DK142360B - Fungicide N-acyl-anilinoeddikesyrederivater til anvendelse ved plantebeskyttelse. - Google Patents
Fungicide N-acyl-anilinoeddikesyrederivater til anvendelse ved plantebeskyttelse. Download PDFInfo
- Publication number
- DK142360B DK142360B DK136375AA DK136375A DK142360B DK 142360 B DK142360 B DK 142360B DK 136375A A DK136375A A DK 136375AA DK 136375 A DK136375 A DK 136375A DK 142360 B DK142360 B DK 142360B
- Authority
- DK
- Denmark
- Prior art keywords
- methyl
- ethyl
- alkyl
- halogen
- plants
- Prior art date
Links
- 230000000855 fungicidal effect Effects 0.000 title description 11
- 239000000417 fungicide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 44
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 36
- 241000196324 Embryophyta Species 0.000 claims description 32
- 239000013543 active substance Substances 0.000 claims description 23
- 230000000694 effects Effects 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000007921 spray Substances 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 15
- -1 halogen anion Chemical class 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- 150000002367 halogens Chemical class 0.000 claims description 13
- 239000000843 powder Substances 0.000 claims description 13
- 239000002689 soil Substances 0.000 claims description 13
- 241000233866 Fungi Species 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000002474 experimental method Methods 0.000 claims description 5
- 235000021536 Sugar beet Nutrition 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 238000005507 spraying Methods 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 230000012010 growth Effects 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000004576 sand Substances 0.000 claims description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 238000005554 pickling Methods 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 230000003287 optical effect Effects 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 235000012211 aluminium silicate Nutrition 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 150000002431 hydrogen Chemical group 0.000 description 6
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 240000003768 Solanum lycopersicum Species 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 235000019993 champagne Nutrition 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 241001281803 Plasmopara viticola Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000005520 cutting process Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NEOYGRJJOGVQPO-UHFFFAOYSA-N methyl 2-(2,6-dimethylanilino)propanoate Chemical compound COC(=O)C(C)NC1=C(C)C=CC=C1C NEOYGRJJOGVQPO-UHFFFAOYSA-N 0.000 description 2
- ACEONLNNWKIPTM-UHFFFAOYSA-N methyl 2-bromopropanoate Chemical compound COC(=O)C(C)Br ACEONLNNWKIPTM-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000003032 phytopathogenic effect Effects 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- GSFSVEDCYBDIGW-UHFFFAOYSA-N 2-(1,3-benzothiazol-2-yl)-6-chlorophenol Chemical compound OC1=C(Cl)C=CC=C1C1=NC2=CC=CC=C2S1 GSFSVEDCYBDIGW-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- FPQQSNUTBWFFLB-UHFFFAOYSA-N 2-chloro-n-(2,6-dimethylphenyl)acetamide Chemical class CC1=CC=CC(C)=C1NC(=O)CCl FPQQSNUTBWFFLB-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- FUCUHFQBEBZAFY-UHFFFAOYSA-N 6-ethyl-2,3-dimethylaniline Chemical compound CCC1=CC=C(C)C(C)=C1N FUCUHFQBEBZAFY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241001553178 Arachis glabrata Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 241001647031 Avena sterilis Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 125000004650 C1-C8 alkynyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000219122 Cucurbita Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- 241001480059 Erysiphaceae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- 240000008790 Musa x paradisiaca Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241001223281 Peronospora Species 0.000 description 1
- 241000233614 Phytophthora Species 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241000221535 Pucciniales Species 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 230000003641 microbiacidal effect Effects 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 239000004531 microgranule Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- SRAWNDFHGTVUNZ-UHFFFAOYSA-M sodium;3,6-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(CCCC)=CC2=CC(CCCC)=CC=C21 SRAWNDFHGTVUNZ-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- INDZTCRIYSRWOH-UHFFFAOYSA-N undec-10-enyl carbamimidothioate;hydroiodide Chemical compound I.NC(=N)SCCCCCCCCCC=C INDZTCRIYSRWOH-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/32—Isothioureas having sulfur atoms of isothiourea groups bound to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH499574 | 1974-04-09 | ||
| CH499574A CH592410A5 (en) | 1974-04-09 | 1974-04-09 | n-Substd. acetanilides - microbicides useful for treating phytopathogenic fungi, prepd. by acylation of substd. anilines |
| CH325975A CH608690A5 (en) | 1975-03-14 | 1975-03-14 | Microbicidal composition |
| CH325975 | 1975-03-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK136375A DK136375A (enExample) | 1975-10-10 |
| DK142360B true DK142360B (da) | 1980-10-20 |
| DK142360C DK142360C (enExample) | 1981-03-30 |
Family
ID=25692584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK136375AA DK142360B (da) | 1974-04-09 | 1975-03-26 | Fungicide N-acyl-anilinoeddikesyrederivater til anvendelse ved plantebeskyttelse. |
Country Status (33)
| Country | Link |
|---|---|
| US (3) | US4294850A (enExample) |
| JP (1) | JPS5443573B2 (enExample) |
| AR (1) | AR226272A1 (enExample) |
| AT (1) | AT341827B (enExample) |
| BG (1) | BG26357A3 (enExample) |
| CA (1) | CA1059141A (enExample) |
| CS (1) | CS187468B2 (enExample) |
| CY (1) | CY1010A (enExample) |
| DD (2) | DD118979A5 (enExample) |
| DE (1) | DE2515091C2 (enExample) |
| DK (1) | DK142360B (enExample) |
| ES (1) | ES436385A1 (enExample) |
| FI (1) | FI61477C (enExample) |
| FR (1) | FR2267042B1 (enExample) |
| GB (1) | GB1500581A (enExample) |
| HK (1) | HK40379A (enExample) |
| HU (1) | HU173318B (enExample) |
| IE (1) | IE40913B1 (enExample) |
| IL (1) | IL47046A (enExample) |
| IT (1) | IT1049536B (enExample) |
| KE (1) | KE2960A (enExample) |
| LU (1) | LU72224A1 (enExample) |
| MY (1) | MY8000056A (enExample) |
| NL (1) | NL184781C (enExample) |
| NO (1) | NO144960C (enExample) |
| OA (1) | OA04979A (enExample) |
| PH (1) | PH13585A (enExample) |
| PL (2) | PL104373B1 (enExample) |
| RO (3) | RO83787B (enExample) |
| SE (1) | SE430015B (enExample) |
| SU (2) | SU730268A3 (enExample) |
| TR (1) | TR18846A (enExample) |
| YU (1) | YU37311B (enExample) |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| OA04979A (fr) * | 1974-04-09 | 1980-11-30 | Ciba Geigy | Nouveaux dérivés de l'aniline utiles comme agents microbicides et leur procédé de préparation. |
| US4147792A (en) * | 1977-02-04 | 1979-04-03 | Ciba-Geigy Corporation | Fungicidal compositions |
| CH627343A5 (en) * | 1977-03-28 | 1982-01-15 | Ciba Geigy Ag | Microbicide |
| CH629939A5 (de) * | 1977-03-29 | 1982-05-28 | Ciba Geigy Ag | Mikrobizides mittel. |
| AT368358B (de) * | 1977-12-24 | 1982-10-11 | Fisons Ltd | Schaedlingsbekaempfungs- und pflanzenwachstumsregulierungsmittel |
| DE2802211A1 (de) | 1978-01-19 | 1979-07-26 | Basf Ag | N-substituierte 2,6-dialkylaniline und verfahren zur herstellung von n- substituierten 2,6-dialkylanilinen |
| BG28977A3 (en) * | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| CS217976B2 (en) * | 1978-04-01 | 1983-02-25 | Lilly Industries Ltd | Fungicide means |
| CH635313A5 (de) * | 1978-05-19 | 1983-03-31 | Ciba Geigy Ag | Pflanzenmikrobizid wirkende hydrazino-acetanilid-derivate, verfahren zu ihrer herstellung sowie mikrobizide mittel mit diesen praeparaten als wirkstoffe. |
| CH635819A5 (de) * | 1978-06-02 | 1983-04-29 | Ciba Geigy Ag | Alkoxy-alkoxy-acetyl acylalanine, deren herstellung und verwendung als pflanzenfungizide. |
| CH637368A5 (de) * | 1978-10-27 | 1983-07-29 | Ciba Geigy Ag | Anilinderivate und daraus hergestellte schaedlingsbekaempfungsmittel. |
| CH641760A5 (de) * | 1978-11-27 | 1984-03-15 | Ciba Geigy Ag | Schaedlingsbekaempfungsmittel. |
| CH639940A5 (en) * | 1978-12-05 | 1983-12-15 | Ciba Geigy Ag | Substituted N-alkoxycarbonylethyl-N-acylanilines, microbicides containing them, and process for the preparation of the compounds |
| DE2948734A1 (de) * | 1978-12-07 | 1980-06-19 | Ciba Geigy Ag | Schaedlingsbekaempfungsmittel |
| FR2447373A1 (fr) * | 1979-01-24 | 1980-08-22 | Rhone Poulenc Agrochimie | Produits derives de l'aniline ayant une activite antifongique ainsi que leur procede de preparation |
| FR2451914A1 (fr) * | 1979-03-20 | 1980-10-17 | Ciba Geigy Ag | Composes aromatiques azotes possedant des proprietes microbicides |
| CH639643A5 (en) * | 1979-03-21 | 1983-11-30 | Ciba Geigy Ag | Pesticides |
| MA18800A1 (fr) * | 1979-04-10 | 1980-12-31 | Ciba Geigy Ag | Naphtylamines acylees,procede pour leur preparation et leur application comme phytofongicides |
| DE2915026A1 (de) * | 1979-04-12 | 1980-10-30 | Bayer Ag | N,n-disubstituierte ethylglycin (thiol)ester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2917893A1 (de) * | 1979-05-03 | 1980-11-13 | Ciba Geigy Ag | N-(alkoxy- bzw. alkoxycarbonalalkyl)- n-hydroxyacetyl- bzw. propionyl-anilin- derivate als pflanzenfungizide |
| DE2917914A1 (de) * | 1979-05-03 | 1980-11-13 | Ciba Geigy Ag | N-(alkoxy- bzw. alkoxycarbonylalkyl)- n-alkoxyalkoxyacetyl-anilin-derivate |
| ES493517A0 (es) * | 1979-07-25 | 1981-05-16 | Hoechst Ag | Procedimiento para la preparacion de anilidas de acido tio- glicolico, fungicidas |
| EP0025019B1 (de) * | 1979-08-29 | 1983-02-09 | Ciba-Geigy Ag | Sulfinyl- und Sulfonylacetanilide, Verfahren zu deren Herstellung und deren Verwendung als Mikrobizide |
| MA19111A1 (fr) * | 1979-10-26 | 1981-12-31 | Ciba Geigy Ag | Derives de l'homoserine,procede pour leur preparation et leur utilisation en tant que microbicides |
| DE2946910A1 (de) * | 1979-11-21 | 1981-07-02 | Hoechst Ag, 6230 Frankfurt | Fungizide sulfonyl-, bzw. sulfinylacetanilide |
| US4377587A (en) * | 1980-07-25 | 1983-03-22 | Ciba-Geigy Corporation | Arylamine derivatives and use thereof as microbicides |
| MA19215A1 (fr) * | 1980-07-25 | 1982-04-01 | Ciba Geigy Ag | Nouveaux derives arylamines,procede pour leur fabrication et utilisation en tant que microbicides . |
| US4448773A (en) * | 1981-04-29 | 1984-05-15 | Ciba-Geigy Corporation | Microbicidal N-alkoxycarbonyl-alkyl-N-substituted acetyl-anilines and -naphthylamines |
| FR2505327A1 (fr) * | 1981-05-08 | 1982-11-12 | Rhone Poulenc Agrochimie | Procede d'halogenation en meta de n-(o,o'-dialkyl phenyl) alaninates et homologues |
| FR2513993A1 (fr) * | 1981-10-06 | 1983-04-08 | Rhone Poulenc Agrochimie | Nouveaux fongicides homologues des n-phenyl alaninates et leur procede de preparation et leur application |
| US4742079A (en) * | 1982-01-26 | 1988-05-03 | Sandoz Ltd. | Fungicides containing cymoxanil and metalaxyl |
| CH654979A5 (de) * | 1982-01-26 | 1986-03-27 | Sandoz Ag | Fungizide und ihre verwendung. |
| EP0230209A3 (de) * | 1985-12-16 | 1987-08-12 | Ciba-Geigy Ag | Mikrobizide |
| HU198825B (en) * | 1987-03-09 | 1989-12-28 | Chinoin Gyogyszer Es Vegyeszet | Synergic fungicides |
| HU202481B (en) * | 1989-04-19 | 1991-03-28 | Nitrokemia Ipartelepek | Process for producing n-phenyl-n-(methoxyacetyl)-dl-alanine methyl ester derivatives |
| CA2023176A1 (en) * | 1989-08-25 | 1991-02-26 | Margaret M. Bowers-Daines | Preparation and use of iodopropargyl esters of a-amino acid derivatives as antimicrobial agents |
| US5252745A (en) * | 1989-08-25 | 1993-10-12 | Rohm And Haas Company | Preparation and use of iodopropargyl esters of α-amino acid derivatives as antimicrobial agents |
| US5266597A (en) * | 1990-11-23 | 1993-11-30 | Eastman Kodak Company | Fungicidal 2-acylacetanilide derivatives |
| US5155136A (en) * | 1990-11-23 | 1992-10-13 | Eastman Kodak Company | Fungicidal, 2-acylacetanilide derivatives |
| US5723491A (en) * | 1994-07-11 | 1998-03-03 | Novartis Corporation | Fungicidal composition and method of controlling fungus infestation |
| CH687169A5 (de) * | 1994-07-11 | 1996-10-15 | Ciba Geigy Ag | Mikrobizide. |
| DE4429014A1 (de) | 1994-08-16 | 1996-02-22 | Basf Ag | Verfahren zur Herstellung von cyclischen Aminen |
| ATE278322T1 (de) | 1998-06-17 | 2004-10-15 | Bayer Cropscience Ag | Mittel zur bekämpfung von pflanzenschädlingen |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| ES2396418T3 (es) | 2004-04-30 | 2013-02-21 | Basf Se | Mezclas fungicidas |
| US20060264415A1 (en) * | 2005-04-01 | 2006-11-23 | Methylgene Inc. | Inhibitors of histone deacetylase |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| BRPI0612022B1 (pt) | 2005-06-09 | 2016-12-06 | Bayer Cropscience Ag | combinações de substâncias ativas, seus usos, processos para combater fungos fitopatogênicos indesejáveis, processo para preparar composições fungicidas, revestimento de semente, e processos para revestir semente e semente transgênica |
| ITMI20051558A1 (it) | 2005-08-09 | 2007-02-10 | Isagro Spa | Miscele e-o composizioni sinergiche cin elevata attivita'fungicida |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2091330B1 (en) | 2006-09-18 | 2017-07-05 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| WO2008071714A1 (en) | 2006-12-15 | 2008-06-19 | Rohm And Haas Company | Mixtures comprising 1-methylcyclopropene |
| EP2679096A1 (en) | 2007-02-06 | 2014-01-01 | Basf Se | Pesticidal mixtures |
| BRPI0810144A2 (pt) | 2007-04-23 | 2014-10-14 | Basf Se | Método para aumentar saúde das plantas e/ou controlar pestes em plantas |
| EP2000028A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| EP2000030A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience AG | Fungizide Wirkstoffkombinationen |
| MX2010002524A (es) | 2007-09-26 | 2010-03-25 | Basf Se | Composiciones fungicidas ternarias, que comprenden boscalida y clorotalonilo. |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| JP5417814B2 (ja) * | 2008-11-25 | 2014-02-19 | 住友化学株式会社 | 植物病害防除用組成物及び植物病害の防除方法 |
| EP2453750A2 (de) | 2009-07-16 | 2012-05-23 | Bayer CropScience AG | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| EP2417853A1 (en) | 2010-08-05 | 2012-02-15 | Basf Se | Synergistic fungicidal and insecticidal mixtures comprising a fungicide and an insecticide |
| MX2013006737A (es) | 2010-12-20 | 2013-07-15 | Basf Se | Mezclas de activos pesticida que comprende compuestos de pirazol. |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| EP2688413B1 (en) | 2011-03-23 | 2018-03-07 | Bayer Intellectual Property GmbH | Active compound combinations |
| WO2012127009A1 (en) | 2011-03-23 | 2012-09-27 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| JP2014525424A (ja) | 2011-09-02 | 2014-09-29 | ビーエーエスエフ ソシエタス・ヨーロピア | アリールキナゾリノン化合物を含む農業用混合物 |
| JP2013142063A (ja) * | 2012-01-10 | 2013-07-22 | Sumitomo Chemical Co Ltd | 植物病害防除組成物およびその用途 |
| KR102093609B1 (ko) | 2012-06-20 | 2020-03-26 | 바스프 에스이 | 피라졸 화합물 및 피라졸 화합물을 포함하는 살충 혼합물 |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| JP6051799B2 (ja) * | 2012-11-12 | 2016-12-27 | 住友化学株式会社 | 農薬用組成物及び植物の生長を促進する方法 |
| EA030875B1 (ru) | 2012-12-20 | 2018-10-31 | Басф Агро Б.В. | Композиции, содержащие триазольное соединение |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| EP3046915A1 (en) | 2013-09-16 | 2016-07-27 | Basf Se | Fungicidal pyrimidine compounds |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| UA121677C2 (uk) | 2015-07-02 | 2020-07-10 | Басф Агро Б.В. | Пестицидні композиції, які містять триазольну сполуку |
| CA3003065A1 (en) | 2015-10-27 | 2017-05-04 | Bayer Cropscience Aktiengesellschaft | Composition comprising a safener, a fungicide and metalaxyl |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1164160A (en) * | 1966-12-30 | 1969-09-17 | Shell Int Research | N,N-Disubstituted Amino Acid Derivatives and their use as Herbicides |
| GB1289283A (enExample) * | 1970-03-04 | 1972-09-13 | ||
| DE2212268C3 (de) * | 1971-03-15 | 1979-09-13 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | N-Halogenacetylanilinoessigsäureester, Verfahren zu deren Herstellung und diese enthaltende herbicide Massen |
| SE397191B (sv) * | 1972-10-13 | 1977-10-24 | Ciba Geigy Ag | N-(1'-alkoxikarbonyl-etyl)-n-haloacetyl-2,6-dialkylaniliner till anvendning som fungicid |
| OA04979A (fr) | 1974-04-09 | 1980-11-30 | Ciba Geigy | Nouveaux dérivés de l'aniline utiles comme agents microbicides et leur procédé de préparation. |
| US4206228A (en) | 1974-04-09 | 1980-06-03 | Ciba-Geigy Corporation | Microbicidal aniline derivatives |
| US4204002A (en) | 1974-04-09 | 1980-05-20 | Ciba-Geigy Corporation | Methods of using N-(substituted)-N-alkoxy carbonyl anilino compounds |
| US4151299A (en) | 1974-04-09 | 1979-04-24 | Ciba-Geigy Corporation | Certain aniline derivatives as microbicidal agents |
| CH623458A5 (enExample) * | 1975-09-30 | 1981-06-15 | Ciba Geigy Ag |
-
1973
- 1973-04-08 OA OA55472A patent/OA04979A/xx unknown
-
1975
- 1975-03-26 NO NO751088A patent/NO144960C/no unknown
- 1975-03-26 FI FI750922A patent/FI61477C/fi not_active IP Right Cessation
- 1975-03-26 DK DK136375AA patent/DK142360B/da not_active IP Right Cessation
- 1975-03-26 SE SE7503519A patent/SE430015B/xx not_active IP Right Cessation
- 1975-04-07 DE DE2515091A patent/DE2515091C2/de not_active Expired
- 1975-04-07 HU HU75CI1567A patent/HU173318B/hu unknown
- 1975-04-07 LU LU72224A patent/LU72224A1/xx unknown
- 1975-04-07 PH PH17028A patent/PH13585A/en unknown
- 1975-04-07 FR FR7510722A patent/FR2267042B1/fr not_active Expired
- 1975-04-07 CA CA223,937A patent/CA1059141A/en not_active Expired
- 1975-04-08 YU YU0893/75A patent/YU37311B/xx unknown
- 1975-04-08 IE IE787/75A patent/IE40913B1/xx unknown
- 1975-04-08 ES ES436385A patent/ES436385A1/es not_active Expired
- 1975-04-08 IL IL47046A patent/IL47046A/xx unknown
- 1975-04-08 GB GB14380/75A patent/GB1500581A/en not_active Expired
- 1975-04-08 AT AT263875A patent/AT341827B/de not_active IP Right Cessation
- 1975-04-08 TR TR18846A patent/TR18846A/xx unknown
- 1975-04-08 BG BG029586A patent/BG26357A3/xx unknown
- 1975-04-08 IT IT22134/75A patent/IT1049536B/it active
- 1975-04-08 DD DD185303A patent/DD118979A5/xx unknown
- 1975-04-08 DD DD192564A patent/DD124973A5/xx unknown
- 1975-04-08 CY CY1010A patent/CY1010A/xx unknown
- 1975-04-09 NL NLAANVRAGE7504236,A patent/NL184781C/xx not_active IP Right Cessation
- 1975-04-09 RO RO106424A patent/RO83787B/ro unknown
- 1975-04-09 PL PL1975192740A patent/PL104373B1/pl unknown
- 1975-04-09 RO RO7581942A patent/RO79678A/ro unknown
- 1975-04-09 SU SU752124200A patent/SU730268A3/ru active
- 1975-04-09 CS CS752436A patent/CS187468B2/cs unknown
- 1975-04-09 RO RO106425A patent/RO84020B/ro unknown
- 1975-04-09 PL PL1975179458A patent/PL97724B1/pl unknown
- 1975-04-09 JP JP4314775A patent/JPS5443573B2/ja not_active Expired
-
1976
- 1976-07-01 SU SU762375578A patent/SU639445A3/ru active
-
1979
- 1979-04-08 AR AR258284A patent/AR226272A1/es active
- 1979-05-11 KE KE2960A patent/KE2960A/xx unknown
- 1979-06-21 HK HK403/79A patent/HK40379A/xx unknown
- 1979-12-07 US US06/101,355 patent/US4294850A/en not_active Expired - Lifetime
-
1980
- 1980-12-30 MY MY56/80A patent/MY8000056A/xx unknown
-
1981
- 1981-06-15 US US06/274,019 patent/US4427696A/en not_active Expired - Lifetime
- 1981-06-15 US US06/273,801 patent/US4439447A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK142360B (da) | Fungicide N-acyl-anilinoeddikesyrederivater til anvendelse ved plantebeskyttelse. | |
| DK141995B (da) | Fungicide, eventuelt halogensubstituerede furan(2)- eller tetrahydrofuran(2)-carboanilider til anvendelse ved plantebeskyttelse eller andre tekniske formål. | |
| JPS6254103B2 (enExample) | ||
| DK154651B (da) | Substituerede n-(1'-alkoxy-, -alkylthio- og -aminocarbonyl-alkyl)-n-aminoacetyl-aniliner og salte deraf med uorganiske og organiske syrer til bekaempelse af fytopatogene svampe, fungicid og fremgangsmaade til bekaempelse af plantepatogene svampe eller til forebyggelse af svampeangreb | |
| FI61476B (fi) | Saosom vaextfungicider anvaendbara halogenacetanilider | |
| GB2095237A (en) | Herbicidal and fungicidal substituted n-furyl or thienyl-methyl amides | |
| DK150848B (da) | N-substituerede sulfonylglycolsyreanilider med fungicid virkning mod fytopatogene svampe samt anvendelse deraf til bekaempelse af fytopatogene svampe | |
| FI61478C (fi) | Vaextfungicida n-(1'-metoxi- och etoxikarbonyl-etyl)-n-acyl-anilinderivat | |
| US4075349A (en) | Microbicidal compositions | |
| JPS648615B2 (enExample) | ||
| CS219337B2 (en) | Fungicide means and method of making the active ingredients | |
| US4330556A (en) | Microbicidal N-1'-hydrocarbyloxycarbonylethyl)-N-alkoxyacetylanilines | |
| CA1127178A (en) | Microbicidal composition | |
| JPS629105B2 (enExample) | ||
| US4101672A (en) | Microbicidal alanine thioesters | |
| US3988328A (en) | 5-Amino-2,3,7,8-tetrathiaalkane-1,9-dioic acids, esters and salts | |
| FI61475C (fi) | Saosom vaextfungicider anvaendbara haloacylanilider | |
| CS214753B2 (en) | Fungicide means and method of making the active component | |
| KR800000712B1 (ko) | 아닐린 유도체의 제조방법 | |
| JPH0147458B2 (enExample) | ||
| CH608690A5 (en) | Microbicidal composition | |
| JPS5925388A (ja) | チオフエン誘導体および農園芸用殺菌剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed | ||
| PUP | Patent expired |