FI83231C - Flytande tvaettmedelssammansaettning. - Google Patents
Flytande tvaettmedelssammansaettning. Download PDFInfo
- Publication number
- FI83231C FI83231C FI855123A FI855123A FI83231C FI 83231 C FI83231 C FI 83231C FI 855123 A FI855123 A FI 855123A FI 855123 A FI855123 A FI 855123A FI 83231 C FI83231 C FI 83231C
- Authority
- FI
- Finland
- Prior art keywords
- liquid
- compound
- surfactant
- nonionic surfactant
- viscosity
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 93
- 239000003599 detergent Substances 0.000 claims description 68
- 239000007788 liquid Substances 0.000 claims description 61
- 150000001875 compounds Chemical class 0.000 claims description 44
- 239000002736 nonionic surfactant Substances 0.000 claims description 44
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 43
- 239000004094 surface-active agent Substances 0.000 claims description 41
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 34
- -1 alkylene glycol monoalkyl ether Chemical class 0.000 claims description 28
- 239000000654 additive Substances 0.000 claims description 23
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 23
- 239000000126 substance Substances 0.000 claims description 23
- 150000002191 fatty alcohols Chemical class 0.000 claims description 18
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- 230000002378 acidificating effect Effects 0.000 claims description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 14
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 13
- 239000000725 suspension Substances 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 108090000790 Enzymes Proteins 0.000 claims description 6
- 102000004190 Enzymes Human genes 0.000 claims description 6
- 229920000388 Polyphosphate Polymers 0.000 claims description 6
- 239000012190 activator Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001205 polyphosphate Substances 0.000 claims description 6
- 235000011176 polyphosphates Nutrition 0.000 claims description 6
- 239000003352 sequestering agent Substances 0.000 claims description 6
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 claims description 5
- 239000007844 bleaching agent Substances 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 239000002270 dispersing agent Substances 0.000 claims description 5
- 229940014800 succinic anhydride Drugs 0.000 claims description 5
- 239000002562 thickening agent Substances 0.000 claims description 5
- 239000003349 gelling agent Substances 0.000 claims description 4
- 239000003112 inhibitor Substances 0.000 claims description 4
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical group 0.000 claims description 3
- 230000007797 corrosion Effects 0.000 claims description 3
- 238000005260 corrosion Methods 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 230000003287 optical effect Effects 0.000 claims description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 2
- 239000000975 dye Substances 0.000 claims description 2
- 230000009969 flowable effect Effects 0.000 claims description 2
- 239000002304 perfume Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 1
- 239000002519 antifouling agent Substances 0.000 claims 1
- 239000007791 liquid phase Substances 0.000 claims 1
- 239000003002 pH adjusting agent Substances 0.000 claims 1
- 239000006174 pH buffer Substances 0.000 claims 1
- 239000001384 succinic acid Substances 0.000 claims 1
- 239000000375 suspending agent Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 34
- 239000000499 gel Substances 0.000 description 27
- 239000002245 particle Substances 0.000 description 17
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 238000005406 washing Methods 0.000 description 14
- 238000001879 gelation Methods 0.000 description 13
- 230000000996 additive effect Effects 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 12
- 230000007423 decrease Effects 0.000 description 12
- 239000003623 enhancer Substances 0.000 description 11
- 238000000227 grinding Methods 0.000 description 11
- 238000010790 dilution Methods 0.000 description 10
- 239000012895 dilution Substances 0.000 description 10
- 235000019832 sodium triphosphate Nutrition 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000004721 Polyphenylene oxide Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000049 pigment Substances 0.000 description 8
- 229920000570 polyether Polymers 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 238000007711 solidification Methods 0.000 description 7
- 230000008023 solidification Effects 0.000 description 7
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- 229920002257 Plurafac® Polymers 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 235000012216 bentonite Nutrition 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 229940088598 enzyme Drugs 0.000 description 6
- 150000002430 hydrocarbons Chemical group 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 230000036961 partial effect Effects 0.000 description 6
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 5
- 238000004140 cleaning Methods 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 229910000323 aluminium silicate Inorganic materials 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 230000008014 freezing Effects 0.000 description 4
- 238000007710 freezing Methods 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 229910052717 sulfur Chemical group 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000536 complexating effect Effects 0.000 description 3
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 3
- 238000007046 ethoxylation reaction Methods 0.000 description 3
- 229940051250 hexylene glycol Drugs 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 150000004965 peroxy acids Chemical class 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 150000004760 silicates Chemical class 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229940120146 EDTMP Drugs 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 229930182556 Polyacetal Natural products 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000005215 alkyl ethers Chemical class 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 150000008040 ionic compounds Chemical class 0.000 description 2
- 239000006194 liquid suspension Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920005646 polycarboxylate Polymers 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 2
- 235000021286 stilbenes Nutrition 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 238000004383 yellowing Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- GAWAYYRQGQZKCR-REOHCLBHSA-N (S)-2-chloropropanoic acid Chemical compound C[C@H](Cl)C(O)=O GAWAYYRQGQZKCR-REOHCLBHSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- MXMWUQAFMKOTIQ-UHFFFAOYSA-N 4-(carboxymethoxy)-4-oxobutanoic acid Chemical class OC(=O)CCC(=O)OCC(O)=O MXMWUQAFMKOTIQ-UHFFFAOYSA-N 0.000 description 1
- FUXZRRZSHWQAAA-UHFFFAOYSA-N 5,5-dioxodibenzothiophene-3,7-diamine Chemical compound C1=C(N)C=C2S(=O)(=O)C3=CC(N)=CC=C3C2=C1 FUXZRRZSHWQAAA-UHFFFAOYSA-N 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 108010004032 Bromelains Proteins 0.000 description 1
- HTYJSJYNEDXLJA-UHFFFAOYSA-N C(C)(=O)ON(CN(OC(C)=O)OC(C)=O)OC(C)=O.[K] Chemical compound C(C)(=O)ON(CN(OC(C)=O)OC(C)=O)OC(C)=O.[K] HTYJSJYNEDXLJA-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical group [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 229910019093 NaOCl Inorganic materials 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 108090000787 Subtilisin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- YEDTWOLJNQYBPU-UHFFFAOYSA-N [Na].[Na].[Na] Chemical compound [Na].[Na].[Na] YEDTWOLJNQYBPU-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 235000019835 bromelain Nutrition 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009960 carding Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- SVMUEEINWGBIPD-UHFFFAOYSA-N dodecylphosphonic acid Chemical compound CCCCCCCCCCCCP(O)(O)=O SVMUEEINWGBIPD-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002193 fatty amides Chemical class 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229940055729 papain Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- HJKYXKSLRZKNSI-UHFFFAOYSA-I pentapotassium;hydrogen sulfate;oxido sulfate;sulfuric acid Chemical compound [K+].[K+].[K+].[K+].[K+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O.OS(=O)(=O)O[O-].OS(=O)(=O)O[O-] HJKYXKSLRZKNSI-UHFFFAOYSA-I 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000867 polyelectrolyte Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- ODBPOHVSVJZQRX-UHFFFAOYSA-M sodium;[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methyl-hydroxyphosphinate Chemical compound [Na+].OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)([O-])=O ODBPOHVSVJZQRX-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical class O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- JEVFKQIDHQGBFB-UHFFFAOYSA-K tripotassium;2-[bis(carboxylatomethyl)amino]acetate Chemical class [K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O JEVFKQIDHQGBFB-UHFFFAOYSA-K 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/20—Organic compounds containing oxygen
- C11D3/2068—Ethers
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/72—Ethers of polyoxyalkylene glycols
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0004—Non aqueous liquid compositions comprising insoluble particles
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/687,815 US4753750A (en) | 1984-12-31 | 1984-12-31 | Liquid laundry detergent composition and method of use |
| US68781584 | 1984-12-31 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI855123A0 FI855123A0 (fi) | 1985-12-20 |
| FI855123L FI855123L (fi) | 1986-07-01 |
| FI83231B FI83231B (fi) | 1991-02-28 |
| FI83231C true FI83231C (fi) | 1991-06-10 |
Family
ID=24761969
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI855123A FI83231C (fi) | 1984-12-31 | 1985-12-20 | Flytande tvaettmedelssammansaettning. |
Country Status (30)
| Country | Link |
|---|---|
| US (1) | US4753750A (ca) |
| JP (1) | JPS61223098A (ca) |
| KR (1) | KR930002846B1 (ca) |
| AT (1) | AT394390B (ca) |
| AU (1) | AU589585B2 (ca) |
| BE (1) | BE903972A (ca) |
| BR (1) | BR8506597A (ca) |
| CA (1) | CA1283016C (ca) |
| CH (1) | CH670651A5 (ca) |
| DE (1) | DE3545946A1 (ca) |
| DK (1) | DK163999C (ca) |
| EG (1) | EG17297A (ca) |
| ES (1) | ES8707291A1 (ca) |
| FI (1) | FI83231C (ca) |
| FR (1) | FR2575490B1 (ca) |
| GB (2) | GB2169613B (ca) |
| GR (1) | GR853151B (ca) |
| HK (2) | HK68792A (ca) |
| IN (1) | IN165215B (ca) |
| IT (1) | IT1182004B (ca) |
| LU (1) | LU86234A1 (ca) |
| MX (1) | MX163216B (ca) |
| NL (1) | NL8503592A (ca) |
| NO (1) | NO166334C (ca) |
| NZ (1) | NZ214786A (ca) |
| PT (1) | PT81769B (ca) |
| SE (1) | SE463875B (ca) |
| SG (1) | SG73192G (ca) |
| ZA (1) | ZA859898B (ca) |
| ZM (1) | ZM10585A1 (ca) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5362413A (en) * | 1984-03-23 | 1994-11-08 | The Clorox Company | Low-temperature-effective detergent compositions and delivery systems therefor |
| US4767558A (en) * | 1985-08-05 | 1988-08-30 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| US4769168A (en) * | 1985-08-05 | 1988-09-06 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| IN166313B (ca) * | 1985-08-05 | 1990-04-07 | Colgate Palmolive Co | |
| NZ216987A (en) * | 1985-08-20 | 1988-09-29 | Colgate Palmolive Co | Nonaqueous liquid low phosphate laundry detergent |
| IN168163B (ca) * | 1986-02-21 | 1991-02-16 | Colgate Palmolive Co | |
| US4753748A (en) * | 1986-08-28 | 1988-06-28 | Colgate-Palmolive Company | Nonaqueous liquid automatic dishwashing detergent composition with improved rinse properties and method of use |
| US4772413A (en) * | 1986-08-28 | 1988-09-20 | Colgate-Palmolive Company | Nonaqueous liquid nonbuilt laundry detergent bleach booster composition containing diacetyl methyl amine and method of use |
| NZ221508A (en) * | 1986-08-28 | 1989-09-27 | Colgate Palmolive Co | Nonionic surfactants |
| NZ221525A (en) * | 1986-09-08 | 1989-08-29 | Colgate Palmolive Co | High foam nonionic liquid surfactant detergent comprising ethoxylated fatty alcohol |
| AU602362B2 (en) * | 1986-10-29 | 1990-10-11 | Colgate-Palmolive Company, The | Built nonaqueous liquid nonionic laundry detergent composition containing hexylene glycol and method of use |
| GB8625974D0 (en) * | 1986-10-30 | 1986-12-03 | Unilever Plc | Non-aqueous liquid detergent |
| US4839084A (en) * | 1987-01-27 | 1989-06-13 | Colgate-Palmolive Company | Built liquid laundry detergent composition containing an alkaline earth metal or zinc salt of higher fatty acid liquefying agent and method of use |
| DE3704465C2 (de) * | 1987-02-13 | 1995-11-02 | Roehm Gmbh | Flüssig-Formulierungen von Enzymen |
| US4889652A (en) * | 1988-05-02 | 1989-12-26 | Colgate-Palmolive Company | Non-aqueous, nonionic heavy duty laundry detergent with improved stability using microsperes and/or vicinal-hydroxy compounds |
| DE3818626A1 (de) * | 1988-06-01 | 1989-12-14 | Huels Chemische Werke Ag | Konzentrierte pumpbare polyethercarboxylate |
| FR2632625B1 (fr) * | 1988-06-13 | 1990-09-07 | Atochem | Stabilisation du peroxyde d'hydrogene |
| DE3829315A1 (de) * | 1988-08-30 | 1990-03-01 | Sandoz Ag | Stabile loesungen von carboxymethylierten aethylenoxidaddukten |
| US4874537A (en) * | 1988-09-28 | 1989-10-17 | The Clorox Company | Stable liquid nonaqueous detergent compositions |
| US4919834A (en) * | 1988-09-28 | 1990-04-24 | The Clorox Company | Package for controlling the stability of a liquid nonaqueous detergent |
| GB2237026A (en) * | 1989-10-17 | 1991-04-24 | Eric George Mackay | A cleaning solution and a method of cleaning |
| EP0482275B1 (en) * | 1990-10-22 | 1996-07-10 | The Procter & Gamble Company | Stable liquid detergent compositions containing bleach |
| JPH08503978A (ja) * | 1992-12-03 | 1996-04-30 | ユニリーバー・ナームローゼ・ベンノートシヤープ | 液体洗浄製品 |
| US5424010A (en) * | 1993-01-06 | 1995-06-13 | Duliba; Edward P. | Light duty liquid detergent composition containing 3-methyl-3-methoxy-butanol |
| DE69427137T2 (de) * | 1993-07-19 | 2001-08-16 | Unilever N.V., Rotterdam | Flüssige Reinigungsprodukte |
| JPH10506931A (ja) * | 1994-09-26 | 1998-07-07 | ザ、プロクター、エンド、ギャンブル、カンパニー | 非水性漂白剤含有液体洗剤組成物 |
| US5929012A (en) * | 1995-02-28 | 1999-07-27 | Procter & Gamble Company | Laundry pretreatment with peroxide bleaches containing chelators for iron, copper or manganese for reduced fabric damage |
| CA2231459A1 (en) * | 1995-07-18 | 1997-02-06 | Unilever Plc | Concentrated aqueous degreasing cleanser |
| US5814592A (en) * | 1996-06-28 | 1998-09-29 | The Procter & Gamble Company | Non-aqueous, particulate-containing liquid detergent compositions with elasticized, surfactant-structured liquid phase |
| US6576602B1 (en) * | 1996-06-28 | 2003-06-10 | The Procter & Gamble Company | Nonaqueous, particulate-containing liquid detergent compositions with surfactant-structured liquid phase |
| US6248393B1 (en) | 1998-02-27 | 2001-06-19 | Parker-Hannifin Corporation | Flame retardant EMI shielding materials and method of manufacture |
| KR100353962B1 (ko) * | 1999-12-23 | 2002-09-26 | 박희대 | 저압 발포기용 수용성 세척제 |
| WO2003022977A1 (en) * | 2001-09-10 | 2003-03-20 | The Procter & Gamble Company | Home laundry method |
| JP2011516656A (ja) * | 2008-04-07 | 2011-05-26 | イーコラブ インコーポレイティド | 超濃縮固体脱脂組成物 |
| US9445975B2 (en) * | 2008-10-03 | 2016-09-20 | Access Business Group International, Llc | Composition and method for preparing stable unilamellar liposomal suspension |
| US20110166370A1 (en) | 2010-01-12 | 2011-07-07 | Charles Winston Saunders | Scattered Branched-Chain Fatty Acids And Biological Production Thereof |
| CN103380107B (zh) | 2011-02-17 | 2015-06-10 | 宝洁公司 | 生物基直链烷基苯基磺酸盐 |
| EP2678410B1 (en) | 2011-02-17 | 2017-09-13 | The Procter and Gamble Company | Composiitons comprising mixtures of c10-c13 alkylphenyl sulfonates |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2940938A (en) * | 1956-10-05 | 1960-06-14 | Procter & Gamble | Process of making a colloidal suspension of phosphates |
| CA729145A (en) * | 1962-03-20 | 1966-03-01 | The Procter & Gamble Company | Built liquid detergent |
| US3579453A (en) * | 1968-11-12 | 1971-05-18 | Rohm & Haas | Alkali-soluble surfactant consisting of substituted succinic acid-nonionic ethoxylate blends |
| US3697451A (en) * | 1969-01-02 | 1972-10-10 | Witco Chemical Corp | Stable enzyme containing liquid detergent |
| DK129804A (ca) * | 1969-01-17 | |||
| US3726814A (en) * | 1971-03-15 | 1973-04-10 | Colgate Palmolive Co | Liquid laundry detergents and a process for preparing same |
| SE381672B (sv) * | 1971-07-15 | 1975-12-15 | Mo Och Domsjoe Ab | Flytande tvettmedelskomposition |
| BE794714A (fr) * | 1972-01-31 | 1973-07-30 | Procter & Gamble | Produit detergent liquide |
| FR2193871B1 (ca) * | 1972-07-25 | 1977-07-22 | Colgate Palmolive Co | |
| SE408714B (sv) * | 1974-11-25 | 1979-07-02 | Berol Kemi Ab | Flytande vattenhaltigt tvett- och rengoringsmedel innehallande en ytaktiv del och komplexbildare |
| DE2557403C2 (de) * | 1975-12-19 | 1983-01-13 | Bayer Ag, 5090 Leverkusen | Verfahren zum Aufschluß Kieselsäure-reicher Chromerze |
| US4206070A (en) * | 1975-12-24 | 1980-06-03 | The Procter & Gamble Company | Detergent compositions |
| GB1533390A (en) * | 1976-04-08 | 1978-11-22 | Shell Int Research | Detergent compositions |
| US4137190A (en) * | 1977-04-04 | 1979-01-30 | Gaf Corporation | Detergent composition comprising synergistic hydrotrope mixture of two classes of organic phosphate esters |
| GB1600981A (en) * | 1977-06-09 | 1981-10-21 | Ici Ltd | Detergent composition |
| DE2829697C2 (de) * | 1978-07-06 | 1986-10-30 | Henkel KGaA, 4000 Düsseldorf | Detergenzzusammensetzung |
| US4246466A (en) * | 1979-08-20 | 1981-01-20 | Hooker Chemicals & Plastics Corporation | Electric heat storage apparatus |
| EP0028849B1 (en) * | 1979-11-09 | 1983-09-28 | Unilever N.V. | Non-aqueous, built liquid detergent composition and method for preparing same |
| DE2948100A1 (de) * | 1979-11-29 | 1981-06-11 | Henkel KGaA, 4000 Düsseldorf | Detergenzzusammensetzung |
| CA1204361A (en) * | 1982-03-05 | 1986-05-13 | George B. Keyes | Cleaning composition for glass and similar hard surfaces |
| US4581161A (en) * | 1984-01-17 | 1986-04-08 | Lever Brothers Company | Aqueous liquid detergent composition with dicarboxylic acids and organic solvent |
| US4622173A (en) * | 1984-12-31 | 1986-11-11 | Colgate-Palmolive Co. | Non-aqueous liquid laundry detergents containing three surfactants including a polycarboxylic acid ester of a non-ionic |
-
1984
- 1984-12-31 US US06/687,815 patent/US4753750A/en not_active Expired - Fee Related
-
1985
- 1985-12-19 IN IN1085/DEL/85A patent/IN165215B/en unknown
- 1985-12-20 FI FI855123A patent/FI83231C/fi not_active IP Right Cessation
- 1985-12-23 DK DK604585A patent/DK163999C/da not_active IP Right Cessation
- 1985-12-23 DE DE19853545946 patent/DE3545946A1/de not_active Ceased
- 1985-12-26 MX MX1099A patent/MX163216B/es unknown
- 1985-12-30 BR BR8506597A patent/BR8506597A/pt unknown
- 1985-12-30 LU LU86234A patent/LU86234A1/fr unknown
- 1985-12-30 KR KR1019850009998A patent/KR930002846B1/ko not_active Expired - Lifetime
- 1985-12-30 NO NO855348A patent/NO166334C/no unknown
- 1985-12-30 IT IT48993/85A patent/IT1182004B/it active
- 1985-12-30 ZA ZA859898A patent/ZA859898B/xx unknown
- 1985-12-30 ES ES550535A patent/ES8707291A1/es not_active Expired
- 1985-12-30 SE SE8506151A patent/SE463875B/sv not_active IP Right Cessation
- 1985-12-30 PT PT81769A patent/PT81769B/pt not_active IP Right Cessation
- 1985-12-30 GR GR853151A patent/GR853151B/el unknown
- 1985-12-31 CH CH5561/85A patent/CH670651A5/de not_active IP Right Cessation
- 1985-12-31 NL NL8503592A patent/NL8503592A/nl unknown
- 1985-12-31 BE BE0/216088A patent/BE903972A/fr not_active IP Right Cessation
- 1985-12-31 FR FR8519510A patent/FR2575490B1/fr not_active Expired
- 1985-12-31 AT AT0377885A patent/AT394390B/de not_active IP Right Cessation
- 1985-12-31 GB GB8531947A patent/GB2169613B/en not_active Expired
- 1985-12-31 AU AU51743/85A patent/AU589585B2/en not_active Ceased
- 1985-12-31 CA CA000498815A patent/CA1283016C/en not_active Expired - Lifetime
- 1985-12-31 ZM ZM105/85A patent/ZM10585A1/xx unknown
- 1985-12-31 EG EG838/85A patent/EG17297A/xx active
-
1986
- 1986-01-04 JP JP61000143A patent/JPS61223098A/ja active Pending
- 1986-01-09 NZ NZ214786A patent/NZ214786A/xx unknown
-
1988
- 1988-04-12 GB GB8808547A patent/GB2202233B/en not_active Expired
-
1992
- 1992-07-16 SG SG731/92A patent/SG73192G/en unknown
- 1992-09-10 HK HK687/92A patent/HK68792A/xx unknown
- 1992-10-15 HK HK800/92A patent/HK80092A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI83231C (fi) | Flytande tvaettmedelssammansaettning. | |
| FI80471C (fi) | Stabiliserat, flytande tvaettmedel foer textiler. | |
| FI80470B (fi) | Vattenfri, flytande tvaettmedelssammansaettning foer textiler, som har effektiv rengoeringseffekt. | |
| KR930008480B1 (ko) | 고급지방 디카르복실산을 함유하는 비-겔화 액체세제조성물과 그 사용방법 | |
| AU604149B2 (en) | Hot water wash cycle built nonaqueous liquid nonionic laundry detergent composition containing amphoteric surfactant and method of use | |
| AU598017B2 (en) | Liquid nonionic laundry detergent composition and method of use | |
| AU592812B2 (en) | Built detergent compositions containing stabilizing agents | |
| US4648983A (en) | Built non aqueous liquid nonionic laundry detergent composition containing urea stabilizer and method of use | |
| US4797225A (en) | Nonaqueous liquid nonionic laundry detergent composition containing an alkali metal dithionite or sulfite reduction bleaching agent and method of use | |
| CA1305006C (en) | Built non-aqueous liquid laundry detergent compositions | |
| FI84279C (fi) | Vattenfri flytande tvaettmedelskomposition. | |
| KR940010116B1 (ko) | 저인산염 또는 인산염이 없는 액상의 비수성 비이온계 세탁용 세제조성물 | |
| US4839084A (en) | Built liquid laundry detergent composition containing an alkaline earth metal or zinc salt of higher fatty acid liquefying agent and method of use | |
| NL8702024A (nl) | Niet-waterige vloeibare niet-ionogene wasgoeddetergentcompositie en werkwijze voor het gebruik daarvan. | |
| KR940010115B1 (ko) | 인산염을 함유치 않거나 저함량 함유하는 세탁용 세제 조성물 | |
| CA1291689C (en) | Low phosphate or phosphate free laundry detergent | |
| CA2066008A1 (en) | Foam reduction in non-aqueous, liquid, heavy-duty laundry detergent containing secondary ethoxylate nonionic surfactant |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: COLGATE-PALMOLIVE COMPANY |