DE966844C - Elektrischer Steuermagnet - Google Patents
Elektrischer SteuermagnetInfo
- Publication number
- DE966844C DE966844C DEV2837A DEV0002837A DE966844C DE 966844 C DE966844 C DE 966844C DE V2837 A DEV2837 A DE V2837A DE V0002837 A DEV0002837 A DE V0002837A DE 966844 C DE966844 C DE 966844C
- Authority
- DE
- Germany
- Prior art keywords
- armature
- control magnet
- magnet according
- legs
- anchor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 210000002414 leg Anatomy 0.000 claims description 86
- 230000005291 magnetic effect Effects 0.000 claims description 56
- 230000004907 flux Effects 0.000 claims description 16
- 238000004804 winding Methods 0.000 claims description 7
- 210000003414 extremity Anatomy 0.000 claims description 5
- 239000003302 ferromagnetic material Substances 0.000 claims description 4
- 239000004020 conductor Substances 0.000 claims description 2
- 210000000689 upper leg Anatomy 0.000 claims description 2
- 239000004836 Glue Stick Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 8
- 230000008901 benefit Effects 0.000 description 6
- 238000013459 approach Methods 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 238000004904 shortening Methods 0.000 description 4
- 238000013461 design Methods 0.000 description 3
- 230000005389 magnetism Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000696 magnetic material Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- YTMNONATNXDQJF-QSLGVYCOSA-N cyanidin 3-O-beta-D-galactoside chloride Chemical group [Cl-].O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OC1=CC2=C(O)C=C(O)C=C2[O+]=C1C1=CC=C(O)C(O)=C1 YTMNONATNXDQJF-QSLGVYCOSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 230000005415 magnetization Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000012887 quadratic function Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000036186 satiety Effects 0.000 description 1
- 235000019627 satiety Nutrition 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/16—Magnetic circuit arrangements
- H01H50/18—Movable parts of magnetic circuits, e.g. armature
- H01H50/34—Means for adjusting limits of movement; Mechanical means for adjusting returning force
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/54—Contact arrangements
- H01H50/56—Contact spring sets
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/54—Contact arrangements
- H01H50/56—Contact spring sets
- H01H50/58—Driving arrangements structurally associated therewith; Mounting of driving arrangements on armature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/02—Non-polarised relays
- H01H51/04—Non-polarised relays with single armature; with single set of ganged armatures
- H01H51/06—Armature is movable between two limit positions of rest and is moved in one direction due to energisation of an electromagnet and after the electromagnet is de-energised is returned by energy stored during the movement in the first direction, e.g. by using a spring, by using a permanent magnet, by gravity
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
- Breakers (AREA)
- Control Of Vehicles With Linear Motors And Vehicles That Are Magnetically Levitated (AREA)
- Valve Device For Special Equipments (AREA)
- Load-Engaging Elements For Cranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE301930X | 1950-06-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE966844C true DE966844C (de) | 1957-09-12 |
Family
ID=42224343
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEV2837A Expired DE966844C (de) | 1950-06-22 | 1950-11-10 | Elektrischer Steuermagnet |
| DEV3444A Expired DE865332C (de) | 1950-06-22 | 1951-06-05 | Elektromagnetische Schaltvorrichtung, insbesondere Relais |
| DEV3471A Expired DE878245C (de) | 1950-06-22 | 1951-06-11 | Anordnung an Elektromagneten fuer Relais, Steuervorrichtungen u. dgl. |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEV3444A Expired DE865332C (de) | 1950-06-22 | 1951-06-05 | Elektromagnetische Schaltvorrichtung, insbesondere Relais |
| DEV3471A Expired DE878245C (de) | 1950-06-22 | 1951-06-11 | Anordnung an Elektromagneten fuer Relais, Steuervorrichtungen u. dgl. |
Country Status (7)
| Country | Link |
|---|---|
| US (3) | US2786163A (enExample) |
| BE (2) | BE504146A (enExample) |
| CH (3) | CH307457A (enExample) |
| DE (3) | DE966844C (enExample) |
| FR (2) | FR1033576A (enExample) |
| GB (2) | GB697758A (enExample) |
| NL (4) | NL161450B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE503963A (enExample) * | 1950-06-22 | |||
| US2982833A (en) * | 1952-08-09 | 1961-05-02 | Vigren Sten Daniel | Electric control magnets |
| BE536186A (enExample) * | 1954-03-05 | |||
| US2858488A (en) * | 1955-02-19 | 1958-10-28 | Pettersson Gustaf Adolf | Electromagnetic relay |
| US2995149A (en) * | 1957-01-28 | 1961-08-08 | Honeywell Regulator Co | High-speed electro-pneumatic switching apparatus |
| DE1065093B (de) * | 1958-04-24 | 1959-09-10 | Siemens Ag | Elektromagnetische Relais |
| US3076880A (en) * | 1960-04-19 | 1963-02-05 | Clare & Co C P | Relay |
| US3231700A (en) * | 1961-01-31 | 1966-01-25 | Fuji Tsushinki Seizo Kk | Electromagnetic relay with banks of resilient contact members |
| DE1205190B (de) * | 1961-10-20 | 1965-11-18 | Telefunken Patent | Flach-Elektromagnet mit E-foermigem Magnetkern und Flachanker |
| NL124719C (enExample) * | 1961-11-09 | |||
| US3241471A (en) * | 1963-03-29 | 1966-03-22 | Polaroid Corp | Shutter apparatus |
| SE326773B (enExample) * | 1966-03-11 | 1970-08-03 | Ericsson Telefon Ab L M | |
| US3403364A (en) * | 1966-06-02 | 1968-09-24 | Western Electric Co | One piece armature backstop member for a relay |
| DE1564690B2 (de) * | 1966-08-18 | 1972-09-07 | Siemens AG, 1000 Berlin u 8000 München | Ungepoltes flachrelais in miniaturbauweise |
| GB1308770A (en) * | 1970-05-26 | 1973-03-07 | Omron Tateisi Electronics Co | Electromagnetic relays |
| US3958198A (en) * | 1973-11-19 | 1976-05-18 | International Standard Electric Corporation | Magneto system including a tiltable u-shaped armature |
| DE59801176D1 (de) * | 1997-05-05 | 2001-09-13 | Tyco Electronics Austria Gmbh | Elektromagnetisches relais |
| DE19804572A1 (de) | 1997-05-05 | 1999-08-12 | Schrack Components Ag | Relais mit Kontaktfedern |
| DE19718985C1 (de) * | 1997-05-05 | 1998-10-08 | Schrack Components Ag | Relais mit Kontaktfedern |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1812545A (en) * | 1928-08-24 | 1931-06-30 | Ericsson Telefon Ab L M | Electromagnetic relay |
| DE576720C (de) * | 1933-05-16 | Favag Fabrique D App Electr S | Flachrelais, bei welchem beidseitig der Magnetspule symmetrisch angeordnete Federn durch einen als flaches Stueck ausgebildeten Anker beeinflusst werden | |
| DE809564C (de) * | 1948-01-07 | 1951-07-30 | Western Electric Co | Viel-Kontakt-Relais |
Family Cites Families (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE303717C (enExample) * | ||||
| DE476403C (de) * | 1929-05-25 | Lorenz Akt Ges C | Einrichtung zur Erhoehung der Empfindlichkeit von Fernsprechrelais mit besonders grossem Hub | |
| US638101A (en) * | 1899-04-07 | 1899-11-28 | James L Cutler | Telegraph instrument. |
| US991829A (en) * | 1906-06-06 | 1911-05-09 | North Electric Co | Electrical relay. |
| GB191228824A (en) * | 1912-06-21 | 1913-06-19 | Siemens Brothers & Co Ltd | Improvements in Electromagnetic Relays. |
| US1218035A (en) * | 1915-09-25 | 1917-03-06 | Western Electric Co | Telegraph-sounder. |
| US1298701A (en) * | 1916-06-13 | 1919-04-01 | Union Switch & Signal Co | Magnetic device. |
| US1282276A (en) * | 1917-09-17 | 1918-10-22 | Leonard D Morris | Electromagnet. |
| GB186433A (en) * | 1921-07-01 | 1922-10-02 | Thomas Lenaghan | Improvements relating to electro-magnetic and polarised relays |
| DE511322C (de) * | 1924-05-10 | 1930-10-29 | Karl Hersen | Relais, insbesondere fuer Fernsprechanlagen |
| DE533917C (de) * | 1927-09-21 | 1931-09-19 | Lorenz Akt Ges C | Relais, insbesondere fuer Fernsprechanlagen, mit mehreren Arbeitsstellungen des Ankers |
| NL43159B (enExample) * | 1927-10-06 | |||
| GB316880A (en) * | 1928-08-04 | 1931-02-02 | Ericsson Telefon Ab L M | Improvements in or relating to electromagnetic relays or shutter indicators |
| BE362366A (enExample) * | 1928-10-17 | |||
| US1883137A (en) * | 1929-09-11 | 1932-10-18 | Western Electric Co | Switching device |
| US1857828A (en) * | 1930-04-30 | 1932-05-10 | Bell Telephone Labor Inc | Circuit controlling device |
| GB357234A (en) * | 1930-06-19 | 1931-09-21 | Standard Telephones Cables Ltd | Improvements in or relating to electro-magnetic relays |
| GB372873A (en) * | 1931-03-06 | 1932-05-19 | Siemens Brothers & Co Ltd | Improvements relating to electric relays |
| US2115836A (en) * | 1934-10-06 | 1938-05-03 | Bell Telephone Labor Inc | Electromagnetic switching device |
| US2120339A (en) * | 1935-11-30 | 1938-06-14 | Union Switch & Signal Co | Electromagnetic device |
| US2178656A (en) * | 1935-12-11 | 1939-11-07 | Bell Telephone Labor Inc | Electromagnetic switching device |
| DE660210C (de) * | 1936-03-19 | 1938-05-21 | Fritz Kesselring Dipl Ing | Elektromagnetisch betaetigter Fahrtrichtungsanzeiger fuer Kraftfahrzeuge |
| DE731316C (de) * | 1936-09-12 | 1943-02-05 | Philips Patentverwaltung | Elektromagnetisches Relais mit einer Anzahl in ihrer Bewegungsrichtung aufeinandergestapelter, durch isolierende Streifen getrennter Kontaktzungenpaare |
| US2174592A (en) * | 1937-08-05 | 1939-10-03 | Bell Telephone Labor Inc | Relay |
| US2162356A (en) * | 1937-09-01 | 1939-06-13 | Bell Telephone Labor Inc | Relay |
| BE438773A (enExample) * | 1939-04-24 | |||
| US2294327A (en) * | 1940-05-17 | 1942-08-25 | Bell Telephone Labor Inc | Electromagnetic relay |
| US2323961A (en) * | 1941-12-31 | 1943-07-13 | Bell Telephone Labor Inc | Relay armature |
| US2395300A (en) * | 1942-05-28 | 1946-02-19 | Bell Telephone Labor Inc | Electrical device |
| BE471117A (enExample) * | 1942-09-23 | |||
| GB585444A (en) * | 1944-04-28 | 1947-02-06 | Standard Telephones Cables Ltd | Improvements in or relating to electromagnetic relays |
| US2462894A (en) * | 1945-02-27 | 1949-03-01 | Magnetic Devices Inc | Electric relay |
| BE465887A (enExample) * | 1945-06-13 | |||
| US2565508A (en) * | 1945-09-24 | 1951-08-28 | Standard Telephones Cables Ltd | Insulator for pile-up switches |
| US2491272A (en) * | 1947-03-28 | 1949-12-13 | Bell Telephone Labor Inc | Protective device for relay contacts |
| NL68096C (enExample) * | 1947-07-14 | 1900-01-01 | ||
| US2460556A (en) * | 1947-11-08 | 1949-02-01 | Bell Telephone Labor Inc | Coil arrangement for electromagnetic devices |
| BE503963A (enExample) * | 1950-06-22 | |||
| FR1035722A (fr) * | 1951-02-23 | 1953-08-28 | Perfectionnements relatifs aux commutateurs à barres de liaison transversales |
-
0
- BE BE503963D patent/BE503963A/xx unknown
- BE BE504146D patent/BE504146A/xx unknown
- NL NL89631D patent/NL89631C/xx active
- NL NL7205457.A patent/NL161696B/xx unknown
- NL NL87835D patent/NL87835C/xx active
- NL NL6803618.A patent/NL161450B/xx unknown
-
1950
- 1950-11-10 DE DEV2837A patent/DE966844C/de not_active Expired
-
1951
- 1951-01-15 FR FR1033576D patent/FR1033576A/fr not_active Expired
- 1951-04-10 CH CH307457D patent/CH307457A/de unknown
- 1951-04-10 CH CH305545D patent/CH305545A/de unknown
- 1951-04-10 CH CH301930D patent/CH301930A/de unknown
- 1951-05-25 GB GB12339/51A patent/GB697758A/en not_active Expired
- 1951-05-31 FR FR1037927D patent/FR1037927A/fr not_active Expired
- 1951-06-05 DE DEV3444A patent/DE865332C/de not_active Expired
- 1951-06-11 DE DEV3471A patent/DE878245C/de not_active Expired
- 1951-06-20 GB GB14686/51A patent/GB697553A/en not_active Expired
- 1951-06-21 US US232722A patent/US2786163A/en not_active Expired - Lifetime
-
1953
- 1953-02-04 US US335006A patent/US2693554A/en not_active Expired - Lifetime
-
1956
- 1956-06-04 US US589109A patent/US2913551A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE576720C (de) * | 1933-05-16 | Favag Fabrique D App Electr S | Flachrelais, bei welchem beidseitig der Magnetspule symmetrisch angeordnete Federn durch einen als flaches Stueck ausgebildeten Anker beeinflusst werden | |
| US1812545A (en) * | 1928-08-24 | 1931-06-30 | Ericsson Telefon Ab L M | Electromagnetic relay |
| DE809564C (de) * | 1948-01-07 | 1951-07-30 | Western Electric Co | Viel-Kontakt-Relais |
Also Published As
| Publication number | Publication date |
|---|---|
| NL89631C (enExample) | |
| US2913551A (en) | 1959-11-17 |
| BE503963A (enExample) | |
| GB697758A (en) | 1953-09-30 |
| GB697553A (en) | 1953-09-23 |
| US2693554A (en) | 1954-11-02 |
| FR1037927A (fr) | 1953-09-23 |
| FR1033576A (fr) | 1953-07-13 |
| CH307457A (de) | 1955-05-31 |
| NL87835C (enExample) | |
| NL161696B (nl) | |
| CH301930A (de) | 1954-09-30 |
| NL161450B (nl) | |
| US2786163A (en) | 1957-03-19 |
| DE865332C (de) | 1953-02-02 |
| BE504146A (enExample) | |
| CH305545A (de) | 1955-02-28 |
| DE878245C (de) | 1953-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE966844C (de) | Elektrischer Steuermagnet | |
| DE2728629C2 (de) | Elektromagnetvorrichtung | |
| DE2830390C2 (de) | Relais | |
| DE7503795U (de) | Kontaktträger für Relais | |
| DE947812C (de) | Schalteinrichtung zur Beeinflussung elektrischer Stromkreise, insbesondere Starkstromkreise, mit durch ein Magnetfeld betaetigtem Schaltelement | |
| DE1218611B (de) | Elektromagnetisches Relais | |
| DE2365190B2 (de) | Elektromagnetsystem | |
| DE1279838B (de) | Elektromagnetisches Relais | |
| DE2905498C2 (de) | Miniaturrelais | |
| DE1934624C3 (de) | Elektromagnetisches Relais | |
| DE102016107410A1 (de) | Bistabiler Aktuator für ein polarisiertes elektromagnetisches Relais | |
| DE267556C (enExample) | ||
| DE3528090C1 (de) | Elektromagnetisches Relais | |
| DE965430C (de) | Elektrischer Steuermagnet | |
| DE1538456B1 (enExample) | ||
| DE1515834C3 (de) | Magnetfeldbetätigter elektrischer Tastschalter | |
| DE1462394C (de) | Koordinatenwahler | |
| AT223688B (de) | Elektromagnetisches, neutrales Relais | |
| AT300931B (de) | Magnetauslöser | |
| DE582152C (de) | Stufenrelais, dessen Kern mit einem Haupt- und einem Hilfspol versehen ist, insbesondere fuer Fernsprechzwecke | |
| DE2911810A1 (de) | Fehlerstrom-ausloeser | |
| DE2245803B2 (de) | Drehankerrelais | |
| DE646717C (de) | Einrichtung zur Verstellung von Klinken, Rasten oder sonstigen Organen | |
| DE1462394B2 (de) | Koordi"atenwähler | |
| DE2008347A1 (enExample) |