DEF0016165MA - - Google Patents
Info
- Publication number
- DEF0016165MA DEF0016165MA DEF0016165MA DE F0016165M A DEF0016165M A DE F0016165MA DE F0016165M A DEF0016165M A DE F0016165MA
- Authority
- DE
- Germany
- Prior art keywords
- dioxythioxanthone
- thioxanthonequinone
- water
- mixture
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 150000002926 oxygen Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 1
- -1 Polyoxy Polymers 0.000 description 1
- 239000004153 Potassium bromate Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229940094037 potassium bromate Drugs 0.000 description 1
- 235000019396 potassium bromate Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YRHRIQCWCFGUEQ-UHFFFAOYSA-N thioxanthen-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3SC2=C1 YRHRIQCWCFGUEQ-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEF0016165MA (show.php) | ||
| DE2503504C2 (de) | Verfahren zur herstellung von kernjodierten jodverbindungen mit aromatischem charakter | |
| DE960275C (de) | Verfahren zur Herstellung von aromatischen Carbonsaeuren | |
| DE955510C (de) | Verfahren zur Herstellung eines heterocyclischen Chinons | |
| DE2215048C3 (de) | Verfahren zur Herstellung von 2-[Bis-(4,4'-dialkylamino)-benzhydryl)-5-aminobenzoesäuren | |
| DE80407C (show.php) | ||
| DE561521C (de) | Verfahren zur Herstellung organischer Sulfopersaeureverbindungen | |
| EP0073464A1 (de) | Verfahren zur Herstellung von Naphthalintetracarbonsäure-1,4,5,8 | |
| DE634968C (de) | Verfahren zur Herstellung von ª‰-Azabenzanthronen | |
| DE515468C (de) | Verfahren zur Darstellung von ª‰-Naphthylaminophenoxyfettsaeuren | |
| DE920129C (de) | Verfahren zur Herstellung heterocyclischer AEthersulfone | |
| DE473330C (de) | Verfahren zur Herstellung eines wasserloeslichen Pinenderivates | |
| DEF0008882MA (show.php) | ||
| DE644157C (de) | Verfahren zur Herstellung von Bz2-Bz2'-Bz3-Trioxydibenzanthronen oder ihrer Chinone | |
| DE749468C (de) | Verfahren zur Herstellung von 2-Aminobenzothiazol | |
| CH342233A (de) | Verfahren zur Herstellung von 1,4-Thioxanthonchinonen | |
| DE1930377A1 (de) | Verfahren zur verbesserten Herstellung von o-Benzoylbenzoesaeure | |
| DE2546822A1 (de) | 4-amino-thioxanthon-s,s-dioxide | |
| DE1063593B (de) | Verfahren zur UEberfuehrung von Dialkaliterephthalaten, die durch thermische Umlagerung von Salzen anderer Benzolcarbonsaeure erhalten worden sind, in Terephthalsaeure | |
| DE1244768B (de) | Verfahren zur Herstellung von Sorbinsaeure oder deren Alkalisalzen durch Oxydation von Sorbinaldehyd | |
| DE1229080B (de) | Verfahren zur Herstellung von 2-Methylmercapto-indandion-(1, 3)-derivaten | |
| DE1117137B (de) | Verfahren zur Herstellung von aromatischen Aminen | |
| DE1014106B (de) | Verfahren zur Herstellung von Thiolphosphorsaeureestern | |
| DEB0032517MA (show.php) | ||
| CH167381A (de) | Verfahren zur Herstellung von 3'-Amino-4'-methoxybenzyl-o-benzoesäure. |