DEV0004387MA - - Google Patents
Info
- Publication number
- DEV0004387MA DEV0004387MA DEV0004387MA DE V0004387M A DEV0004387M A DE V0004387MA DE V0004387M A DEV0004387M A DE V0004387MA
- Authority
- DE
- Germany
- Prior art keywords
- anhydrous
- water
- bis
- solution
- methylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 5
- 125000001118 alkylidene group Chemical group 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 5
- 239000005077 polysulfide Substances 0.000 claims description 5
- 150000008117 polysulfides Polymers 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- ZZHIDJWUJRKHGX-UHFFFAOYSA-N 1,4-bis(chloromethyl)benzene Chemical compound ClCC1=CC=C(CCl)C=C1 ZZHIDJWUJRKHGX-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 229920001021 polysulfide Polymers 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 3
- 238000006068 polycondensation reaction Methods 0.000 claims description 3
- 150000004763 sulfides Chemical class 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims 2
- 150000001408 amides Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 4
- AWKUJKPNTJGGJP-UHFFFAOYSA-N 2,2-dichlorobut-3-enamide Chemical compound C=CC(C(=O)N)(Cl)Cl AWKUJKPNTJGGJP-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1182824B (de) | Verfahren zur Herstellung von Polyoxymethylendiaethern | |
| DE68912621T2 (de) | Wäsche von Polyarylensulfiden mit einer Pufferlösung. | |
| DE60210020T2 (de) | Herstellung von Polysulfidzusammensetzungen | |
| DE3750798T2 (de) | Verfahren zur Herstellung eines Polyarylenthioäthers mit hoher Kristallinsationsgeschwindigkeit. | |
| DE2546182C2 (de) | Verfahren zur Herstellung eines praktisch von Acrylnitril freien Mischpolymerisates aus Styrol und Acrylnitril | |
| DEV0004387MA (forum.php) | ||
| DE68902219T2 (de) | Mercaptoalkylacetoacetate, deren verwendung und ein verfahren zu deren herstellung. | |
| DE954918C (de) | Verfahren zur Herstellung von schwefelhaltigen Polykondensationsprodukten | |
| DE1942459A1 (de) | Kontinuierliches Verfahren zur Herstellung von Methylendianilin | |
| DE1249275B (de) | Verfahren zur Herstellung von Nitrilo - tris - methylenphosphonsaure | |
| DE69004204T2 (de) | 2,4-Pentandionmonosulfonsäure und Verfahren zu ihrer Herstellung. | |
| DE69004042T2 (de) | 2,4-Pentandion-1,5-Disulfonsäure und Verfahren zu ihrer Herstellung. | |
| DE60015602T2 (de) | Rückgewinnung von modifizierungsverbindungen und polaren organischen verbindungen aus einer polyarylensulfid-recyclemischung | |
| DE60026593T2 (de) | Methanolextraktion aus polaren organischen verbindungen und modifikatorverbindungen aus poly(arylensulfid) polymer-und oligomerströmen | |
| DE3873615T2 (de) | Polycyanoarylthioether. | |
| EP0491147B1 (de) | Verfahren zur Herstellung von Gold(I)mercaptiden | |
| DE2536010A1 (de) | Verfahren zur herstellung von cyclischen diphenylsiloxanen | |
| DE710965C (de) | Verfahren zur Herstellung von Halogen enthaltenden Formaldehydkondensationserzeugnissen aus Sulfonamiden | |
| DE3872441T2 (de) | Verfahren zur herstellung von propanon-1,3-disulfonsaeure. | |
| EP0888296B1 (de) | In wasser schwerlösliche metallsalze, verfahren zur herstellung derselben und ihre verwendung als glanzzusatz zur elektrolytischen abscheidung von metallen | |
| DE644077C (de) | Verfahren zur Herstellung von Thiazolidinabkoemmlingen | |
| DE855566C (de) | Verfahren zur Herstellung von Pentamethylentetraminsulfon | |
| DE1223156B (de) | Verfahren zur Herstellung von hoehermolekularen Polykondensaten | |
| DE825406C (de) | Verfahren zur Herstellung von stickstoffhaltigen Thioaethern | |
| DE496979C (de) | Verfahren zur Herstellung von schwefel- und stickstoffhaltigen Kondensationsprodukten |