DEE0007689MA - - Google Patents
Info
- Publication number
- DEE0007689MA DEE0007689MA DEE0007689MA DE E0007689M A DEE0007689M A DE E0007689MA DE E0007689M A DEE0007689M A DE E0007689MA
- Authority
- DE
- Germany
- Prior art keywords
- paper
- black
- yellow
- salt
- dupont
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000975 dye Substances 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 13
- 229920002261 Corn starch Polymers 0.000 claims description 5
- 229920001131 Pulp (paper) Polymers 0.000 claims description 5
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 claims description 5
- 239000008120 corn starch Substances 0.000 claims description 5
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000001043 yellow dye Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- SSGULEJGEZIWBC-UHFFFAOYSA-N 5-[[2-(1,2-dinitro-2-phenylethenyl)-3,4,5,6-tetrasulfophenyl]diazenyl]-6-(2-phenylethenyl)benzene-1,2,3,4-tetrasulfonic acid Chemical compound [N+](=O)([O-])C(=C(C1=C(C(=C(C(=C1N=NC1=C(C(=C(C(=C1C=CC1=CC=CC=C1)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)[N+](=O)[O-])C1=CC=CC=C1 SSGULEJGEZIWBC-UHFFFAOYSA-N 0.000 claims description 2
- 241001274216 Naso Species 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- 239000011229 interlayer Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims 1
- 230000002411 adverse Effects 0.000 claims 1
- 230000036571 hydration Effects 0.000 claims 1
- 238000006703 hydration reaction Methods 0.000 claims 1
- 229940018564 m-phenylenediamine Drugs 0.000 claims 1
- 239000004071 soot Substances 0.000 description 4
- 239000006229 carbon black Substances 0.000 description 3
- OETHQSJEHLVLGH-UHFFFAOYSA-N metformin hydrochloride Chemical compound Cl.CN(C)C(=N)N=C(N)N OETHQSJEHLVLGH-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000001048 orange dye Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000009527 percussion Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 230000037303 wrinkles Effects 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2049289A1 (de) | Farbphotographische lichtempfindliche Materialien mit verbesserter Lichtechtheit | |
| DE2456075A1 (de) | Verwendung von metallchelaten zum stabilisieren organischer verbindungen vor der einwirkung sichtbarer und ultravioletter strahlung | |
| DE965674C (de) | Diazotypiematerial | |
| DE958354C (de) | Schwarzgefaerbtes Einlagepapier fuer lichtempfindliche photographische Materialien und Verfahren zu seiner Herstellung | |
| DE2109752B2 (de) | Durchsichtige Folie mit einer Ausrüstung gegen die Bildung von Newtonschen Ringen | |
| DE685901C (de) | Verfahren zur Feinkornentwicklung | |
| DEE0007689MA (enrdf_load_stackoverflow) | ||
| DE901419C (de) | Schwarze Hektographen-Kopiertinte | |
| DE1172952B (de) | Diazotypiematerial | |
| DE2364040A1 (de) | Photographisches silberhalogenidaufzeichnungsmaterial | |
| DE645267C (de) | Verfahren zur Herstellung von lichtempfindlichen Diazoschichten und Bildern hieraus auf beliebigen Unterlagen | |
| DE1772017A1 (de) | Diazotypie-Materialien | |
| DE954311C (de) | Verfahren zur Herstellung von farbigen Bildern durch chromogene Entwicklung | |
| DE660599C (de) | Verfahren zur Herstellung von Sicherheitspapier | |
| DE545129C (de) | Verfahren zur Darstellung gefaerbter Celluloidmassen | |
| DE2002931C3 (de) | Verfahren zur Herstellung von Papier mit fluoreszierenden Eigenschaften | |
| DE2334277A1 (de) | Verfahren zur herstellung von polychromatisch aktiven thiazin-eosinaten | |
| DE1282821B (de) | Fluoreszierende Markierungsmittel | |
| DE1267545B (de) | Photographisches Schutzpapier | |
| DE825346C (de) | Verfahren zur Mattierung photographischer Papiere | |
| DE634829C (de) | Verfahren zur Herstellung transparenter Schreibtinten | |
| AT160298B (de) | Verfahren zur Herstellung mehrfarbiger photographischer Bilder. | |
| DE1911491C3 (de) | Lichtempfindliche Diazoniumsalze, Verfahren zu ihrer Herstellung und sie enthaltendes Diazotypie-Kopiermaterial | |
| DE922390C (de) | Lichtempfindliche Schicht fuer das Diazotypieverfahren | |
| DE1181537B (de) | Verfahren zur Herstellung fluoreszierender Postwertzeichen-Papiere |