FI63760C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara penicilliner - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara penicilliner Download PDFInfo
- Publication number
- FI63760C FI63760C FI751340A FI751340A FI63760C FI 63760 C FI63760 C FI 63760C FI 751340 A FI751340 A FI 751340A FI 751340 A FI751340 A FI 751340A FI 63760 C FI63760 C FI 63760C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- group
- acid
- dioxo
- compound
- Prior art date
Links
- 230000001225 therapeutic effect Effects 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 66
- -1 N-Piperazinocarbonyl-amino Chemical group 0.000 claims abstract description 40
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 150000001768 cations Chemical class 0.000 claims abstract description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 11
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 50
- 238000000034 method Methods 0.000 claims description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 35
- 125000006239 protecting group Chemical group 0.000 claims description 10
- 229930182555 Penicillin Natural products 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000002960 penicillins Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000004193 piperazinyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 229910014033 C-OH Inorganic materials 0.000 claims description 3
- 229910014570 C—OH Inorganic materials 0.000 claims description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 claims description 3
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 3
- 125000005633 phthalidyl group Chemical group 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229940049954 penicillin Drugs 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 2
- 150000007942 carboxylates Chemical class 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical group N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims 1
- 125000002743 phosphorus functional group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 28
- 239000000126 substance Substances 0.000 abstract description 20
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000539 amino acid group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 83
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 73
- 239000000243 solution Substances 0.000 description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- 239000013078 crystal Substances 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 30
- 239000002253 acid Substances 0.000 description 29
- 239000000047 product Substances 0.000 description 27
- 159000000000 sodium salts Chemical class 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- 239000000725 suspension Substances 0.000 description 22
- 239000010410 layer Substances 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 238000001914 filtration Methods 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 238000007792 addition Methods 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 150000003951 lactams Chemical class 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 description 6
- 241000894006 Bacteria Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 230000000844 anti-bacterial effect Effects 0.000 description 5
- 150000001805 chlorine compounds Chemical class 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 229960003424 phenylacetic acid Drugs 0.000 description 4
- 239000003279 phenylacetic acid Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000283690 Bos taurus Species 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- 108090000204 Dipeptidase 1 Proteins 0.000 description 3
- 241000588747 Klebsiella pneumoniae Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000588769 Proteus <enterobacteria> Species 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 102000006635 beta-lactamase Human genes 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- ZBEKOEYCWKIMGU-UHFFFAOYSA-N 1-ethylpiperazine-2,3-dione Chemical compound CCN1CCNC(=O)C1=O ZBEKOEYCWKIMGU-UHFFFAOYSA-N 0.000 description 2
- KJCIMSSFGUGTGA-UHFFFAOYSA-N 1-methylpiperazin-2-one Chemical compound CN1CCNCC1=O KJCIMSSFGUGTGA-UHFFFAOYSA-N 0.000 description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 101150065749 Churc1 gene Proteins 0.000 description 2
- 208000035473 Communicable disease Diseases 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 102100038239 Protein Churchill Human genes 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- WNZQDUSMALZDQF-UHFFFAOYSA-N isobenzofuranone Natural products C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- OLSFRDLMFAOSIA-UHFFFAOYSA-N 2-chloro-1,3,2-dioxaphospholane Chemical compound ClP1OCCO1 OLSFRDLMFAOSIA-UHFFFAOYSA-N 0.000 description 1
- SSXYKBHZZRYLLY-UHFFFAOYSA-N 2-chloro-1,3-oxazole Chemical compound ClC1=NC=CO1 SSXYKBHZZRYLLY-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- KXEAZJHCOWBLLF-UHFFFAOYSA-N 3-methyl-3-(3-methylpentan-3-yloxy)pentane Chemical compound CCC(C)(CC)OC(C)(CC)CC KXEAZJHCOWBLLF-UHFFFAOYSA-N 0.000 description 1
- OJKQOOBAMDKEDK-UHFFFAOYSA-N 3-oxopiperazine-1-carbaldehyde Chemical compound O=CN1CCNC(=O)C1 OJKQOOBAMDKEDK-UHFFFAOYSA-N 0.000 description 1
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 1
- OOGMZUVDPWTYIC-UHFFFAOYSA-N 4-methylsulfonylpiperazin-2-one Chemical compound CS(=O)(=O)N1CCNC(=O)C1 OOGMZUVDPWTYIC-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 101000755914 Apis cerana Venom serine protease inhibitor Proteins 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- 101100495842 Caenorhabditis elegans cht-3 gene Proteins 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- KLOHDWPABZXLGI-YWUHCJSESA-M ampicillin sodium Chemical compound [Na+].C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C([O-])=O)(C)C)=CC=CC=C1 KLOHDWPABZXLGI-YWUHCJSESA-M 0.000 description 1
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- IYNDLOXRXUOGIU-LQDWTQKMSA-M benzylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)CC1=CC=CC=C1 IYNDLOXRXUOGIU-LQDWTQKMSA-M 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229940041514 candida albicans extract Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004122 cyclic group Chemical class 0.000 description 1
- HVBMYHDTXIDFKE-UHFFFAOYSA-N diethyl hydrogen phosphate;ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O.CCOP(O)(=O)OCC HVBMYHDTXIDFKE-UHFFFAOYSA-N 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical compound CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000005506 phthalide group Chemical group 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- LVCJBUWIZQQMSU-IBTYICNHSA-M sodium;(2s,5r)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound [Na+].[O-]C(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 LVCJBUWIZQQMSU-IBTYICNHSA-M 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000012138 yeast extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Hydrogenated Pyridines (AREA)
Priority Applications (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
FI780330A FI62833C (fi) | 1974-05-09 | 1978-02-01 | Som mellanprodukter vid framstaellning av antibakteriella penicillin- och cefalosporinderivat anvaendbara 2,3-dioxopiperazinderivat och foerfarande foer framstaellning av dem |
FI810165A FI65780C (fi) | 1974-05-09 | 1981-01-21 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara cefalosporiner |
FI810468A FI62834C (fi) | 1974-05-09 | 1981-02-16 | Som mellanprodukter vid framstaellning av antibakteriella penicillin- och cefalosporinderivat anvaendbara 2,3-dioxopiperazinderivat och foerfarande foer deras framstaellning |
Applications Claiming Priority (14)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP5066374 | 1974-05-09 | ||
JP5066374A JPS539238B2 (en:Method) | 1974-05-09 | 1974-05-09 | |
JP5225474 | 1974-05-13 | ||
JP5225474A JPS539239B2 (en:Method) | 1974-05-13 | 1974-05-13 | |
JP6078774A JPS539240B2 (en:Method) | 1974-05-31 | 1974-05-31 | |
JP6078774 | 1974-05-31 | ||
JP9199674 | 1974-08-13 | ||
JP9199674A JPS5123284A (en) | 1974-08-13 | 1974-08-13 | Shinkina penishirinruino seizoho |
JP10995474 | 1974-09-26 | ||
JP10995474A JPS5139687A (ja) | 1974-09-26 | 1974-09-26 | Shinkinapenishirinruinoseizoho |
JP14249974A JPS5170788A (en) | 1974-12-13 | 1974-12-13 | Shinkina sefuarosuhorinruino seizoho |
JP14249974 | 1974-12-13 | ||
JP50037207A JPS51113890A (en) | 1975-03-27 | 1975-03-27 | Method for preparing novel cephalosporins |
JP3720775 | 1975-03-27 |
Publications (3)
Publication Number | Publication Date |
---|---|
FI751340A7 FI751340A7 (en:Method) | 1975-11-10 |
FI63760B FI63760B (fi) | 1983-04-29 |
FI63760C true FI63760C (fi) | 1983-08-10 |
Family
ID=27564446
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
FI751340A FI63760C (fi) | 1974-05-09 | 1975-05-07 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara penicilliner |
Country Status (18)
Country | Link |
---|---|
AR (1) | AR209607A1 (en:Method) |
AT (1) | AT344906B (en:Method) |
BE (1) | BE828692A (en:Method) |
CH (1) | CH605995A5 (en:Method) |
CY (1) | CY1026A (en:Method) |
DD (1) | DD117882A5 (en:Method) |
DE (2) | DE2560239C2 (en:Method) |
DK (1) | DK151338C (en:Method) |
FI (1) | FI63760C (en:Method) |
FR (2) | FR2269937B1 (en:Method) |
GB (2) | GB1508064A (en:Method) |
HK (1) | HK26279A (en:Method) |
HU (1) | HU169633B (en:Method) |
IL (2) | IL47168A (en:Method) |
KE (1) | KE2923A (en:Method) |
NL (1) | NL162386C (en:Method) |
PH (5) | PH21545A (en:Method) |
SE (2) | SE431457B (en:Method) |
Families Citing this family (32)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2528079A1 (de) * | 1975-06-24 | 1977-01-20 | Bayer Ag | Penicilline, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
CH624958A5 (en) * | 1975-06-24 | 1981-08-31 | Bayer Ag | Process for the preparation of beta-lactam compounds |
FR2338046A2 (fr) * | 1976-01-19 | 1977-08-12 | Toyama Chemical Co Ltd | Nouvelles cephalosporines, leur procede de preparation et leur application en therapeutique |
JPS6026800B2 (ja) * | 1976-01-22 | 1985-06-25 | 富山化学工業株式会社 | 新規な7α−メトキシセフアロスポリン類およびその製造法 |
JPS52106883A (en) * | 1976-02-13 | 1977-09-07 | Toyama Chem Co Ltd | Novel penicillins and cephalosporins |
JPS5331690A (en) * | 1976-09-01 | 1978-03-25 | Shionogi & Co Ltd | Oxadithiacephalosporins |
DE2831568C2 (de) * | 1977-07-23 | 1985-01-10 | Toyama Chemical Co. Ltd., Tokio / Tokyo | 7α-Methoxycephalosporine und Verfahren zur Herstellung derselben |
DE2810083A1 (de) * | 1978-03-08 | 1979-09-20 | Bayer Ag | Beta-lactam-verbindungen |
DE2813771A1 (de) * | 1978-03-30 | 1979-10-11 | Bayer Ag | Beta-lactam-verbindungen |
DE2817228A1 (de) * | 1978-04-20 | 1979-10-31 | Bayer Ag | Verfahren zur herstellung halbsynthetischer beta-lactamantibiotika |
EP0015240A1 (de) * | 1979-02-16 | 1980-09-03 | Ciba-Geigy Ag | Azacyclyl (thio) ureidoacetyl-Verbindungen und Verfahren zu ihrer Herstellung |
CA1209477A (en) * | 1981-03-26 | 1986-08-12 | Bruce E. Haeger | Composition of matter comprising a lyophilized preparation of a penicillin derivative |
CA1200239A (en) * | 1981-03-30 | 1986-02-04 | Donald C. Boop | Process for preparing 6-¬d-(-)-alpha-(4-c1-c4 alkyl- 2,3-dioxo-1-piperazinocarbonyl-amino)- phenylacetamido|penicillanic acid |
JPS57118587A (en) * | 1981-11-26 | 1982-07-23 | Toyama Chem Co Ltd | Novel penicillin |
BG46664A1 (en) * | 1985-08-16 | 1990-02-15 | Druzhestven N Izsledovatelski | Method for preparing of 6- /d (-)- alpha- (4- ethyl- 2, 3- dioxo- 1- piperazine carbonylamino)- phenylacetamido/- penicillanic acid |
DE3619562A1 (de) * | 1986-06-11 | 1987-12-17 | Basf Ag | Verfahren zur herstellung von 2,3-dioxo-4-oxicarbonylpiperazinderivaten, neue 2,3-dioxo-4-oxicarbonylpiperazinderivate und deren verwendung |
US5859012A (en) * | 1996-04-03 | 1999-01-12 | Merck & Co., Inc. | Inhibitors of farnesyl-protein transferase |
GB9923748D0 (en) | 1999-10-07 | 1999-12-08 | Glaxo Group Ltd | Chemical compounds |
USRE39921E1 (en) | 1999-10-07 | 2007-11-13 | Smithkline Beecham Corporation | Chemical compounds |
GB0025354D0 (en) | 2000-10-17 | 2000-11-29 | Glaxo Group Ltd | Chemical compounds |
EP1427418B1 (en) | 2001-08-24 | 2009-11-11 | Yale University | Piperazinone compounds as anti-tumor and anti-cancer agents |
GB0203022D0 (en) | 2002-02-08 | 2002-03-27 | Glaxo Group Ltd | Chemical compounds |
JP2005522436A (ja) | 2002-02-08 | 2005-07-28 | グラクソ グループ リミテッド | ピペリジルカルボキシアミド誘導体またはそのタキキニン介在疾患の治療における使用 |
GB0203020D0 (en) | 2002-02-08 | 2002-03-27 | Glaxo Group Ltd | Chemical compounds |
KR20090104855A (ko) * | 2007-01-31 | 2009-10-06 | 토야마 케미칼 컴퍼니 리미티드 | 피페라실린나트륨의 신규 결정 |
MY155655A (en) | 2008-10-31 | 2015-11-13 | Shionogi & Co | Cephalosporin having catechol group |
CA2795322A1 (en) | 2010-04-05 | 2011-10-13 | Shionogi & Co., Ltd. | Cephem compound having catechol group |
WO2011125966A1 (ja) | 2010-04-05 | 2011-10-13 | 塩野義製薬株式会社 | 擬似カテコール基を有するセフェム化合物 |
US9085589B2 (en) | 2010-04-28 | 2015-07-21 | Shionogi & Co., Ltd. | Cephem derivative |
KR20140039202A (ko) | 2011-04-28 | 2014-04-01 | 시오노기세야쿠 가부시키가이샤 | 카테콜 또는 의사 카테콜 구조를 갖는 신규 세펨 화합물 |
JPWO2013002215A1 (ja) | 2011-06-27 | 2015-02-23 | 塩野義製薬株式会社 | ピリジニウム基を有するセフェム化合物 |
CN110746445B (zh) * | 2019-10-16 | 2021-03-16 | 深圳海关食品检验检疫技术中心 | 一种头孢哌酮氘代内标物的制备方法 |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE1770620A1 (de) * | 1968-06-12 | 1971-11-11 | Bayer Ag | Neue Penicilline |
DE2025415C3 (de) * | 1970-05-25 | 1981-01-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von cyclischen Acylureido-Penicillinen |
DE2104580C3 (de) * | 1971-02-01 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Acylureidopenicilline |
BE790440A (en:Method) * | 1971-10-23 | 1973-04-24 | Bayer Ag | |
BE794886A (fr) * | 1972-02-22 | 1973-08-02 | Pfizer | Acides 6-(alpha-(omega-guanidinoalcanoylamino)acylamino)-penicillaniques |
CH570407A5 (en:Method) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
AR204813A1 (es) * | 1972-05-08 | 1976-03-05 | Yamanouchi Pharma Co Ltd | Proceso para la preparacion de derivados de ampilicina |
-
1975
- 1975-04-24 IL IL47168A patent/IL47168A/xx unknown
- 1975-04-28 CY CY1026A patent/CY1026A/xx unknown
- 1975-04-28 GB GB15360/77A patent/GB1508064A/en not_active Expired
- 1975-04-28 GB GB17557/75A patent/GB1508062A/en not_active Expired
- 1975-04-30 DE DE2560239A patent/DE2560239C2/de not_active Expired
- 1975-04-30 DE DE2519400A patent/DE2519400C3/de not_active Expired
- 1975-05-02 BE BE156035A patent/BE828692A/xx not_active IP Right Cessation
- 1975-05-05 PH PH17137A patent/PH21545A/en unknown
- 1975-05-06 CH CH584775A patent/CH605995A5/xx not_active IP Right Cessation
- 1975-05-06 FR FR7514159A patent/FR2269937B1/fr not_active Expired
- 1975-05-06 AR AR258658A patent/AR209607A1/es active
- 1975-05-07 NL NL7505375.A patent/NL162386C/xx not_active IP Right Cessation
- 1975-05-07 DK DK201975A patent/DK151338C/da not_active IP Right Cessation
- 1975-05-07 FI FI751340A patent/FI63760C/fi not_active IP Right Cessation
- 1975-05-08 DD DD185922A patent/DD117882A5/xx unknown
- 1975-05-08 HU HUTO1002A patent/HU169633B/hu unknown
- 1975-05-09 SE SE7505392A patent/SE431457B/xx not_active IP Right Cessation
-
1976
- 1976-02-10 PH PH18076A patent/PH20534A/en unknown
- 1976-10-22 FR FR7631895A patent/FR2320295A1/fr active Granted
- 1976-11-08 AT AT828976A patent/AT344906B/de not_active IP Right Cessation
- 1976-11-15 PH PH19128A patent/PH22346A/en unknown
- 1976-11-15 PH PH19129A patent/PH22336A/en unknown
-
1977
- 1977-05-25 PH PH19814A patent/PH21987A/en unknown
- 1977-11-29 IL IL53485A patent/IL53485A0/xx not_active IP Right Cessation
-
1978
- 1978-07-27 SE SE7808204A patent/SE435062B/sv not_active IP Right Cessation
-
1979
- 1979-03-01 KE KE2923A patent/KE2923A/xx unknown
- 1979-04-26 HK HK262/79A patent/HK26279A/xx unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
FI63760C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara penicilliner | |
RU2130939C1 (ru) | Производные цефалоспорина и фармацевтический препарат | |
EP0071395B1 (en) | Beta-lactam antibacterial agents | |
CN107260729B (zh) | β-内酰胺化合物及其用途 | |
CA1146535A (en) | Aminothiazoles with terminal aminocarboxylic acid grouping | |
US4231928A (en) | Antibacterial agents | |
US3981865A (en) | Bis-type penicillins and process for producing the same | |
EP0295630A2 (de) | Cephalosporinderivate | |
US3962224A (en) | Cephalosporin compounds | |
US4018933A (en) | Acylaminopenicillanic acids and process for preparing them | |
NZ208055A (en) | Amino-lower alkyl penem compounds and pharmaceutical compositions | |
US4735938A (en) | 2-aminothiazolyl-containing β-lactam antibiotics | |
HUT55789A (en) | Process for producing new penicillin derivatives and pharmaceutical compositions containing them as active components | |
CA1178272A (en) | Penicillin derivatives | |
YOSHIDA et al. | STUDIES ON MONOCYCLIC β-LACTAM ANTIBIOTICS II. SYNTHESIS AND ANTIBACTERIAL ACTIVITY OF 3-ACYLAMINO-2-AZETIDINONE-1-OXYSULFONIC ACIDS | |
EP0150458B1 (en) | Cephem compounds | |
HUP0102350A2 (hu) | Propenil-cefalosporin-származékok, eljárás előállításukra, ezeket tartalmazó gyógyszerkészítmények, valamint intermedierek | |
HU205611B (en) | Process for producing 1,1-dioxo-penicillanoyl-oxy-methyl-d-6-/alpha-/methylen-amino/-phenyl-acetyl-amino/-penicillanate, salts and pharmaceutical compositions contaiing them as active components | |
NO891403L (no) | Nye forbindelser. | |
NO882652L (no) | Acylderivater. | |
US4472300A (en) | Azetidinone derivatives and process for preparation thereof | |
JPS60209589A (ja) | セフアロスポリン誘導体のエステル | |
US4173703A (en) | Preparation of carbamates | |
US4029654A (en) | 7-Methoxy phenylureidocephalosporins | |
CS199669B2 (en) | Method of producing derivatives of 7 beta-aryl-malonamido-3-substituted thiomethyl-1-oxadethia-3-cephem-4-carboxylic acids |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
MA | Patent expired | ||
MA | Patent expired |
Owner name: TOYAMA CHEMICAL CO., LTD. |