DE902934C - Stabilisierung von Glyoxal-Haerteloesungen fuer photographische Zwecke - Google Patents
Stabilisierung von Glyoxal-Haerteloesungen fuer photographische ZweckeInfo
- Publication number
- DE902934C DE902934C DEG7561A DEG0007561A DE902934C DE 902934 C DE902934 C DE 902934C DE G7561 A DEG7561 A DE G7561A DE G0007561 A DEG0007561 A DE G0007561A DE 902934 C DE902934 C DE 902934C
- Authority
- DE
- Germany
- Prior art keywords
- glyoxal
- hardening
- solution
- solutions
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 title claims description 34
- 229940015043 glyoxal Drugs 0.000 title claims description 17
- 230000006641 stabilisation Effects 0.000 title description 2
- 238000011105 stabilization Methods 0.000 title description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 6
- 235000010338 boric acid Nutrition 0.000 claims description 6
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 5
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910021538 borax Inorganic materials 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000004328 sodium tetraborate Substances 0.000 claims description 3
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 3
- 125000005619 boric acid group Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 239000000243 solution Substances 0.000 description 18
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 108010010803 Gelatin Proteins 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- 150000001639 boron compounds Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 206010034972 Photosensitivity reaction Diseases 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 230000036211 photosensitivity Effects 0.000 description 3
- 229960001922 sodium perborate Drugs 0.000 description 3
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 229940037003 alum Drugs 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000012964 benzotriazole Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960002645 boric acid Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 2
- 230000037303 wrinkles Effects 0.000 description 2
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- AEQDJSLRWYMAQI-UHFFFAOYSA-N 2,3,9,10-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline Chemical compound C1CN2CC(C(=C(OC)C=C3)OC)=C3CC2C2=C1C=C(OC)C(OC)=C2 AEQDJSLRWYMAQI-UHFFFAOYSA-N 0.000 description 1
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- -1 aliphatic aldehydes Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- KUGSJJNCCNSRMM-UHFFFAOYSA-N ethoxyboronic acid Chemical compound CCOB(O)O KUGSJJNCCNSRMM-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- CTXKJNCPTVBAAU-UHFFFAOYSA-N phenylmethoxyboronic acid Chemical compound OB(O)OCC1=CC=CC=C1 CTXKJNCPTVBAAU-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- WSHYKIAQCMIPTB-UHFFFAOYSA-M potassium;2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate Chemical compound [K+].[O-]C=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 WSHYKIAQCMIPTB-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 239000000176 sodium gluconate Substances 0.000 description 1
- 235000012207 sodium gluconate Nutrition 0.000 description 1
- 229940005574 sodium gluconate Drugs 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/268—Processing baths not provided for elsewhere, e.g. pre-treatment, stop, intermediate or rinse baths
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US199558A US2671024A (en) | 1950-12-06 | 1950-12-06 | Stabilization of photographic glyoxal hardening solutions with water soluble boron compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE902934C true DE902934C (de) | 1954-01-28 |
Family
ID=22738053
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG7561A Expired DE902934C (de) | 1950-12-06 | 1951-12-02 | Stabilisierung von Glyoxal-Haerteloesungen fuer photographische Zwecke |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2671024A (show.php) |
| BE (1) | BE507602A (show.php) |
| CH (1) | CH299730A (show.php) |
| DE (1) | DE902934C (show.php) |
| FR (1) | FR1046164A (show.php) |
| GB (1) | GB694702A (show.php) |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE381162A (show.php) * | 1930-07-12 | |||
| US1981391A (en) * | 1932-09-27 | 1934-11-20 | Eastman Kodak Co | Acid hardening fixing bath |
| US2091689A (en) * | 1935-04-02 | 1937-08-31 | Eastman Kodak Co | Photographic hardening developer |
| BE438129A (show.php) * | 1939-03-04 | |||
| US2414858A (en) * | 1940-12-04 | 1947-01-28 | Strathmore Paper Company | Tanning of proteins |
| US2378247A (en) * | 1942-02-27 | 1945-06-12 | Eastman Kodak Co | Concentrated liquid hardeners and process for preparing |
| US2333182A (en) * | 1942-10-24 | 1943-11-02 | Hizone Products | Embalming composition |
| US2436076A (en) * | 1946-09-27 | 1948-02-17 | Cluett Peabody & Co Inc | Method of stabilizing against shrinkage textile materials of regenerated cellulose |
| US2512708A (en) * | 1946-11-01 | 1950-06-27 | Du Pont | Resorcinol-aldehyde tanning product |
-
0
- BE BE507602D patent/BE507602A/xx unknown
-
1950
- 1950-12-06 US US199558A patent/US2671024A/en not_active Expired - Lifetime
-
1951
- 1951-11-19 GB GB27091/51A patent/GB694702A/en not_active Expired
- 1951-11-27 CH CH299730D patent/CH299730A/fr unknown
- 1951-12-02 DE DEG7561A patent/DE902934C/de not_active Expired
- 1951-12-05 FR FR1046164D patent/FR1046164A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH299730A (fr) | 1954-06-30 |
| FR1046164A (fr) | 1953-12-03 |
| GB694702A (en) | 1953-07-22 |
| BE507602A (show.php) | |
| US2671024A (en) | 1954-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE874704C (de) | Lichtempfindliche Schicht fuer Zeichenleinwand | |
| DE1269484B (de) | Entwickler fuer die Farbentwicklung | |
| DE1522373B2 (de) | Verfahren zur Herstellung photographischer direktpositiver Bilder | |
| DE1900468A1 (de) | Verfahren zur Entwicklung von Flachdruckplatten | |
| DE1572125B2 (de) | Fotografisches Material für die Herstellung direktpositiver Bilder | |
| DE1814834A1 (de) | Photographische Verarbeitungsfluessigkeit | |
| DE1942562A1 (de) | Verfahren zur Haertung photographischer Schichten | |
| DE2157543A1 (de) | Entwicklerzusammensetzung fur photo graphische Silberhalogenidmateri alien | |
| DE902934C (de) | Stabilisierung von Glyoxal-Haerteloesungen fuer photographische Zwecke | |
| DE1547813A1 (de) | Schleierverhuetung bei der fotografischen Farbentwicklung mittels Paraphenylendiaminderivaten | |
| DE2113346A1 (de) | Direktpositivemulsionen mit verbesserter Strahlungsempfindlichkeit | |
| DE1244573B (de) | Verfahren zur Herstellung einer modifizierten Gelatine fuer photographische Zwecke | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE3613622A1 (de) | Stabilisierung eines fotografisch hergestellten silberbildes | |
| DE1253049B (de) | Waessriger Schwarz-Weiss-Entwickler fuer die photographische Umkehrverarbeitung farbphotographischer Materialien | |
| DE2102713A1 (de) | Härtende Bleichfixierbäder | |
| DE1547910A1 (de) | Verfahren zur Behandlung von lichtempfindlichen Silberhalogenid-Emulsionen sowie lichtempfindliche Silberhalogenid-Emulsionen | |
| DE2524431B2 (de) | Silberfarbbleichverfahren | |
| DE1597490A1 (de) | Entwicklungsverfahren | |
| DE2049502A1 (de) | Photographisches Entwicklungsverfahren und hierfür geeignete Entwicklerlosung | |
| DE3733291A1 (de) | Stabilisierung eines fotografisch hergestellten silberbildes | |
| DE2205873A1 (de) | Hochtemperaturentwicklungsverfahren für farbphotographische Silberhalogenidmaterialien | |
| DE2129085A1 (de) | Stabilisierungsmittel fur licht empfindliches Silberhalogenidmaterial | |
| DE1926491C3 (de) | Entwicklungsausgleichsbad für farbphotographische, SiI berhalogenidemulsionen enthaltende Aufzeichnungsmaterialien | |
| DE1200680B (de) | Photographisches Material zur Herstellung eines Reliefbildes |