FI56374C - Foerfarande foer framstaellning av beta-receptorblockerande ureidofenoxi-alkanolaminderivat - Google Patents
Foerfarande foer framstaellning av beta-receptorblockerande ureidofenoxi-alkanolaminderivat Download PDFInfo
- Publication number
- FI56374C FI56374C FI325671A FI325671A FI56374C FI 56374 C FI56374 C FI 56374C FI 325671 A FI325671 A FI 325671A FI 325671 A FI325671 A FI 325671A FI 56374 C FI56374 C FI 56374C
- Authority
- FI
- Finland
- Prior art keywords
- group
- general formula
- formula
- hydroxy
- phenoxy
- Prior art date
Links
- 230000000903 blocking effect Effects 0.000 title claims description 5
- 102000012740 beta Adrenergic Receptors Human genes 0.000 title description 2
- 108010079452 beta Adrenergic Receptors Proteins 0.000 title description 2
- -1 ureidophenyl Chemical class 0.000 claims description 70
- 150000001875 compounds Chemical class 0.000 claims description 51
- 125000004432 carbon atom Chemical group C* 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 125000006239 protecting group Chemical group 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000001412 amines Chemical class 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 7
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 235000005985 organic acids Nutrition 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 239000002876 beta blocker Substances 0.000 claims description 2
- 150000007529 inorganic bases Chemical class 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims 5
- 230000007017 scission Effects 0.000 claims 5
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- 230000029936 alkylation Effects 0.000 claims 1
- 238000005804 alkylation reaction Methods 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 238000004061 bleaching Methods 0.000 claims 1
- 230000006315 carbonylation Effects 0.000 claims 1
- 238000005810 carbonylation reaction Methods 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 210000001672 ovary Anatomy 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 123
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 81
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 66
- 239000000243 solution Substances 0.000 description 65
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 63
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- 238000002844 melting Methods 0.000 description 31
- 230000008018 melting Effects 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 238000001953 recrystallisation Methods 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 17
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- MXFWWQICDIZSOA-UHFFFAOYSA-N talinolol Chemical compound C1=CC(OCC(O)CNC(C)(C)C)=CC=C1NC(=O)NC1CCCCC1 MXFWWQICDIZSOA-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 8
- 239000005711 Benzoic acid Substances 0.000 description 8
- 229960004365 benzoic acid Drugs 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- 229960001317 isoprenaline Drugs 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 7
- 229960005215 dichloroacetic acid Drugs 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- BLOZPOZETDEMRB-UHFFFAOYSA-N 1-(4-aminophenoxy)-3-(tert-butylamino)propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC=C(N)C=C1 BLOZPOZETDEMRB-UHFFFAOYSA-N 0.000 description 6
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 229910000564 Raney nickel Inorganic materials 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- OWUOHIMJYZRAGE-UHFFFAOYSA-N 1-cyclohexyl-3-[4-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound C=1C=C(OCC2OC2)C=CC=1NC(=O)NC1CCCCC1 OWUOHIMJYZRAGE-UHFFFAOYSA-N 0.000 description 5
- WWCSRBJGECHTEY-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea Chemical compound C1=CC(OCC(O)CNC(C)C)=CC=C1NC(=O)NC1CCCCC1 WWCSRBJGECHTEY-UHFFFAOYSA-N 0.000 description 5
- OJANSDIGRNTINO-UHFFFAOYSA-N CC(C)(C)N(CC(COC(C=C1)=CC=C1NC(NC1CCCCC1)=O)O)CC1=CC=CC=C1 Chemical compound CC(C)(C)N(CC(COC(C=C1)=CC=C1NC(NC1CCCCC1)=O)O)CC1=CC=CC=C1 OJANSDIGRNTINO-UHFFFAOYSA-N 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000000370 acceptor Substances 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 229940074355 nitric acid Drugs 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- GTMZDRXSOBSLHE-UHFFFAOYSA-N phenyl N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]carbamate hydrochloride Chemical compound Cl.O(C1=CC=CC=C1)C(=O)NC1=CC=C(OCC(CNC(C)C)O)C=C1 GTMZDRXSOBSLHE-UHFFFAOYSA-N 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- QFUSOYKIDBRREL-NSCUHMNNSA-N (e)-but-2-en-1-amine Chemical compound C\C=C\CN QFUSOYKIDBRREL-NSCUHMNNSA-N 0.000 description 3
- PBXOIGMNAGFCHA-UHFFFAOYSA-N 1-[4-(3-amino-2-hydroxypropoxy)phenyl]-3-cyclohexylurea hydrochloride Chemical compound Cl.C1(CCCCC1)NC(NC1=CC=C(OCC(CN)O)C=C1)=O PBXOIGMNAGFCHA-UHFFFAOYSA-N 0.000 description 3
- APBDSTSXZFGYOL-UHFFFAOYSA-N 1-[4-(3-chloro-2-hydroxypropoxy)phenyl]-3-cyclohexylurea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OCC(CCl)O)C=C1)=O APBDSTSXZFGYOL-UHFFFAOYSA-N 0.000 description 3
- MVSQSTCYZTZEIE-UHFFFAOYSA-N 1-ethyl-3-[4-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound C1=CC(NC(=O)NCC)=CC=C1OCC1OC1 MVSQSTCYZTZEIE-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- GFXXPMIPRAMQCB-UHFFFAOYSA-N Cl.[N+](=O)([O-])C1=CC=C(OCC(CNC(C)(C)C)O)C=C1 Chemical compound Cl.[N+](=O)([O-])C1=CC=C(OCC(CNC(C)(C)C)O)C=C1 GFXXPMIPRAMQCB-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- FGMUQNDVAWYYSW-UHFFFAOYSA-N [4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea Chemical compound CC(C)NCC(O)COC1=CC=C(NC(N)=O)C=C1 FGMUQNDVAWYYSW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000006264 debenzylation reaction Methods 0.000 description 3
- 229940013688 formic acid Drugs 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 235000011087 fumaric acid Nutrition 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910052987 metal hydride Inorganic materials 0.000 description 3
- 150000004681 metal hydrides Chemical class 0.000 description 3
- 230000004118 muscle contraction Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229940032330 sulfuric acid Drugs 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- JYBJDVFUKCGOFM-UHFFFAOYSA-N 1-cyclohexyl-3-[3-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound C1(CCCCC1)NC(=O)NC1=CC(=CC=C1)OCC1CO1 JYBJDVFUKCGOFM-UHFFFAOYSA-N 0.000 description 2
- XMUPYGCITCUYQP-UHFFFAOYSA-N 1-methyl-3-[4-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound CNC(=O)NC1=CC=C(C=C1)OCC1CO1 XMUPYGCITCUYQP-UHFFFAOYSA-N 0.000 description 2
- XFSBVAOIAHNAPC-XTHSEXKGSA-N 16-Ethyl-1alpha,6alpha,19beta-trimethoxy-4-(methoxymethyl)-aconitane-3alpha,8,10alpha,11,18alpha-pentol, 8-acetate 10-benzoate Chemical compound O([C@H]1[C@]2(O)C[C@H]3[C@@]45C6[C@@H]([C@@]([C@H]31)(OC(C)=O)[C@@H](O)[C@@H]2OC)[C@H](OC)[C@@H]4[C@]([C@@H](C[C@@H]5OC)O)(COC)CN6CC)C(=O)C1=CC=CC=C1 XFSBVAOIAHNAPC-XTHSEXKGSA-N 0.000 description 2
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- XFSBVAOIAHNAPC-UHFFFAOYSA-N Aconitin Natural products CCN1CC(C(CC2OC)O)(COC)C3C(OC)C(C(C45)(OC(C)=O)C(O)C6OC)C1C32C4CC6(O)C5OC(=O)C1=CC=CC=C1 XFSBVAOIAHNAPC-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- VNFHCSQMXQQNSL-UHFFFAOYSA-N [4-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound C1=CC(NC(=O)N)=CC=C1OCC1OC1 VNFHCSQMXQQNSL-UHFFFAOYSA-N 0.000 description 2
- 229940039750 aconitine Drugs 0.000 description 2
- STDXGNLCJACLFY-UHFFFAOYSA-N aconitine Natural products CCN1CC2(COC)C(O)CC(O)C34C5CC6(O)C(OC)C(O)C(OC(=O)C)(C5C6OC(=O)c7ccccc7)C(C(OC)C23)C14 STDXGNLCJACLFY-UHFFFAOYSA-N 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 230000001746 atrial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 229940116315 oxalic acid Drugs 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 229960004838 phosphoric acid Drugs 0.000 description 2
- DURULFYMVIFBIR-UHFFFAOYSA-N practolol Chemical compound CC(C)NCC(O)COC1=CC=C(NC(C)=O)C=C1 DURULFYMVIFBIR-UHFFFAOYSA-N 0.000 description 2
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 230000035488 systolic blood pressure Effects 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 150000007968 uric acids Chemical class 0.000 description 2
- MBHQWSSJIBMVIA-UHFFFAOYSA-N 1-(4-aminophenoxy)-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=C(N)C=C1 MBHQWSSJIBMVIA-UHFFFAOYSA-N 0.000 description 1
- DGXWLOOOWHMBLA-UHFFFAOYSA-N 1-(4-aminophenoxy)-3-(tert-butylamino)propan-2-ol hydrochloride Chemical compound Cl.NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1 DGXWLOOOWHMBLA-UHFFFAOYSA-N 0.000 description 1
- DIXHLBMAUVRJOS-UHFFFAOYSA-N 1-(tert-butylamino)-3-(4-nitrophenoxy)propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC=C([N+]([O-])=O)C=C1 DIXHLBMAUVRJOS-UHFFFAOYSA-N 0.000 description 1
- QWXUJPJVNKCDKJ-UHFFFAOYSA-N 1-(tert-butylamino)-3-chloropropan-2-ol;hydrochloride Chemical compound Cl.CC(C)(C)NCC(O)CCl QWXUJPJVNKCDKJ-UHFFFAOYSA-N 0.000 description 1
- RVYHWDPLEHCZOY-UHFFFAOYSA-N 1-[4-(1-amino-2-hydroxy-4,4,6,6-tetramethylheptoxy)phenyl]-3-cyclohexylurea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OC(C(CC(CC(C)(C)C)(C)C)O)N)C=C1)=O RVYHWDPLEHCZOY-UHFFFAOYSA-N 0.000 description 1
- ZWMOWFJMDHZCNJ-UHFFFAOYSA-N 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-methylurea Chemical compound CNC(=O)NC1=CC=C(OCC(O)CNC(C)C)C=C1 ZWMOWFJMDHZCNJ-UHFFFAOYSA-N 0.000 description 1
- VHJCBLXZVBTABV-UHFFFAOYSA-N 1-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-3-propan-2-ylurea Chemical compound C(C)(C)NC(NC1=CC=C(OCC(CNC(C)C)O)C=C1)=O VHJCBLXZVBTABV-UHFFFAOYSA-N 0.000 description 1
- RUPKEIHOXHDNNN-UHFFFAOYSA-N 1-[4-[3-(but-2-enylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea Chemical compound C1=CC(OCC(O)CNCC=CC)=CC=C1NC(=O)NC1CCCCC1 RUPKEIHOXHDNNN-UHFFFAOYSA-N 0.000 description 1
- OGHBPFBLTODNEK-UHFFFAOYSA-N 1-[4-[3-(cycloheptylamino)-2-hydroxypropoxy]phenyl]-3-cyclohexylurea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OCC(CNC2CCCCCC2)O)C=C1)=O OGHBPFBLTODNEK-UHFFFAOYSA-N 0.000 description 1
- ZXICSJLSQAPYGB-UHFFFAOYSA-N 1-but-2-enyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea Chemical compound C(C=CC)NC(NC1=CC=C(OCC(CNC(C)C)O)C=C1)=O ZXICSJLSQAPYGB-UHFFFAOYSA-N 0.000 description 1
- ZVWSNXCTWJBKPV-UHFFFAOYSA-N 1-cyclohexyl-3-[2-(oxiran-2-ylmethoxy)phenyl]urea Chemical compound C1(CCCCC1)NC(=O)NC1=C(C=CC=C1)OCC1CO1 ZVWSNXCTWJBKPV-UHFFFAOYSA-N 0.000 description 1
- UGJCCJAWMRVCOV-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[2-hydroxy-3-(3-methylbutylamino)propoxy]phenyl]urea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OCC(CNCCC(C)C)O)C=C1)=O UGJCCJAWMRVCOV-UHFFFAOYSA-N 0.000 description 1
- MQVJCDXQDDHXED-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[2-hydroxy-3-(methylamino)propoxy]phenyl]urea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OCC(CNC)O)C=C1)=O MQVJCDXQDDHXED-UHFFFAOYSA-N 0.000 description 1
- KSQZLKFCBZMSKA-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[3-(cyclohexylamino)-2-hydroxypropoxy]phenyl]urea Chemical compound C=1C=C(NC(=O)NC2CCCCC2)C=CC=1OCC(O)CNC1CCCCC1 KSQZLKFCBZMSKA-UHFFFAOYSA-N 0.000 description 1
- NYYSFOJJGVOLRP-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[3-(cyclopentylamino)-2-hydroxypropoxy]phenyl]urea Chemical compound C=1C=C(NC(=O)NC2CCCCC2)C=CC=1OCC(O)CNC1CCCC1 NYYSFOJJGVOLRP-UHFFFAOYSA-N 0.000 description 1
- OSOJHWBJMSAAEJ-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[3-(hexylamino)-2-hydroxypropoxy]phenyl]urea Chemical compound C1(CCCCC1)NC(NC1=CC=C(OCC(CNCCCCCC)O)C=C1)=O OSOJHWBJMSAAEJ-UHFFFAOYSA-N 0.000 description 1
- IAIBRPHXTNASAD-UHFFFAOYSA-N 1-cyclopropyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea Chemical compound C1(CC1)NC(NC1=CC=C(OCC(CNC(C)C)O)C=C1)=O IAIBRPHXTNASAD-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- CFJMHEIWIQRQOI-UHFFFAOYSA-N 1-hexyl-3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]urea Chemical compound CCCCCCNC(=O)NC1=CC=C(OCC(O)CNC(C)C)C=C1 CFJMHEIWIQRQOI-UHFFFAOYSA-N 0.000 description 1
- 125000005978 1-naphthyloxy group Chemical group 0.000 description 1
- LJQGARKSJMMQBX-UHFFFAOYSA-N 2-methyl-n-propylpropan-2-amine Chemical compound CCCNC(C)(C)C LJQGARKSJMMQBX-UHFFFAOYSA-N 0.000 description 1
- PAONSUXLFOSFKN-UHFFFAOYSA-N 2-methyl-n-propylpropan-2-amine;hydrochloride Chemical compound Cl.CCCNC(C)(C)C PAONSUXLFOSFKN-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- 241000173529 Aconitum napellus Species 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- BKEVFGZOTDXVMT-UHFFFAOYSA-N C(C)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O Chemical compound C(C)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O BKEVFGZOTDXVMT-UHFFFAOYSA-N 0.000 description 1
- FPTDKRUSFXYSMN-UHFFFAOYSA-N C(C=1C(O)=CC=CC1)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O Chemical compound C(C=1C(O)=CC=CC1)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O FPTDKRUSFXYSMN-UHFFFAOYSA-N 0.000 description 1
- DXMOSRUOHNDLAU-UHFFFAOYSA-N C(CCC(=O)O)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O Chemical compound C(CCC(=O)O)(=O)O.C1(CCCCC1)NC(NC1=CC=C(OCC(CNC(C)(C)C)O)C=C1)=O DXMOSRUOHNDLAU-UHFFFAOYSA-N 0.000 description 1
- CBJGSKRIEFGMPU-UHFFFAOYSA-N C1(CCCCC1)N(C(=O)N)C1=CC=C(C=C1)OCC1CO1 Chemical compound C1(CCCCC1)N(C(=O)N)C1=CC=C(C=C1)OCC1CO1 CBJGSKRIEFGMPU-UHFFFAOYSA-N 0.000 description 1
- NFVONSZOHZDACD-UHFFFAOYSA-N Cl.N(C(=O)N)C1=CC=C(OCC(CNC(C)(C)C)O)C=C1 Chemical compound Cl.N(C(=O)N)C1=CC=C(OCC(CNC(C)(C)C)O)C=C1 NFVONSZOHZDACD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229910000990 Ni alloy Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical group C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- UKXSKSHDVLQNKG-UHFFFAOYSA-N benzilic acid Chemical compound C=1C=CC=CC=1C(O)(C(=O)O)C1=CC=CC=C1 UKXSKSHDVLQNKG-UHFFFAOYSA-N 0.000 description 1
- 229940087675 benzilic acid Drugs 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007805 chemical reaction reactant Substances 0.000 description 1
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 230000035487 diastolic blood pressure Effects 0.000 description 1
- KNPZPCOJIIEWQB-DTPOWOMPSA-N dibenzoyl (2R,3R)-2,3-dihydroxybutanedioate propan-1-amine Chemical compound CCCN.O=C([C@H](O)[C@@H](O)C(=O)OC(=O)C=1C=CC=CC=1)OC(=O)C1=CC=CC=C1 KNPZPCOJIIEWQB-DTPOWOMPSA-N 0.000 description 1
- 229940120124 dichloroacetate Drugs 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- AXIFAUVPXCABHW-UHFFFAOYSA-N ethyl n-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(OCC(O)CNC(C)C)C=C1 AXIFAUVPXCABHW-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- XKDUZXVNQOZCFC-UHFFFAOYSA-N hexan-1-amine;hydron;chloride Chemical compound Cl.CCCCCCN XKDUZXVNQOZCFC-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000036543 hypotension Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 210000005240 left ventricle Anatomy 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- DLSOILHAKCBARI-UHFFFAOYSA-N n-benzyl-2-methylpropan-2-amine Chemical compound CC(C)(C)NCC1=CC=CC=C1 DLSOILHAKCBARI-UHFFFAOYSA-N 0.000 description 1
- VLSTXUUYLIALPB-UHFFFAOYSA-N n-propan-2-ylpropan-1-amine Chemical compound CCCNC(C)C VLSTXUUYLIALPB-UHFFFAOYSA-N 0.000 description 1
- CWYZDPHNAGSFQB-UHFFFAOYSA-N n-propylbutan-1-amine Chemical compound CCCCNCCC CWYZDPHNAGSFQB-UHFFFAOYSA-N 0.000 description 1
- JPZAYXNLNMYCAK-UHFFFAOYSA-N n-propylbutan-1-amine;hydrochloride Chemical compound Cl.CCCCNCCC JPZAYXNLNMYCAK-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 230000009090 positive inotropic effect Effects 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- FJWLWIRHZOHPIY-UHFFFAOYSA-N potassium;hydroiodide Chemical compound [K].I FJWLWIRHZOHPIY-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003349 semicarbazides Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD15123670 | 1970-11-13 | ||
| DD15123670 | 1970-11-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56374B FI56374B (fi) | 1979-09-28 |
| FI56374C true FI56374C (fi) | 1980-01-10 |
Family
ID=5483145
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI325671A FI56374C (fi) | 1970-11-13 | 1971-11-15 | Foerfarande foer framstaellning av beta-receptorblockerande ureidofenoxi-alkanolaminderivat |
Country Status (13)
| Country | Link |
|---|---|
| BG (7) | BG20897A1 (index.php) |
| CH (1) | CH565750A5 (index.php) |
| CS (7) | CS177498B1 (index.php) |
| DE (1) | DE2153024C3 (index.php) |
| DK (1) | DK136712C (index.php) |
| FI (1) | FI56374C (index.php) |
| FR (1) | FR2113982A1 (index.php) |
| HU (1) | HU172438B (index.php) |
| PL (7) | PL95648B1 (index.php) |
| RO (7) | RO64200A (index.php) |
| SE (1) | SE373838B (index.php) |
| SU (7) | SU510470A1 (index.php) |
| YU (4) | YU36491B (index.php) |
-
1971
- 1971-10-25 DE DE19712153024 patent/DE2153024C3/de not_active Expired
- 1971-10-27 CH CH1564971A patent/CH565750A5/xx not_active IP Right Cessation
- 1971-11-06 BG BG1894571A patent/BG20897A1/xx unknown
- 1971-11-06 BG BG2093471A patent/BG18955A1/xx unknown
- 1971-11-06 BG BG2093571A patent/BG20898A1/xx unknown
- 1971-11-06 BG BG2093771A patent/BG18956A1/xx unknown
- 1971-11-06 BG BG2093871A patent/BG18957A1/xx unknown
- 1971-11-06 BG BG2093671A patent/BG19907A1/xx unknown
- 1971-11-06 BG BG2093971A patent/BG18958A1/xx unknown
- 1971-11-09 RO RO7487271A patent/RO64200A/ro unknown
- 1971-11-09 RO RO7521871A patent/RO62905A/ro unknown
- 1971-11-09 RO RO7521971A patent/RO62906A/ro unknown
- 1971-11-09 RO RO7486571A patent/RO64022A/ro unknown
- 1971-11-09 RO RO6869271A patent/RO62250A/ro unknown
- 1971-11-09 RO RO7522071A patent/RO63448A/ro unknown
- 1971-11-09 RO RO7522171A patent/RO62907A/ro unknown
- 1971-11-10 CS CS801471A patent/CS177498B1/cs unknown
- 1971-11-10 CS CS801574A patent/CS177499B1/cs unknown
- 1971-11-10 CS CS801071A patent/CS177495B1/cs unknown
- 1971-11-10 CS CS801174A patent/CS177496B1/cs unknown
- 1971-11-10 CS CS801274A patent/CS177497B1/cs unknown
- 1971-11-10 CS CS787871A patent/CS177451B1/cs unknown
- 1971-11-10 CS CS801374A patent/CS183020B1/cs unknown
- 1971-11-11 PL PL17846571A patent/PL95648B1/pl unknown
- 1971-11-11 DK DK551371A patent/DK136712C/da not_active IP Right Cessation
- 1971-11-11 HU HU71AE00000345A patent/HU172438B/hu unknown
- 1971-11-11 PL PL17847071A patent/PL95744B1/pl unknown
- 1971-11-11 PL PL17846671A patent/PL94028B1/pl unknown
- 1971-11-11 PL PL17846871A patent/PL94076B1/pl unknown
- 1971-11-11 PL PL17846971A patent/PL95743B1/pl unknown
- 1971-11-11 PL PL17846771A patent/PL94027B1/pl unknown
- 1971-11-11 PL PL15149071A patent/PL89374B1/pl unknown
- 1971-11-11 YU YU283671A patent/YU36491B/xx unknown
- 1971-11-12 SU SU1908717A patent/SU510470A1/ru active
- 1971-11-12 SU SU1908721A patent/SU511316A1/ru active
- 1971-11-12 SU SU1714257A patent/SU521262A1/ru active
- 1971-11-12 SU SU7101908715A patent/SU580207A1/ru active
- 1971-11-12 SE SE1455471A patent/SE373838B/xx unknown
- 1971-11-12 SU SU1908723A patent/SU496268A1/ru active
- 1971-11-15 FR FR7140829A patent/FR2113982A1/fr active Granted
- 1971-11-15 FI FI325671A patent/FI56374C/fi active
-
1973
- 1973-04-13 SU SU1908719A patent/SU504758A1/ru active
- 1973-04-13 SU SU7301908722A patent/SU578304A1/ru active
-
1979
- 1979-02-20 YU YU41079A patent/YU41079A/xx unknown
- 1979-03-08 YU YU56479A patent/YU56479A/xx unknown
- 1979-03-15 YU YU62579A patent/YU62579A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4034009A (en) | 4-Ureido-2-acyl phenoxypropanolamine | |
| NO161543B (no) | Sprengladning for bruk ved skjoeting av roer ved eksplosjonssveising. | |
| DE3512627A1 (de) | Amino-propanol-derivate, verfahren zu deren herstellung, verwendung derselben und diese enthaltende arzneimittel | |
| CA1149819A (en) | Process for the manufacture of new amines | |
| US4363808A (en) | N-(3-Phenoxy-2-hydroxypropyl)benzimidazole-1-alkanamines | |
| FI56374C (fi) | Foerfarande foer framstaellning av beta-receptorblockerande ureidofenoxi-alkanolaminderivat | |
| FI62060C (fi) | Foerfarande foer framstaellning av beta-blockerande substituerad 2-hydroxi-3-(2-acyl-4-ureido-fenoxi)-propylaminderivat | |
| EP0085286B1 (en) | Para-substituted 3-phenoxy-1-carbonylaminoalkylamino-propan-2-ols having beta receptor blocking properties | |
| US3383415A (en) | 2-tertiary-aminomethyl-nu-(loweralkyl) anilines | |
| GB1574665A (en) | 3,4-dihydrocarbostyril derivatives and process for preparing the same | |
| US3334115A (en) | Basically substituted ureas and salts thereof | |
| US2974142A (en) | Morphinan derivatives | |
| NO115028B (index.php) | ||
| US3983169A (en) | Phenoxypropylamine derivatives | |
| US3524851A (en) | 1-phenoxy-3-morpholino alkylamino-2-propanols | |
| CA1061341A (en) | Process for the preparation of phenoxypropylamine derivatives and salts thereof | |
| US2843585A (en) | 3-aralkyl-2-oxazolidones and 3-aralkyl-2-pentoxazolidones and their synthesis | |
| US3228976A (en) | 1, 4-bis-(aminomethyl)-1-cyclohexene compounds | |
| US3360562A (en) | 2-tertiaryaminomethyl-n-acylanilines | |
| CS203057B2 (en) | Method of producing novel derivatives of n-/3,3-diphenyl propyl/-propylendiamine | |
| US3864398A (en) | Process for the preparation of acylamino alkanol derivatives | |
| Tatsuno et al. | Synthesis and adrenergic. beta.-blocking activity of some 1, 3-benzodioxole derivatives | |
| FI59582B (fi) | Foerfarande foer framstaellning av nya terapeutiskt verksamma fenoxylpropylaminderivat och deras salter | |
| US3821301A (en) | Substituted aminoalkyl guanidines | |
| US4172150A (en) | Cardiac stimulants |