HU187580B - Process for producing 1-cyclopropy-6-fluoro-1,4-dihydro-4-oxo-7-piperazino-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing them as active agents - Google Patents
Process for producing 1-cyclopropy-6-fluoro-1,4-dihydro-4-oxo-7-piperazino-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing them as active agents Download PDFInfo
- Publication number
- HU187580B HU187580B HU823457A HU345782A HU187580B HU 187580 B HU187580 B HU 187580B HU 823457 A HU823457 A HU 823457A HU 345782 A HU345782 A HU 345782A HU 187580 B HU187580 B HU 187580B
- Authority
- HU
- Hungary
- Prior art keywords
- fluoro
- dihydro
- oxo
- quinoline
- carboxylic acid
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 14
- 230000000844 anti-bacterial effect Effects 0.000 title claims description 7
- 239000013543 active substance Substances 0.000 title 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract 3
- 150000001875 compounds Chemical class 0.000 claims description 28
- 239000007788 liquid Substances 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000007911 parenteral administration Methods 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 10
- -1 beta-hydroxyethyl Chemical group 0.000 abstract description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract description 7
- 150000003839 salts Chemical class 0.000 abstract description 7
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical class C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 abstract description 6
- 150000004677 hydrates Chemical class 0.000 abstract description 4
- TXJIOKSSHCOKKH-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)CCN1C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2C1CC1 TXJIOKSSHCOKKH-UHFFFAOYSA-N 0.000 abstract description 2
- NYCAUWIIPPYOAQ-UHFFFAOYSA-N 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydroiodide Chemical compound I.C1CN(CC)CCN1C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2C1CC1 NYCAUWIIPPYOAQ-UHFFFAOYSA-N 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- ISPVACVJFUIDPD-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ISPVACVJFUIDPD-UHFFFAOYSA-N 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 7
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- DYRSCZBWQXEMNL-UHFFFAOYSA-N diethyl 2-(2,4-dichloro-5-fluorobenzoyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C(=O)C1=CC(F)=C(Cl)C=C1Cl DYRSCZBWQXEMNL-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- JXWCOCIEGOAZOG-UHFFFAOYSA-N 1,5-dichloro-2-fluoro-4-methylbenzene Chemical compound CC1=CC(F)=C(Cl)C=C1Cl JXWCOCIEGOAZOG-UHFFFAOYSA-N 0.000 description 3
- IGSFOXNHUBLZHU-UHFFFAOYSA-N 2,4-dichloro-5-methylaniline Chemical compound CC1=CC(N)=C(Cl)C=C1Cl IGSFOXNHUBLZHU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- AYNNSCRYTDRFCP-UHFFFAOYSA-N triazene Chemical compound NN=N AYNNSCRYTDRFCP-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- KZCWJHUTTSVCRO-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(Cl)C=C1Cl KZCWJHUTTSVCRO-UHFFFAOYSA-N 0.000 description 2
- QRFMMROPLHREJD-UHFFFAOYSA-N 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoic acid Chemical compound OC(=O)CC(=O)C1=CC(F)=C(Cl)C=C1Cl QRFMMROPLHREJD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- DNAXZSHNKROABO-UHFFFAOYSA-N C(C)C(=C(C(=O)O)C(C1=C(C=C(C(=C1)F)Cl)Cl)=O)NC1CC1 Chemical compound C(C)C(=C(C(=O)O)C(C1=C(C=C(C(=C1)F)Cl)Cl)=O)NC1CC1 DNAXZSHNKROABO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 2
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- WZWNFRQEMDEWEO-UHFFFAOYSA-N 1,5-dichloro-2-fluoro-4-(trichloromethyl)benzene Chemical compound FC1=CC(C(Cl)(Cl)Cl)=C(Cl)C=C1Cl WZWNFRQEMDEWEO-UHFFFAOYSA-N 0.000 description 1
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 1
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NMOWGWOAPRKWIR-UHFFFAOYSA-N 3-oxo-4h-quinoxaline-2-carboxylic acid Chemical compound C1=CC=C2NC(=O)C(C(=O)O)=NC2=C1 NMOWGWOAPRKWIR-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VRQMMAOJMPTCHU-UHFFFAOYSA-N C(C)OC(C(=C(OCC)CC)C(C1=C(C=C(C(=C1)F)Cl)Cl)=O)=O Chemical compound C(C)OC(C(=C(OCC)CC)C(C1=C(C=C(C(=C1)F)Cl)Cl)=O)=O VRQMMAOJMPTCHU-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- DIOIOSKKIYDRIQ-UHFFFAOYSA-N ciprofloxacin hydrochloride Chemical compound Cl.C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 DIOIOSKKIYDRIQ-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- POKPUCWXUHWGMX-UHFFFAOYSA-N ethyl 3-(2,4-dichloro-5-fluorophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(Cl)C=C1Cl POKPUCWXUHWGMX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- OGJPXUAPXNRGGI-UHFFFAOYSA-N norfloxacin Chemical class C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 OGJPXUAPXNRGGI-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Communicable Diseases (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Fodder In General (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813142854 DE3142854A1 (de) | 1981-10-29 | 1981-10-29 | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU187580B true HU187580B (en) | 1986-01-28 |
Family
ID=6145081
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU823457A HU187580B (en) | 1981-10-29 | 1982-10-28 | Process for producing 1-cyclopropy-6-fluoro-1,4-dihydro-4-oxo-7-piperazino-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing them as active agents |
Country Status (20)
| Country | Link |
|---|---|
| EP (1) | EP0078362B1 (enFirst) |
| JP (5) | JPS5874667A (enFirst) |
| KR (1) | KR870000895B1 (enFirst) |
| AT (1) | ATE23040T1 (enFirst) |
| AU (3) | AU561103B2 (enFirst) |
| CA (1) | CA1218067A (enFirst) |
| DD (1) | DD202560A5 (enFirst) |
| DE (2) | DE3142854A1 (enFirst) |
| DK (2) | DK160491C (enFirst) |
| ES (1) | ES8307787A1 (enFirst) |
| FI (1) | FI78689C (enFirst) |
| GR (1) | GR77707B (enFirst) |
| HU (1) | HU187580B (enFirst) |
| IE (1) | IE53709B1 (enFirst) |
| IL (1) | IL66243A (enFirst) |
| LU (1) | LU88325I2 (enFirst) |
| NO (2) | NO158018C (enFirst) |
| NZ (1) | NZ202278A (enFirst) |
| PH (1) | PH18803A (enFirst) |
| ZA (1) | ZA824829B (enFirst) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3248505A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(4- (oxoalkyl)-1-piperazinyl/-3-chinolincarbonsaeuren und ihre derivate, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3248506A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(alkyl-1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306771A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinoloncarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306772A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinolonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3318145A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4730000A (en) * | 1984-04-09 | 1988-03-08 | Abbott Laboratories | Quinoline antibacterial compounds |
| US4551456A (en) * | 1983-11-14 | 1985-11-05 | Merck & Co., Inc. | Ophthalmic use of norfloxacin and related antibiotics |
| EP0160578B1 (en) * | 1984-02-17 | 1989-11-23 | Daiichi Seiyaku Co., Ltd. | 1,8-naphthyridine derivatives |
| US4542133A (en) * | 1984-04-26 | 1985-09-17 | Abbott Laboratories | Methylenedioxy quino-benoxazine derivatives and antibacterial use |
| US4540694A (en) * | 1984-04-26 | 1985-09-10 | Abbott Laboratories | 1-Pyridine substituted quino-benoxazines and antibacterial use |
| US4528285A (en) * | 1984-04-26 | 1985-07-09 | Abbott Laboratories | Methylenedioxy quino-benzothiazine derivatives |
| US4607032A (en) * | 1984-04-26 | 1986-08-19 | Abbott Laboratories | Quino-benoxazine antibacterial compounds |
| US4533663A (en) * | 1984-04-26 | 1985-08-06 | Abbott Laboratories | Quino-benzothiazine antibacterial compounds |
| US4529725A (en) * | 1984-04-26 | 1985-07-16 | Abbott Laboratories | 1-Pyridine substituted quino-benzothiazine |
| GB8412094D0 (en) * | 1984-05-11 | 1984-06-20 | Scras | Quinoline derivatives |
| DE3420798A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-(3-aryl-l-piperazinyl)- sowie 7-(3-cyclohexyl-l-piperazinyl)-3-chinoloncarbonsaeuren |
| DE3426482A1 (de) * | 1984-07-18 | 1986-01-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von halogenierten aroylessigestern |
| IE58742B1 (en) * | 1984-07-20 | 1993-11-05 | Warner Lambert Co | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7h-pyrido[1,2,3-de] [1,4]benzoxauine-6-carboxylic acids; sibstituted-5-amino-6-6fluoro-4-oxo.1,4-dihydroquinoline-3 carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1.8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds |
| DE3502935A1 (de) * | 1984-09-29 | 1986-04-10 | Bayer Ag, 5090 Leverkusen | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
| FR2574404B1 (fr) * | 1984-12-12 | 1987-04-24 | Provesan Sa | Derives 1-substitues de l'acide 6-fluoro-7-(pyrrol-1-yl)-1,4-dihydro-4-oxoquinoleine-3-carboxylique, leur preparation et leur application en tant que medicaments |
| JPS6212760A (ja) * | 1984-12-14 | 1987-01-21 | Dai Ichi Seiyaku Co Ltd | 1−(2−ハロゲノシクロプロピル)キノリンカルボン酸誘導体 |
| JPS61180771A (ja) * | 1985-01-05 | 1986-08-13 | バイエル・アクチエンゲゼルシヤフト | 安定な抗バクテリア剤水溶液 |
| DE3517709A1 (de) * | 1985-01-05 | 1986-07-10 | Bayer Ag | Basische zubereitungen von chinoloncarbonsaeuren |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| DE3501247A1 (de) * | 1985-01-16 | 1986-07-17 | Bayer Ag, 5090 Leverkusen | Aminoacrylsaeure-derivate |
| AT392789B (de) * | 1985-01-23 | 1991-06-10 | Toyama Chemical Co Ltd | Verfahren zur herstellung von 1-substituierten aryl-1,4-dihydro-4-oxonaphthyridinderivaten |
| US4851535A (en) * | 1985-01-23 | 1989-07-25 | Toyama Chemical Co., Ltd. | Nicotinic acid derivatives |
| AT392791B (de) * | 1985-01-23 | 1991-06-10 | Toyama Chemical Co Ltd | Verfahren zur herstellung von 1-substituierten aryl-1,4-dihydro-4-oxonaphthyridinderivaten |
| DE3509546A1 (de) * | 1985-03-16 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | 7-amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3608745A1 (de) * | 1985-07-24 | 1987-01-29 | Bayer Ag | Bakterizide zubereitungen zur anwendung auf dem gebiet der veterinaermedizin |
| EP0224121A3 (en) * | 1985-11-19 | 1987-11-11 | ROTTAPHARM S.p.A. | 7-[4-amino-piperazinyl]- or 7-[4-chloro-piperazinyl]quinolinone derivatives, a process for the preparation thereof and pharmaceutical compositions containing them |
| DE3542002A1 (de) * | 1985-11-28 | 1987-06-04 | Bayer Ag | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7- (1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4668680A (en) * | 1985-12-12 | 1987-05-26 | Warner-Lambert Company | 5-amino-6,8-difluoroquinolones as antibacterial agents |
| US4689325A (en) * | 1985-12-23 | 1987-08-25 | Abbott Laboratories | Isoxazolo-pyrido-phenoxazine and isothiazolo-pyrido-phenoxazine derivatives |
| US4687770A (en) * | 1985-12-23 | 1987-08-18 | Abbott Laboratories | Isoxazolo-pyrido-benzoxazine and isothiazolo-pyrido-benzoxazine derivatives |
| US4772706A (en) * | 1986-01-13 | 1988-09-20 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| JPS62246541A (ja) * | 1986-01-20 | 1987-10-27 | Kyorin Pharmaceut Co Ltd | ベンゾイル酢酸エステル誘導体とその製造方法 |
| DE3705621C2 (de) * | 1986-02-25 | 1997-01-09 | Otsuka Pharma Co Ltd | Heterocyclisch substituierte Chinoloncarbonsäurederivate |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| JPS63198664A (ja) * | 1986-03-31 | 1988-08-17 | Sankyo Co Ltd | キノロンカルボン酸誘導体 |
| DE3641312A1 (de) * | 1986-12-03 | 1988-06-09 | Bayer Ag | Verfahren zur herstellung von chinolincarbonsaeuren |
| HU198709B (en) * | 1987-04-08 | 1989-11-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing quinoline-carboxylic acid derivatives |
| US5591744A (en) * | 1987-04-16 | 1997-01-07 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| DE3713672A1 (de) * | 1987-04-24 | 1988-11-17 | Bayer Ag | Verfahren zur herstellung von parenteral verabreichbaren chinoloncarbonsaeuren |
| JP2556330B2 (ja) * | 1987-07-09 | 1996-11-20 | 杏林製薬株式会社 | アニソ−ル誘導体並びにその製造方法 |
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| US5164392A (en) * | 1987-10-16 | 1992-11-17 | Dainippon Pharmaceutical Co., Ltd. | Quinoline derivatives and antibacterial agent containing them |
| IL88003A (en) * | 1987-10-16 | 1992-11-15 | Dainippon Pharmaceutical Co | Quinoline derivatives,their preparation and pharmaceutical compositions containing them |
| EP0342849A3 (en) * | 1988-05-19 | 1990-03-14 | Pfizer Inc. | Intermediates for preparing 1,4-dihydro-4-oxo-quinoline-3-carboxylic acid esters |
| KR910003630B1 (ko) * | 1988-06-17 | 1991-06-07 | 한국과학기술원 | 벤조일 아세틱 에스테르 유도체 및 그 제조방법 |
| GR1000201B (el) * | 1988-06-23 | 1992-03-20 | Tsetis Kleon | Mέ?οδος για την παρασκευή του 1-κυκλοπροπυλο-6-φ?ορο-1,4-διϋδρο-4-οξο-7κινολίνο-3-καρβοξυλικού οξέος δομικού λί?ου παρασκευής των 1-κυκλοπρόπυλο-6-φ?όρο-1,4-διϋδρο-4οξο-7-πιπεράζινο-κινολινο 3καρβοξυλικών οξέων. |
| AU618823B2 (en) * | 1988-07-20 | 1992-01-09 | Sankyo Company Limited | 4-oxoquinoline-3-carboxylic acid derivatives, their preparation and their use |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| US5219781A (en) * | 1988-12-08 | 1993-06-15 | Mitsubishi Denki Kabushiki Kaisha | Method for manufacturing semiconductor memory device having a stacked type capacitor |
| FR2655545B1 (fr) * | 1989-12-11 | 1994-06-10 | Rhone Poulenc Sante | Nouvelle application therapeutique des derives des fluoroquinolones. |
| EP0449445A3 (en) * | 1990-03-27 | 1993-08-25 | Pfizer Inc. | Preparation of beta-ketoesters useful in preparing quinolone antibiotics |
| ES2039301B1 (es) * | 1991-11-20 | 1994-05-16 | Genesis Para La Investigacion | Procedimiento de obtencion de nuevos intermedios de sintesis utiles para la preparacion de fluoroquinolonas. |
| ES2050594B1 (es) * | 1991-12-31 | 1994-12-16 | Ind Quimica Agropecuaria S A | Procedimiento para la obtencion de acidos 6-fluoro-1,4-dihidro-4-oxo-7-piperazino-quinolin-3-carboxilicos sustituidos en 1-n. |
| ES2050613B1 (es) * | 1992-10-16 | 1996-03-16 | Iteve S A | Nuevo procedimiento para la preparacion de derivados del acido 1-ciclopropil-3-quinolincarboxilico. |
| US5532239A (en) * | 1993-08-02 | 1996-07-02 | Assistance Publique - Hopitaux De Paris | Therapeutic application of fluoroquinolone derivatives |
| ES2088742B1 (es) | 1994-06-29 | 1997-03-16 | Salvat Lab Sa | Composicion antibiotica de aplicacion otica. |
| AU705718B2 (en) * | 1995-05-24 | 1999-05-27 | Alcon Laboratories, Inc. | Antibacterial compositions |
| DE19547635A1 (de) * | 1995-12-20 | 1997-06-26 | Bayer Ag | Verfahren zur Herstellung von Cyclopropancarbonsäureamiden |
| AU757777B2 (en) | 1998-12-04 | 2003-03-06 | Influx, Inc. | Inhibitors of multidrug transporters |
| WO2001017991A1 (en) | 1999-09-02 | 2001-03-15 | Wakunaga Pharmaceutical Co., Ltd. | Quinolinecarboxylic acid derivative or its salt |
| SE9904108D0 (sv) * | 1999-11-15 | 1999-11-15 | New Pharma Research Ab | Nya föreningar |
| DE10031043A1 (de) | 2000-06-26 | 2002-02-14 | Bayer Ag | Retardzubereitungen von Chinolonantibiotika und Verfahren zu ihrer Herstellung |
| ATE319710T1 (de) | 2000-12-21 | 2006-03-15 | Pharmacia & Upjohn Co Llc | Antimikrobielle chinolonderivate und ihre verwendung zur behandlung bakterieller infektionen |
| US20070197548A1 (en) | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone compositions |
| US7973022B2 (en) | 2006-02-17 | 2011-07-05 | Idexx Laboratories, Inc. | Fluoroquinolone carboxylic acid salt compositions |
| DE102007004732A1 (de) | 2007-01-31 | 2008-08-07 | Bayer Healthcare Ag | Enrofloxacin-Hexahydrat |
| US7902227B2 (en) * | 2007-07-27 | 2011-03-08 | Janssen Pharmaceutica Nv. | C-7 isoxazolinyl quinolone / naphthyridine derivatives useful as antibacterial agents |
| WO2013157018A1 (en) | 2012-04-18 | 2013-10-24 | Indian Institute Of Technology Madras | A process for the preparation of the core structure in quinolone and napthyridone class of antibiotics |
| KR20190016962A (ko) | 2016-06-15 | 2019-02-19 | 와쿠나가 세이야쿠 가부시키 가이샤 | 신규 피리돈카르복실산 유도체 또는 그 염 |
| CN113912539B (zh) * | 2021-12-13 | 2022-03-11 | 山东国邦药业有限公司 | 一种环丙羧酸的合成方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5188973A (ja) * | 1975-01-29 | 1976-08-04 | Shinkinakinoronkarubonsanjudotainoseiho | |
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| JPS5466686A (en) * | 1977-09-20 | 1979-05-29 | Dainippon Pharmaceut Co Ltd | Quinoline-3-carboxylic acid derivative, its preparation, and pharmaceutical composition containig the same |
| US4292317A (en) * | 1977-09-20 | 1981-09-29 | Laboratorie Roger Bellon | 1,4-Dihydro-quinoline-3-carboxylic acid derivatives, process for their preparation and compositions containing them |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| DE3033157A1 (de) * | 1980-09-03 | 1982-04-01 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| JPS5762259A (en) * | 1980-09-05 | 1982-04-15 | Kyorin Pharmaceut Co Ltd | Preparation of substituted quinolinecarboxylic acid derivative |
| IE52125B1 (en) * | 1980-10-02 | 1987-06-24 | Fox Charles L Jun | 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quino-line carboxylic acid and metal salts thereof useful in burn therapy |
| US4788320A (en) * | 1986-01-20 | 1988-11-29 | Kyorin Pharmaceutical Co., Ltd. | Benzoylacetic acid ester derivatives and process for their preparations |
| US4689423A (en) * | 1986-04-01 | 1987-08-25 | Warner-Lambert Company | Process for the preparation of 2,3,4,5-tetrafluorobenzoyl acetates |
| JPS6356224A (ja) * | 1986-08-27 | 1988-03-10 | 株式会社クボタ | マルチ作業機の覆土装置 |
| CA2017090A1 (en) * | 1990-05-17 | 1991-11-17 | Stephen Dunn | Coating composition |
-
1981
- 1981-10-29 DE DE19813142854 patent/DE3142854A1/de not_active Withdrawn
-
1982
- 1982-07-01 IE IE1606/82A patent/IE53709B1/en not_active IP Right Cessation
- 1982-07-05 NO NO822346A patent/NO158018C/no not_active IP Right Cessation
- 1982-07-06 IL IL66243A patent/IL66243A/xx not_active IP Right Cessation
- 1982-07-07 ZA ZA824829A patent/ZA824829B/xx unknown
- 1982-07-07 DK DK306082A patent/DK160491C/da not_active IP Right Cessation
- 1982-07-08 FI FI822442A patent/FI78689C/fi not_active IP Right Cessation
- 1982-07-09 AU AU85768/82A patent/AU561103B2/en not_active Expired
- 1982-07-16 DD DD82241728A patent/DD202560A5/de unknown
- 1982-07-19 EP EP82106472A patent/EP0078362B1/de not_active Expired
- 1982-07-19 AT AT82106472T patent/ATE23040T1/de not_active IP Right Cessation
- 1982-07-19 DE DE8282106472T patent/DE3273892D1/de not_active Expired
- 1982-07-19 KR KR8203203A patent/KR870000895B1/ko not_active Expired
- 1982-07-29 JP JP57131346A patent/JPS5874667A/ja active Granted
- 1982-08-13 CA CA000409435A patent/CA1218067A/en not_active Expired
- 1982-10-25 GR GR69612A patent/GR77707B/el unknown
- 1982-10-26 NZ NZ202278A patent/NZ202278A/en unknown
- 1982-10-28 HU HU823457A patent/HU187580B/hu unknown
- 1982-10-28 ES ES516921A patent/ES8307787A1/es not_active Expired
- 1982-10-28 PH PH28052A patent/PH18803A/en unknown
-
1987
- 1987-04-09 AU AU71405/87A patent/AU573125B2/en not_active Expired
- 1987-04-09 AU AU71406/87A patent/AU573126B2/en not_active Expired
- 1987-05-25 JP JP62127876A patent/JPS6322075A/ja active Granted
- 1987-05-25 JP JP62127878A patent/JPS6322057A/ja active Granted
- 1987-05-25 JP JP62127877A patent/JPS6322076A/ja active Granted
-
1990
- 1990-08-10 DK DK190890A patent/DK162637C/da not_active IP Right Cessation
-
1991
- 1991-05-27 JP JP3151073A patent/JPH0824536B2/ja not_active Expired - Lifetime
-
1993
- 1993-06-24 LU LU88325C patent/LU88325I2/fr unknown
-
1994
- 1994-12-30 NO NO1994030C patent/NO1994030I1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU187580B (en) | Process for producing 1-cyclopropy-6-fluoro-1,4-dihydro-4-oxo-7-piperazino-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing them as active agents | |
| KR920005112B1 (ko) | 7-아미노-1-시클로프로필-6,8-디할로게노-1,4-디히드로-4-옥소-3-퀴놀린카르복실산의 제조방법 | |
| US4544658A (en) | 1-Cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(alkyl-1-piperazinyl)quinoline-3-carboxylic acids, processes for their preparation and antibacterial agents containing them | |
| US4670444A (en) | 7-amino-1-cyclopropyl-4-oxo-1, 4-dihydro-quinoline-and naphthyridine-3-carboxylic acids and antibacterial agents containing these compounds | |
| US5077429A (en) | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-quinoline- and naphthyridine-3-carboxylic acids, processes for their preparation and antibacterial agents containing these compounds | |
| HU192399B (en) | Process for producing quinoloncarboxylic acids and antibacterial pharmaceutical compositions containing them | |
| EP0191185B1 (en) | Quinoline-carboxylic acid derivatives | |
| HU194866B (en) | Process for producing 7-/3-aryl-1-piperazinyl/- and 7-/3-cyclohexyl-1-piperazinyl/-3-quinoline-carboxylic acids and pharmaceutical compositions containing them as active agents | |
| US4559342A (en) | Quinolone acids and antibacterial agents containing these compounds | |
| KR870000896B1 (ko) | 1-시클로프로필-6-플루오로-1,4-디히드로-4-옥소-7-[4-(옥소알킬)-1-피페라지닐] 퀴놀린-3-카복실산 유도체의 제조방법 | |
| HU193623B (en) | Process for producing 6,7-disubstituted-1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtiridine-3-carboxylic acid derivatives and pharmaceutical compositions containing them | |
| HU189916B (en) | Process for production of substituated-1-ethil-1,4-dihydro-4-oxo-kinolin-3-carboxylic acids and 7-/l-pirolil/-derivates of 1-ethil-1,4-dihydro-4-oxo-1,8-naftiridin-3-carboxylic acids and medical preparates consisting of such compounds | |
| US5498615A (en) | Quinolone carboxylic acid derivatives and process for preparing the same | |
| CA2004693A1 (en) | Antibacterial quinolone compounds | |
| JPS6237628B2 (enFirst) | ||
| KR900009024B1 (ko) | 퀴놀론카르복실산 화합물 및 이의 약학적 용도 | |
| JPS6144866A (ja) | キノロン−及びナフチリドン−カルボン酸の製造方法 | |
| KR920001134B1 (ko) | 시프로플록사신의 제조방법 | |
| US5631266A (en) | Quinolone carboxylic acid derivatives and process for preparing the same | |
| HU197893B (en) | Process for producing quinolinecarboxylic acid derivatives and pharmaceutical compositions comprising these compounds as active ingredient | |
| KR870000894B1 (ko) | 퀴놀론 카복실산의 제조방법 | |
| CA1272210A (en) | Alkyl 2,4-dichloro-5-fluorobenzoyl-acetates and process for their preparation | |
| KR870000893B1 (ko) | 퀴놀론 카복실산의 제조방법 | |
| EP0155244A2 (en) | 1-Ethyl-6-fluoro-7-(1H-pirrol-1-yl)-1,4-dihydro-4-oxoquinoline-3-carboxylic acid: preparation and antimicrobial activities | |
| KR870001004B1 (ko) | 퀴놀론 카복실산의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |