DE920206C - Verfahren zur Herstellung von formbaren Massen auf der Grundlage von Acrylsaeurenitrilpolymerisaten - Google Patents
Verfahren zur Herstellung von formbaren Massen auf der Grundlage von AcrylsaeurenitrilpolymerisatenInfo
- Publication number
- DE920206C DE920206C DEC4118A DEC0004118A DE920206C DE 920206 C DE920206 C DE 920206C DE C4118 A DEC4118 A DE C4118A DE C0004118 A DEC0004118 A DE C0004118A DE 920206 C DE920206 C DE 920206C
- Authority
- DE
- Germany
- Prior art keywords
- acrylonitrile
- copolymer
- vinyl
- mixture
- basic component
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 38
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 229920002239 polyacrylonitrile Polymers 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims 8
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 28
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 28
- 229920001577 copolymer Polymers 0.000 claims description 26
- -1 vinyl compound Chemical class 0.000 claims description 16
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 claims description 13
- 229920000642 polymer Polymers 0.000 claims description 12
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 7
- 150000002825 nitriles Chemical class 0.000 claims description 7
- 229920002554 vinyl polymer Polymers 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- 229920002125 Sokalan® Polymers 0.000 claims description 3
- 239000004584 polyacrylic acid Substances 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 238000009987 spinning Methods 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- KANZWHBYRHQMKZ-UHFFFAOYSA-N 2-ethenylpyrazine Chemical compound C=CC1=CN=CC=N1 KANZWHBYRHQMKZ-UHFFFAOYSA-N 0.000 description 2
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N 3-Methyl-3-buten-2-one Chemical compound CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- KYPOHTVBFVELTG-OWOJBTEDSA-N (e)-but-2-enedinitrile Chemical compound N#C\C=C\C#N KYPOHTVBFVELTG-OWOJBTEDSA-N 0.000 description 1
- JMCVTMBYSNJZGH-UHFFFAOYSA-N 1-chloroethyl 2-methylprop-2-enoate Chemical compound CC(Cl)OC(=O)C(C)=C JMCVTMBYSNJZGH-UHFFFAOYSA-N 0.000 description 1
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 description 1
- ZPQFAVDVWVKUOJ-UHFFFAOYSA-N 1-ethenylsulfonylbutane Chemical compound CCCCS(=O)(=O)C=C ZPQFAVDVWVKUOJ-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 description 1
- YBXYCBGDIALKAK-UHFFFAOYSA-N 2-chloroprop-2-enamide Chemical compound NC(=O)C(Cl)=C YBXYCBGDIALKAK-UHFFFAOYSA-N 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- FDRCIXUKBBBOPH-UHFFFAOYSA-N 2-ethenyl-1,3-benzoxazole Chemical class C1=CC=C2OC(C=C)=NC2=C1 FDRCIXUKBBBOPH-UHFFFAOYSA-N 0.000 description 1
- PGMMQIGGQSIEGH-UHFFFAOYSA-N 2-ethenyl-1,3-oxazole Chemical class C=CC1=NC=CO1 PGMMQIGGQSIEGH-UHFFFAOYSA-N 0.000 description 1
- MLMGJTAJUDSUKA-UHFFFAOYSA-N 2-ethenyl-1h-imidazole Chemical class C=CC1=NC=CN1 MLMGJTAJUDSUKA-UHFFFAOYSA-N 0.000 description 1
- ZCTDZBGLIPTFFF-UHFFFAOYSA-N 2-ethenyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(C=C)C(=O)C21 ZCTDZBGLIPTFFF-UHFFFAOYSA-N 0.000 description 1
- XHCCPUQVFMEKIZ-UHFFFAOYSA-N 2-ethenyl-4,6-dimethylpyridine Chemical compound CC1=CC(C)=NC(C=C)=C1 XHCCPUQVFMEKIZ-UHFFFAOYSA-N 0.000 description 1
- OHAHNWHDCLIFSX-UHFFFAOYSA-N 2-ethenyl-4-ethylpyridine Chemical compound CCC1=CC=NC(C=C)=C1 OHAHNWHDCLIFSX-UHFFFAOYSA-N 0.000 description 1
- YQUDMNIUBTXLSX-UHFFFAOYSA-N 2-ethenyl-5-ethylpyridine Chemical compound CCC1=CC=C(C=C)N=C1 YQUDMNIUBTXLSX-UHFFFAOYSA-N 0.000 description 1
- VMWGBWNAHAUQIO-UHFFFAOYSA-N 2-ethenyl-6-methylpyridine Chemical compound CC1=CC=CC(C=C)=N1 VMWGBWNAHAUQIO-UHFFFAOYSA-N 0.000 description 1
- QQBUHYQVKJQAOB-UHFFFAOYSA-N 2-ethenylfuran Chemical compound C=CC1=CC=CO1 QQBUHYQVKJQAOB-UHFFFAOYSA-N 0.000 description 1
- IGDLZDCWMRPMGL-UHFFFAOYSA-N 2-ethenylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(C=C)C(=O)C2=C1 IGDLZDCWMRPMGL-UHFFFAOYSA-N 0.000 description 1
- XUGNJOCQALIQFG-UHFFFAOYSA-N 2-ethenylquinoline Chemical class C1=CC=CC2=NC(C=C)=CC=C21 XUGNJOCQALIQFG-UHFFFAOYSA-N 0.000 description 1
- DZLUPKIRNOCKJB-UHFFFAOYSA-N 2-methoxy-n,n-dimethylacetamide Chemical compound COCC(=O)N(C)C DZLUPKIRNOCKJB-UHFFFAOYSA-N 0.000 description 1
- RPNFBXZFXRYWKN-UHFFFAOYSA-N 3-ethenyl-4-methylpyridine Chemical compound CC1=CC=NC=C1C=C RPNFBXZFXRYWKN-UHFFFAOYSA-N 0.000 description 1
- KNWOTKCKGFQYRP-UHFFFAOYSA-N 3-ethenyl-5-ethylpyridine Chemical compound CCC1=CN=CC(C=C)=C1 KNWOTKCKGFQYRP-UHFFFAOYSA-N 0.000 description 1
- DPZYLEIWHTWHCU-UHFFFAOYSA-N 3-ethenylpyridine Chemical compound C=CC1=CC=CN=C1 DPZYLEIWHTWHCU-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000012932 acetate dye Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229920001893 acrylonitrile styrene Polymers 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- YPTLFOZCUOHVFO-VOTSOKGWSA-N diethyl (e)-2-methylbut-2-enedioate Chemical compound CCOC(=O)\C=C(/C)C(=O)OCC YPTLFOZCUOHVFO-VOTSOKGWSA-N 0.000 description 1
- YPTLFOZCUOHVFO-SREVYHEPSA-N diethyl (z)-2-methylbut-2-enedioate Chemical compound CCOC(=O)\C=C(\C)C(=O)OCC YPTLFOZCUOHVFO-SREVYHEPSA-N 0.000 description 1
- IEPRKVQEAMIZSS-AATRIKPKSA-N diethyl fumarate Chemical compound CCOC(=O)\C=C\C(=O)OCC IEPRKVQEAMIZSS-AATRIKPKSA-N 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 1
- AFSIMBWBBOJPJG-UHFFFAOYSA-N ethenyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC=C AFSIMBWBBOJPJG-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 125000005395 methacrylic acid group Chemical class 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F220/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride ester, amide, imide or nitrile thereof
- C08F220/02—Monocarboxylic acids having less than ten carbon atoms; Derivatives thereof
- C08F220/42—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L33/00—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical, or of salts, anhydrides, esters, amides, imides or nitriles thereof; Compositions of derivatives of such polymers
- C08L33/18—Homopolymers or copolymers of nitriles
- C08L33/20—Homopolymers or copolymers of acrylonitrile
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01F—CHEMICAL FEATURES IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS; APPARATUS SPECIALLY ADAPTED FOR THE MANUFACTURE OF CARBON FILAMENTS
- D01F6/00—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof
- D01F6/02—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from homopolymers obtained by reactions only involving carbon-to-carbon unsaturated bonds
- D01F6/18—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from homopolymers obtained by reactions only involving carbon-to-carbon unsaturated bonds from polymers of unsaturated nitriles, e.g. polyacrylonitrile, polyvinylidene cyanide
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S525/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S525/916—Polymer from ethylenic monomers only, having cationic group
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Toxicology (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Artificial Filaments (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US158332A US2688008A (en) | 1950-04-26 | 1950-04-26 | Mixed acrylonitrile polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE920206C true DE920206C (de) | 1954-11-15 |
Family
ID=22567638
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC4118A Expired DE920206C (de) | 1950-04-26 | 1951-04-27 | Verfahren zur Herstellung von formbaren Massen auf der Grundlage von Acrylsaeurenitrilpolymerisaten |
Country Status (7)
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3123434A (en) * | 1964-03-03 | Textile | ||
| BE501164A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1950-02-11 | |||
| DE1069818B (de) * | 1958-10-29 | 1959-11-26 | The Dow Chemical Company, Midland, Mich. (V. St. A.) | Verfahren zur Herstellung von verformbaren Lösungen aus Polyacrylnitril |
| US2769792A (en) * | 1951-11-05 | 1956-11-06 | Chemstrand Corp | Fiber-forming vinyl chloride copolymer blends with acrylonitrile polymers |
| US2776270A (en) * | 1952-10-21 | 1957-01-01 | Eastman Kodak Co | Mixtures comprising acrylonitrile polymers with polyacrylonitrile |
| US2776271A (en) * | 1952-10-21 | 1957-01-01 | Eastman Kodak Co | Mixtures comprising acrylonitrile polymers containing alkenyl carbonamides and polyacrylonitrile |
| US2752324A (en) * | 1953-03-02 | 1956-06-26 | Chemstrand Corp | Dyeable fiber-forming mixtures of acrylonitrile polymers and alkenyl haloacetate polymers |
| US2775573A (en) * | 1953-03-02 | 1956-12-25 | Alfred B Craig | Dyeable polymer blends, including copolymers of acrylonitrile with alkenyl haloacetates |
| US2971937A (en) * | 1953-05-29 | 1961-02-14 | Chemstrand Corp | Fiber forming composition containing acrylonitrile polymer and acrylonitrile nu-vinylpyrrolidone copolymer |
| BE528051A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1953-06-25 | |||
| US2908659A (en) * | 1953-08-06 | 1959-10-13 | Du Pont | Solution of a synthetic cross-linked polymer in a swelling liquid, process of using,and products obtained therefrom |
| NL84628C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1953-08-20 | |||
| US2891929A (en) * | 1954-03-31 | 1959-06-23 | Eastman Kodak Co | Polyesters of a glycol, a dicarboxylic acid and an aminoacid |
| US2860120A (en) * | 1954-07-23 | 1958-11-11 | Phillips Petroleum Co | Resins of epoxy compounds and polymers of alkyl substituted vinylpyridines and the like |
| US2848356A (en) * | 1954-08-30 | 1958-08-19 | Phillips Petroleum Co | Fungicides, their preparation and use |
| US2831826A (en) * | 1954-12-30 | 1958-04-22 | Eastman Kodak Co | Mixtures of acrylic nitrile-ethylenic chloride copolymers with acrylamidic polymers and fibers thereof |
| BE544722A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-01-27 | |||
| US3029214A (en) * | 1955-04-13 | 1962-04-10 | Chemstrand Corp | Stabilized solutions of acrylonitrile polymers |
| US3004904A (en) * | 1955-05-25 | 1961-10-17 | Nalco Chemical Co | Electronegative selective permeable membrane and method of production |
| US3004909A (en) * | 1955-06-08 | 1961-10-17 | Nalco Chemical Co | Electropositive selective permeable membrane and method of production |
| BE553210A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-12-08 | |||
| US2878206A (en) * | 1956-05-23 | 1959-03-17 | Chemstrand Corp | Acrylonitrile polymer composition stabilized with metal formaldehyde sulfoxylate, a weak acid, and an inorganic acid and method of making same |
| US2878225A (en) * | 1956-05-23 | 1959-03-17 | Chemstrand Corp | Acrylonitrile polymer composition stabilized with metal formaldehyde sulfoxylate, analkali phosphate, and an inorganic acid and method of making same |
| US2878221A (en) * | 1956-05-23 | 1959-03-17 | Chemstrand Corp | Acrylonitrile polymer composition stabilized with metal formaldehyde sulfoxylate and formaldehyde and method of making same |
| US2888313A (en) * | 1956-07-23 | 1959-05-26 | Gen Aniline & Film Corp | Continuous dyeing process |
| US2980635A (en) * | 1957-02-07 | 1961-04-18 | Dow Chemical Co | Ion-exchange articles and method of manufacture from acrylonitrile polymer aquagels |
| US2941986A (en) * | 1957-08-02 | 1960-06-21 | Chemstrand Corp | Copolymers of acrylonitrile and 1-vinylimidazoles |
| US2949444A (en) * | 1957-08-02 | 1960-08-16 | Chemstrand Corp | Interpolymers of acrylonitrile and 1-vinylimidazoles |
| US2956041A (en) * | 1957-08-12 | 1960-10-11 | Firestone Tire & Rubber Co | Blend of a vinyl chloride resin, a rubbery diolefin copolymer and a copolymer of acrylonitrile and alkyl methacrylate |
| US2972537A (en) * | 1957-09-03 | 1961-02-21 | Eastman Kodak Co | Condensation products of polyvinylketones with hydrazides containing quaternary nitrogen groups |
| NL231903A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-10-02 | |||
| US3035009A (en) * | 1957-11-25 | 1962-05-15 | Dow Chemical Co | Graft copolymers of monomeric acrylates and monomeric organic sulfonic acid compounds upon polyvinyllactams, acrylonitrile polymer compositions obtainable therewith, and method of preparation |
| NL233321A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1957-11-26 | |||
| US2958670A (en) * | 1957-12-12 | 1960-11-01 | Du Pont | Compositions and fibers containing acrylonitrile polymer blends and method of making |
| US3048561A (en) * | 1958-01-29 | 1962-08-07 | Dow Chemical Co | Compositions consisting essentially of graft copolymers of vinyl pyridine monomers on acrylonitrile polymers and method of preparing same |
| NL111105C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-01-29 | |||
| US2959565A (en) * | 1958-01-29 | 1960-11-08 | Dow Chemical Co | Compositions comprising graft copolymers of certain monomeric polyglycol esters of acrylates and methacrylates on superpolyamide substrates |
| US3003845A (en) * | 1958-04-01 | 1961-10-10 | Dow Chemical Co | Dye-receptive polymer compositions of fiber-forming polymers and crosslinked n-vinyl - 3 - morpholinone copolymers, preparation thereof and articles resulting therefrom |
| US2990393A (en) * | 1958-07-24 | 1961-06-27 | Eastman Kodak Co | Process for making graft copolymers containing acrylonitrile and a vinyl pyridine |
| US3315014A (en) * | 1960-02-04 | 1967-04-18 | Uniroyal Inc | Dyeable polypropylene fibers containing polymers of vinyl pyridines |
| US3156743A (en) * | 1959-12-21 | 1964-11-10 | Eastman Kodak Co | Dyeable polypropylene fibers containing acrylate and methacrylate units in polymeric form |
| NL260814A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-12-21 | |||
| US3242120A (en) * | 1960-03-22 | 1966-03-22 | Du Pont | Self-supporting gel shaped structures |
| US3113122A (en) * | 1960-04-12 | 1963-12-03 | Union Carbide Corp | Dyeable fiber-forming compositions of an acrylonitrile-containing polymer and a cyanoethyl acrylate ester/alkyl acrylate ester copolymer |
| IT649534A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1960-04-21 | |||
| US3271292A (en) * | 1960-11-08 | 1966-09-06 | Kollsman Paul | Ion exchange membranes and spacers and process of making them |
| US3088932A (en) * | 1960-12-02 | 1963-05-07 | Monsanto Chemicals | Acrylonitrile polymer composition and stabilized with zinc oxalate, zinc acetate, or chromium acetate |
| US3157714A (en) * | 1960-12-27 | 1964-11-17 | Union Carbide Corp | Fiber-forming compositions |
| US3419638A (en) * | 1962-02-14 | 1968-12-31 | Beaunit Corp | Dyeable polypropylene |
| US3406139A (en) * | 1963-01-29 | 1968-10-15 | Rohm & Haas | Vinylimidazoline and vinyltetrahydropyrimidine polymers |
| NL124336C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-11-19 | 1900-01-01 | ||
| US3409705A (en) * | 1963-12-04 | 1968-11-05 | Eastman Kodak Co | Process for preparing biphase plastics |
| US3313867A (en) * | 1964-10-06 | 1967-04-11 | Monsanto Co | Modified acrylonitrile polymers |
| GB1329126A (en) * | 1969-12-11 | 1973-09-05 | Mitsubishi Rayon Co | Acrylic fibre and a method for manufacturing the same |
| US4153648A (en) * | 1977-10-28 | 1979-05-08 | The Standard Oil Company | Thermoplastic nitrile resin blends |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE465585A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1942-06-17 | |||
| US2527863A (en) * | 1947-08-29 | 1950-10-31 | Du Pont | Modification and dyeing of acrylonitrile polymers |
-
0
- BE BE502706D patent/BE502706A/xx unknown
- NL NL75895D patent/NL75895C/xx active
- NL NL7307909.A patent/NL160413B/xx unknown
-
1950
- 1950-04-26 US US158332A patent/US2688008A/en not_active Expired - Lifetime
-
1951
- 1951-04-24 FR FR1044675D patent/FR1044675A/fr not_active Expired
- 1951-04-24 GB GB9511/51A patent/GB691493A/en not_active Expired
- 1951-04-25 CH CH291825D patent/CH291825A/fr unknown
- 1951-04-27 DE DEC4118A patent/DE920206C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US2688008A (en) | 1954-08-31 |
| NL75895C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| CH291825A (fr) | 1953-07-15 |
| BE502706A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| NL160413B (nl) | |
| GB691493A (en) | 1953-05-13 |
| FR1044675A (fr) | 1953-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE920206C (de) | Verfahren zur Herstellung von formbaren Massen auf der Grundlage von Acrylsaeurenitrilpolymerisaten | |
| DE916348C (de) | Plastische, polymere Massen, insbesondere fuer die Herstellung von kuenstlichen Gebilden, wie Faeden oder Fasern | |
| EP0590460B1 (de) | Hochkonzentrierte wässrige Poly(acrylnitril)-Emulsionen und Verfahren zu ihrer Herstellung | |
| EP0019870B1 (de) | Fäden und Fasern aus Acrylnitril-Copolymer-Mischungen sowie Verfahren zu ihrer Herstellung | |
| DE1279889B (de) | Verfahren zur Herstellung von Fasern oder Faeden auf der Grundlage von ueberwiegend Acrylnitrilpolymerisate enthaltenden Massen | |
| DE2229800C3 (de) | Glanzstabilisierte Fasern und Filme aus Acrylnitrücopolymerisaten | |
| DE1569153B2 (de) | Polymerisat-Mischung auf der Grundlage von Acrylnitrilpolymerisaten | |
| DE2014764C3 (de) | Von Vakuolen freie Fäden und Filme aus Acrylnitrilpolymerisaten | |
| DE2821614C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE2624081A1 (de) | Verfahren zur herstellung flammfester acrylharzfasern | |
| DE1234028C2 (de) | Verfahren zur Herstellung von direkt verspinn-baren Polyacrylnitrilmischpolymerisatloesungen | |
| DE932161C (de) | Verfahren zur Herstellung von ternaeren Mischpolymerisaten auf Acrylsaeurenitrilbasis, die 1-Vinylimidazole enthalten | |
| DE1569139C (de) | Stabilisierung von Acrylnitril/ Vinylchlorid Mischpolymerisaten bzw Polymerisat Gemischen | |
| DE2402957A1 (de) | Stabilisierung halogenhaltiger acrylnitrilpolymerer | |
| DE2438211B2 (de) | Verfahren zur herstellung von acrylfaeden | |
| DE2454323A1 (de) | Modacrylfaeden mit verbesserten coloristischen eigenschaften | |
| DE3333146C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE914306C (de) | Gemisch zur Herstellung anfaerbbarer Faeden oder Fasern | |
| AT208500B (de) | Verfahren zur Herstellung von synthetischen Fasern aus Polyacrylnitrilpolymerisaten oder Mischpolymerisaten mit überwiegendem Anteil an Acrylnitril | |
| DE2164917B2 (de) | Modacrylfäden und -fasern, die beim Kontakt mit Wasser über 80 Grad C glänzend und transparent bleiben, sowie Verfahren zu ihrer Herstellung | |
| DE2354356C3 (de) | Acrylnitril-Mischpolymerisatlösungen | |
| DE2454322A1 (de) | Modacrylfaeden mit verbesserten coloristischen eigenschaften | |
| AT223813B (de) | Polymermischung mit verbesserter Farbaffinität | |
| CH364111A (de) | Verfahren zur Herstellung von Lösungen von Acrylnitril-Vinylpyridin-Kopolymeren in organischen Lösungsmitteln | |
| DE1114277B (de) | Verfahren zur Herstellung von Gebilden, wie Faeden, Fasern oder Filmen, aus Acrylnitrilpolymerisaten oder -mischpolymerisaten |