FI69451C - Foerfarande foer framstaellning av antiinflammatoriska 4,5-diaryl-2-nitroimidazoler - Google Patents
Foerfarande foer framstaellning av antiinflammatoriska 4,5-diaryl-2-nitroimidazoler Download PDFInfo
- Publication number
- FI69451C FI69451C FI792683A FI792683A FI69451C FI 69451 C FI69451 C FI 69451C FI 792683 A FI792683 A FI 792683A FI 792683 A FI792683 A FI 792683A FI 69451 C FI69451 C FI 69451C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- fluorophenyl
- imidazole
- pyridyl
- ether
- Prior art date
Links
- 230000003110 anti-inflammatory effect Effects 0.000 title claims description 8
- 238000005057 refrigeration Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000006239 protecting group Chemical group 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- -1 4,5-disubstituted-1- (substituted) imidazole Chemical class 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 241000700159 Rattus Species 0.000 description 10
- 206010003246 arthritis Diseases 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 238000005160 1H NMR spectroscopy Methods 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 6
- 150000002460 imidazoles Chemical class 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000003814 drug Substances 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 239000000538 analytical sample Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- HZOXZYDMJBZXOH-UHFFFAOYSA-N 3-[5-(4-fluorophenyl)-1h-imidazol-4-yl]pyridine Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=NC=CC=2)N=CN1 HZOXZYDMJBZXOH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 3
- 208000009386 Experimental Arthritis Diseases 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 208000002193 Pain Diseases 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 229940124599 anti-inflammatory drug Drugs 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 210000003141 lower extremity Anatomy 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000001272 nitrous oxide Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JQBQAYRWGWUSIC-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-thiophen-2-ylethanone Chemical compound C1=CC(F)=CC=C1CC(=O)C1=CC=CS1 JQBQAYRWGWUSIC-UHFFFAOYSA-N 0.000 description 2
- MDELWZVHTHCFLX-UHFFFAOYSA-N 2-bromo-2-(4-fluorophenyl)-1-thiophen-2-ylethanone Chemical compound C1=CC(F)=CC=C1C(Br)C(=O)C1=CC=CS1 MDELWZVHTHCFLX-UHFFFAOYSA-N 0.000 description 2
- JRKLLMBFTGWAHF-UHFFFAOYSA-N 4,5-bis(4-fluorophenyl)-1-(oxan-2-yl)imidazole Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC(F)=CC=2)N(C2OCCCC2)C=N1 JRKLLMBFTGWAHF-UHFFFAOYSA-N 0.000 description 2
- HEORGCSKTUCAKD-UHFFFAOYSA-N 4,5-bis(4-fluorophenyl)-2-nitro-1h-imidazole Chemical compound N1C([N+](=O)[O-])=NC(C=2C=CC(F)=CC=2)=C1C1=CC=C(F)C=C1 HEORGCSKTUCAKD-UHFFFAOYSA-N 0.000 description 2
- BKCYPFPBTODILR-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-1-(oxan-2-yl)imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)N(C2OCCCC2)C=N1 BKCYPFPBTODILR-UHFFFAOYSA-N 0.000 description 2
- YJAVOIABTIPPRH-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-nitro-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC([N+]([O-])=O)=N1 YJAVOIABTIPPRH-UHFFFAOYSA-N 0.000 description 2
- LNGZFKSQWBJIHX-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-nitro-5-phenyl-1h-imidazole Chemical compound N1C([N+](=O)[O-])=NC(C=2C=C(Cl)C(Cl)=CC=2)=C1C1=CC=CC=C1 LNGZFKSQWBJIHX-UHFFFAOYSA-N 0.000 description 2
- ZLHTTXRBURFPFT-UHFFFAOYSA-N 4-(4-fluorophenyl)-5-thiophen-2-yl-1h-imidazole Chemical compound C1=CC(F)=CC=C1C1=C(C=2SC=CC=2)NC=N1 ZLHTTXRBURFPFT-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 241000186359 Mycobacterium Species 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229960005215 dichloroacetic acid Drugs 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229960001680 ibuprofen Drugs 0.000 description 2
- 229960000905 indomethacin Drugs 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical compound COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229960002895 phenylbutazone Drugs 0.000 description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- MGKPFALCNDRSQD-UHFFFAOYSA-N 2-(4-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(F)C=C1 MGKPFALCNDRSQD-UHFFFAOYSA-N 0.000 description 1
- JHQBLYITVCBGTO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C=C1 JHQBLYITVCBGTO-UHFFFAOYSA-N 0.000 description 1
- ZVAKZVDJIUFFFP-UHFFFAOYSA-N 2-chlorooxolane Chemical compound ClC1CCCO1 ZVAKZVDJIUFFFP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- HVNWCVGXMCVZTL-UHFFFAOYSA-N 3-[5-(4-fluorophenyl)-2-nitro-1h-imidazol-4-yl]pyridine Chemical compound N1C([N+](=O)[O-])=NC(C=2C=CC(F)=CC=2)=C1C1=CC=CN=C1 HVNWCVGXMCVZTL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JPXCIPNJJMSYDI-UHFFFAOYSA-N 4,5-bis(4-chlorophenyl)-2-methylsulfanyl-1h-imidazole Chemical class N1C(SC)=NC(C=2C=CC(Cl)=CC=2)=C1C1=CC=C(Cl)C=C1 JPXCIPNJJMSYDI-UHFFFAOYSA-N 0.000 description 1
- MIZORTJPUUOUSA-UHFFFAOYSA-N 4,5-bis(4-fluorophenyl)-1h-imidazole Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC(F)=CC=2)NC=N1 MIZORTJPUUOUSA-UHFFFAOYSA-N 0.000 description 1
- YIJUBZDDOUUKDA-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-1h-imidazole Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC=N1 YIJUBZDDOUUKDA-UHFFFAOYSA-N 0.000 description 1
- XJXSIQHSQFQXPU-UHFFFAOYSA-N 4,5-bis(4-methoxyphenyl)-2-methylsulfanyl-1h-imidazole Chemical class C1=CC(OC)=CC=C1C1=C(C=2C=CC(OC)=CC=2)NC(SC)=N1 XJXSIQHSQFQXPU-UHFFFAOYSA-N 0.000 description 1
- CPHGOBGXZQKCKI-UHFFFAOYSA-N 4,5-diphenyl-1h-imidazole Chemical class N1C=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 CPHGOBGXZQKCKI-UHFFFAOYSA-N 0.000 description 1
- OLYQHZPUTHODJR-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-5-phenyl-1h-imidazole Chemical compound C1=C(Cl)C(Cl)=CC=C1C1=C(C=2C=CC=CC=2)NC=N1 OLYQHZPUTHODJR-UHFFFAOYSA-N 0.000 description 1
- UKOXUFAUGYUNSU-UHFFFAOYSA-N 4-(4-ethoxyphenyl)-5-(4-fluorophenyl)-1h-imidazole Chemical compound C1=CC(OCC)=CC=C1C1=C(C=2C=CC(F)=CC=2)NC=N1 UKOXUFAUGYUNSU-UHFFFAOYSA-N 0.000 description 1
- LOPRWBCCUFUHGP-UHFFFAOYSA-N 4-(4-ethoxyphenyl)-5-(4-fluorophenyl)-2-nitro-1h-imidazole Chemical compound C1=CC(OCC)=CC=C1C1=C(C=2C=CC(F)=CC=2)NC([N+]([O-])=O)=N1 LOPRWBCCUFUHGP-UHFFFAOYSA-N 0.000 description 1
- PMOSZXVZSQWILZ-UHFFFAOYSA-N 4-(4-fluorophenyl)-2-nitro-5-thiophen-2-yl-1h-imidazole Chemical compound N1C([N+](=O)[O-])=NC(C=2C=CC(F)=CC=2)=C1C1=CC=CS1 PMOSZXVZSQWILZ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- WIRAGWWPVYPXKT-UHFFFAOYSA-N OC(C1=CC=C(C=C1)F)C1=NC=CC=C1C(=O)C=1C(=NC=CC1)C(C1=CC=C(C=C1)F)O Chemical compound OC(C1=CC=C(C=C1)F)C1=NC=CC=C1C(=O)C=1C(=NC=CC1)C(C1=CC=C(C=C1)F)O WIRAGWWPVYPXKT-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N Putrescine Natural products NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000269319 Squalius cephalus Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 206010042674 Swelling Diseases 0.000 description 1
- GLYOPNLBKCBTMI-UHFFFAOYSA-N [2-chloro-2-(1-chloro-2-phenylethoxy)ethyl]benzene Chemical compound C=1C=CC=CC=1CC(Cl)OC(Cl)CC1=CC=CC=C1 GLYOPNLBKCBTMI-UHFFFAOYSA-N 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 230000002456 anti-arthritic effect Effects 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- QGYIJDOHCKDOPU-UHFFFAOYSA-N bis[2-[(4-fluorophenyl)methyl]pyridin-3-yl]methanone Chemical compound FC1=CC=C(CC2=NC=CC=C2C(=O)C=2C(=NC=CC=2)CC2=CC=C(C=C2)F)C=C1 QGYIJDOHCKDOPU-UHFFFAOYSA-N 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 210000002249 digestive system Anatomy 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 201000006549 dyspepsia Diseases 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960001238 methylnicotinate Drugs 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229940117615 mineral oil 5 mg/ml Drugs 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- JCZMXVGQBBATMY-UHFFFAOYSA-N nitro acetate Chemical compound CC(=O)O[N+]([O-])=O JCZMXVGQBBATMY-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US93771578A | 1978-08-29 | 1978-08-29 | |
| US93771578 | 1978-08-29 | ||
| US06/018,023 US4199592A (en) | 1978-08-29 | 1979-03-06 | Antiinflammatory 4,5-diaryl-2-nitroimidazoles |
| US1802379 | 1979-03-06 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI792683A7 FI792683A7 (fi) | 1980-03-01 |
| FI69451B FI69451B (fi) | 1985-10-31 |
| FI69451C true FI69451C (fi) | 1986-02-10 |
Family
ID=26690639
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI792683A FI69451C (fi) | 1978-08-29 | 1979-08-29 | Foerfarande foer framstaellning av antiinflammatoriska 4,5-diaryl-2-nitroimidazoler |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4199592A (enExample) |
| EP (1) | EP0008755B1 (enExample) |
| AR (1) | AR222834A1 (enExample) |
| AU (1) | AU525866B2 (enExample) |
| CA (1) | CA1131229A (enExample) |
| DE (1) | DE2962568D1 (enExample) |
| DK (1) | DK281079A (enExample) |
| ES (1) | ES483700A1 (enExample) |
| FI (1) | FI69451C (enExample) |
| GR (1) | GR71198B (enExample) |
| IE (1) | IE48935B1 (enExample) |
| IL (1) | IL58123A (enExample) |
| MX (1) | MX6046E (enExample) |
| NO (1) | NO152215C (enExample) |
| PH (1) | PH14620A (enExample) |
| PT (1) | PT70128A (enExample) |
| YU (1) | YU209979A (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348404A (en) * | 1980-07-21 | 1982-09-07 | E. I. Du Pont De Nemours And Company | Antiinflammatory 4,5-diaryl-α-polyfluoroalkyl-1H-imidazole-2-methanamines |
| US4462992A (en) * | 1982-02-08 | 1984-07-31 | Research Corporation | Nitroimidazole radiosensitizers for hypoxic tumor cells and compositions thereof |
| US4503065A (en) * | 1982-08-03 | 1985-03-05 | E. I. Du Pont De Nemours And Company | Antiinflammatory 4,5-diaryl 1-2-halo imidazoles |
| EP0117485A3 (de) * | 1983-02-28 | 1985-01-23 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Pyridin-, Pyrazin- und Pyrimidinderivate und deren Verwendung als fungizide Wirkstoffe |
| US4686231A (en) * | 1985-12-12 | 1987-08-11 | Smithkline Beckman Corporation | Inhibition of 5-lipoxygenase products |
| US4780470A (en) * | 1986-08-19 | 1988-10-25 | Smithkline Beckman Corporation | Inhibition of interleukin-1 by monocytes and/or macrophages |
| US5916891A (en) | 1992-01-13 | 1999-06-29 | Smithkline Beecham Corporation | Pyrimidinyl imidazoles |
| US5670527A (en) * | 1993-07-16 | 1997-09-23 | Smithkline Beecham Corporation | Pyridyl imidazole compounds and compositions |
| US5593992A (en) * | 1993-07-16 | 1997-01-14 | Smithkline Beecham Corporation | Compounds |
| US5593991A (en) * | 1993-07-16 | 1997-01-14 | Adams; Jerry L. | Imidazole compounds, use and process of making |
| IL118544A (en) * | 1995-06-07 | 2001-08-08 | Smithkline Beecham Corp | History of imidazole, the process for their preparation and the pharmaceutical preparations containing them |
| US5739143A (en) * | 1995-06-07 | 1998-04-14 | Smithkline Beecham Corporation | Imidazole compounds and compositions |
| US6369068B1 (en) | 1995-06-07 | 2002-04-09 | Smithkline Beecham Corporation | Amino substituted pyrimidine containing compounds |
| ZA9610687B (en) * | 1995-12-22 | 1997-09-29 | Smithkline Beecham Corp | Novel synthesis. |
| US6046208A (en) * | 1996-01-11 | 2000-04-04 | Smithkline Beecham Corporation | Substituted imidazole compounds |
| PL187516B1 (pl) * | 1996-01-11 | 2004-07-30 | Smithkline Beecham Corp | Nowe podstawione pochodne imidazolu, sposób ich wytwarzania oraz kompozycja farmaceutyczna zawierająca te związki |
| AP9700912A0 (en) | 1996-01-11 | 1997-01-31 | Smithkline Beecham Corp | Novel cycloalkyl substituted imidazoles |
| ZA97175B (en) * | 1996-01-11 | 1997-11-04 | Smithkline Beecham Corp | Novel substituted imidazole compounds. |
| WO1997035856A1 (en) * | 1996-03-25 | 1997-10-02 | Smithkline Beecham Corporation | Novel treatment for cns injuries |
| WO1998007425A1 (en) | 1996-08-21 | 1998-02-26 | Smithkline Beecham Corporation | Imidazole compounds, compositions and use |
| US5929076A (en) * | 1997-01-10 | 1999-07-27 | Smithkline Beecham Corporation | Cycloalkyl substituted imidazoles |
| CA2294057A1 (en) | 1997-06-13 | 1998-12-17 | Smithkline Beecham Corporation | Novel pyrazole and pyrazoline substituted compounds |
| JP2002505690A (ja) | 1997-06-19 | 2002-02-19 | スミスクライン・ビーチャム・コーポレイション | 新規なアリールオキシピリミジン置換イミダゾール化合物 |
| US7301021B2 (en) * | 1997-07-02 | 2007-11-27 | Smithkline Beecham Corporation | Substituted imidazole compounds |
| TW517055B (en) | 1997-07-02 | 2003-01-11 | Smithkline Beecham Corp | Novel substituted imidazole compounds |
| AU8381098A (en) | 1997-07-02 | 1999-01-25 | Smithkline Beecham Corporation | Novel cycloalkyl substituted imidazoles |
| US6562832B1 (en) | 1997-07-02 | 2003-05-13 | Smithkline Beecham Corporation | Substituted imidazole compounds |
| US6489325B1 (en) | 1998-07-01 | 2002-12-03 | Smithkline Beecham Corporation | Substituted imidazole compounds |
| JP2001518507A (ja) | 1997-10-08 | 2001-10-16 | スミスクライン・ビーチャム・コーポレイション | 新規シクロアルケニル置換化合物 |
| ATE257703T1 (de) * | 1997-10-27 | 2004-01-15 | Takeda Chemical Industries Ltd | 1,3-thiazole als adenosine a3 rezeptor antagonisten zur behandlung von asthma, allergien und diabetes |
| AU1924699A (en) | 1997-12-19 | 1999-07-12 | Smithkline Beecham Corporation | Compounds of heteroaryl substituted imidazole, their pharmaceutical compositionsand uses |
| HUP0102058A3 (en) | 1998-05-22 | 2002-05-28 | Smithkline Beecham Corp | Novel 2-alkyl substituted imidazole compounds, process for their preparation, pharmaceutical compositions containing them and their use |
| US6858617B2 (en) | 1998-05-26 | 2005-02-22 | Smithkline Beecham Corporation | Substituted imidazole compounds |
| ES2221426T3 (es) * | 1998-08-20 | 2004-12-16 | Smithkline Beecham Corporation | Nuevos compuestos de triazol sustituidos. |
| AU1909200A (en) * | 1998-11-04 | 2000-05-22 | Smithkline Beecham Corporation | Pyridin-4-yl or pyrimidin-4-yl substituted pyrazines |
| US6239279B1 (en) | 1998-12-16 | 2001-05-29 | Smithkline Beecham Corporation | Synthesis for 4-aryl-5-pyrimidine imidazole substituted derivatives |
| WO2001038314A1 (en) | 1999-11-23 | 2001-05-31 | Smithkline Beecham Corporation | 3,4-dihydro-(1h)quinazolin-2-one compounds as csbp/p38 kinase inhibitors |
| US6759410B1 (en) | 1999-11-23 | 2004-07-06 | Smithline Beecham Corporation | 3,4-dihydro-(1H)-quinazolin-2-ones and their use as CSBP/p38 kinase inhibitors |
| ATE305787T1 (de) | 1999-11-23 | 2005-10-15 | Smithkline Beecham Corp | 3,4-dihydro-(1h)chinazolin-2-on-verbindungen als csbp/p39-kinase-inhibitoren |
| ES2230171T3 (es) | 1999-11-23 | 2005-05-01 | Smithkline Beecham Corporation | Compuestos 3,4-dihidro-(1h)quinazolin-2-ona como inhibidores de csbp/p38 quinasa. |
| US7235551B2 (en) * | 2000-03-02 | 2007-06-26 | Smithkline Beecham Corporation | 1,5-disubstituted-3,4-dihydro-1h-pyrimido[4,5-d]pyrimidin-2-one compounds and their use in treating csbp/p38 kinase mediated diseases |
| NZ524806A (en) * | 2000-10-23 | 2006-03-31 | Smithkline Beecham Corp | Tri-substituted 8H-pyrido[2,3-d]pyrimidin-7-one compounds |
| UY29440A1 (es) | 2005-03-25 | 2006-10-02 | Glaxo Group Ltd | Nuevos compuestos |
| JP2008537937A (ja) * | 2005-03-25 | 2008-10-02 | グラクソ グループ リミテッド | ピリド[2,3−d]ピリミジン−7−オンおよび3,4−ジヒドロピリミド[4,5−d]ピリミジン−2(1H)−オン誘導体の製造方法 |
| MD4150C1 (ro) * | 2011-10-11 | 2012-09-30 | Институт Химии Академии Наук Молдовы | Procedeu de obţinere a compuşilor coordinativi ai Co(II), Ni(II) şi Zn(II) cu 2-nitro-4,5-difenilimidazol pornind de la 4,5-difenilimidazol şi nitraţii metalelor respective |
| MD4178C1 (ro) * | 2012-02-27 | 2013-02-28 | Институт Химии Академии Наук Молдовы | Procedeu de obţinere a 2-nitro-4,5-difenilimidazolului |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL124627C (enExample) * | 1964-08-12 | |||
| BE688585A (enExample) * | 1965-10-21 | 1967-04-20 | ||
| US3651080A (en) * | 1969-11-07 | 1972-03-21 | Ciba Geigy Corp | Certain substituted 2-alkylmercaptoimidazole derivatives |
| US3707475A (en) * | 1970-11-16 | 1972-12-26 | Pfizer | Antiinflammatory imidazoles |
| US3901908A (en) * | 1970-12-28 | 1975-08-26 | Ciba Geigy Corp | 2-alkyl- and 2-cycloalkyl-4,5-bis-phenyl-imidazoles |
| US3929807A (en) * | 1971-05-10 | 1975-12-30 | Ciba Geigy Corp | 2-Substituted-4(5)-(aryl)-5(4)-(2,3 or -4-pyridyl)-imidazoles |
| DE2229223C3 (de) * | 1971-07-30 | 1975-12-18 | Gruppo Lepetit S.P.A., Mailand (Italien) | 2-Nitro-S-imidazol-Derivate und Verfahren zu deren Herstellung |
| DK16778A (da) * | 1977-02-09 | 1978-08-10 | Du Pont | Imidazolderivater deres anvendelser og fremstilling |
| US4182769A (en) * | 1977-02-09 | 1980-01-08 | E. I. Du Pont De Nemours And Company | Anti-inflammatory 1-substituted-4,5-diaryl-2-(substituted-thio) imidazoles and their corresponding sulfoxides and sulfones |
-
1979
- 1979-03-06 US US06/018,023 patent/US4199592A/en not_active Expired - Lifetime
- 1979-04-28 PH PH22970A patent/PH14620A/en unknown
- 1979-07-03 DK DK281079A patent/DK281079A/da not_active Application Discontinuation
- 1979-08-24 CA CA334,410A patent/CA1131229A/en not_active Expired
- 1979-08-25 DE DE7979103139T patent/DE2962568D1/de not_active Expired
- 1979-08-25 EP EP79103139A patent/EP0008755B1/en not_active Expired
- 1979-08-27 AR AR277867A patent/AR222834A1/es active
- 1979-08-28 MX MX798353U patent/MX6046E/es unknown
- 1979-08-28 AU AU50354/79A patent/AU525866B2/en not_active Ceased
- 1979-08-28 YU YU02099/79A patent/YU209979A/xx unknown
- 1979-08-28 NO NO792787A patent/NO152215C/no unknown
- 1979-08-28 ES ES483700A patent/ES483700A1/es not_active Expired
- 1979-08-28 IL IL58123A patent/IL58123A/xx unknown
- 1979-08-28 PT PT70128A patent/PT70128A/pt unknown
- 1979-08-29 IE IE1643/79A patent/IE48935B1/en unknown
- 1979-08-29 GR GR59931A patent/GR71198B/el unknown
- 1979-08-29 FI FI792683A patent/FI69451C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AR222834A1 (es) | 1981-06-30 |
| FI69451B (fi) | 1985-10-31 |
| IL58123A0 (en) | 1979-12-30 |
| US4199592A (en) | 1980-04-22 |
| NO152215C (no) | 1985-08-28 |
| FI792683A7 (fi) | 1980-03-01 |
| NO152215B (no) | 1985-05-13 |
| MX6046E (es) | 1984-10-11 |
| IE791643L (en) | 1980-02-29 |
| CA1131229A (en) | 1982-09-07 |
| PT70128A (en) | 1979-09-01 |
| PH14620A (en) | 1981-10-12 |
| YU209979A (en) | 1983-04-30 |
| GR71198B (enExample) | 1983-04-11 |
| AU5035479A (en) | 1980-03-06 |
| EP0008755B1 (en) | 1982-04-21 |
| DK281079A (da) | 1980-03-01 |
| IE48935B1 (en) | 1985-06-26 |
| NO792787L (no) | 1980-03-03 |
| AU525866B2 (en) | 1982-12-02 |
| IL58123A (en) | 1983-05-15 |
| DE2962568D1 (en) | 1982-06-03 |
| EP0008755A1 (en) | 1980-03-19 |
| ES483700A1 (es) | 1980-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI69451C (fi) | Foerfarande foer framstaellning av antiinflammatoriska 4,5-diaryl-2-nitroimidazoler | |
| DE69512925T2 (de) | Ortho-substituierte aromatische ether und ihre verwendung in schmerzstillenden pharmazeutischen zusammensetzungen | |
| US4110337A (en) | Triazolobenzodiazepines | |
| JPH09208583A (ja) | トリアゾール系抗真菌薬製造に有用な中間体 | |
| JPS582936B2 (ja) | 5↓−アロイルピロ−ル酢酸およびその塩類の製法 | |
| US4438117A (en) | 2-Substituted thio-4,5-diarylpyrimidines | |
| NO152091B (no) | Analogifremgangsmaate ved fremstilling av antiinflammatorisk virksomme 5-substituerte 2,3-difenylthiofener | |
| US4602093A (en) | Novel substituted imidazoles, their preparation and use | |
| WO1996020936A1 (en) | Novel thiazolidin-4-one derivatives | |
| US4159338A (en) | Antiinflammatory-4,5-dicyclic-2-(substituted thio)-imidazoles and their corresponding sulfoxides and sulfones | |
| IE902587A1 (en) | 1h-4,1,2,-benzoxadiazine derivatives having medicinal¹utility and their preparation and use | |
| DE69904818T2 (de) | Thienodipyridinderivate, ihre herstellung und verwendung | |
| US4375479A (en) | Indanyl derivatives and use | |
| US4335136A (en) | Anti-inflammatory 4,5-diaryl-α-(polyfluoroalkyl)-1H-pyrrole-2-methanamines | |
| US4347251A (en) | Novel 3-substituted amino-1-substituted heteroaryl-2-pyrazolines | |
| CA1119613A (en) | Process for preparing benzylidene derivatives | |
| DE2402705A1 (de) | Tetrahydrofluorensaeuren | |
| NO143499B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive indanderivater | |
| US4432991A (en) | Therapeutically active 3-amino-1-phenyl(and substituted phenyl)-2-pyrazolines | |
| US4495196A (en) | Antiinflammatory 4,5-diaryl-α-polyfluoroalkyl-1H-pyrrole-2-methanols and method for use thereof | |
| JPH0830063B2 (ja) | 新規なイミダゾ−ル誘導体およびその塩 | |
| CA1310648C (en) | Condensed pyrazole derivatives and process for their preparation | |
| US4906658A (en) | Fluoro-sulfones | |
| US4251535A (en) | Antiinflammatory 4,5-diaryl-2-nitroimidazoles | |
| US3681365A (en) | Derivatives of acetic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: E.I. DU PONT DE NEMOURS AND COMPANY |