FI76073C - Foerfarande och mellanprodukt foer framstaellning av terapeutiskt verksamma 1-fenyl-2-aminokarbonyl- indolfoereningar och deras mellanprodukter. - Google Patents
Foerfarande och mellanprodukt foer framstaellning av terapeutiskt verksamma 1-fenyl-2-aminokarbonyl- indolfoereningar och deras mellanprodukter. Download PDFInfo
- Publication number
- FI76073C FI76073C FI822722A FI822722A FI76073C FI 76073 C FI76073 C FI 76073C FI 822722 A FI822722 A FI 822722A FI 822722 A FI822722 A FI 822722A FI 76073 C FI76073 C FI 76073C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- compounds
- lower alkyl
- lower alkoxy
- hydroxy
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 150
- 239000002253 acid Substances 0.000 claims abstract description 52
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 38
- 239000001257 hydrogen Substances 0.000 claims abstract description 38
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 38
- 238000000034 method Methods 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 12
- SHVVLJKMYJRHOL-UHFFFAOYSA-N 1-phenylindole-2-carboxamide Chemical class NC(=O)C1=CC2=CC=CC=C2N1C1=CC=CC=C1 SHVVLJKMYJRHOL-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 8
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 34
- 150000002367 halogens Chemical class 0.000 claims description 29
- 229910052736 halogen Inorganic materials 0.000 claims description 28
- 150000002431 hydrogen Chemical class 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- JZQYAVBXJCQSOK-UHFFFAOYSA-N n-[3-(diethylamino)-2-hydroxypropyl]-3-methoxy-1-phenylindole-2-carboxamide Chemical compound CCN(CC)CC(O)CNC(=O)C1=C(OC)C2=CC=CC=C2N1C1=CC=CC=C1 JZQYAVBXJCQSOK-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 2
- -1 cycloalkylalkyl radical Chemical class 0.000 abstract description 33
- 239000000543 intermediate Substances 0.000 abstract description 10
- 230000003288 anthiarrhythmic effect Effects 0.000 abstract description 7
- 125000005843 halogen group Chemical group 0.000 abstract 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- 238000006243 chemical reaction Methods 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 44
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 150000007513 acids Chemical class 0.000 description 14
- 239000002585 base Substances 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 229910052783 alkali metal Inorganic materials 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 125000006239 protecting group Chemical group 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 7
- 150000007529 inorganic bases Chemical class 0.000 description 7
- 150000007530 organic bases Chemical class 0.000 description 7
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 229940086542 triethylamine Drugs 0.000 description 7
- VUDOZMPZIKJIRP-UHFFFAOYSA-N 3-methoxy-1-phenylindole-2-carboxylic acid Chemical compound C12=CC=CC=C2C(OC)=C(C(O)=O)N1C1=CC=CC=C1 VUDOZMPZIKJIRP-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000010640 amide synthesis reaction Methods 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 5
- 229940106681 chloroacetic acid Drugs 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 238000007912 intraperitoneal administration Methods 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 208000003663 ventricular fibrillation Diseases 0.000 description 5
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 206010003119 arrhythmia Diseases 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 150000004292 cyclic ethers Chemical class 0.000 description 4
- 238000006266 etherification reaction Methods 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 231100000816 toxic dose Toxicity 0.000 description 4
- 206010047302 ventricular tachycardia Diseases 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- LEJMOTVCCRDZNE-UHFFFAOYSA-N 1-amino-3-(diethylamino)propan-2-ol Chemical compound CCN(CC)CC(O)CN LEJMOTVCCRDZNE-UHFFFAOYSA-N 0.000 description 3
- XFSBVAOIAHNAPC-XTHSEXKGSA-N 16-Ethyl-1alpha,6alpha,19beta-trimethoxy-4-(methoxymethyl)-aconitane-3alpha,8,10alpha,11,18alpha-pentol, 8-acetate 10-benzoate Chemical compound O([C@H]1[C@]2(O)C[C@H]3[C@@]45C6[C@@H]([C@@]([C@H]31)(OC(C)=O)[C@@H](O)[C@@H]2OC)[C@H](OC)[C@@H]4[C@]([C@@H](C[C@@H]5OC)O)(COC)CN6CC)C(=O)C1=CC=CC=C1 XFSBVAOIAHNAPC-XTHSEXKGSA-N 0.000 description 3
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 3
- FGERXQWKKIVFQG-UHFFFAOYSA-N 5-bromo-2-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1Cl FGERXQWKKIVFQG-UHFFFAOYSA-N 0.000 description 3
- XFSBVAOIAHNAPC-UHFFFAOYSA-N Aconitin Natural products CCN1CC(C(CC2OC)O)(COC)C3C(OC)C(C(C45)(OC(C)=O)C(O)C6OC)C1C32C4CC6(O)C5OC(=O)C1=CC=CC=C1 XFSBVAOIAHNAPC-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 229940039750 aconitine Drugs 0.000 description 3
- STDXGNLCJACLFY-UHFFFAOYSA-N aconitine Natural products CCN1CC2(COC)C(O)CC(O)C34C5CC6(O)C(OC)C(O)C(OC(=O)C)(C5C6OC(=O)c7ccccc7)C(C(OC)C23)C14 STDXGNLCJACLFY-UHFFFAOYSA-N 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 3
- 150000008046 alkali metal hydrides Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- FIPKYULXDOPLTJ-UHFFFAOYSA-N methyl 5-bromo-3-methoxy-1-phenylindole-2-carboxylate Chemical compound COC(=O)C1=C(OC)C2=CC(Br)=CC=C2N1C1=CC=CC=C1 FIPKYULXDOPLTJ-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 2
- UPSPBEBNRCBILT-UHFFFAOYSA-N 3-ethoxy-1-phenylindole-2-carboxylic acid Chemical compound C12=CC=CC=C2C(OCC)=C(C(O)=O)N1C1=CC=CC=C1 UPSPBEBNRCBILT-UHFFFAOYSA-N 0.000 description 2
- AIGFWMUPKDTJIU-UHFFFAOYSA-N 3-methoxy-5-methyl-1-phenylindole-2-carboxylic acid Chemical compound C12=CC=C(C)C=C2C(OC)=C(C(O)=O)N1C1=CC=CC=C1 AIGFWMUPKDTJIU-UHFFFAOYSA-N 0.000 description 2
- LPUWYOYEASKNNC-UHFFFAOYSA-N 5-bromo-2-[n-(carboxymethyl)anilino]benzoic acid Chemical compound C=1C=C(Br)C=C(C(O)=O)C=1N(CC(=O)O)C1=CC=CC=C1 LPUWYOYEASKNNC-UHFFFAOYSA-N 0.000 description 2
- KQHNCAVDFNHPNO-UHFFFAOYSA-N 5-bromo-n-[3-(diethylamino)-2-hydroxypropyl]-3-methoxy-1-phenylindole-2-carboxamide Chemical compound CCN(CC)CC(O)CNC(=O)C1=C(OC)C2=CC(Br)=CC=C2N1C1=CC=CC=C1 KQHNCAVDFNHPNO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- QTQJWVXWZMPQAE-UHFFFAOYSA-N CN(C)CC(CNC(=O)C1=C(C2=CC=CC=C2N1C3=CC=CC=C3)OC)O Chemical compound CN(C)CC(CNC(=O)C1=C(C2=CC=CC=C2N1C3=CC=CC=C3)OC)O QTQJWVXWZMPQAE-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 208000000418 Premature Cardiac Complexes Diseases 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000003416 antiarrhythmic agent Substances 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- DRZNIGZXXAPLOU-UHFFFAOYSA-N methyl 3-ethoxy-1-phenylindole-2-carboxylate Chemical compound C12=CC=CC=C2C(OCC)=C(C(=O)OC)N1C1=CC=CC=C1 DRZNIGZXXAPLOU-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- CAOXMPJAYNYUSR-UHFFFAOYSA-N n-(2,3-dihydroxypropyl)-3-methoxy-1-phenylindole-2-carboxamide Chemical compound C12=CC=CC=C2C(OC)=C(C(=O)NCC(O)CO)N1C1=CC=CC=C1 CAOXMPJAYNYUSR-UHFFFAOYSA-N 0.000 description 2
- PANBHHKTJFSYKE-UHFFFAOYSA-N n-[3-(diethylamino)-2-hydroxypropyl]-1-(2,4-dimethoxyphenyl)-3-methoxyindole-2-carboxamide Chemical compound CCN(CC)CC(O)CNC(=O)C1=C(OC)C2=CC=CC=C2N1C1=CC=C(OC)C=C1OC PANBHHKTJFSYKE-UHFFFAOYSA-N 0.000 description 2
- LBWVSSLTSGEHNV-UHFFFAOYSA-N n-ethyl-3-methoxy-1-phenylindole-2-carboxamide Chemical compound CCNC(=O)C1=C(OC)C2=CC=CC=C2N1C1=CC=CC=C1 LBWVSSLTSGEHNV-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 230000003449 preventive effect Effects 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- HGXCCLZGBIJLBZ-UHFFFAOYSA-N 1-(2,4-dimethoxyphenyl)-3-methoxyindole-2-carboxylic acid Chemical compound C12=CC=CC=C2C(OC)=C(C(O)=O)N1C1=CC=C(OC)C=C1OC HGXCCLZGBIJLBZ-UHFFFAOYSA-N 0.000 description 1
- WMHIWHPGXRRKJM-UHFFFAOYSA-N 1-phenylindole-2-carboxylic acid Chemical class OC(=O)C1=CC2=CC=CC=C2N1C1=CC=CC=C1 WMHIWHPGXRRKJM-UHFFFAOYSA-N 0.000 description 1
- VFHUJFBEFDVZPJ-UHFFFAOYSA-N 1h-indole-2-carboxamide Chemical class C1=CC=C2NC(C(=O)N)=CC2=C1 VFHUJFBEFDVZPJ-UHFFFAOYSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WVUULNDRFBHTFG-UHFFFAOYSA-N 3-chloro-n,n-diethylpropan-1-amine Chemical compound CCN(CC)CCCCl WVUULNDRFBHTFG-UHFFFAOYSA-N 0.000 description 1
- RFJAMPBJDBLPQQ-UHFFFAOYSA-N 3-methoxy-1-phenylindole-2-carbonyl chloride Chemical compound C12=CC=CC=C2C(OC)=C(C(Cl)=O)N1C1=CC=CC=C1 RFJAMPBJDBLPQQ-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- YPZZNBGNTSTCNL-UHFFFAOYSA-N 5-bromo-3-methoxy-1-phenylindole-2-carboxylic acid Chemical compound C12=CC=C(Br)C=C2C(OC)=C(C(O)=O)N1C1=CC=CC=C1 YPZZNBGNTSTCNL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- ZQTQPYJGMWHXMO-UHFFFAOYSA-N OOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOO ZQTQPYJGMWHXMO-UHFFFAOYSA-N 0.000 description 1
- FYKAKDPHDGCKTF-UHFFFAOYSA-N OOOOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOOOO FYKAKDPHDGCKTF-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 206010038669 Respiratory arrest Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 206010047281 Ventricular arrhythmia Diseases 0.000 description 1
- CVBIBJYUKLXHOH-UHFFFAOYSA-N [2-hydroxy-3-[(3-methoxy-1-phenylindole-2-carbonyl)amino]propyl] 4-methylbenzenesulfonate Chemical compound C=1C=CC=CC=1N1C2=CC=CC=C2C(OC)=C1C(=O)NCC(O)COS(=O)(=O)C1=CC=C(C)C=C1 CVBIBJYUKLXHOH-UHFFFAOYSA-N 0.000 description 1
- DXGTUUQHTDOFFQ-UHFFFAOYSA-N [N].C1=CC=C2NC=CC2=C1 Chemical group [N].C1=CC=C2NC=CC2=C1 DXGTUUQHTDOFFQ-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 230000006229 amino acid addition Effects 0.000 description 1
- 125000005096 aminoalkylaminocarbonyl group Chemical group 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- ZFFRPTQZUPFNKK-UHFFFAOYSA-N ethyl(oxiran-2-ylmethyl)carbamic acid Chemical compound CCN(C(O)=O)CC1CO1 ZFFRPTQZUPFNKK-UHFFFAOYSA-N 0.000 description 1
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000013401 experimental design Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 210000003194 forelimb Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 125000003387 indolinyl group Chemical class N1(CCC2=CC=CC=C12)* 0.000 description 1
- PCKPVGOLPKLUHR-UHFFFAOYSA-N indoxyl Chemical class C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- QUNONUINNDDPOX-UHFFFAOYSA-N methyl 3-methoxy-1-phenylindole-2-carboxylate Chemical compound COC(=O)C1=C(OC)C2=CC=CC=C2N1C1=CC=CC=C1 QUNONUINNDDPOX-UHFFFAOYSA-N 0.000 description 1
- JJGASEQCCIBHPY-UHFFFAOYSA-N methyl 3-methoxy-5-methyl-1-phenylindole-2-carboxylate Chemical compound COC(=O)C1=C(OC)C2=CC(C)=CC=C2N1C1=CC=CC=C1 JJGASEQCCIBHPY-UHFFFAOYSA-N 0.000 description 1
- AVRFEFWZIIFRQQ-UHFFFAOYSA-N methyl 3-methoxy-5-methyl-1h-indole-2-carboxylate Chemical compound C1=C(C)C=C2C(OC)=C(C(=O)OC)NC2=C1 AVRFEFWZIIFRQQ-UHFFFAOYSA-N 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- FBGDWUDGXBSDJC-UHFFFAOYSA-N n-[3-(diethylamino)-2-hydroxypropyl]-3-ethoxy-1-phenylindole-2-carboxamide Chemical compound C12=CC=CC=C2C(OCC)=C(C(=O)NCC(O)CN(CC)CC)N1C1=CC=CC=C1 FBGDWUDGXBSDJC-UHFFFAOYSA-N 0.000 description 1
- QFDGNFAPAMWAAM-UHFFFAOYSA-N n-[3-(diethylamino)-2-hydroxypropyl]-3-methoxy-1-phenylindole-2-carboxamide;hydrochloride Chemical compound Cl.CCN(CC)CC(O)CNC(=O)C1=C(OC)C2=CC=CC=C2N1C1=CC=CC=C1 QFDGNFAPAMWAAM-UHFFFAOYSA-N 0.000 description 1
- POJFCHQFQFJQSL-UHFFFAOYSA-N n-[3-(diethylamino)-2-hydroxypropyl]-3-methoxy-5-methyl-1-phenylindole-2-carboxamide Chemical compound CCN(CC)CC(O)CNC(=O)C1=C(OC)C2=CC(C)=CC=C2N1C1=CC=CC=C1 POJFCHQFQFJQSL-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- NARVIWMVBMUEOG-UHFFFAOYSA-N prop-1-en-2-ol Chemical group CC(O)=C NARVIWMVBMUEOG-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000001020 rhythmical effect Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- FVIRGMIYFJWRGC-UHFFFAOYSA-N sulfurobromidic acid Chemical class OS(Br)(=O)=O FVIRGMIYFJWRGC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 210000001364 upper extremity Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3131527 | 1981-08-08 | ||
| DE19813131527 DE3131527A1 (de) | 1981-08-08 | 1981-08-08 | 1-phenyl-2-aminocarbonylindol-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI822722A0 FI822722A0 (fi) | 1982-08-05 |
| FI822722L FI822722L (fi) | 1983-02-09 |
| FI76073B FI76073B (fi) | 1988-05-31 |
| FI76073C true FI76073C (fi) | 1988-09-09 |
Family
ID=6138966
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI822722A FI76073C (fi) | 1981-08-08 | 1982-08-05 | Foerfarande och mellanprodukt foer framstaellning av terapeutiskt verksamma 1-fenyl-2-aminokarbonyl- indolfoereningar och deras mellanprodukter. |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US4803198A (enExample) |
| EP (1) | EP0071935B1 (enExample) |
| JP (1) | JPS58159459A (enExample) |
| AT (1) | ATE16478T1 (enExample) |
| AU (1) | AU554976B2 (enExample) |
| CA (1) | CA1189859A (enExample) |
| DD (1) | DD202542A5 (enExample) |
| DE (2) | DE3131527A1 (enExample) |
| DK (1) | DK156569B (enExample) |
| ES (4) | ES8400403A1 (enExample) |
| FI (1) | FI76073C (enExample) |
| GR (1) | GR76804B (enExample) |
| HU (1) | HU186962B (enExample) |
| IE (1) | IE53646B1 (enExample) |
| IL (1) | IL66485A (enExample) |
| NO (1) | NO156526C (enExample) |
| NZ (1) | NZ201514A (enExample) |
| PH (1) | PH18886A (enExample) |
| PT (1) | PT75352B (enExample) |
| SU (2) | SU1195903A3 (enExample) |
| ZA (1) | ZA825667B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3304019A1 (de) * | 1983-02-07 | 1984-08-09 | Kali-Chemie Pharma Gmbh, 3000 Hannover | 3-acyloxy-1-phenyl-2-aminocarbonylindol-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US4675332A (en) * | 1984-12-10 | 1987-06-23 | Warner-Lambert Company | Acidic tetrazolyl substituted indole compounds and their use as antiallergy agents |
| US5047402A (en) * | 1988-04-13 | 1991-09-10 | Ici Americas Inc. | Cyclic amides as medicaments |
| US5395817A (en) * | 1992-01-22 | 1995-03-07 | Imperial Chemical Industries Plc | N-arylindoles and their use as herbicides |
| US5599774A (en) * | 1992-01-22 | 1997-02-04 | Imperial Chemical Industries Plc | N-arylindoles and their use as herbicides |
| ZA939516B (en) * | 1992-12-22 | 1994-06-06 | Smithkline Beecham Corp | Endothelin receptor antagonists |
| US5424329A (en) * | 1993-08-18 | 1995-06-13 | Warner-Lambert Company | Indole-2-carboxamides as inhibitors of cell adhesion |
| US5686481A (en) * | 1993-12-21 | 1997-11-11 | Smithkline Beecham Corporation | Endothelin receptor antagonists |
| US5684032A (en) * | 1994-12-13 | 1997-11-04 | Smithkline Beecham Corporation | Compounds |
| DE19532054A1 (de) * | 1995-08-31 | 1997-03-06 | Hoechst Ag | Verfahren zur Herstellung von N-Carboxymethylen-4-chlor-anthranilsäure, sowie deren Dialkylestern |
| KR100627616B1 (ko) * | 1997-05-09 | 2006-09-26 | 하. 룬트벡 아크티에 셀스카브 | 세르틴돌의 제조방법 |
| NZ582056A (en) * | 2007-08-10 | 2012-08-31 | Lundbeck & Co As H | Bicyclic heteroaryl compounds for treating conditions related to p2x7 receptor activation |
| KR20180017013A (ko) | 2015-05-06 | 2018-02-20 | 더 리젠츠 오브 더 유니버시티 오브 캘리포니아 | K-Ras 조절제 |
| EP3612526A2 (en) | 2017-04-20 | 2020-02-26 | The Regents of the University of California | K-ras modulators |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE105495C (enExample) * | ||||
| DE158089C (enExample) * | ||||
| BE439918A (enExample) * | 1939-11-29 | |||
| FR869014A (fr) * | 1941-01-04 | 1942-01-22 | Telefunken Gmbh | Perfectionnements aux systèmes de concentration de rayons électroniques |
| US3198807A (en) * | 1961-07-25 | 1965-08-03 | Substitutes carboxamide indoles and indolines | |
| DE1720033A1 (de) * | 1966-03-02 | 1971-05-19 | Yoshitomi Pharmaceutical | Neue Indolderivate und Verfahren zu ihrer Herstellung |
| NL133069C (enExample) * | 1966-07-29 | |||
| DE1643262C3 (de) * | 1967-12-13 | 1975-06-26 | C.H. Boehringer Sohn, 6507 Ingelheim | i-Phenoxy^-hydroxy-S-alklyaminopropane, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US3634402A (en) * | 1968-04-26 | 1972-01-11 | Sumitomo Chemical Co | Process for producing 1 4-benzodiazepine derivatives and their salts |
| FR2260332A1 (en) * | 1974-02-12 | 1975-09-05 | Delalande Sa | 1-Phenyl-2-aminocarbonyl-indoles - with respiratory analeptic, antiinflammatory analgesic, vasodilator, diuretic and anti-ulcer activity |
| US4196143A (en) * | 1974-07-01 | 1980-04-01 | The Dow Chemical Company | Substituted phenoxyalkyl quaternary ammonium compounds |
| US4175083A (en) * | 1975-09-08 | 1979-11-20 | Warner-Lambert Company | Indolopyrones having antiallergic activity |
| US4059583A (en) * | 1975-11-13 | 1977-11-22 | Mcneil Laboratories, Incorporated | Substituted indoles |
| DE2931323A1 (de) * | 1979-08-02 | 1981-02-26 | Kali Chemie Pharma Gmbh | Neue n-aminoalkylindol-derivate und ihre salze |
| DE3304019A1 (de) * | 1983-02-07 | 1984-08-09 | Kali-Chemie Pharma Gmbh, 3000 Hannover | 3-acyloxy-1-phenyl-2-aminocarbonylindol-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
-
1981
- 1981-08-08 DE DE19813131527 patent/DE3131527A1/de not_active Withdrawn
-
1982
- 1982-05-21 GR GR68225A patent/GR76804B/el unknown
- 1982-07-30 PT PT75352A patent/PT75352B/pt unknown
- 1982-08-02 JP JP57133831A patent/JPS58159459A/ja active Granted
- 1982-08-02 DE DE8282106962T patent/DE3267429D1/de not_active Expired
- 1982-08-02 AT AT82106962T patent/ATE16478T1/de not_active IP Right Cessation
- 1982-08-02 EP EP82106962A patent/EP0071935B1/de not_active Expired
- 1982-08-04 DD DD82242249A patent/DD202542A5/de unknown
- 1982-08-05 ZA ZA825667A patent/ZA825667B/xx unknown
- 1982-08-05 PH PH27677A patent/PH18886A/en unknown
- 1982-08-05 FI FI822722A patent/FI76073C/fi not_active IP Right Cessation
- 1982-08-06 AU AU86961/82A patent/AU554976B2/en not_active Ceased
- 1982-08-06 NZ NZ201514A patent/NZ201514A/xx unknown
- 1982-08-06 HU HU822533A patent/HU186962B/hu unknown
- 1982-08-06 SU SU823478602A patent/SU1195903A3/ru active
- 1982-08-06 IE IE1896/82A patent/IE53646B1/en unknown
- 1982-08-06 NO NO822693A patent/NO156526C/no unknown
- 1982-08-06 ES ES514816A patent/ES8400403A1/es not_active Expired
- 1982-08-06 DK DK352482A patent/DK156569B/da not_active Application Discontinuation
- 1982-08-06 IL IL66485A patent/IL66485A/xx unknown
- 1982-08-09 CA CA000409061A patent/CA1189859A/en not_active Expired
-
1983
- 1983-06-15 ES ES523267A patent/ES8403478A1/es not_active Expired
- 1983-06-15 ES ES523268A patent/ES8404854A1/es not_active Expired
- 1983-06-15 ES ES523269A patent/ES523269A0/es active Granted
- 1983-10-27 SU SU833655359A patent/SU1223843A3/ru active
-
1986
- 1986-07-15 US US06/885,684 patent/US4803198A/en not_active Expired - Fee Related
-
1988
- 1988-10-28 US US07/264,049 patent/US4924004A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI76073C (fi) | Foerfarande och mellanprodukt foer framstaellning av terapeutiskt verksamma 1-fenyl-2-aminokarbonyl- indolfoereningar och deras mellanprodukter. | |
| RU2155187C2 (ru) | Производные индола, их таутомеры, смеси их изомеров или отдельные изомеры и фармацевтически приемлемые соли, фармацевтическая композиция с антиопухолевой или ингибирующей протеин-тирозинкиназу активностью и способ торможения зависящего от протеин-тирозинкиназы заболевания или борьбы с аберрантным ростом клеток млекопитающего или человека. | |
| RU2157803C2 (ru) | Производные циклоалкано-индола и азаиндола, смесь их изомеров или отдельные изомеры и их фармацевтически приемлемые соли, производные карбоновой кислоты в качестве исходных соединений и фармацевтическая композиция, ингибирующая высвобождение ассоциированных с аполипопротеином в-100 липопротеинов | |
| NZ242078A (en) | Indole derivatives, pharmaceutical compositions and intermediates therefor | |
| NO300845B1 (no) | Substituerte tienyl- eller pyrrolylkarboksylsyrederivater, og medisiner som inneholder dem | |
| NZ201294A (en) | Imidazoquinoxaline derivatives | |
| EP0597003A1 (en) | Quinoline derivatives as immunostimulants | |
| IE57057B1 (en) | Carboxamides,process for their preparation and pharmaceutical preparations containing them | |
| CA1140564A (en) | Benzoyl derivatives, their preparation and their use as pharmaceutical compositions | |
| PL125321B1 (en) | Process for preparing novel,condensed derivatives of pyrimidines | |
| EP0481383B1 (en) | Heterocyclic amine derivatives, their production and use | |
| CN103923080A (zh) | 一种制备抗血栓药物阿哌沙班的方法 | |
| FI78084C (fi) | Foerfarande foer framstaellning av nya, terapeutiskt verksamma bensopyranderivat. | |
| US5286858A (en) | Optically active thienotriazolodiazepine compounds | |
| JPS6140674B2 (enExample) | ||
| SU1549480A3 (ru) | Способ получени производных иминотиазолидина или их гидрохлоридов | |
| DK155009B (da) | Analogifremgangsmaade til fremstilling af thienooe2,3-eaa-1,2-thiazin-1,1-dioxidderivat eller farmaceutisk tolerable salte heraf samt udgangsmateriale til brug ved fremgangsmaaden | |
| US3787419A (en) | N-substituted-alpha,alpha,alpha-trifluoro-m-toluamides | |
| EP0602598A1 (en) | 3-Phenylindolyl-, -benzofuranyl- and -benzothienyl- alkylcarboxanilides, their production and use | |
| IE55377B1 (en) | 1,5-diphenylpyrazolin-3-one compounds,method for preparing them,and pharmaceutical compositions containing these compounds | |
| FI73215C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-oxopyrido/2,1-f/-as-triaziniumderivat. | |
| FI67537C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla nya 1,2-bis-dialkylaminoetoxi-3-fenoxipropaner | |
| FI82249B (fi) | Foerfarande foer framstaellning av nya pyridinderivat. | |
| US4480100A (en) | [2-[(Nitropyridinyl)amino]phenyl]arymethanones | |
| JPS6036423B2 (ja) | 新規ヒドラジンの製法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: KALI-CHEMIE PHARMA GMBH |