FI77460C - Foerfarande och alkali som tillsatsmedel innehaollande katalysator foer direkt syntes av dimetyl-diklorsilan. - Google Patents
Foerfarande och alkali som tillsatsmedel innehaollande katalysator foer direkt syntes av dimetyl-diklorsilan. Download PDFInfo
- Publication number
- FI77460C FI77460C FI843804A FI843804A FI77460C FI 77460 C FI77460 C FI 77460C FI 843804 A FI843804 A FI 843804A FI 843804 A FI843804 A FI 843804A FI 77460 C FI77460 C FI 77460C
- Authority
- FI
- Finland
- Prior art keywords
- weight
- silicon
- tin
- catalyst
- compound
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 26
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000000034 method Methods 0.000 title claims description 17
- 230000015572 biosynthetic process Effects 0.000 title description 9
- 238000003786 synthesis reaction Methods 0.000 title description 9
- 239000000654 additive Substances 0.000 title description 6
- 230000000996 additive effect Effects 0.000 title description 2
- 239000003513 alkali Substances 0.000 title description 2
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 25
- 239000010703 silicon Substances 0.000 claims abstract description 25
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000010949 copper Substances 0.000 claims abstract description 16
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims abstract description 15
- 229910052802 copper Inorganic materials 0.000 claims abstract description 15
- 229910052718 tin Inorganic materials 0.000 claims abstract description 15
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052751 metal Inorganic materials 0.000 claims abstract description 11
- 239000002184 metal Substances 0.000 claims abstract description 11
- 229940050176 methyl chloride Drugs 0.000 claims abstract description 9
- 239000007787 solid Substances 0.000 claims abstract description 9
- 229910052700 potassium Inorganic materials 0.000 claims abstract description 6
- 229910052701 rubidium Inorganic materials 0.000 claims abstract description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000011591 potassium Substances 0.000 claims abstract description 5
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000005749 Copper compound Substances 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 4
- 150000001880 copper compounds Chemical class 0.000 claims abstract description 4
- 229910052744 lithium Inorganic materials 0.000 claims abstract description 4
- 229910052708 sodium Inorganic materials 0.000 claims abstract description 4
- 239000011734 sodium Substances 0.000 claims abstract description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims abstract description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 150000001340 alkali metals Chemical class 0.000 claims description 14
- 229910052725 zinc Inorganic materials 0.000 claims description 10
- 239000011701 zinc Substances 0.000 claims description 10
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 4
- 150000003606 tin compounds Chemical class 0.000 claims description 4
- 150000003752 zinc compounds Chemical class 0.000 claims description 4
- 229960003280 cupric chloride Drugs 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 31
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 abstract description 23
- -1 cesium compound Chemical class 0.000 abstract description 7
- 150000002739 metals Chemical class 0.000 abstract description 3
- 229910052792 caesium Inorganic materials 0.000 abstract 4
- 229910052787 antimony Inorganic materials 0.000 abstract 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 abstract 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 abstract 3
- QABCGOSYZHCPGN-UHFFFAOYSA-N chloro(dimethyl)silicon Chemical compound C[Si](C)Cl QABCGOSYZHCPGN-UHFFFAOYSA-N 0.000 description 18
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 12
- 239000011135 tin Substances 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000001103 potassium chloride Substances 0.000 description 6
- 235000011164 potassium chloride Nutrition 0.000 description 6
- 239000011521 glass Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 5
- 229910000906 Bronze Inorganic materials 0.000 description 4
- 239000005046 Chlorosilane Substances 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000010974 bronze Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 4
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229920001296 polysiloxane Polymers 0.000 description 4
- FGDZQCVHDSGLHJ-UHFFFAOYSA-M rubidium chloride Chemical compound [Cl-].[Rb+] FGDZQCVHDSGLHJ-UHFFFAOYSA-M 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 3
- 229920000548 poly(silane) polymer Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 150000004756 silanes Chemical class 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 150000001339 alkali metal compounds Chemical class 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229940045803 cuprous chloride Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000320 mechanical mixture Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 238000003822 preparative gas chromatography Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910000573 alkali metal alloy Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- YGZSVWMBUCGDCV-UHFFFAOYSA-N chloro(methyl)silane Chemical class C[SiH2]Cl YGZSVWMBUCGDCV-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- FOAZAXXZMUVOGS-UHFFFAOYSA-N methane;tin Chemical compound C.[Sn] FOAZAXXZMUVOGS-UHFFFAOYSA-N 0.000 description 1
- 239000005055 methyl trichlorosilane Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000005120 petroleum cracking Methods 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/12—Organo silicon halides
- C07F7/16—Preparation thereof from silicon and halogenated hydrocarbons direct synthesis
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
- B01J23/70—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper
- B01J23/76—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36
- B01J23/835—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00 of the iron group metals or copper combined with metals, oxides or hydroxides provided for in groups B01J23/02 - B01J23/36 with germanium, tin or lead
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Surface Acoustic Wave Elements And Circuit Networks Thereof (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8315401A FR2552438B1 (fr) | 1983-09-28 | 1983-09-28 | Procede et catalyseur avec un alcalin comme additif pour la synthese directe du dimethyldichlorosilane |
| FR8315401 | 1983-09-28 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI843804A0 FI843804A0 (fi) | 1984-09-27 |
| FI843804L FI843804L (fi) | 1985-03-29 |
| FI77460B FI77460B (fi) | 1988-11-30 |
| FI77460C true FI77460C (fi) | 1989-03-10 |
Family
ID=9292610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI843804A FI77460C (fi) | 1983-09-28 | 1984-09-27 | Foerfarande och alkali som tillsatsmedel innehaollande katalysator foer direkt syntes av dimetyl-diklorsilan. |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4661613A (enExample) |
| EP (1) | EP0138679B1 (enExample) |
| JP (1) | JPS6078641A (enExample) |
| KR (1) | KR900005185B1 (enExample) |
| AT (1) | ATE28462T1 (enExample) |
| AU (1) | AU567583B2 (enExample) |
| BR (1) | BR8404850A (enExample) |
| CA (1) | CA1246532A (enExample) |
| DE (1) | DE3464919D1 (enExample) |
| ES (1) | ES536290A0 (enExample) |
| FI (1) | FI77460C (enExample) |
| FR (1) | FR2552438B1 (enExample) |
| HK (1) | HK62890A (enExample) |
| NO (1) | NO167667C (enExample) |
| NZ (1) | NZ209671A (enExample) |
| PT (1) | PT79275B (enExample) |
| ZA (1) | ZA847490B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4500724A (en) * | 1983-07-28 | 1985-02-19 | General Electric Company | Method for making alkylhalosilanes |
| FR2552437B1 (fr) * | 1983-09-28 | 1986-09-12 | Rhone Poulenc Spec Chim | Procede et catalyseur avec le cesium comme additif pour la synthese directe du dimethyldichlorosilane |
| US4864044A (en) * | 1985-02-15 | 1989-09-05 | Union Carbide Corporation | Tin containing activated silicon for the direct reaction |
| FR2577930B1 (fr) * | 1985-02-22 | 1987-06-05 | Rhone Poulenc Spec Chim | Procede et catalyseur avec un metal alcalino-terreux choisi comme additif parmi le calcium, le magnesium et le beryllium pour la synthese directe du dimethyldichlorosilane |
| FR2577929B1 (fr) * | 1985-02-22 | 1987-06-05 | Rhone Poulenc Spec Chim | Procede et catalyseur avec le baryum et/ou le strontium comme additif pour la synthese directe du dimethyldichlorosilane |
| US4762940A (en) * | 1987-12-11 | 1988-08-09 | Dow Corning Corporation | Method for preparation of alkylhalosilanes |
| US4973725A (en) * | 1988-06-28 | 1990-11-27 | Union Carbide Chemicals And Plastics Company Inc. | Direct synthesis process for organohalohydrosilanes |
| DE3823308A1 (de) * | 1988-07-09 | 1990-01-11 | Bayer Ag | Verfahren zur herstellung von organosilanen |
| DE3841417A1 (de) * | 1988-12-08 | 1990-06-13 | Bayer Ag | Verfahren zur herstellung von organosilanen |
| US4965388A (en) * | 1990-01-02 | 1990-10-23 | Dow Corning Corporation | Method for preparing organohalosilanes |
| US5061672A (en) * | 1990-01-30 | 1991-10-29 | Elkem Metals Company | Active mass for making organohalosilanes |
| FR2665446B1 (fr) * | 1990-07-31 | 1992-11-27 | Rhone Poulenc Chimie | Procede et catalyseur comprenant un compose de lanthanide comme additif promoteur pour la synthese directe du dimethyldichlorosilane. |
| KR950002860B1 (ko) * | 1992-06-13 | 1995-03-27 | 한국과학기술연구원 | 클로로알켄닐실란들과그제조방법 |
| DE4408113A1 (de) * | 1994-03-10 | 1995-09-14 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Methylchlorsilanen |
| KR100407518B1 (ko) * | 1995-12-29 | 2004-02-25 | 고려화학 주식회사 | 디메틸디클로로실란의제조방법 |
| DE19817775A1 (de) * | 1998-04-21 | 1999-10-28 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Organochlorsilanen |
| FR2848124B1 (fr) * | 2002-12-09 | 2006-03-10 | Rhodia Chimie Sa | Utilisation d'une composition comprenant cuivre, metal alcalin et phosphore comme systeme catalytique pour conduire la synthese directe d'alkylhalogenosilanes en attenuant la formation de coke |
| FR2848211B1 (fr) * | 2002-12-09 | 2005-01-14 | Rhodia Chimie Sa | Procede et systeme catalytique comprenant un metal alcalin et du phosphore comme additifs promoteurs pour la synthese directe d'alkylhalogenosilanes |
| FR2861728B1 (fr) * | 2003-11-05 | 2005-12-30 | Rhodia Chimie Sa | Procede de synthese directe d'alkylhalogenosilanes |
| DE102005005052A1 (de) * | 2005-02-03 | 2006-08-10 | Wacker Chemie Ag | Verfahren zur Herstellung von Methylchlorsilanen |
| DE102013209604A1 (de) * | 2013-05-23 | 2014-11-27 | Wacker Chemie Ag | Verfahren zur Herstellung von Methylchlorsilanen |
| WO2020249237A1 (de) * | 2019-06-14 | 2020-12-17 | Wacker Chemie Ag | Verfahren zur herstellung von methylchlorsilanen mit strukturoptimierten silicium-partikeln |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2380995A (en) * | 1941-09-26 | 1945-08-07 | Gen Electric | Preparation of organosilicon halides |
| US2466413A (en) * | 1946-02-21 | 1949-04-05 | Gen Electric | Method of preparation of hydrocarbon-substituted halosilanes |
| FR1046295A (fr) * | 1951-12-11 | 1953-12-04 | Nat D Etudes & De Rech S Aeron | Perfectionnements apportés aux procédés pour la fabrication par synthèse de composés organosiliciques halogénés |
| DE1046619B (de) * | 1954-12-07 | 1958-12-18 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Arylchlorsilanen |
| US2917529A (en) * | 1956-07-10 | 1959-12-15 | Du Pont | Preparation of alkyl chlorosilanes |
| DE1161430B (de) * | 1961-03-30 | 1964-01-16 | Basf Ag | Verfahren zur Herstellung von Alkylchlor-polysilanen und/oder Alkylchlormonosilanen |
| DE1134671B (de) * | 1961-06-22 | 1962-08-16 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Methyl- bzw. AEthylchlorsilanen mit hohem Gehalt an Methyl- bzw. AEthyldichlorsilan |
| SU151336A1 (ru) * | 1961-12-08 | 1962-11-30 | С.А. Голубцов | Способ получени диметилдихлорсилана |
| US3555064A (en) * | 1967-12-22 | 1971-01-12 | Raisa Anatolievna Turetskaya | Method for the manufacture of phenyl and methylphenylchlorosilanes |
| SU810707A1 (ru) * | 1977-02-01 | 1981-03-07 | Предприятие П/Я А-7925 | Способ получени алкилхлорсиланов |
| US4170570A (en) * | 1978-01-03 | 1979-10-09 | Standard Oil Company (Ohio) | Process for preparing oxidation catalysts |
| DE3312775A1 (de) * | 1982-04-16 | 1983-10-27 | General Electric Co., Schenectady, N.Y. | Verfahren zum herstellen von methylchlorsilanen |
| FR2552437B1 (fr) * | 1983-09-28 | 1986-09-12 | Rhone Poulenc Spec Chim | Procede et catalyseur avec le cesium comme additif pour la synthese directe du dimethyldichlorosilane |
-
1983
- 1983-09-28 FR FR8315401A patent/FR2552438B1/fr not_active Expired
-
1984
- 1984-09-11 JP JP59188989A patent/JPS6078641A/ja active Granted
- 1984-09-21 AT AT84401888T patent/ATE28462T1/de not_active IP Right Cessation
- 1984-09-21 EP EP84401888A patent/EP0138679B1/fr not_active Expired
- 1984-09-21 DE DE8484401888T patent/DE3464919D1/de not_active Expired
- 1984-09-24 ZA ZA847490A patent/ZA847490B/xx unknown
- 1984-09-24 AU AU33442/84A patent/AU567583B2/en not_active Ceased
- 1984-09-25 NZ NZ209671A patent/NZ209671A/en unknown
- 1984-09-26 NO NO843855A patent/NO167667C/no unknown
- 1984-09-27 KR KR1019840005937A patent/KR900005185B1/ko not_active Expired
- 1984-09-27 BR BR8404850A patent/BR8404850A/pt not_active IP Right Cessation
- 1984-09-27 CA CA000464202A patent/CA1246532A/fr not_active Expired
- 1984-09-27 ES ES536290A patent/ES536290A0/es active Granted
- 1984-09-27 PT PT79275A patent/PT79275B/pt not_active IP Right Cessation
- 1984-09-27 FI FI843804A patent/FI77460C/fi not_active IP Right Cessation
- 1984-09-28 US US06/655,715 patent/US4661613A/en not_active Expired - Lifetime
-
1990
- 1990-08-09 HK HK628/90A patent/HK62890A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU567583B2 (en) | 1987-11-26 |
| FI843804A0 (fi) | 1984-09-27 |
| DE3464919D1 (en) | 1987-08-27 |
| FI843804L (fi) | 1985-03-29 |
| ES8602822A1 (es) | 1985-12-01 |
| PT79275A (fr) | 1984-10-01 |
| NO167667C (no) | 1991-11-27 |
| ES536290A0 (es) | 1985-12-01 |
| EP0138679A3 (enExample) | 1985-06-26 |
| FR2552438A1 (fr) | 1985-03-29 |
| JPH045678B2 (enExample) | 1992-02-03 |
| FI77460B (fi) | 1988-11-30 |
| NO167667B (no) | 1991-08-19 |
| CA1246532A (fr) | 1988-12-13 |
| NO843855L (no) | 1985-03-29 |
| NZ209671A (en) | 1987-03-31 |
| PT79275B (fr) | 1986-11-18 |
| HK62890A (en) | 1990-08-17 |
| JPS6078641A (ja) | 1985-05-04 |
| EP0138679A2 (fr) | 1985-04-24 |
| FR2552438B1 (fr) | 1985-11-08 |
| AU3344284A (en) | 1985-04-04 |
| EP0138679B1 (fr) | 1987-07-22 |
| KR900005185B1 (ko) | 1990-07-20 |
| ATE28462T1 (de) | 1987-08-15 |
| ZA847490B (en) | 1985-05-29 |
| KR850002832A (ko) | 1985-05-20 |
| US4661613A (en) | 1987-04-28 |
| BR8404850A (pt) | 1985-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI77460C (fi) | Foerfarande och alkali som tillsatsmedel innehaollande katalysator foer direkt syntes av dimetyl-diklorsilan. | |
| FI77040C (fi) | Foerfarande foer direkt syntes av dimetyldiklorsilan. | |
| JP2562833B2 (ja) | トリアルコキシシラン−テトラアルコキシシラン混合物の製造方法 | |
| US5075477A (en) | Direct synthesis of methylchlorosilaakanes | |
| US4645851A (en) | Selective production of dimethyldichlorosilane | |
| US4684741A (en) | Selective production of dimethyldichlorosilane | |
| EP1280733A2 (en) | Method for preparing a contact mass | |
| US5117030A (en) | Catalyst/promoter for direct synthesis of dimethyldichlorosilane | |
| US4487950A (en) | Method for making methylchlorosilanes | |
| KR100514566B1 (ko) | 할로실란 알킬의 제조 방법 | |
| JP5529272B2 (ja) | クロロシランからハイドロジェンシランへの水素化脱塩素のための触媒および該触媒を用いたハイドロジェンシランの製造方法 | |
| CA1336607C (en) | Preparation of organosilanes | |
| KR101153590B1 (ko) | 페닐클로로실란의 제조 방법 | |
| JPS6337117B2 (enExample) | ||
| KR100785673B1 (ko) | 알킬할로게노실란의 직접 합성을 위한 촉매 시스템 및 방법 | |
| KR100785674B1 (ko) | 알킬할로실란의 직접 합성을 위한 구리, 인 및 알칼리 금속기재 촉매 조성물 | |
| NO831302L (no) | Fremgangsmaate for fremstilling av metylklorsilaner | |
| JPH04297483A (ja) | オルガノハロシラン類の調製方法 | |
| AU703621B2 (en) | Method of producing alkyl halogen silanes | |
| US5120520A (en) | Silane products from reaction of solid silicon monoxide with aromatic halides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: RHONE-POULENC SPECIALITES CHIMIQUES |