DESC011647MA - - Google Patents
Info
- Publication number
- DESC011647MA DESC011647MA DESC011647MA DE SC011647M A DESC011647M A DE SC011647MA DE SC011647M A DESC011647M A DE SC011647MA
- Authority
- DE
- Germany
- Prior art keywords
- acid
- triiodo
- benzoic acid
- diamino
- chain
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002253 acid Substances 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 7
- XCZKKZXWDBOGPA-UHFFFAOYSA-N 2-phenylbenzene-1,4-diol Chemical compound OC1=CC=C(O)C(C=2C=CC=CC=2)=C1 XCZKKZXWDBOGPA-UHFFFAOYSA-N 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 6
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 230000010933 acylation Effects 0.000 description 7
- 238000005917 acylation reaction Methods 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000002872 contrast media Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 229940039231 contrast media Drugs 0.000 description 2
- -1 dipropionyl compound Chemical class 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OIXRDAZPDINJPT-UHFFFAOYSA-N 2,4,6-triiodo-3,5-bis(propanoylamino)benzoic acid Chemical compound CCC(=O)NC1=C(I)C(NC(=O)CC)=C(I)C(C(O)=O)=C1I OIXRDAZPDINJPT-UHFFFAOYSA-N 0.000 description 1
- MTYCANXGXKRMAI-UHFFFAOYSA-N 3,5-bis(butanoylamino)-2,4,6-triiodobenzoic acid Chemical compound CCCC(=O)NC1=C(I)C(NC(=O)CCC)=C(I)C(C(O)=O)=C1I MTYCANXGXKRMAI-UHFFFAOYSA-N 0.000 description 1
- UENRXLSRMCSUSN-UHFFFAOYSA-N 3,5-diaminobenzoic acid Chemical compound NC1=CC(N)=CC(C(O)=O)=C1 UENRXLSRMCSUSN-UHFFFAOYSA-N 0.000 description 1
- LZVYTVQEXANZSA-UHFFFAOYSA-N 3,5-diformamido-2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C(NC=O)=C(I)C(NC=O)=C1I LZVYTVQEXANZSA-UHFFFAOYSA-N 0.000 description 1
- XCNHOBHCZBIGJP-UHFFFAOYSA-N 3-acetamido-5-amino-2,4,6-triiodobenzoic acid Chemical compound CC(=O)NC1=C(I)C(N)=C(I)C(C(O)=O)=C1I XCNHOBHCZBIGJP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 238000002583 angiography Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000013155 cardiography Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000002601 radiography Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 238000007487 urography Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3429949A1 (de) | Neue nicht -ionische 2,4,6-trijod-isophthalsaeure-bis-amide, verfahren zu ihrer herstellung und ihre verwendung als roentgenkontrastmittel | |
| EP0317492B1 (de) | Neue substituierte Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-triiodanilide), Verfahren zu deren Herstellung sowie diese enthaltende Röntgenkontrastmittel | |
| DE970133C (de) | Verfahren zur Herstellung von N-Acylderivaten der 3, 5-Diamino-2, 4, 6-trijod-benzoesaeure | |
| DESC011647MA (esLanguage) | ||
| DE2124904C3 (de) | Hydroxy- und Alkoxyacetamido-trijodbenzoesäuren, deren Salze mit physiologisch verträglichen Basen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Röntgenkontrastmittel | |
| DE1125587B (de) | Roentgenkontrastmittel | |
| DE1214358B (de) | Roentgenkontrastmittel | |
| DE1123438B (de) | Roentgenkontrastmittel | |
| DE2215048B2 (de) | Verfahren zur Herstellung von 2- [Bis-(4,4'dialkylamino)-benzhydryl] -5- aminobenzoesäuren | |
| DE2425912C3 (de) | S-Hydroxyacylaminomethyl-S-acylamino-2,4,6-trijod-benzoesäuren und deren Salze, Verfahren zur Herstellung dieser Verbindungen u. diese Verbindungen enthaltende Röntgenkontrastmittel | |
| AT117475B (de) | Verfahren zur Darstellung von Substitutionsprodukten des ß-Jodpyridins. | |
| DE825684C (de) | Verfahren zur Herstellung von Carbonsaeureestern | |
| DE1445127C (de) | ^-Sulfanilamido-S-methoxy-pyrazin und ein Verfahren zu seiner Herstellung | |
| DE2264723C2 (de) | Verfahren zur Herstellung von Salzen des 4,4'-(2-Pyridylmethylen)-bis-(phenylhydrogensulfats) | |
| CH324082A (de) | Verfahren zur Herstellung von N-Acylderivaten der 3,5-Diamino-2,4,6-trijod-benzoesäure | |
| DE704549C (de) | Verfahren zur Herstellung von Pplyjodoxyphenylphenylessigsaeuren | |
| DE864254C (de) | Verfahren zur Herstellung von Reduktinsaeure | |
| DE1443297A1 (de) | 5-Amino-2,4,6-trijod-isophthalamidsaeurederivate und Verfahren zu ihrer Herstellung | |
| DE915339C (de) | Verfahren zur Herstellung von substituierten Pteridinen | |
| DE613403C (de) | Verfahren zur Darstellung am Kohlenstoff und am Stickstoff substituierter Barbitursaeuren | |
| DE847447C (de) | Verfahren zur Herstellung von 21-Oxypregnen-(5)-ol-(3)-on-(20)-abkoemmlingen | |
| DE1200832B (de) | Verfahren zur Herstellung von 3, 5-Dijodthyroninderivaten | |
| WO2002044155A1 (de) | Verfahren zur herstellung von phenylen-bis-benzimidazol-tetrasulfonsäure-dinatriumsalz | |
| DE1902595A1 (de) | Neue Chinolin-Derivate und Verfahren zu ihrer Herstellung | |
| DE1950329A1 (de) | Neue 4-Nitro-N1-pyrazolylverbindungen und Verfahren zu deren Herstellung |