DEI0006592MA - - Google Patents
Info
- Publication number
- DEI0006592MA DEI0006592MA DEI0006592MA DE I0006592M A DEI0006592M A DE I0006592MA DE I0006592M A DEI0006592M A DE I0006592MA
- Authority
- DE
- Germany
- Prior art keywords
- alloy
- tin
- reaction
- magnesium
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910045601 alloy Inorganic materials 0.000 claims description 30
- 239000000956 alloy Substances 0.000 claims description 30
- 229910019021 Mg 2 Sn Inorganic materials 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 18
- 239000011777 magnesium Substances 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 7
- -1 hydrocarbon halide Chemical class 0.000 claims description 7
- 229910052749 magnesium Inorganic materials 0.000 claims description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052753 mercury Inorganic materials 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 229910001128 Sn alloy Inorganic materials 0.000 claims description 4
- 229910000861 Mg alloy Inorganic materials 0.000 claims description 3
- 150000002730 mercury Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 13
- 229910052718 tin Inorganic materials 0.000 description 9
- 150000001350 alkyl halides Chemical class 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 5
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- RWWNQEOPUOCKGR-UHFFFAOYSA-N tetraethyltin Chemical compound CC[Sn](CC)(CC)CC RWWNQEOPUOCKGR-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910000978 Pb alloy Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001347 alkyl bromides Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 2
- 229910000528 Na alloy Inorganic materials 0.000 description 2
- RRXGIIMOBNNXDK-UHFFFAOYSA-N [Mg].[Sn] Chemical compound [Mg].[Sn] RRXGIIMOBNNXDK-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- UAZMXAXHGIZMSU-UHFFFAOYSA-N sodium tin Chemical compound [Na].[Sn] UAZMXAXHGIZMSU-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- KQPIFPBKXYBDGV-UHFFFAOYSA-M triethylstannanylium;bromide Chemical compound CC[Sn](Br)(CC)CC KQPIFPBKXYBDGV-UHFFFAOYSA-M 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001500 aryl chlorides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- QSGGLKRQVLBHKX-UHFFFAOYSA-L dibromo(diethyl)stannane Chemical compound CC[Sn](Br)(Br)CC QSGGLKRQVLBHKX-UHFFFAOYSA-L 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001905 inorganic group Chemical group 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- FVRKTAOFDKFAMI-UHFFFAOYSA-M tributylstannanylium;bromide Chemical compound [Br-].CCCC[Sn+](CCCC)CCCC FVRKTAOFDKFAMI-UHFFFAOYSA-M 0.000 description 1
- CPRPKIMXLHBUGA-UHFFFAOYSA-N triethyltin Chemical compound CC[Sn](CC)CC CPRPKIMXLHBUGA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE960461C (de) | Verfahren zur Herstellung von Organohalogenmonosilanen aus Organohalogenpolysilanen | |
| DE1277255B (de) | Verfahren zur Herstellung von Alkylzinnhalogenidgemischen | |
| DE2753124C2 (enrdf_load_stackoverflow) | ||
| DE946447C (de) | Verfahren zur Herstellung von Organozinnverbindungen | |
| DE1161893B (de) | Verfahren zur Umwandlung von hochalkylierten in niedriger alkylierte Zinnverbindungen | |
| DE1159949B (de) | Verfahren zur Herstellung Cyclopentadienyl-Metallverbindungen | |
| EP0158163B1 (de) | Herstellung von Organozinn-halogeniden durch katalysierte Redistribution von höher alkylierten Organozinn-Verbindungen mit niedriger alkylierten | |
| DEI0006592MA (enrdf_load_stackoverflow) | ||
| DE1945645A1 (de) | Verfahren zur Herstellung von Diorganochlorphosphinen | |
| DE1152413C2 (de) | Verfahren zur herstellung von organozinnverbindungen | |
| DE1618073A1 (de) | Verfahren zur Herstellung von omega-Cyanopolymethylenzinnkomplexen | |
| DE2545065B2 (de) | Verfahren zur Herstellung von Monomethylzinntrihalogeniden | |
| DE1223383B (de) | Verfahren zur Herstellung von Pentafluorophenylmagnesiumchlorid | |
| DE2101207A1 (de) | Cyclische Stickstoff enthaltende Organosihciumverbindungen | |
| DE1235914B (de) | Verfahren zur Herstellung von Hexaalkyldistannanen | |
| EP0443355B1 (de) | Verfahren zur Herstellung von wasserfreien Zinndicarboxylatdihalogeniden | |
| WO1991009039A2 (de) | Verfahren für die direktsynthese von organozinnverbindungen und deren verwendung | |
| AT226247B (de) | Verfahren zur Herstellung von Organozinnverbindungen | |
| AT280311B (de) | Verfahren zur Herstellung von Alkyl- oder Zykloalkylzinnhalogeniden | |
| DE1908883A1 (de) | Verfahren zur Herstellung von Dibutylzinnmaleat | |
| DE1768914C (de) | Verfahren zur Herstellung von Alkyl oder Cycloalkylzinnhalogeniden | |
| DE19624906B4 (de) | Verfahren zur Herstellung von Organozinntrihalogeniden und Diorganozinndihalogeniden | |
| DE1568007C (de) | Verfahren zur Herstellung von 1,1,2,2 Tetrachlor 1,2 bis (p chlorphenyl) athan | |
| DE102016217012A1 (de) | Verfahren zur Vorbereitung von hochreinem Monooctylzinn-Trichlorid | |
| AT234717B (de) | Verfahren zur Herstellung von Organozinnverbindungen |