-UHFFFAOYSA-N 0.000 description 1
- MEUYSTBIFGHWHX-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[5-(2h-tetrazol-5-ylsulfonyl)pentoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCS(=O)(=O)C1=NN=NN1 MEUYSTBIFGHWHX-UHFFFAOYSA-N 0.000 description 1
- QSGASMCSIVMQJN-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[7-(2h-tetrazol-5-yl)heptoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCCC1=NN=NN1 QSGASMCSIVMQJN-UHFFFAOYSA-N 0.000 description 1
- DJSOLURLLLPFKJ-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[8-(2h-tetrazol-5-yl)octoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCCCC1=NNN=N1 DJSOLURLLLPFKJ-UHFFFAOYSA-N 0.000 description 1
- UPQSGTPRVZDWTL-UHFFFAOYSA-N 1-[2-hydroxy-3-propyl-4-[9-(2h-tetrazol-5-yl)nonoxy]phenyl]ethanone Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCCCCCC1=NNN=N1 UPQSGTPRVZDWTL-UHFFFAOYSA-N 0.000 description 1
- XMSMRPLYCVJOSX-UHFFFAOYSA-N 1-[2-hydroxy-4-[6-(4-methylpiperazin-1-yl)hexoxy]-3-propylphenyl]ethanone;dihydrochloride Chemical compound Cl.Cl.CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCN1CCN(C)CC1 XMSMRPLYCVJOSX-UHFFFAOYSA-N 0.000 description 1
- DRGBHKZRLWJAOU-UHFFFAOYSA-N 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCBr DRGBHKZRLWJAOU-UHFFFAOYSA-N 0.000 description 1
- HUFSSBDWHMWGRZ-UHFFFAOYSA-N 1-[4-(6-aminohexoxy)-2-hydroxy-3-propylphenyl]ethanone;hydrochloride Chemical compound Cl.CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCN HUFSSBDWHMWGRZ-UHFFFAOYSA-N 0.000 description 1
- LCOYOZXQIYKODZ-UHFFFAOYSA-N 1-[4-(6-bromohexoxy)-2-hydroxy-3-propylphenyl]ethanone Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCBr LCOYOZXQIYKODZ-UHFFFAOYSA-N 0.000 description 1
- MHYQZIFJPKOXBT-UHFFFAOYSA-N 1-[4-[6-(dimethylamino)hexoxy]-2-hydroxy-3-propylphenyl]ethanone;hydrochloride Chemical compound Cl.CCCC1=C(OCCCCCCN(C)C)C=CC(C(C)=O)=C1O MHYQZIFJPKOXBT-UHFFFAOYSA-N 0.000 description 1
- MWMHZJCHSHBKKX-UHFFFAOYSA-N 10-(4-acetyl-3-hydroxy-2-propylphenoxy)decanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCCCCC#N MWMHZJCHSHBKKX-UHFFFAOYSA-N 0.000 description 1
- JQPLVAZZHTVGRE-UHFFFAOYSA-N 13-(4-acetyl-3-hydroxy-2-propylphenoxy)tridecanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCCCCCCCC#N JQPLVAZZHTVGRE-UHFFFAOYSA-N 0.000 description 1
- BXXWFOGWXLJPPA-UHFFFAOYSA-N 2,3-dibromobutane Chemical compound CC(Br)C(C)Br BXXWFOGWXLJPPA-UHFFFAOYSA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- MNURPFVONZPVLA-UHFFFAOYSA-N 2-chlorobenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1Cl MNURPFVONZPVLA-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- DAWPAGKUGXIGOS-UHFFFAOYSA-N 3-(4-acetyl-3-hydroxy-2-propylphenoxy)propyl carbamimidothioate hydrobromide Chemical compound Br.CCCC1=C(O)C(C(C)=O)=CC=C1OCCCSC(N)=N DAWPAGKUGXIGOS-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical class CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 4-chlorobutanenitrile Chemical compound ClCCCC#N ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 0.000 description 1
- IIOFIPVRCBPDDH-UHFFFAOYSA-N 5-(4-acetyl-3-hydroxy-2-propylphenoxy)-n,n-dimethylpentanamide Chemical compound CCCC1=C(OCCCCC(=O)N(C)C)C=CC(C(C)=O)=C1O IIOFIPVRCBPDDH-UHFFFAOYSA-N 0.000 description 1
- NDSNGWAPADIOLU-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)-6-(4-benzylphenyl)hexanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OC(CCCCC(O)=O)C(C=C1)=CC=C1CC1=CC=CC=C1 NDSNGWAPADIOLU-UHFFFAOYSA-N 0.000 description 1
- NCPVWWWCZTVCQB-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)-6-phenylhexanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OC(CCCCC(O)=O)C1=CC=CC=C1 NCPVWWWCZTVCQB-UHFFFAOYSA-N 0.000 description 1
- MLWPOZRNKJJTJT-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxy-2-propylphenoxy)heptanoic acid Chemical compound CCCC1=C(OC(C)CCCCC(O)=O)C=CC(C(C)=O)=C1O MLWPOZRNKJJTJT-UHFFFAOYSA-N 0.000 description 1
- LJNQROCXPMCVIY-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)-2,2-dimethylhexanoic acid Chemical compound CC(=O)C1=CC=C(OCCCCC(C)(C)C(O)=O)C=C1O LJNQROCXPMCVIY-UHFFFAOYSA-N 0.000 description 1
- HOPMGAZUTKZHAO-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)-6-phenylhexanoic acid Chemical compound C1=C(O)C(C(=O)C)=CC=C1OC(CCCCC(O)=O)C1=CC=CC=C1 HOPMGAZUTKZHAO-UHFFFAOYSA-N 0.000 description 1
- URJWBCFJEACFCQ-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)heptanoic acid Chemical compound OC(=O)CCCCC(C)OC1=CC=C(C(C)=O)C(O)=C1 URJWBCFJEACFCQ-UHFFFAOYSA-N 0.000 description 1
- FUUHKGKVGFLSDN-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)hexanoic acid Chemical compound CC(=O)C1=CC=C(OCCCCCC(O)=O)C=C1O FUUHKGKVGFLSDN-UHFFFAOYSA-N 0.000 description 1
- WUEUHAUOMBTDQB-UHFFFAOYSA-N 6-(4-acetyl-3-hydroxyphenoxy)nonanoic acid Chemical compound OC(=O)CCCCC(CCC)OC1=CC=C(C(C)=O)C(O)=C1 WUEUHAUOMBTDQB-UHFFFAOYSA-N 0.000 description 1
- PFLCTUWJZOKXHB-UHFFFAOYSA-N 6-chloro-2-methyl-6-oxohexanoic acid Chemical compound OC(=O)C(C)CCCC(Cl)=O PFLCTUWJZOKXHB-UHFFFAOYSA-N 0.000 description 1
- PLKNMBFMTVKLEW-UHFFFAOYSA-N 6-chlorohexanenitrile Chemical compound ClCCCCCC#N PLKNMBFMTVKLEW-UHFFFAOYSA-N 0.000 description 1
- IHAUFAWTBDBKSS-UHFFFAOYSA-N 7-(4-acetyl-3-hydroxy-2-propylphenoxy)heptanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCC#N IHAUFAWTBDBKSS-UHFFFAOYSA-N 0.000 description 1
- UWYHVTBPVWRPTN-UHFFFAOYSA-N 7-(4-acetyl-3-hydroxy-2-propylphenoxy)heptanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCC(O)=O UWYHVTBPVWRPTN-UHFFFAOYSA-N 0.000 description 1
- MEMGABXUPFXUFC-UHFFFAOYSA-N 8-(4-acetyl-3-hydroxy-2-propylphenoxy)octanenitrile Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCCC#N MEMGABXUPFXUFC-UHFFFAOYSA-N 0.000 description 1
- FGHCFIGUBUNXBE-UHFFFAOYSA-N 8-(4-acetyl-3-hydroxy-2-propylphenoxy)octanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCCC(O)=O FGHCFIGUBUNXBE-UHFFFAOYSA-N 0.000 description 1
- HQPGBTKYUVCVSH-UHFFFAOYSA-N 9-(4-acetyl-3-hydroxy-2-propylphenoxy)nonanoic acid Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCCCCC(O)=O HQPGBTKYUVCVSH-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241001449342 Chlorocrambe hastata Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical class COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- IGVPBCZDHMIOJH-UHFFFAOYSA-N Phenyl butyrate Chemical class CCCC(=O)OC1=CC=CC=C1 IGVPBCZDHMIOJH-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010036790 Productive cough Diseases 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical class OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- UXRYPXYCULHWFA-UHFFFAOYSA-N [2-hydroxy-3-propyl-4-[4-(2h-tetrazol-5-yl)butoxy]phenyl]-phenylmethanone Chemical compound C1=CC(C(=O)C=2C=CC=CC=2)=C(O)C(CCC)=C1OCCCCC1=NN=NN1 UXRYPXYCULHWFA-UHFFFAOYSA-N 0.000 description 1
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 230000001364 causal effect Effects 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical class CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical compound C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- UUOBVSXWTANPSN-UHFFFAOYSA-N ethyl 6-(4-acetyl-3-hydroxy-2-propylphenoxy)-6-(4-benzylphenyl)hexanoate Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OC(CCCCC(=O)OCC)C(C=C1)=CC=C1CC1=CC=CC=C1 UUOBVSXWTANPSN-UHFFFAOYSA-N 0.000 description 1
- OUHHAOKXQRZRSY-UHFFFAOYSA-N ethyl 6-oxoheptanoate Chemical compound CCOC(=O)CCCCC(C)=O OUHHAOKXQRZRSY-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical class CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- WDAXFOBOLVPGLV-UHFFFAOYSA-N isobutyric acid ethyl ester Natural products CCOC(=O)C(C)C WDAXFOBOLVPGLV-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003903 lactic acid esters Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 1
- 229960000582 mepyramine Drugs 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- VARNCSDXNAQXSS-UHFFFAOYSA-N methyl 6-(4-acetyl-3-hydroxyphenoxy)-2,2-dimethylhexanoate Chemical compound COC(=O)C(C)(C)CCCCOC1=CC=C(C(C)=O)C(O)=C1 VARNCSDXNAQXSS-UHFFFAOYSA-N 0.000 description 1
- JGHBADISYGCEFZ-UHFFFAOYSA-N methyl 6-(4-benzylphenyl)-6-oxohexanoate Chemical compound C1=CC(C(=O)CCCCC(=O)OC)=CC=C1CC1=CC=CC=C1 JGHBADISYGCEFZ-UHFFFAOYSA-N 0.000 description 1
- JEHRKICNZALDPQ-UHFFFAOYSA-N methyl 6-bromononanoate Chemical compound CCCC(Br)CCCCC(=O)OC JEHRKICNZALDPQ-UHFFFAOYSA-N 0.000 description 1
- HDLGIEZOMYJKAK-UHFFFAOYSA-N methyl 6-chloro-6-oxohexanoate Chemical compound COC(=O)CCCCC(Cl)=O HDLGIEZOMYJKAK-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- UOBSVARXACCLLH-UHFFFAOYSA-N monomethyl adipate Chemical compound COC(=O)CCCCC(O)=O UOBSVARXACCLLH-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical class C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical class CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical class OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000003362 replicative effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical class OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 150000003329 sebacic acid derivatives Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000008925 spontaneous activity Effects 0.000 description 1
- 208000024794 sputum Diseases 0.000 description 1
- 210000003802 sputum Anatomy 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000000858 thiocyanato group Chemical group *SC#N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- XKGLSKVNOSHTAD-UHFFFAOYSA-N valerophenone Chemical compound CCCCC(=O)C1=CC=CC=C1 XKGLSKVNOSHTAD-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- GDJZZWYLFXAGFH-UHFFFAOYSA-M xylenesulfonate group Chemical group C1(C(C=CC=C1)C)(C)S(=O)(=O)[O-] GDJZZWYLFXAGFH-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/32—Isothioureas having sulfur atoms of isothiourea groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pulmonology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/439,239 US4661505A (en) | 1982-11-03 | 1982-11-03 | Leukotriene antagonists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT35234A HUT35234A (en) | 1985-06-28 |
| HU197871B true HU197871B (en) | 1989-06-28 |
Family
ID=23743890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU833787A HU197871B (en) | 1982-11-03 | 1983-11-02 | Process for producing 3-hydroxy-phenoxy derivatives of leucotrien-antagonistic activity |
Country Status (28)
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4507498A (en) * | 1982-04-09 | 1985-03-26 | Hoffmann-La Roche Inc. | Phenoxycarboxylic acids |
| US5143931A (en) * | 1982-06-24 | 1992-09-01 | Smithkline Beecham Corporation | Leukotriene antagonists containing tetrazolyl groups |
| US4959364A (en) * | 1985-02-04 | 1990-09-25 | G. D. Searle & Co. | Method of treating inflammation, allergy, asthma and proliferative skin disease using heterocyclic amides |
| US4628115A (en) * | 1985-03-25 | 1986-12-09 | Hoffmann-La Roche Inc. | Substituted 4-acetyl-3-hydroxyphenoxy alkanoic acids |
| US4937253A (en) * | 1985-04-19 | 1990-06-26 | Smithkline Beecham Corporation | Ester prodrugs |
| US4939279A (en) * | 1985-04-19 | 1990-07-03 | Smithkline Beecham Corporation | Leukotriene antagonists |
| US4672066A (en) * | 1985-04-22 | 1987-06-09 | Hoffmann-La Roche Inc. | Derivatives of 4-acetyl-3-hydroxy-2-alkyl-phenoxycarboxylic acids |
| GB8523776D0 (en) * | 1985-09-26 | 1985-10-30 | Scras | Catechol derivatives |
| JPS6272657A (ja) * | 1985-09-27 | 1987-04-03 | Terumo Corp | アミド誘導体およびこれを含有する5−リポキシゲナ−ゼ作用阻害剤 |
| US4663332A (en) * | 1985-10-10 | 1987-05-05 | Hoffman-La Roche Inc. | 5-substituted N-alkylated tetrazoles |
| DE3604050A1 (de) * | 1986-02-08 | 1987-08-13 | Boehringer Mannheim Gmbh | Thioether, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| US4801616A (en) * | 1986-03-25 | 1989-01-31 | Eli Lilly And Company | Diphenylmethanone compounds and anti-inflammatory use thereof |
| JPS62242682A (ja) * | 1986-04-16 | 1987-10-23 | Tokyo Tanabe Co Ltd | 新規なピリド[1,2―a]ピリミジン誘導体及びその製造法 |
| FR2598146B1 (fr) * | 1986-04-30 | 1989-01-20 | Rech Ind | Nouveau procede de preparation de fibrates. |
| US5098613A (en) * | 1987-01-12 | 1992-03-24 | Eli Lilly And Company | Anti-inflammatory agents |
| US5294613A (en) * | 1987-01-12 | 1994-03-15 | Eli Lilly And Company | Method of treating endotoxic shock in mammals |
| US4992576A (en) * | 1987-01-12 | 1991-02-12 | Eli Lilly And Company | Intermediates for leukotriene antagonists |
| US4945099A (en) * | 1987-01-12 | 1990-07-31 | Eli Lilly And Company | Anti-inflammatory agents |
| US5235064A (en) * | 1987-01-12 | 1993-08-10 | Eli Lilly And Company | Leukotriene antagonists |
| CA1315279C (en) * | 1987-01-12 | 1993-03-30 | Nancy Grace Bollinger | Anti-inflammatory agents |
| US5171882A (en) * | 1987-01-12 | 1992-12-15 | Eli Lilly And Company | Leukotriene antagonists |
| US4874777A (en) * | 1987-04-10 | 1989-10-17 | Eli Lilly And Company | Leukotriene antagonists |
| US4853398A (en) * | 1987-04-13 | 1989-08-01 | Eli Lilly And Company | Leukotriene antagonists and use thereas |
| US4942245A (en) * | 1987-04-20 | 1990-07-17 | Kyorin Pharmaceutical Co., Ltd. | Benzimidazole Derivatives |
| EP0295882B1 (en) * | 1987-06-19 | 1991-08-21 | Eli Lilly And Company | Process for intermediates to leukotriene antagonists |
| US4777298A (en) * | 1987-06-19 | 1988-10-11 | Eli Lilly And Company | Process for intermediates to leukotriene antagonists |
| US4777299A (en) * | 1987-06-19 | 1988-10-11 | Eli Lilly And Company | Process for leukotriene antagonists |
| PT87616B (pt) * | 1987-06-24 | 1992-09-30 | Smithkline Beecham Corp | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticas |
| US4820722A (en) * | 1987-08-14 | 1989-04-11 | Eli Lilly And Company | Disubstituted tetrazoles and their use as leukotriene antagonists |
| US4820723A (en) * | 1987-08-14 | 1989-04-11 | Eli Lilly And Company | Disubstituted tetrazole leukotriene antagonists and methods for their use thereas |
| US5008439A (en) * | 1988-03-21 | 1991-04-16 | Hoechst Celanese Corporation | Synthesis of 2-(4-hydroxyphenoxy) alkanoic acid esters |
| US4908476A (en) * | 1988-03-21 | 1990-03-13 | Hoechst Celanese Corporation | Synthesis of 2-(4-hydroxyphenoxy)alkanoic acids |
| US4935522A (en) * | 1988-03-21 | 1990-06-19 | Hoechst Celanese Corporation | Process for producing ethyl 2-[4'-(6"-chloro-2"-benzoxazolyloxy)phenoxy]propionate |
| EP0357545A3 (de) * | 1988-07-21 | 1990-03-21 | Ciba-Geigy Ag | Kationische Verbindungen, deren Herstellung und deren Anwendung zur fotochemischen Stabilisierung basisch anfärbbarer Polyamid-, Polyacrylnitril-und Polyesterfasermaterialien |
| US4954513A (en) * | 1988-12-23 | 1990-09-04 | Smithkline Beecham Corporation | Leukotriene antagonists |
| JPH04297466A (ja) * | 1990-06-22 | 1992-10-21 | Nippon Shinyaku Co Ltd | テトラゾール誘導体及び医薬 |
| DE4028866A1 (de) * | 1990-09-07 | 1992-03-12 | Schering Ag | Neue leukotrien-b(pfeil abwaerts)4(pfeil abwaerts)-antagonisten, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| CN1037681C (zh) * | 1991-01-31 | 1998-03-11 | 日本新药株式会社 | 四唑衍生物与医药 |
| IT1250436B (it) * | 1991-07-01 | 1995-04-07 | Mini Ricerca Scient Tecnolog | Benzofenoni ad azione antifungina |
| PH30449A (en) * | 1991-11-25 | 1997-05-28 | Lilly Co Eli | Substituted phenyl phenol leukotriene antagonists |
| US5352690A (en) * | 1992-07-01 | 1994-10-04 | Eli Lilly And Company | 1,2,4-trioxygenated benzene derivatives useful as leukotriene antagonists |
| US5455274A (en) * | 1992-12-09 | 1995-10-03 | Ciba-Geigy Corporation | Hydroxyamidine derivatives |
| AU1846695A (en) * | 1994-02-16 | 1995-09-04 | Idun Pharmaceuticals | Methods for controlling free radical generation by inflammatory cells |
| US6566560B2 (en) | 1999-03-22 | 2003-05-20 | Immugen Pharmaceuticals, Inc. | Resorcinolic compounds |
| US6541510B2 (en) * | 2000-09-28 | 2003-04-01 | Immugen Pharmaceuticals, Inc. | Antiviral methods and compounds |
| AU2001296402A1 (en) * | 2000-09-28 | 2002-04-08 | Immugen Pharmaceuticals, Inc. | Methods and compounds for inhibiting eicosanoid metabolism and platelet aggregation |
| US6756399B2 (en) * | 2001-06-29 | 2004-06-29 | The United States Of America As Represented By The Department Of Health And Human Services | Use of lipoxygenase inhibitors and PPAR ligands as anti-cancer therapeutic and intervention agents |
| AU2003214226A1 (en) * | 2002-03-18 | 2003-10-08 | Immugen Pharmaceuticals, Inc. | Topical formulations of resorcinols and cannibinoids and methods of use |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3255241A (en) * | 1961-01-19 | 1966-06-07 | Merck & Co Inc | (2-alkylidene acyl)phenoxy-and (2-alkylidene acyl)phenylmercaptocarboxylic acids |
| BE639727A (cg-RX-API-DMAC10.html) * | 1962-11-13 | |||
| US3311636A (en) * | 1963-03-14 | 1967-03-28 | Upjohn Co | Organic chemical compounds and process |
| US3261868A (en) * | 1963-03-14 | 1966-07-19 | Upjohn Co | Aminoalkoxy-hydroxyacetophenones |
| US3320306A (en) * | 1964-01-29 | 1967-05-16 | Merck & Co Inc | Process for the preparation of 4-(2-methylenealkanoyl)phenoxy alkanoic acids by decarboxylation |
| GB1185539A (en) * | 1967-11-03 | 1970-03-25 | Smith & Nephew | Substituted Tetrazoles |
| DE2003430C3 (de) * | 1969-01-31 | 1978-12-07 | Laboratorien Fournier Gmbh, 6600 Saarbruecken | p-Benzoylphenoxyisobuttersäureester, ihre Herstellung und diese enthaltende Arzneimittel |
| GB1415295A (en) * | 1971-10-14 | 1975-11-26 | Orchimed Sa | Substituted phenoxy-alkyl-carboxylic acids and derivatives thereof |
| GB1384530A (en) * | 1971-07-29 | 1975-02-19 | Fisons Ltd | Chromone derivatives |
| SU469247A3 (ru) * | 1972-01-14 | 1975-04-30 | Майлз Лабораториз Инк (Фирма) | Способ получени производных хромона |
| FR2173778A1 (en) * | 1972-03-02 | 1973-10-12 | Aries Robert | 5-phenoxyalkyltetrazoles - hypocholesterolaemics and anorectics |
| CH599184A5 (en) * | 1974-08-16 | 1978-05-12 | Sandoz Ag | 5-Substd. 4-hydroxyalkyl-salicylaldehyde derivs. prepn. |
| DE2460689C3 (de) * | 1974-12-20 | 1980-06-26 | Klinge Pharma Gmbh & Co, 8000 Muenchen | 13-disubstituierte Propanol-(2)-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US4136192A (en) * | 1975-09-23 | 1979-01-23 | Beecham Group Limited | 4-hydroxy-3-nitro (cyano) coumarins |
| GB1524260A (en) * | 1976-11-23 | 1978-09-06 | Beecham Group Ltd | Aminoalkyloneoxyd substituted 4-hydroxy-3 nitrocoumarins |
| DE2735856A1 (de) * | 1977-08-09 | 1979-02-22 | Klinge Co Chem Pharm Fab | Neue 1,3-diphenoxypropan-2-on-derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| ZA805478B (en) * | 1979-09-05 | 1981-09-30 | Glaxo Group Ltd | Phenol derivatives |
| FI73423C (fi) * | 1980-02-29 | 1987-10-09 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av farmakologiskt verksamma tetrazolderivat. |
| EP0056172B1 (en) * | 1981-01-09 | 1985-04-03 | FISONS plc | Phenoxy- and thiophenoxy compounds, methods for their preparation and pharmaceutical formulations containing them |
| US4567201A (en) * | 1981-11-25 | 1986-01-28 | Takeda Chemical Industries, Ltd. | Diphenoxypropane derivatives and compositions of antiasthmatic and antiinflammatory agents thereof |
| ZA831846B (en) * | 1982-04-09 | 1983-11-30 | Hoffmann La Roche | Phenoyxyalkylcarboxylic acid derivatives |
| US4507498A (en) * | 1982-04-09 | 1985-03-26 | Hoffmann-La Roche Inc. | Phenoxycarboxylic acids |
| US5105017A (en) * | 1983-07-18 | 1992-04-14 | Eli Lilly And Company | Leukotriene antagonist intermediates |
-
1982
- 1982-11-03 US US06/439,239 patent/US4661505A/en not_active Expired - Fee Related
-
1983
- 1983-10-31 ES ES526940A patent/ES526940A0/es active Granted
- 1983-10-31 ZA ZA838118A patent/ZA838118B/xx unknown
- 1983-10-31 NZ NZ206111A patent/NZ206111A/en unknown
- 1983-10-31 RO RO112447A patent/RO88317B/ro unknown
- 1983-10-31 IL IL70093A patent/IL70093A/xx not_active IP Right Cessation
- 1983-11-01 EP EP83306638A patent/EP0108592B1/en not_active Expired
- 1983-11-01 FI FI834002A patent/FI81343C/fi not_active IP Right Cessation
- 1983-11-01 GR GR72839A patent/GR78946B/el unknown
- 1983-11-01 CA CA000440201A patent/CA1242194A/en not_active Expired
- 1983-11-01 IE IE2551/83A patent/IE56204B1/en not_active IP Right Cessation
- 1983-11-01 DD DD83256210A patent/DD215083A5/de not_active IP Right Cessation
- 1983-11-01 AT AT83306638T patent/ATE30023T1/de not_active IP Right Cessation
- 1983-11-01 DE DE8383306638T patent/DE3373899D1/de not_active Expired
- 1983-11-01 GB GB08329099A patent/GB2129797B/en not_active Expired
- 1983-11-01 DK DK4998/83A patent/DK499883D0/da not_active Application Discontinuation
- 1983-11-01 AU AU20875/83A patent/AU572806B2/en not_active Ceased
- 1983-11-02 AR AR294707A patent/AR240318A1/es active
- 1983-11-02 KR KR1019830005206A patent/KR860001570B1/ko not_active Expired
- 1983-11-02 EG EG684/83A patent/EG16819A/xx active
- 1983-11-02 JP JP58206866A patent/JPS59104344A/ja active Granted
- 1983-11-02 PT PT77592A patent/PT77592B/pt not_active IP Right Cessation
- 1983-11-02 PL PL1983244401A patent/PL139647B1/pl unknown
- 1983-11-02 SU SU833662253A patent/SU1433412A3/ru active
- 1983-11-02 HU HU833787A patent/HU197871B/hu not_active IP Right Cessation
- 1983-11-02 PH PH29778A patent/PH21170A/en unknown
- 1983-11-03 CS CS838106A patent/CS247076B2/cs unknown
-
1987
- 1987-09-23 MY MYPI87001889A patent/MY102027A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU197871B (en) | Process for producing 3-hydroxy-phenoxy derivatives of leucotrien-antagonistic activity | |
| US5393768A (en) | Leukotriene antagonists | |
| US4639464A (en) | Antihypertensive substituted imidazole derivatives | |
| EP0288189B1 (en) | Improvements in or relating to leukotriene antagonists | |
| US4752616A (en) | Arylthioalkylphenyl carboxylic acids, compositions containing same and method of use | |
| US4013776A (en) | Phenylsulphinyl-amidine derivatives | |
| US5126371A (en) | Diarylacetylenes, their preparation and their use | |
| KR860001980B1 (ko) | 류코트리엔 길항제의 제조방법 | |
| US4861798A (en) | Lipoxygenase inhibitory compounds | |
| MC1230A1 (fr) | Derives de stilbene | |
| CH640837A5 (fr) | Derives de l'imidazole. | |
| US4325964A (en) | Phenylamidine derivatives | |
| US4783473A (en) | Geminally substituted cyclic ether carboxylic acids, derivatives thereof, compositions containing same and method of use | |
| US5256694A (en) | Diarylacetylenes, their preparation and their use | |
| US4764521A (en) | Leukotriene antagonists and a method of use there as | |
| EP0288190B1 (en) | Improvements in or relating to leukotriene antagonists | |
| US3873539A (en) | Substituted-4-aminoacetyl alkanoylphenones | |
| US4769482A (en) | Cyano and thiocyano intermediates | |
| US5135938A (en) | Leukotriene antagonists | |
| DK167919B1 (da) | Acylphenoxyalkanderivater, en fremgangsmaade til fremstilling deraf og farmaceutiske praeparater indeholdende derivaterne | |
| BE820920A (fr) | Acides (1-hydroxy-5-indanyloxy- (ou thio))-alcanoiques et procedes pour leur preparation | |
| EP0087858A1 (en) | New chromanone compounds and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |