DK142283B - Fremgangsmåde til fremstilling af benz(f)-2,5-oxazociner eller syreadditionssalte deraf. - Google Patents
Fremgangsmåde til fremstilling af benz(f)-2,5-oxazociner eller syreadditionssalte deraf. Download PDFInfo
- Publication number
- DK142283B DK142283B DK83376AA DK83376A DK142283B DK 142283 B DK142283 B DK 142283B DK 83376A A DK83376A A DK 83376AA DK 83376 A DK83376 A DK 83376A DK 142283 B DK142283 B DK 142283B
- Authority
- DK
- Denmark
- Prior art keywords
- methyl
- benz
- preparation
- acid addition
- oxazocines
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- 239000002253 acid Substances 0.000 title claims description 10
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 6
- HHDZPYDYAHWNKQ-UHFFFAOYSA-N 3h-4,1-benzoxazocine Chemical class N1=CCOC=CC2=CC=CC=C21 HHDZPYDYAHWNKQ-UHFFFAOYSA-N 0.000 title description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- -1 benzene-2,5-oxazocines Chemical class 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 6
- BQZCTHIUWLLYBR-UHFFFAOYSA-N 5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine;hydrochloride Chemical compound Cl.C1COC(C)CC2=CC=CC=C2N1C1=CC=CC=C1 BQZCTHIUWLLYBR-UHFFFAOYSA-N 0.000 claims description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 claims 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 238000012958 reprocessing Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910000039 hydrogen halide Inorganic materials 0.000 description 8
- 239000012433 hydrogen halide Substances 0.000 description 8
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical compound C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- NHTAQNXZFMZXBU-UHFFFAOYSA-N 2-[[2-[hydroxy(phenyl)methyl]phenyl]methyl-methylamino]ethanol Chemical compound OCCN(C)CC1=CC=CC=C1C(O)C1=CC=CC=C1 NHTAQNXZFMZXBU-UHFFFAOYSA-N 0.000 description 2
- SFVYUAJWNYVQDB-UHFFFAOYSA-N 2h-1,2-benzoxazocine Chemical class O1NC=CC=CC2=CC=CC=C21 SFVYUAJWNYVQDB-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- KQJGNHWFPBAXDJ-UHFFFAOYSA-N 5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine Chemical compound C1COC(C)CC2=CC=CC=C2N1C1=CC=CC=C1 KQJGNHWFPBAXDJ-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D267/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D267/22—Eight-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55631575 | 1975-03-07 | ||
| US05/556,315 US3978085A (en) | 1975-03-07 | 1975-03-07 | Process for benz[f]-2,5-oxazocines |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK83376A DK83376A (show.php) | 1976-09-08 |
| DK142283B true DK142283B (da) | 1980-10-06 |
| DK142283C DK142283C (show.php) | 1981-03-02 |
Family
ID=24220811
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK83376AA DK142283B (da) | 1975-03-07 | 1976-02-26 | Fremgangsmåde til fremstilling af benz(f)-2,5-oxazociner eller syreadditionssalte deraf. |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3978085A (show.php) |
| JP (1) | JPS51113889A (show.php) |
| AR (1) | AR211856A1 (show.php) |
| AT (1) | AT351548B (show.php) |
| AU (1) | AU510010B2 (show.php) |
| BE (1) | BE839252A (show.php) |
| CA (1) | CA1058615A (show.php) |
| CH (1) | CH616416A5 (show.php) |
| CS (1) | CS186732B2 (show.php) |
| DE (1) | DE2609015C2 (show.php) |
| DK (1) | DK142283B (show.php) |
| ES (1) | ES445556A1 (show.php) |
| FI (1) | FI61310C (show.php) |
| FR (1) | FR2303007A1 (show.php) |
| GB (1) | GB1545872A (show.php) |
| IL (1) | IL49160A (show.php) |
| MX (1) | MX3577E (show.php) |
| NL (1) | NL7601985A (show.php) |
| NO (1) | NO145138C (show.php) |
| PH (1) | PH12176A (show.php) |
| SE (1) | SE427929B (show.php) |
| ZA (1) | ZA76183B (show.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4208349A (en) * | 1978-07-27 | 1980-06-17 | Riker Laboratories, Inc. | Process for the preparation of 2-[N-(2-hydroxyethyl)-N-lower alkylaminomethyl]benzhydrols |
| US4318909A (en) * | 1980-01-17 | 1982-03-09 | John Wyeth & Brother Limited | Benzoxazocines |
| US4626522A (en) * | 1980-01-17 | 1986-12-02 | John Wyeth & Brother Limited | Benzoxazocines intermediates |
| US20060019940A1 (en) * | 2002-12-20 | 2006-01-26 | Baxter Andrew D | Novel benzoxazocines and their therapeutic use |
| DE60322947D1 (de) * | 2002-12-20 | 2008-09-25 | Sosei R & D Ltd | Deraufnahme inhibitoren |
| WO2005103019A1 (en) * | 2004-04-21 | 2005-11-03 | Sosei R&D Ltd. | Benzoxazocines and their therapeutic use as monoamine reuptake inhibitors |
| CN102363610A (zh) * | 2011-11-01 | 2012-02-29 | 安徽万和制药有限公司 | 一种合成盐酸奈福泮的新方法 |
| CN107556263A (zh) * | 2016-06-30 | 2018-01-09 | 康普药业股份有限公司 | 一种盐酸奈福泮的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA863349A (en) * | 1971-02-09 | Riker Laboratories, Inc. | Heterocyclic compounds |
-
1975
- 1975-03-07 US US05/556,315 patent/US3978085A/en not_active Expired - Lifetime
-
1976
- 1976-01-13 ZA ZA00760183A patent/ZA76183B/xx unknown
- 1976-02-11 CA CA245,538A patent/CA1058615A/en not_active Expired
- 1976-02-26 DK DK83376AA patent/DK142283B/da unknown
- 1976-02-26 NL NL7601985A patent/NL7601985A/xx not_active Application Discontinuation
- 1976-02-26 ES ES445556A patent/ES445556A1/es not_active Expired
- 1976-02-26 SE SE7602449A patent/SE427929B/xx unknown
- 1976-02-26 NO NO760656A patent/NO145138C/no unknown
- 1976-03-01 CH CH252976A patent/CH616416A5/de not_active IP Right Cessation
- 1976-03-04 DE DE2609015A patent/DE2609015C2/de not_active Expired
- 1976-03-05 JP JP51024042A patent/JPS51113889A/ja active Pending
- 1976-03-05 AT AT164476A patent/AT351548B/de not_active IP Right Cessation
- 1976-03-05 IL IL49160A patent/IL49160A/xx unknown
- 1976-03-05 CS CS7600001466A patent/CS186732B2/cs unknown
- 1976-03-05 MX MX7645U patent/MX3577E/es unknown
- 1976-03-05 AU AU11705/76A patent/AU510010B2/en not_active Expired
- 1976-03-05 PH PH18179A patent/PH12176A/en unknown
- 1976-03-05 FR FR7606418A patent/FR2303007A1/fr active Granted
- 1976-03-05 BE BE164904A patent/BE839252A/xx not_active IP Right Cessation
- 1976-03-05 FI FI760573A patent/FI61310C/fi not_active IP Right Cessation
- 1976-03-05 AR AR262450A patent/AR211856A1/es active
- 1976-03-08 GB GB9209/76A patent/GB1545872A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES445556A1 (es) | 1977-06-16 |
| FR2303007A1 (fr) | 1976-10-01 |
| SE7602449L (sv) | 1976-09-08 |
| NO760656L (show.php) | 1976-09-08 |
| CH616416A5 (show.php) | 1980-03-31 |
| IL49160A (en) | 1979-01-31 |
| GB1545872A (en) | 1979-05-16 |
| ATA164476A (de) | 1979-01-15 |
| AR211856A1 (es) | 1978-03-31 |
| NO145138C (no) | 1982-01-20 |
| SE427929B (sv) | 1983-05-24 |
| CA1058615A (en) | 1979-07-17 |
| DK83376A (show.php) | 1976-09-08 |
| AT351548B (de) | 1979-07-25 |
| DK142283C (show.php) | 1981-03-02 |
| DE2609015C2 (de) | 1986-05-07 |
| AU510010B2 (en) | 1980-06-05 |
| FI61310B (fi) | 1982-03-31 |
| CS186732B2 (en) | 1978-12-29 |
| FI760573A7 (show.php) | 1976-09-08 |
| JPS51113889A (en) | 1976-10-07 |
| IL49160A0 (en) | 1976-05-31 |
| FI61310C (fi) | 1982-07-12 |
| ZA76183B (en) | 1976-12-29 |
| AU1170576A (en) | 1977-09-08 |
| NO145138B (no) | 1981-10-12 |
| NL7601985A (nl) | 1976-09-09 |
| PH12176A (en) | 1978-11-21 |
| DE2609015A1 (de) | 1976-09-16 |
| US3978085A (en) | 1976-08-31 |
| MX3577E (es) | 1981-03-19 |
| FR2303007B1 (show.php) | 1980-02-08 |
| BE839252A (fr) | 1976-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6912664B2 (ja) | タピナロフを調製するためのプロセス | |
| US8658809B2 (en) | Process for the preparation of dronedarone | |
| DK142283B (da) | Fremgangsmåde til fremstilling af benz(f)-2,5-oxazociner eller syreadditionssalte deraf. | |
| US6399781B1 (en) | Process for making 3-amino-2-chloro-4-methylpyridine | |
| JP3871705B2 (ja) | エポキシドの合成方法 | |
| SU506297A3 (ru) | Способ получени солей производных 6,11-дигидродибензо (в,е)тиепина | |
| WO2015127175A1 (en) | Composition, synthesis, and use of new arylsulfonyl isonitriles | |
| US3101345A (en) | 2-hydroxymethyl-8-hydroxy-1,4-benzodioxane | |
| Work | 79. Antiplasmodial action and chemical constitution. Part VI. Compounds related to lepidylamine | |
| CS202017B2 (en) | Process for preparing 1-phenyl-1,3,4,6-tetrahydrobenzoxazocines | |
| JPH0522709B2 (show.php) | ||
| Dimsdale | The formation of 2‐alkoxyquinolines from quinoline N‐oxides in alcoholic media | |
| DK168624B1 (da) | Fremgangsmåde til fremstilling af 5-chlor-2-methoxynicotinsyre ved chlorering af 2-methoxynicotinsyre | |
| SU840038A1 (ru) | Способ получени 4,5,6,7-тетрагидро-иНдОлА | |
| EP1281708B1 (en) | Process for the preparation of 5-Formylphthalide | |
| EP0555283B1 (en) | Intermediates in the preparation of 4,5-difluoroanthranilic acid | |
| SU327187A1 (ru) | Способ получения 2-кето-1-изонитрозо- -1-сульфонов | |
| SU396318A1 (ru) | Способ получения о- | |
| SU727144A3 (ru) | Способ получени 2-галоидметил1,4бензодиазепинов или их солей | |
| SU1558899A1 (ru) | Способ получени 4-гексилокси-1-нафтонитрила | |
| Yajima et al. | Synthesis of 2-and 4-Bromoquinolines with A New Brominating Reagent, PBr3-DMF | |
| SU534183A3 (ru) | Способ получени производных бензоциклогептаоксазолона | |
| JPS6218554B2 (show.php) | ||
| JP2522931B2 (ja) | 四級アンモニウム塩 | |
| SU431156A1 (ru) | Способ получения бис- |