GB1576625A - Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof - Google Patents
Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof Download PDFInfo
- Publication number
- GB1576625A GB1576625A GB14916/76A GB1491676A GB1576625A GB 1576625 A GB1576625 A GB 1576625A GB 14916/76 A GB14916/76 A GB 14916/76A GB 1491676 A GB1491676 A GB 1491676A GB 1576625 A GB1576625 A GB 1576625A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compounds
- group
- amino
- methoxyimino
- acetamido
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 71
- 238000002360 preparation method Methods 0.000 title description 38
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 title description 2
- -1 nitro, hydroxy Chemical group 0.000 claims description 290
- 150000001875 compounds Chemical class 0.000 claims description 280
- 238000006243 chemical reaction Methods 0.000 claims description 116
- 125000000217 alkyl group Chemical group 0.000 claims description 99
- 150000003839 salts Chemical class 0.000 claims description 87
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 81
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 72
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 72
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 66
- 239000002253 acid Substances 0.000 claims description 43
- 125000003545 alkoxy group Chemical group 0.000 claims description 35
- 125000001424 substituent group Chemical group 0.000 claims description 35
- 125000004423 acyloxy group Chemical group 0.000 claims description 33
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 33
- 125000006239 protecting group Chemical group 0.000 claims description 31
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 30
- 229910052736 halogen Inorganic materials 0.000 claims description 29
- 150000002367 halogens Chemical group 0.000 claims description 28
- 125000004442 acylamino group Chemical group 0.000 claims description 26
- 238000003379 elimination reaction Methods 0.000 claims description 26
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 26
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 125000001931 aliphatic group Chemical group 0.000 claims description 17
- 125000003342 alkenyl group Chemical group 0.000 claims description 17
- 125000003282 alkyl amino group Chemical group 0.000 claims description 16
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims description 14
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 13
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 13
- 125000003277 amino group Chemical group 0.000 claims description 13
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 13
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 230000007935 neutral effect Effects 0.000 claims description 8
- RTRCVCSWKHSZJC-LNUXAPHWSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)NC=O RTRCVCSWKHSZJC-LNUXAPHWSA-N 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- QDDMXPSXDJRLNO-LESKNEHBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C=1N=C(SC=1)N QDDMXPSXDJRLNO-LESKNEHBSA-N 0.000 claims description 6
- HJJDBAOLQAWBMH-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)=NOC HJJDBAOLQAWBMH-WCRCJTMVSA-N 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- SRSVDFPJBXWEGG-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC(=NN=2)C)C(=O)O)C1=O)C=1N=C(SC=1)N SRSVDFPJBXWEGG-LNUXAPHWSA-N 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 5
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical group [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- FHYWAOQGXIZAAF-LESKNEHBSA-N (6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CO)=C(C(O)=O)N1C(=O)C2NC(=O)C(=NOC)C1=CSC(N)=N1 FHYWAOQGXIZAAF-LESKNEHBSA-N 0.000 claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- TYSUXLWLQIYEPJ-WCRCJTMVSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C=1N=C(SC=1)NC=O TYSUXLWLQIYEPJ-WCRCJTMVSA-N 0.000 claims description 3
- FRJYFZQECCODGB-XPKAQORNSA-N (6R)-7-[[2-methoxyimino-2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC(=NN=2)C)C(=O)O)C1=O)C=1N=C(SC=1)NC(=O)OC(C)(C)CC FRJYFZQECCODGB-XPKAQORNSA-N 0.000 claims description 3
- CZWWCTHQXBMHDA-UHFFFAOYSA-N 3h-1,3-thiazol-2-one Chemical compound OC1=NC=CS1 CZWWCTHQXBMHDA-UHFFFAOYSA-N 0.000 claims description 3
- 208000035473 Communicable disease Diseases 0.000 claims description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000005110 aryl thio group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- ASGIQPRGHDBJBR-XCGJVMPOSA-N (6r)-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1C=C(C(O)=O)N2C(=O)C[C@H]2S1 ASGIQPRGHDBJBR-XCGJVMPOSA-N 0.000 claims description 2
- MCSWUKXFFGUOQE-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-N-(3,11-dioxo-10-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undec-1(8)-en-4-yl)-2-methoxyiminoacetamide Chemical compound C12SCC(COC3=O)=C3N2C(=O)C1NC(=O)C(=NOC)C1=CSC(N)=N1 MCSWUKXFFGUOQE-UHFFFAOYSA-N 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 9
- NWJSHDLORUZMLL-LESKNEHBSA-N (6R)-3-(hydroxymethyl)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CO)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O NWJSHDLORUZMLL-LESKNEHBSA-N 0.000 claims 1
- YSFVFWQKYKNZLS-LESKNEHBSA-N (6R)-3-formyl-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=O)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O YSFVFWQKYKNZLS-LESKNEHBSA-N 0.000 claims 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 claims 1
- 241000786363 Rhampholeon spectrum Species 0.000 description 409
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 282
- 239000000203 mixture Substances 0.000 description 192
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 131
- 239000000243 solution Substances 0.000 description 130
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 121
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 116
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 105
- 239000007864 aqueous solution Substances 0.000 description 96
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 82
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 80
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 79
- 239000002904 solvent Substances 0.000 description 74
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 70
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 69
- 238000003756 stirring Methods 0.000 description 65
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 63
- 238000001816 cooling Methods 0.000 description 59
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 57
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 56
- 239000010410 layer Substances 0.000 description 46
- 239000011541 reaction mixture Substances 0.000 description 46
- 239000013078 crystal Substances 0.000 description 40
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 40
- 235000019341 magnesium sulphate Nutrition 0.000 description 40
- 238000001914 filtration Methods 0.000 description 38
- 230000002829 reductive effect Effects 0.000 description 38
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 35
- 239000000284 extract Substances 0.000 description 35
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 35
- 235000017557 sodium bicarbonate Nutrition 0.000 description 35
- 239000000843 powder Substances 0.000 description 32
- 239000011780 sodium chloride Substances 0.000 description 31
- 125000002252 acyl group Chemical group 0.000 description 29
- 239000000706 filtrate Substances 0.000 description 29
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 27
- 235000011054 acetic acid Nutrition 0.000 description 26
- 239000003921 oil Substances 0.000 description 26
- 239000007858 starting material Substances 0.000 description 26
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 22
- 230000007062 hydrolysis Effects 0.000 description 22
- 238000006460 hydrolysis reaction Methods 0.000 description 22
- 239000000725 suspension Substances 0.000 description 22
- 230000001376 precipitating effect Effects 0.000 description 21
- 229920006395 saturated elastomer Polymers 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 20
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 20
- 229910052783 alkali metal Inorganic materials 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 17
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 16
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 16
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 15
- 238000004440 column chromatography Methods 0.000 description 15
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 14
- 239000002198 insoluble material Substances 0.000 description 14
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 241000699670 Mus sp. Species 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 150000001721 carbon Chemical group 0.000 description 12
- 230000002411 adverse Effects 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- JFPVXVDWJQMJEE-IZRZKJBUSA-N cefuroxime Chemical compound N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)\C(=N/OC)C1=CC=CO1 JFPVXVDWJQMJEE-IZRZKJBUSA-N 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 238000007796 conventional method Methods 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- 235000011181 potassium carbonates Nutrition 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 8
- 241000699666 Mus <mouse, genus> Species 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 230000000844 anti-bacterial effect Effects 0.000 description 8
- 235000019253 formic acid Nutrition 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- NLARCUDOUOQRPB-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(N)=N1 NLARCUDOUOQRPB-UHFFFAOYSA-N 0.000 description 7
- 241000894006 Bacteria Species 0.000 description 7
- 230000008030 elimination Effects 0.000 description 7
- POBMBNPEUPDXRS-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(N)=N1 POBMBNPEUPDXRS-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 150000007522 mineralic acids Chemical class 0.000 description 7
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 7
- 150000007524 organic acids Chemical class 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 7
- 238000010792 warming Methods 0.000 description 7
- DDLWWOLZXHAVNY-PVQCJRHBSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=CC=C1)O DDLWWOLZXHAVNY-PVQCJRHBSA-N 0.000 description 6
- VGIJLQLDEHZKNU-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(O)=C1 VGIJLQLDEHZKNU-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 125000005907 alkyl ester group Chemical group 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 125000001589 carboacyl group Chemical group 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 150000007530 organic bases Chemical class 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 238000005185 salting out Methods 0.000 description 6
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 6
- 235000017281 sodium acetate Nutrition 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- ZZJNYZZMWBXNON-SSDOTTSWSA-N (6R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O ZZJNYZZMWBXNON-SSDOTTSWSA-N 0.000 description 5
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- RVBOFXPFJHCIBC-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 RVBOFXPFJHCIBC-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 241000588724 Escherichia coli Species 0.000 description 5
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 5
- 150000008041 alkali metal carbonates Chemical class 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 5
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 5
- 229960001668 cefuroxime Drugs 0.000 description 5
- 229910001873 dinitrogen Inorganic materials 0.000 description 5
- NWVPUDXLGUWDPK-UHFFFAOYSA-N ethyl 2-hydroxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NO)C1=CSC(C)=N1 NWVPUDXLGUWDPK-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 5
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 150000007529 inorganic bases Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 5
- 239000012046 mixed solvent Substances 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 5
- 230000002633 protecting effect Effects 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- HGZZXAIQRPGHLO-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C(Cl)=C1 HGZZXAIQRPGHLO-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- JZWIECIMQZFZBA-UHFFFAOYSA-N ethyl 2-methoxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(C)=N1 JZWIECIMQZFZBA-UHFFFAOYSA-N 0.000 description 4
- LULLGGWIEBUSRX-UHFFFAOYSA-N ethyl 4-bromo-2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NOC)C(=O)CBr LULLGGWIEBUSRX-UHFFFAOYSA-N 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- XIQUJVRFXPBMHS-UHFFFAOYSA-N hydron;o-prop-2-enylhydroxylamine;chloride Chemical compound Cl.NOCC=C XIQUJVRFXPBMHS-UHFFFAOYSA-N 0.000 description 4
- 208000015181 infectious disease Diseases 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- UPUSOGVFGJXYSC-UHFFFAOYSA-N methyl 2-(3-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=CC(O)=C1 UPUSOGVFGJXYSC-UHFFFAOYSA-N 0.000 description 4
- DUPFUKBMWBUFJO-UHFFFAOYSA-N methyl 2-methoxyimino-2-(3-methoxyphenyl)acetate Chemical compound CON=C(C(=O)OC)C1=CC=CC(OC)=C1 DUPFUKBMWBUFJO-UHFFFAOYSA-N 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 4
- 230000036961 partial effect Effects 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 239000003223 protective agent Substances 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 125000005270 trialkylamine group Chemical group 0.000 description 4
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 4
- NZIYUPNWNHTHLH-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)N NZIYUPNWNHTHLH-WCRCJTMVSA-N 0.000 description 3
- FUJHOWWZSJQUCM-XCWJXAQQSA-N (6R)-7-[[2-(3-acetyloxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)OC(C)=O FUJHOWWZSJQUCM-XCWJXAQQSA-N 0.000 description 3
- DSBFHCFBFBNGPS-LRHAYUFXSA-N (6R)-7-[[2-(3-carbamoyloxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)OC(N)=O DSBFHCFBFBNGPS-LRHAYUFXSA-N 0.000 description 3
- VIGCKDLYZDIDJJ-LRHAYUFXSA-N (6R)-7-[[2-(3-carbamoyloxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)OC(N)=O VIGCKDLYZDIDJJ-LRHAYUFXSA-N 0.000 description 3
- GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 description 3
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 3
- NBDYDHVCTKPDRI-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=CC(O)=C1 NBDYDHVCTKPDRI-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- SRXBNGGXTMGKLV-UHFFFAOYSA-N 2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(=NS(C)(=O)=O)N1C SRXBNGGXTMGKLV-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 3
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 244000052616 bacterial pathogen Species 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- 229940092714 benzenesulfonic acid Drugs 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- HVJCFGLFQGEABA-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate;hydrobromide Chemical compound Br.CCOC(=O)C(=NOC)C1=CSC(N)=N1 HVJCFGLFQGEABA-UHFFFAOYSA-N 0.000 description 3
- TWOSWYTYJIGDMK-UHFFFAOYSA-N ethyl 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(NS(C)(=O)=O)=N1 TWOSWYTYJIGDMK-UHFFFAOYSA-N 0.000 description 3
- HASOOENYFDJEAK-UHFFFAOYSA-N ethyl 2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOC HASOOENYFDJEAK-UHFFFAOYSA-N 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- UVIKGMUJMBEWPS-OTOKDRCRSA-N (6R)-3-[[1-[2-(dimethylamino)ethyl]tetrazol-5-yl]sulfanylmethyl]-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CCN(C)C)C(=O)O)C1=O)C1=CC(=CC=C1)O UVIKGMUJMBEWPS-OTOKDRCRSA-N 0.000 description 2
- SDRAZXKCTYAZCN-JOPIAHFSSA-N (6R)-7-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NC(C)=O SDRAZXKCTYAZCN-JOPIAHFSSA-N 0.000 description 2
- HDVSQRZEMUDAFB-LNUXAPHWSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NC=O HDVSQRZEMUDAFB-LNUXAPHWSA-N 0.000 description 2
- QFSHWZBMAJWAKD-OWPRLUFZSA-N (6R)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl QFSHWZBMAJWAKD-OWPRLUFZSA-N 0.000 description 2
- YVVHNWXUVZZJLN-FBLFFUNLSA-N (6R)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl YVVHNWXUVZZJLN-FBLFFUNLSA-N 0.000 description 2
- SMADMIRXJWEEFP-XPKAQORNSA-N (6R)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-ethoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl SMADMIRXJWEEFP-XPKAQORNSA-N 0.000 description 2
- YAHBOBZNBRCZTE-LRHAYUFXSA-N (6R)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl YAHBOBZNBRCZTE-LRHAYUFXSA-N 0.000 description 2
- AIIAALXOBGNELJ-XPKAQORNSA-N (6R)-7-[[2-(3-chloro-4-methoxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)OC)Cl AIIAALXOBGNELJ-XPKAQORNSA-N 0.000 description 2
- SALOBMMZZLLPHS-LEQGEALCSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1(=CC=CC=C1)SCON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O SALOBMMZZLLPHS-LEQGEALCSA-N 0.000 description 2
- WWJVPVFCVFPNAM-LRHAYUFXSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O WWJVPVFCVFPNAM-LRHAYUFXSA-N 0.000 description 2
- FKUSBJLGFQCGNP-XPKAQORNSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC(=NN=2)C)C(=O)O)C1=O)C1=CC(=CC=C1)O FKUSBJLGFQCGNP-XPKAQORNSA-N 0.000 description 2
- NEPCNTZYVNFCHP-LRHAYUFXSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)O NEPCNTZYVNFCHP-LRHAYUFXSA-N 0.000 description 2
- HXAJFXZLXPUJTD-LRHAYUFXSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2)C(=O)O)C1=O)C1=CC(=CC=C1)O HXAJFXZLXPUJTD-LRHAYUFXSA-N 0.000 description 2
- OFEYSCBDBPNVFO-LRHAYUFXSA-N (6R)-7-[[2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] OFEYSCBDBPNVFO-LRHAYUFXSA-N 0.000 description 2
- ZRRPQGVLWZVEOH-LEQGEALCSA-N (6R)-7-[[2-[(4-bromo-3-hydroxyphenyl)methoxyimino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC=1C=C(CON=C(C(=O)NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)C2=CC=C(C=C2)O)C=CC=1Br ZRRPQGVLWZVEOH-LEQGEALCSA-N 0.000 description 2
- KYSRACREASUUDK-LNUXAPHWSA-N (6R)-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NS(=O)(=O)C KYSRACREASUUDK-LNUXAPHWSA-N 0.000 description 2
- TXNAJCBFBZZSKF-XPKAQORNSA-N (6R)-7-[[2-[3-(methanesulfonamido)phenyl]-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)NS(=O)(=O)C TXNAJCBFBZZSKF-XPKAQORNSA-N 0.000 description 2
- ZCMAJOOQBJFWHE-XPKAQORNSA-N (6R)-7-[[2-ethoxyimino-2-(3-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)O ZCMAJOOQBJFWHE-XPKAQORNSA-N 0.000 description 2
- AFKFIEMYVUCHDP-XCWJXAQQSA-N (6R)-7-[[2-ethoxyimino-2-(3-methoxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)OC AFKFIEMYVUCHDP-XCWJXAQQSA-N 0.000 description 2
- ZPQYBIDWWVGHSN-JOPIAHFSSA-N (6R)-7-[[2-methoxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)C ZPQYBIDWWVGHSN-JOPIAHFSSA-N 0.000 description 2
- FDPNKRIRUWISAG-WCRCJTMVSA-N (6R)-7-[[2-methoxyimino-2-(2-oxo-3H-1,3-thiazol-4-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1NC(SC=1)=O FDPNKRIRUWISAG-WCRCJTMVSA-N 0.000 description 2
- WFXQGXREICDMFM-JOPIAHFSSA-N (6R)-7-[[2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N(C(SC=1)=NS(=O)(=O)C)C WFXQGXREICDMFM-JOPIAHFSSA-N 0.000 description 2
- ZJIANJKJAAXAOC-HWZXHQHMSA-N (6r)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)C(N)[C@H]21 ZJIANJKJAAXAOC-HWZXHQHMSA-N 0.000 description 2
- QSRIABDFMFXWHM-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-[(2,2,2-trichloroacetyl)carbamoyloxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)NC(=O)C(Cl)(Cl)Cl)=C(C(O)=O)N2C(=O)C(N)[C@H]21 QSRIABDFMFXWHM-HWZXHQHMSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- NRRJNSWNWIDHOX-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC=O)=N1 NRRJNSWNWIDHOX-UHFFFAOYSA-N 0.000 description 2
- ZGDJADIWALELKK-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxyiminoacetic acid Chemical compound CC(C)(C)OC(=O)C(C)ON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 ZGDJADIWALELKK-UHFFFAOYSA-N 0.000 description 2
- MDLNSYPSBFFRQV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 MDLNSYPSBFFRQV-UHFFFAOYSA-N 0.000 description 2
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 2
- JOZCNWTTZMKMKP-UHFFFAOYSA-N 2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 JOZCNWTTZMKMKP-UHFFFAOYSA-N 0.000 description 2
- WGAHPPCMFJHWPP-UHFFFAOYSA-N 2-(4-hydroxy-3-nitrophenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 WGAHPPCMFJHWPP-UHFFFAOYSA-N 0.000 description 2
- RWFVZMKKWDZXTC-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C=C1 RWFVZMKKWDZXTC-UHFFFAOYSA-N 0.000 description 2
- OKXSLIQEAFUVDG-UHFFFAOYSA-N 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]-2-oxoacetic acid Chemical compound CCC(C)(C)OC(=O)N=C1NC(C(=O)C(O)=O)=CS1 OKXSLIQEAFUVDG-UHFFFAOYSA-N 0.000 description 2
- ZQBSVRDSLDHQON-UHFFFAOYSA-N 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=NC(C(=O)C(O)=O)=CS1 ZQBSVRDSLDHQON-UHFFFAOYSA-N 0.000 description 2
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 2
- LLKKDHSXDQIHKK-UHFFFAOYSA-N 2-methoxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(C)=N1 LLKKDHSXDQIHKK-UHFFFAOYSA-N 0.000 description 2
- CSKICGDLPJACCN-UHFFFAOYSA-N 2-methoxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(OC)=C1 CSKICGDLPJACCN-UHFFFAOYSA-N 0.000 description 2
- MDEKEOFWAHRGNU-UHFFFAOYSA-N 2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(=O)C(F)(F)F)=N1 MDEKEOFWAHRGNU-UHFFFAOYSA-N 0.000 description 2
- XJAINPOVVPZLBI-UHFFFAOYSA-N 2-methylbutan-2-yl carbonochloridate Chemical compound CCC(C)(C)OC(Cl)=O XJAINPOVVPZLBI-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- PEUIDFFZNZQFPP-UHFFFAOYSA-N CS(=O)(=O)NC1=NC(C(=NO)C(O)=O)=CS1 Chemical compound CS(=O)(=O)NC1=NC(C(=NO)C(O)=O)=CS1 PEUIDFFZNZQFPP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000008351 acetate buffer Substances 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000003113 dilution method Methods 0.000 description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- BTEPYCPXBCCSDL-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(=NO)C1=CSC(N)=N1 BTEPYCPXBCCSDL-UHFFFAOYSA-N 0.000 description 2
- CSAITDDAMOOJCF-UHFFFAOYSA-N ethyl 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(NC=O)=N1 CSAITDDAMOOJCF-UHFFFAOYSA-N 0.000 description 2
- FNZGLUZYTZFOCC-UHFFFAOYSA-N ethyl 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate Chemical compound CCOC(=O)CC1=CSC(=NC(=O)OC(C)(C)CC)N1 FNZGLUZYTZFOCC-UHFFFAOYSA-N 0.000 description 2
- ZDUDYELVFBGZKP-UHFFFAOYSA-N ethyl 2-methoxyimino-2-(2-oxo-3h-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(=O)N1 ZDUDYELVFBGZKP-UHFFFAOYSA-N 0.000 description 2
- YRMWFEHGTIMEPD-UHFFFAOYSA-N ethyl 4-bromo-2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NO)C(=O)CBr YRMWFEHGTIMEPD-UHFFFAOYSA-N 0.000 description 2
- QQTHNMBPRSXIHX-UHFFFAOYSA-N ethyl 4-chloro-2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NOC)C(=O)CCl QQTHNMBPRSXIHX-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- UYCSHWSMVPQQLC-UHFFFAOYSA-N methyl 2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C(Cl)=C1 UYCSHWSMVPQQLC-UHFFFAOYSA-N 0.000 description 2
- XUVLJLAYKCZYNW-UHFFFAOYSA-N methyl 2-(3-chloro-4-methoxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(OC)C(Cl)=C1 XUVLJLAYKCZYNW-UHFFFAOYSA-N 0.000 description 2
- KFETZKZNJICLJB-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C=C1 KFETZKZNJICLJB-UHFFFAOYSA-N 0.000 description 2
- YZNJBWGIACRNIT-UHFFFAOYSA-N methyl 2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetate Chemical compound CON=C(C(=O)OC)C1=CSC(=NS(C)(=O)=O)N1C YZNJBWGIACRNIT-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 239000011369 resultant mixture Substances 0.000 description 2
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 239000001974 tryptic soy broth Substances 0.000 description 2
- 108010050327 trypticase-soy broth Proteins 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- LSSBHOQSJVWGJN-LESKNEHBSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O LSSBHOQSJVWGJN-LESKNEHBSA-N 0.000 description 1
- FLPXGOKWVSECBG-PVQCJRHBSA-N (6R)-3-(hydroxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CO)C(=O)O)C1=O)C1=CC(=CC=C1)O FLPXGOKWVSECBG-PVQCJRHBSA-N 0.000 description 1
- CDVAEKVMTXTOCU-HWZXHQHMSA-N (6R)-4-formyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)C1S[C@H]2N(C(=C1)C(=O)O)C(C2)=O CDVAEKVMTXTOCU-HWZXHQHMSA-N 0.000 description 1
- IXDRKYDLUJLBSZ-FLGXBNSWSA-N (6R)-7-[[2-(1-carboxyethoxyimino)-2-(3-chloro-4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl IXDRKYDLUJLBSZ-FLGXBNSWSA-N 0.000 description 1
- WYDYCTWQAVUMTM-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2C)C(=O)O)C1=O)C=1N=C(SC=1)N WYDYCTWQAVUMTM-LNUXAPHWSA-N 0.000 description 1
- JMDGFSNUIRDAGR-SXMPBOCKSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrochloride Chemical compound Cl.CON=C(C(=O)NC1[C@H]2SCC(CSc3nncs3)=C(N2C1=O)C(O)=O)c1csc(N)n1 JMDGFSNUIRDAGR-SXMPBOCKSA-N 0.000 description 1
- ATLGCITWPNPOLQ-XPKAQORNSA-N (6R)-7-[[2-(3-acetyloxyphenyl)-2-methoxyiminoacetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=CC=C1)OC(C)=O ATLGCITWPNPOLQ-XPKAQORNSA-N 0.000 description 1
- NPYWFWUMRXDNNU-FBLFFUNLSA-N (6R)-7-[[2-(4-hydroxyphenyl)-2-(thiophen-2-ylmethoxyimino)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=CC=C1)CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC=C(C=C1)O NPYWFWUMRXDNNU-FBLFFUNLSA-N 0.000 description 1
- KDFVCYIRODYRNU-LRHAYUFXSA-N (6R)-7-[[2-(4-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC=C(C=C1)O KDFVCYIRODYRNU-LRHAYUFXSA-N 0.000 description 1
- FKIKGBMLDFJVQZ-JOPIAHFSSA-N (6R)-7-[[2-[2-(ethoxycarbonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)NC(=O)OCC FKIKGBMLDFJVQZ-JOPIAHFSSA-N 0.000 description 1
- AWECEMUPQSISDS-XCWJXAQQSA-N (6R)-7-[[2-[4-(dimethylamino)phenyl]-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC=C(C=C1)N(C)C AWECEMUPQSISDS-XCWJXAQQSA-N 0.000 description 1
- CQEQEFBORYBUQM-XPKAQORNSA-N (6R)-7-[[2-methoxyimino-2-(3-methoxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)OC CQEQEFBORYBUQM-XPKAQORNSA-N 0.000 description 1
- AFLBKDZOKBSNFH-WCRCJTMVSA-N (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O AFLBKDZOKBSNFH-WCRCJTMVSA-N 0.000 description 1
- ANDVLUUACKOYBA-WCRCJTMVSA-N (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O ANDVLUUACKOYBA-WCRCJTMVSA-N 0.000 description 1
- JFPVXVDWJQMJEE-LNUXAPHWSA-N (6r)-3-(carbamoyloxymethyl)-7-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(COC(N)=O)=C(C(O)=O)N1C(=O)C2NC(=O)C(=NOC)C1=CC=CO1 JFPVXVDWJQMJEE-LNUXAPHWSA-N 0.000 description 1
- DUSZFPWPQILNNQ-XPJFZRNWSA-N (6r)-4-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C[C@H]2SC1N DUSZFPWPQILNNQ-XPJFZRNWSA-N 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- MYBOTUJPOSBJSE-UHFFFAOYSA-N 1,2,3,7,8,9,10,10a-octahydropyrido[1,2-a][1,4]diazepine Chemical compound C1=CCNCC2CCCCN21 MYBOTUJPOSBJSE-UHFFFAOYSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- GMTSPBYBJKGPJF-UHFFFAOYSA-N 1-(3-chloro-4-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC=C(O)C(Cl)=C1 GMTSPBYBJKGPJF-UHFFFAOYSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- WLPJORSRYZSOSK-UHFFFAOYSA-N 2,2,2-trifluoro-n-(1,3-thiazol-2-yl)acetamide Chemical compound FC(F)(F)C(=O)NC1=NC=CS1 WLPJORSRYZSOSK-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- FZNBZZPMDCQZOP-UHFFFAOYSA-N 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(C)=O)=N1 FZNBZZPMDCQZOP-UHFFFAOYSA-N 0.000 description 1
- URGSBEYHHRKMJL-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetic acid Chemical compound NC1=NC(C(=NO)C(O)=O)=CS1 URGSBEYHHRKMJL-UHFFFAOYSA-N 0.000 description 1
- AMOYMEBHYUTMKJ-UHFFFAOYSA-N 2-(2-phenylethoxy)ethylbenzene Chemical compound C=1C=CC=CC=1CCOCCC1=CC=CC=C1 AMOYMEBHYUTMKJ-UHFFFAOYSA-N 0.000 description 1
- DFSKPEQQIRYPNI-UHFFFAOYSA-N 2-(3-acetyloxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(OC(C)=O)=C1 DFSKPEQQIRYPNI-UHFFFAOYSA-N 0.000 description 1
- UBUPXQFPLZQYGY-UHFFFAOYSA-N 2-(3-carbamoyloxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(OC(N)=O)=C1 UBUPXQFPLZQYGY-UHFFFAOYSA-N 0.000 description 1
- OSTTZPDIXFQGII-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-ethoxyiminoacetic acid Chemical compound CCON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 OSTTZPDIXFQGII-UHFFFAOYSA-N 0.000 description 1
- GOBQBRLUEONTHO-UHFFFAOYSA-N 2-(3-chloro-4-methoxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(OC)C(Cl)=C1 GOBQBRLUEONTHO-UHFFFAOYSA-N 0.000 description 1
- GOIYEFHSLYIQBZ-UHFFFAOYSA-N 2-(3-chloro-4-methoxyphenyl)-2-oxoacetic acid Chemical compound COC1=CC=C(C(=O)C(O)=O)C=C1Cl GOIYEFHSLYIQBZ-UHFFFAOYSA-N 0.000 description 1
- MSKLUHOSYJHLTI-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound ClC1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 MSKLUHOSYJHLTI-UHFFFAOYSA-N 0.000 description 1
- CGXXIWFTHWCOPO-UHFFFAOYSA-N 2-(3-methoxyphenyl)-2-oxoacetic acid Chemical compound COC1=CC=CC(C(=O)C(O)=O)=C1 CGXXIWFTHWCOPO-UHFFFAOYSA-N 0.000 description 1
- PIXZHKBEUCNVFL-UHFFFAOYSA-N 2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C([N+]([O-])=O)=C1 PIXZHKBEUCNVFL-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- AMVYUIXILXXWJS-UHFFFAOYSA-N 2-[(4-bromo-3-hydroxyphenyl)methoxyimino]-2-(4-hydroxyphenyl)acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)=NOCC1=CC=C(Br)C(O)=C1 AMVYUIXILXXWJS-UHFFFAOYSA-N 0.000 description 1
- AQVLHKMMVBCJJY-UHFFFAOYSA-N 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NS(C)(=O)=O)=N1 AQVLHKMMVBCJJY-UHFFFAOYSA-N 0.000 description 1
- NMWQTNWQPALXDK-UHFFFAOYSA-N 2-[3-(methanesulfonamido)phenyl]-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(NS(C)(=O)=O)=C1 NMWQTNWQPALXDK-UHFFFAOYSA-N 0.000 description 1
- ABWSHWSJDKGYQN-UHFFFAOYSA-N 2-[3-(methanesulfonamido)phenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC=CC(C(=O)C(O)=O)=C1 ABWSHWSJDKGYQN-UHFFFAOYSA-N 0.000 description 1
- OBWCANOTHOUKMT-UHFFFAOYSA-N 2-[4-(dimethylamino)phenyl]-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(N(C)C)C=C1 OBWCANOTHOUKMT-UHFFFAOYSA-N 0.000 description 1
- BGIZWGFKUMPOAV-UHFFFAOYSA-N 2-amino-1,3-thiazol-4-ol Chemical compound NC1=NC(O)=CS1 BGIZWGFKUMPOAV-UHFFFAOYSA-N 0.000 description 1
- ILLHORFDXDLILE-UHFFFAOYSA-N 2-bromopropanoyl bromide Chemical compound CC(Br)C(Br)=O ILLHORFDXDLILE-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- PPJOCCVSFQYQTJ-UHFFFAOYSA-N 2-ethoxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CC=CC(O)=C1 PPJOCCVSFQYQTJ-UHFFFAOYSA-N 0.000 description 1
- IYFYSCODANBBNP-UHFFFAOYSA-N 2-ethoxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CC=CC(OC)=C1 IYFYSCODANBBNP-UHFFFAOYSA-N 0.000 description 1
- YNTPIKSPJIQDTM-UHFFFAOYSA-N 2-hydroxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound ON=C(C(O)=O)C1=CC=CC(O)=C1 YNTPIKSPJIQDTM-UHFFFAOYSA-N 0.000 description 1
- ZCHPYTDXVYNYCH-UHFFFAOYSA-N 2-methoxyimino-2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetic acid Chemical compound CCC(C)(C)OC(=O)NC1=NC(C(=NOC)C(O)=O)=CS1 ZCHPYTDXVYNYCH-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- IYTUKSIOQKTZEG-UHFFFAOYSA-N 3-chloro-4-hydroxyphenylacetic acid Natural products OC(=O)CC1=CC=C(O)C(Cl)=C1 IYTUKSIOQKTZEG-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- AGWWTUWTOBEQFE-UHFFFAOYSA-N 4-methyl-1h-1,2,4-triazole-5-thione Chemical compound CN1C=NN=C1S AGWWTUWTOBEQFE-UHFFFAOYSA-N 0.000 description 1
- SCCXADHXVLCUPI-UHFFFAOYSA-N 5h-1,3-thiazol-2-one Chemical class O=C1SCC=N1 SCCXADHXVLCUPI-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- RHICLMJFAINZKL-YMEOYEJQSA-N C(=O)(O)C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1C(C(=C(C=C1)O)Cl)=NOC Chemical compound C(=O)(O)C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1C(C(=C(C=C1)O)Cl)=NOC RHICLMJFAINZKL-YMEOYEJQSA-N 0.000 description 1
- 150000004006 C-nitroso compounds Chemical class 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 241000234435 Lilium Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000219470 Mirabilis Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 229910017912 NH2OH Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ATPFRGQBOVFFQM-WJIDAKASSA-N [(1s,3r,7r,8r,8as)-3-(hydroxymethyl)-8-[2-[(2r,4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate Chemical compound C([C@@H]1[C@H](C)C=CC2=C[C@H](CO)C[C@@H]([C@@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 ATPFRGQBOVFFQM-WJIDAKASSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000316 alkaline earth metal phosphate Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- NVYVHAPFRUEAJN-UHFFFAOYSA-N anisole;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.COC1=CC=CC=C1 NVYVHAPFRUEAJN-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- ZSHHQOWEAFTSBF-UHFFFAOYSA-J calcium magnesium dihydrogen phosphate phosphate Chemical compound P(=O)([O-])([O-])[O-].[Mg+2].P(=O)([O-])(O)O.[Ca+2] ZSHHQOWEAFTSBF-UHFFFAOYSA-J 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- XNVRKLCQBZTGNA-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(N)=N1 XNVRKLCQBZTGNA-UHFFFAOYSA-N 0.000 description 1
- SHQNGLYXRFCPGZ-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)CC1=CSC(N)=N1 SHQNGLYXRFCPGZ-UHFFFAOYSA-N 0.000 description 1
- VJNVIPBXFCGLJH-UHFFFAOYSA-N ethyl 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(NC(=O)OC(C)(C)CC)=N1 VJNVIPBXFCGLJH-UHFFFAOYSA-N 0.000 description 1
- CFIKUJFTFRBHTI-UHFFFAOYSA-N ethyl 2-[2-(ethoxycarbonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate Chemical compound CCOC(=O)NC1=NC(C(=NOC)C(=O)OCC)=CS1 CFIKUJFTFRBHTI-UHFFFAOYSA-N 0.000 description 1
- OEYODLCZSAZKAI-UHFFFAOYSA-N ethyl 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(NS(C)(=O)=O)=N1 OEYODLCZSAZKAI-UHFFFAOYSA-N 0.000 description 1
- LRVKRWBZGGSQIP-UHFFFAOYSA-N ethyl 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetate Chemical compound CCOC(=O)CC1=CSC(NS(C)(=O)=O)=N1 LRVKRWBZGGSQIP-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- UGOCIZBVCIURJA-UHFFFAOYSA-N ethyl n-(1,3-thiazol-2-yl)carbamate Chemical compound CCOC(=O)NC1=NC=CS1 UGOCIZBVCIURJA-UHFFFAOYSA-N 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- RGZRSLKIOCHTSI-UHFFFAOYSA-N hydron;n-methylhydroxylamine;chloride Chemical compound Cl.CNO RGZRSLKIOCHTSI-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- SPUACDWLOLSOQO-UHFFFAOYSA-M methoxyazanium;chloride Chemical compound [Cl-].CO[NH3+] SPUACDWLOLSOQO-UHFFFAOYSA-M 0.000 description 1
- RORQKPVCWZXGLK-UHFFFAOYSA-N methyl 2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C([N+]([O-])=O)=C1 RORQKPVCWZXGLK-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- POOAXOGRBVEUFA-UHFFFAOYSA-N n-(1,3-thiazol-2-yl)formamide Chemical compound O=CNC1=NC=CS1 POOAXOGRBVEUFA-UHFFFAOYSA-N 0.000 description 1
- YERQTUMWIDGYMQ-UHFFFAOYSA-N n-(1,3-thiazol-2-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=NC=CS1 YERQTUMWIDGYMQ-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- NUXCOKIYARRTDC-UHFFFAOYSA-N o-ethylhydroxylamine;hydron;chloride Chemical compound Cl.CCON NUXCOKIYARRTDC-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- XQXPVVBIMDBYFF-UHFFFAOYSA-N para-hydroxyphenylacetic acid Natural products OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008055 phosphate buffer solution Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- PAVLRKXGMXXRRM-LWPABBACSA-M sodium (6R)-3-(carbamoyloxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)[O-])C1=O)C1=CC(=CC=C1)O.[Na+] PAVLRKXGMXXRRM-LWPABBACSA-M 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- FLKYBGKDCCEQQM-ZHWMGRLRSA-M sodium;(6r)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].S1C(C)=NN=C1SCC1=C(C([O-])=O)N2C(=O)C(NC(=O)CN3N=NN=C3)[C@H]2SC1 FLKYBGKDCCEQQM-ZHWMGRLRSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- MXJGKTHZWIGRJG-UHFFFAOYSA-N tert-butyl 2-aminooxyacetate Chemical compound CC(C)(C)OC(=O)CON MXJGKTHZWIGRJG-UHFFFAOYSA-N 0.000 description 1
- CZJIOLXNSPBYNA-UHFFFAOYSA-N tert-butyl 2-aminooxypropanoate Chemical compound NOC(C)C(=O)OC(C)(C)C CZJIOLXNSPBYNA-UHFFFAOYSA-N 0.000 description 1
- CVAWKJKISIPBOD-UHFFFAOYSA-N tert-butyl 2-bromopropanoate Chemical compound CC(Br)C(=O)OC(C)(C)C CVAWKJKISIPBOD-UHFFFAOYSA-N 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (55)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB14916/76A GB1576625A (en) | 1976-04-12 | 1976-04-12 | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof |
| JP51125826A JPS5941995B2 (ja) | 1976-04-12 | 1976-10-19 | 3,7−ジ置換−3−セフエム−4−カルボン酸化合物およびその塩類およびそれらの製造方法 |
| US05/767,700 US4166115A (en) | 1976-04-12 | 1977-02-11 | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| DK075077A DK162391C (da) | 1976-04-12 | 1977-02-21 | Analogifremgangsmaade til fremstilling af syn-isomerer af 3,7-disubstituerede 3-cephem-4-carboxylsyreforbindelser |
| DE19772707565 DE2707565A1 (de) | 1976-04-12 | 1977-02-22 | Syn-isomere von 3,7-disubstituierten-3-cephem-4-carbonsaeureverbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
| SE7701964A SE443981B (sv) | 1976-04-12 | 1977-02-22 | Analogiforfarande for framstellning av syn-isomerer av 3,7 disubstituerade 3-cefem-4-karboxylsyraforeningar |
| ZA00771059A ZA771059B (en) | 1976-04-12 | 1977-02-22 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| CA000272430A CA1337522C (en) | 1976-04-12 | 1977-02-23 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| CH244777A CH638532A5 (de) | 1976-04-12 | 1977-02-25 | Verfahren zur herstellung der syn-isomere von 3,7-disubstituierten 3-cephem-4-carbonsaeuren. |
| HU77FU348A HU177441B (en) | 1976-04-12 | 1977-02-28 | Process for preparing syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acid derivatives |
| HU77FU362A HU183009B (en) | 1976-04-12 | 1977-02-28 | Process for producing 2-oximino-acetic acid derivatives substituted with thiazolyl-4-ring at the 2 position |
| IE2634/80A IE45598B1 (en) | 1976-04-12 | 1977-03-01 | Intermediates in the preparation of syn-isomers of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| IE440/77A IE45597B1 (en) | 1976-04-12 | 1977-03-01 | Syn isomer of 3,7-disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof |
| AT138477A AT358728B (de) | 1976-04-12 | 1977-03-02 | Verfahren zur herstellung von neuen synisomeren von 3,7-disubstituierten 3-cephem-4-carbon- saeureverbindungen |
| FR7707173A FR2348219A1 (fr) | 1976-04-12 | 1977-03-10 | Procede de preparation d'isomeres syn de composes d'acides 3,7-cephem-4-carboxyliques 3,7-disubstitues et nouveaux produits ainsi obtenus, a activite antibacterienne |
| BE175758A BE852427A (fr) | 1976-04-12 | 1977-03-14 | Procede de preparation d'isomeres syn de composes d'acides 3,7-cephem-4-carboxyliques 3,7-disubstitues et nouveaux produits ainsi obtenus |
| ES457191A ES457191A1 (es) | 1976-04-12 | 1977-03-25 | Un procedimiento para preparar el isomero sin de los com- puestos del acido 3-cefem-4-carboxilico sustituido en las posiciones 3 y 7. |
| MX8561A MX155110A (es) | 1976-04-12 | 1977-04-11 | Procedimiento para preparar un intermedio para la obtencion del isomero sin del acido 3-cefem-4-carboxilico disubstituido en las posiciones 3 y 7 |
| MX775624U MX4985E (es) | 1976-04-12 | 1977-04-11 | Procedimiento para preparar el isomero,sin del acido 3-cefem 4-carboxilico disubstituido en las posiciones 3 y 7 |
| KR7700883A KR840000141B1 (ko) | 1976-04-12 | 1977-04-12 | 3, 7-디서브스티튜티드-3-세펨-4-카르복실산화합물의 신(syn) 이성체의 제조방법 |
| NL7703969A NL191259C (nl) | 1976-04-12 | 1977-04-12 | Werkwijze ter bereiding van een geneesmiddel met antibacteriële werking, alsmede werkwijze voor het bereiden van de syn-isomeer van een 7-[2-gesubstitueerd-2-(veretherd oxyimino)aceetamido]-3-(gesubstitueerd methyl)-3-cefem-4-carbonzuurderivaat. |
| AR257178A AR227864A1 (es) | 1976-04-12 | 1977-04-20 | Procedimiento para obtener isomeros syn de compuestos del acido 3-cefem-4-carboxilicos 3,7 disustituidos |
| JP8249077A JPS5368796A (en) | 1976-04-12 | 1977-07-08 | Syn-isomer of 3,7-disubstd.-3-cephem-4-carboxylic acids, and their preventingor treating agents containing their salts as active constituent againstdiseases caused by bacterial infection |
| JP8248977A JPS5368795A (en) | 1976-04-12 | 1977-07-08 | Syn-isomer of 7-substd.-3-methyl-3-cephem-4-carboxylic acids, their salts,and their preparation |
| FR7802762A FR2367756B1 (fr) | 1976-04-12 | 1978-02-01 | Derives 2-alcoxyamino-2-(amino-1,3-thiazolyl) acetiques et leur utilisation |
| US05/883,395 US4544653A (en) | 1976-04-12 | 1978-03-06 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| US05/887,999 US4279818A (en) | 1976-04-12 | 1978-03-20 | Syn-isomers of 7-[2-alkoxyimino-2-(2-amino-thiazol-4-yl)acetamido]-3-[nitrobenzoyl-, or benzoyl-oxymethyl]-3-cephem-4-carboxylic acid |
| AR271541A AR223143A1 (es) | 1976-04-12 | 1978-03-27 | Un procedimiento para preparar el isomero sin de los compuestos del acido 3-cefem-4-carboxilico sustituido en las posiciones 3 y 7 |
| ES468719A ES468719A1 (es) | 1976-04-12 | 1978-04-12 | Un procedimiento para preparar el isomero sin de los com- puestos del acido 3-cefem-4-carboxilico sustituido en las posiciones 3 y 7. |
| US05/916,952 US4316019A (en) | 1976-04-12 | 1978-06-19 | Preparation of syn-isomer of 3-alkanoyloxymethyl-7-(2-alkoxyimino-2-thiazolylacetamido-3-cephem-4-carboxylic acid compounds |
| ES477741A ES477741A1 (es) | 1976-04-12 | 1979-02-15 | Un procedimiento para preparar derivados de acido acetico. |
| US06/040,976 US4877873A (en) | 1976-04-02 | 1979-05-21 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| US06/077,557 US4304770A (en) | 1976-04-12 | 1979-09-21 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| ES485062A ES485062A1 (es) | 1976-04-12 | 1979-10-16 | Un procedimiento para preparar derivados de acido acetico |
| ES485061A ES485061A1 (es) | 1976-04-12 | 1979-10-16 | Un procedimiento para preparar el siomero sin descompuestos de acido 3-cefem-4-carboxilico sustituido en las posiciones 3 y 7 |
| ES485063A ES485063A1 (es) | 1976-04-12 | 1979-10-16 | Un procedimiento para preparar derivados de acido acetico |
| ES485064A ES485064A1 (es) | 1976-04-12 | 1979-10-16 | Un procedimiento para preparar derivados de acido acetico |
| AT0677379A AT372375B (de) | 1976-04-12 | 1979-10-17 | Verfahren zur herstellung von neuen 1,3-thiazol- verbindungen und von deren salzen |
| AT0677579A AT372377B (de) | 1976-04-12 | 1979-10-17 | Verfahren zur herstellung von neuen 1,3-thiazol- verbindungen und von deren salzen |
| JP15697479A JPS5598189A (en) | 1976-04-12 | 1979-12-03 | Syn-isomer of 3, 7-di-substituted-3-cephem-4-carboxylic acid compound, its salt, and their preparation |
| US06/123,164 US4331664A (en) | 1976-04-12 | 1980-02-20 | Syn isomer of 7-[2-cyclo(lower) alkoxyimino-2-(2-amino-or substituted aminothiazol-4-yl)acetamido]-3-lower alkanoyloxymethyl or heterocyclicthiomethyl-3-cephem-4-carboxylic acid compounds |
| US06/240,221 US4364943A (en) | 1976-04-12 | 1981-03-03 | Syn-isomer of 7-[2-alkoxyimino-2-(2-amino-alkanoylamino-or haloalkanoylamino-thiazol-4-yl) acetamids]-3-[hexanoyl-, or phenylalkanoyl-oxymethyl or benzothiazolylthiomethyl]-3-cephem-4-carboxylic acid |
| US06/296,117 US4493833A (en) | 1976-04-12 | 1981-08-25 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds |
| KR1019810003622A KR840000142B1 (ko) | 1976-04-12 | 1981-09-28 | 3,7-이치환-3-세펨-4-카르복실산화합물의 syn-이성체의 제조방법 |
| US06/353,879 US4431643A (en) | 1976-04-12 | 1982-03-01 | Syn-isomer of 3-substituted-7-[2-cyclopentyloxyimino-2-(2-aminothiazol-4-yl)-acetamido]-3 |
| JP58128676A JPS5962597A (ja) | 1976-04-12 | 1983-07-13 | 3,7−ジ置換−3−セフエム−4−カルボン酸化合物のシン異性体およびその塩類およびそれらを製造する方法 |
| CH409683A CH643822A5 (de) | 1976-04-12 | 1983-07-26 | Verfahren zur herstellung der syn-isomeren von 2-oxyiminoessigsaeuren. |
| CH409883A CH643836A5 (de) | 1976-04-12 | 1983-07-26 | Verfahren zur herstellung der syn-isomeren von 2-oxyiminoessigsaeuren. |
| CH409783A CH643823A5 (de) | 1976-04-12 | 1983-07-26 | Verfahren zur herstellung der syn-isomeren von 2-oxyiminoessigsaeuren. |
| CH409583A CH643557A5 (en) | 1976-04-12 | 1983-07-26 | Process for the preparation of syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acids |
| SE8304465A SE457351B (sv) | 1976-04-12 | 1983-08-17 | Tiazolderivat till anvaendning som mellanprodukt foer framstaellning av 3,7 disubstituerade 3-cefem-4-karboxylsyrafoereningar samt foerfarande foer framstaellning daerav |
| US06/525,499 US4804752A (en) | 1976-04-12 | 1983-08-22 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| US06/615,721 US4871860A (en) | 1976-04-12 | 1984-05-31 | Syn-isomer of 3,7-disubstituted-3-cephem-4-caroxylic acid compounds and processes for the preparation thereof |
| US07/370,873 US5079369A (en) | 1976-04-12 | 1989-06-23 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
| JP2261173A JPH0684338B2 (ja) | 1976-04-12 | 1990-09-28 | 置換酢酸誘導体 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB14916/76A GB1576625A (en) | 1976-04-12 | 1976-04-12 | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof |
| GB2349076 | 1976-06-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1576625A true GB1576625A (en) | 1980-10-08 |
Family
ID=26250890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB14916/76A Expired GB1576625A (en) | 1976-04-02 | 1976-04-12 | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof |
Country Status (3)
| Country | Link |
|---|---|
| JP (6) | JPS5941995B2 (enrdf_load_stackoverflow) |
| GB (1) | GB1576625A (enrdf_load_stackoverflow) |
| HU (1) | HU183009B (enrdf_load_stackoverflow) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2188046A (en) * | 1985-05-30 | 1987-09-23 | Shionogi & Co | Hydroxymethylcephem compounds and their preparation |
| US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US4866055A (en) * | 1986-11-25 | 1989-09-12 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives and their crystalline derivatives |
| US4880798A (en) * | 1986-11-25 | 1989-11-14 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US4888332A (en) * | 1983-12-29 | 1989-12-19 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US5064953A (en) * | 1983-12-29 | 1991-11-12 | Mochida Pharmaceutical Co., Ltd. | Intermediates cephalosporin derivatives |
| US5189157A (en) * | 1987-06-16 | 1993-02-23 | Hoffmann La Roche Inc. | Antibacterial cephalosporin compounds |
| EP0832893A1 (en) * | 1996-09-25 | 1998-04-01 | Eisai Chemical Co., Ltd. | Process for the production of cephem compounds |
| CN112480024A (zh) * | 2020-12-11 | 2021-03-12 | 山东金城医药化工有限公司 | 生产氨噻肟酸反式异构体的方法 |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE878433A (fr) * | 1978-08-31 | 1980-02-25 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 3-cephem-4-carboxylique 3,7-disubstitue, nouveaux produits ainsi obtenus et leur utilisation pour leur activite antibacterienne |
| BE878514A (fr) * | 1978-09-04 | 1980-02-29 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 3-cephem-4-carboxylique a disubstitution en positions 3 et 7, nouveaux produits ainsi obtenus et leur utilisation pour leur activite antibacterienne |
| SE439312B (sv) * | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| NL7805715A (nl) * | 1977-06-03 | 1978-12-05 | Hoffmann La Roche | Werkwijze voor het bereiden van acylderivaten. |
| FR2410655A1 (fr) * | 1977-12-05 | 1979-06-29 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-substitue 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| JPS5498795A (en) * | 1978-01-13 | 1979-08-03 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
| JPS54128594A (en) * | 1978-03-27 | 1979-10-05 | Fujisawa Pharmaceut Co Ltd | 3,7-disubstituted-3-cephem-4-carboxylic acid derivative |
| FR2432521A1 (fr) * | 1978-03-31 | 1980-02-29 | Roussel Uclaf | Nouvelles oximes o-substituees derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2421907A1 (fr) * | 1978-04-07 | 1979-11-02 | Roussel Uclaf | Nouvelles cephalosporines derivees de l'acide 7-/2-(2-amino 4-thiazolyl)2-(carboxymethoxyimino/acetamido 3-substitue cephalosporanique, leur procede de preparation et leur application comme medicaments |
| GB1604723A (en) * | 1978-05-26 | 1981-12-16 | Glaxo Operations Ltd | 7-(2-aminothiazol-4-yl)-2-oxyimino-acetamido)-cephem derivatives |
| GB1604722A (en) * | 1978-05-26 | 1981-12-16 | Glaxo Operations Ltd | 7-(2-(2-amino-4-thiozolyl)-2-oxymino-acetamido)-cephem derivatives |
| US4288435A (en) * | 1978-07-17 | 1981-09-08 | Fujisawa Pharmaceutical Co., Ltd. | 3,7-Disubstituted-3-cephem-4-carboxylic acid compounds and pharmaceutical antibacterial compositions containing them |
| US4703046A (en) * | 1978-09-08 | 1987-10-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds and processes for preparation thereof |
| BE878637A (fr) * | 1978-09-11 | 1980-03-06 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 3-cephem-4-carboxylique 3,7-disubstitue et de leurs sels pharmaceutiquement acceptables, nouveaux produits ainsi obtenus et leur utilisation pour leurs activites antimicrobiennes |
| JPH02111750A (ja) * | 1978-09-12 | 1990-04-24 | Fujisawa Pharmaceut Co Ltd | 酪酸誘導体 |
| JPS5585594A (en) * | 1978-11-13 | 1980-06-27 | Fujisawa Pharmaceut Co Ltd | Cephem compound and their preparation |
| JPS5579393A (en) * | 1978-12-11 | 1980-06-14 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
| JPS5616490A (en) * | 1979-07-18 | 1981-02-17 | Hoechst Ag | Cephem compound manufacture |
| IL61458A0 (en) * | 1979-12-07 | 1980-12-31 | Erba Farmitalia | N-substituted thiazolyl derivatives of oximino-substituted cephalosporins, their preparation and pharmalceutical compositions containing them |
| EP0037380B1 (en) * | 1980-03-28 | 1984-09-12 | BIOCHEMIE Gesellschaft m.b.H. | New process for the production of cephalosporin antibiotics, and novel intermediates used in such process and their production |
| IL63207A (en) * | 1980-07-24 | 1985-09-29 | Lonza Ag | Process for the preparation of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyiminoacetic acid esters |
| JPS57154175A (en) * | 1981-03-16 | 1982-09-22 | Mitsui Toatsu Chem Inc | 2-thiazoleamine derivative, its preparation, and drug composition comprising it |
| JPS57157594U (enrdf_load_stackoverflow) * | 1981-03-31 | 1982-10-04 | ||
| WO1984002703A1 (en) * | 1983-01-07 | 1984-07-19 | Takeda Chemical Industries Ltd | Process for preparing aminothiazolylacetic acid derivatives |
| EP0115770B2 (en) * | 1983-01-07 | 1996-06-19 | Takeda Chemical Industries, Ltd. | Thiazole Derivatives |
| WO1984004305A1 (en) * | 1983-05-02 | 1984-11-08 | Takeda Chemical Industries Ltd | Process for preparing aminothiazoleacetic acid derivatives |
| GB8318846D0 (en) * | 1983-07-12 | 1983-08-10 | Fujisawa Pharmaceutical Co | Prophylactic/therapeutic agent against fish diseases |
| JPS60178891A (ja) * | 1984-02-24 | 1985-09-12 | Kureha Chem Ind Co Ltd | セファロスポリン誘導体及び該誘導体を含有する医薬 |
| JPS60155167A (ja) * | 1984-07-31 | 1985-08-15 | Fujisawa Pharmaceut Co Ltd | 置換イミノ酢酸誘導体およびその塩類 |
| JPS6236386A (ja) * | 1985-08-09 | 1987-02-17 | Kureha Chem Ind Co Ltd | セフアロスポリン誘導体、その製造方法及び該誘導体を含有する医薬 |
| JPS6332235A (ja) * | 1986-07-25 | 1988-02-10 | アトラス・エア・(オ−ストラリア)・ピ−テイ−ワイ・リミテツド | 区域空調方法及びその装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1445979A (en) * | 1972-10-25 | 1976-08-11 | Glaxo Lab Ltd | Cephalosporin derivatives |
| GB1453049A (en) * | 1973-08-21 | 1976-10-20 | Glaxo Lab Ltd | Cephalosporing antibiotics |
| JPS4849789A (enrdf_load_stackoverflow) * | 1971-10-25 | 1973-07-13 | ||
| JPS50111093A (enrdf_load_stackoverflow) * | 1974-02-20 | 1975-09-01 | ||
| GB1536281A (en) * | 1975-06-09 | 1978-12-20 | Takeda Chemical Industries Ltd | Cephem compounds |
| SE440655B (sv) * | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
| FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
-
1976
- 1976-04-12 GB GB14916/76A patent/GB1576625A/en not_active Expired
- 1976-10-19 JP JP51125826A patent/JPS5941995B2/ja not_active Expired
-
1977
- 1977-02-28 HU HU77FU362A patent/HU183009B/hu unknown
- 1977-07-08 JP JP8248977A patent/JPS5368795A/ja active Pending
- 1977-07-08 JP JP8249077A patent/JPS5368796A/ja active Granted
-
1979
- 1979-12-03 JP JP15697479A patent/JPS5598189A/ja active Granted
-
1983
- 1983-07-13 JP JP58128676A patent/JPS5962597A/ja active Granted
-
1990
- 1990-09-28 JP JP2261173A patent/JPH0684338B2/ja not_active Expired - Lifetime
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4888332A (en) * | 1983-12-29 | 1989-12-19 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US5064953A (en) * | 1983-12-29 | 1991-11-12 | Mochida Pharmaceutical Co., Ltd. | Intermediates cephalosporin derivatives |
| US4840945A (en) * | 1985-04-01 | 1989-06-20 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US4904791A (en) * | 1985-04-01 | 1990-02-27 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US4956474A (en) * | 1985-04-01 | 1990-09-11 | Mochida Pharmaceutical Co., Ltd. | Intermediates of cephalosporin compounds |
| GB2188046A (en) * | 1985-05-30 | 1987-09-23 | Shionogi & Co | Hydroxymethylcephem compounds and their preparation |
| US4866055A (en) * | 1986-11-25 | 1989-09-12 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives and their crystalline derivatives |
| US4880798A (en) * | 1986-11-25 | 1989-11-14 | Mochida Pharmaceutical Co., Ltd. | Cephalosporin derivatives |
| US5189157A (en) * | 1987-06-16 | 1993-02-23 | Hoffmann La Roche Inc. | Antibacterial cephalosporin compounds |
| EP0832893A1 (en) * | 1996-09-25 | 1998-04-01 | Eisai Chemical Co., Ltd. | Process for the production of cephem compounds |
| CN112480024A (zh) * | 2020-12-11 | 2021-03-12 | 山东金城医药化工有限公司 | 生产氨噻肟酸反式异构体的方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52125190A (en) | 1977-10-20 |
| JPS5368795A (en) | 1978-06-19 |
| JPH0373553B2 (enrdf_load_stackoverflow) | 1991-11-22 |
| JPH0684338B2 (ja) | 1994-10-26 |
| JPS5962597A (ja) | 1984-04-10 |
| HU183009B (en) | 1984-04-28 |
| JPH03135946A (ja) | 1991-06-10 |
| JPS5598189A (en) | 1980-07-25 |
| JPS5368796A (en) | 1978-06-19 |
| JPS6141516B2 (enrdf_load_stackoverflow) | 1986-09-16 |
| JPS6137250B2 (enrdf_load_stackoverflow) | 1986-08-22 |
| JPS5941995B2 (ja) | 1984-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4544653A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| GB1576625A (en) | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof | |
| CA1337522C (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US4544751A (en) | Thiadiazole derivatives | |
| EP0057422B1 (en) | New cephem compounds, processes for preparation thereof and pharmaceutical composition containing them | |
| EP0036673B1 (en) | New thiadiazol compounds and processes for their preparation | |
| EP0055465B1 (en) | 7-acylaminocephalosporanic acid derivatives and processes for the preparation thereof | |
| US4411898A (en) | 7-[2-Oxyimino-2-(2-aminothiazol-4-yl)acetamido]-3-(1-carboxyalkyl-1H-tetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid compounds | |
| US4521413A (en) | Cephem compounds | |
| US4487767A (en) | 7-[Amino or carboxy substituted oxyimino]-3-[amino or alkoxy substituted heterocyclic thiomethyl] cephalosporin derivatives | |
| EP0184227B1 (en) | 2-oxymino 2-aminothiazolyl acetic acid derivatives and processes for preparation thereof | |
| US4304770A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US4703046A (en) | Cephem compounds and processes for preparation thereof | |
| US4331664A (en) | Syn isomer of 7-[2-cyclo(lower) alkoxyimino-2-(2-amino-or substituted aminothiazol-4-yl)acetamido]-3-lower alkanoyloxymethyl or heterocyclicthiomethyl-3-cephem-4-carboxylic acid compounds | |
| US4804752A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US5079369A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US4364943A (en) | Syn-isomer of 7-[2-alkoxyimino-2-(2-amino-alkanoylamino-or haloalkanoylamino-thiazol-4-yl) acetamids]-3-[hexanoyl-, or phenylalkanoyl-oxymethyl or benzothiazolylthiomethyl]-3-cephem-4-carboxylic acid | |
| US4871860A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-caroxylic acid compounds and processes for the preparation thereof | |
| US4493833A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds | |
| US4431643A (en) | Syn-isomer of 3-substituted-7-[2-cyclopentyloxyimino-2-(2-aminothiazol-4-yl)-acetamido]-3 | |
| US4350694A (en) | Cephalosporin analogues and antimicrobial compositions | |
| GB2033377A (en) | New Cephem Compounds and Processes for Preparation Thereof | |
| GB2034692A (en) | New cephem compounds and processes for preparation thereof | |
| GB2023583A (en) | 3,7-disubstituted-3-cephem-4- carboxylic Acid Compounds and Processes for the Preparation Thereof | |
| GB1602965A (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| 704A | Declaration that licence is not available as of right for an excepted use (par. 4a/1977) | ||
| PE20 | Patent expired after termination of 20 years |
Effective date: 19970208 |