DE896453C - Azokomponenten fuer die Diazotypie - Google Patents
Azokomponenten fuer die DiazotypieInfo
- Publication number
- DE896453C DE896453C DEK4417D DEK0004417D DE896453C DE 896453 C DE896453 C DE 896453C DE K4417 D DEK4417 D DE K4417D DE K0004417 D DEK0004417 D DE K0004417D DE 896453 C DE896453 C DE 896453C
- Authority
- DE
- Germany
- Prior art keywords
- azo components
- carboxylic acid
- acid
- azo
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 title claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 235000005074 zinc chloride Nutrition 0.000 description 6
- 239000011592 zinc chloride Substances 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 229940081735 acetylcellulose Drugs 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 125000005429 oxyalkyl group Chemical group 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- KAUQJMHLAFIZDU-UHFFFAOYSA-N 6-Hydroxy-2-naphthoic acid Chemical compound C1=C(O)C=CC2=CC(C(=O)O)=CC=C21 KAUQJMHLAFIZDU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- -1 aliphatic amino alcohols Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GPUMPJNVOBTUFM-UHFFFAOYSA-N naphthalene-1,2,3-trisulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC2=C1 GPUMPJNVOBTUFM-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/58—Coupling substances therefor
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Paper (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK4417D DE896453C (de) | 1941-01-18 | 1941-01-18 | Azokomponenten fuer die Diazotypie |
| CH224979D CH224979A (de) | 1941-01-18 | 1941-10-14 | Verfahren zur Herstellung von Diazotypien. |
| BE443226D BE443226A (en:Method) | 1941-01-18 | 1941-10-30 | |
| FR878531D FR878531A (fr) | 1941-01-18 | 1942-01-16 | Composants azoïques pour la diazotypie |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK4417D DE896453C (de) | 1941-01-18 | 1941-01-18 | Azokomponenten fuer die Diazotypie |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE896453C true DE896453C (de) | 1953-11-12 |
Family
ID=5709731
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK4417D Expired DE896453C (de) | 1941-01-18 | 1941-01-18 | Azokomponenten fuer die Diazotypie |
Country Status (4)
| Country | Link |
|---|---|
| BE (1) | BE443226A (en:Method) |
| CH (1) | CH224979A (en:Method) |
| DE (1) | DE896453C (en:Method) |
| FR (1) | FR878531A (en:Method) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1255486B (de) * | 1963-09-14 | 1967-11-30 | Kalle Ag | Zweikomponenten-Diazotypiematerial |
| US3622325A (en) * | 1968-03-07 | 1971-11-23 | Ricoh Kk | Diazotype photographic copying material adapted for wet development and for producing copied image in black color |
-
1941
- 1941-01-18 DE DEK4417D patent/DE896453C/de not_active Expired
- 1941-10-14 CH CH224979D patent/CH224979A/de unknown
- 1941-10-30 BE BE443226D patent/BE443226A/xx unknown
-
1942
- 1942-01-16 FR FR878531D patent/FR878531A/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1255486B (de) * | 1963-09-14 | 1967-11-30 | Kalle Ag | Zweikomponenten-Diazotypiematerial |
| US3622325A (en) * | 1968-03-07 | 1971-11-23 | Ricoh Kk | Diazotype photographic copying material adapted for wet development and for producing copied image in black color |
Also Published As
| Publication number | Publication date |
|---|---|
| CH224979A (de) | 1942-12-31 |
| FR878531A (fr) | 1943-01-22 |
| BE443226A (en:Method) | 1941-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1070030B (en:Method) | ||
| DE825204C (de) | Lichtempfindliches Material fuer das Diazotypieverfahren | |
| DE1068556B (en:Method) | ||
| DE896453C (de) | Azokomponenten fuer die Diazotypie | |
| DE1172952B (de) | Diazotypiematerial | |
| DE1226879B (de) | Lichtempfindliches Kopiermaterial mit einseitig diazotiertem p-Phenylendiamin-Derivat als licht-empfindliche Substanz | |
| DE1447733B2 (de) | 2-(3,5-dihydroxyphenyl)-benzimidazolderivate | |
| DE1086124B (de) | Diazotypie-Kopierschichten zur Herstellung von Zwischenoriginalen | |
| DE831804C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE763721C (de) | Lichtempfindliche Schichten | |
| DE2248744A1 (de) | Naphthanilid-derivate und verfahren zu deren herstellung | |
| DE2123282A1 (de) | Wärmeempfindliches Kopiermaterial | |
| DE694078C (de) | Lichtempfindliche Schichten | |
| DE838692C (de) | Azokomponenten fuer die Diazotypie | |
| DE1572088C3 (de) | Zweikomponenten-Diazotypiematerial für die Herstellung von Zwischenoriginalen | |
| DE1597617A1 (de) | Zweikomponenten-Diazotypiematerial | |
| AT259368B (de) | Lichtempfindlisches Kopiermaterial mit einseitig diazotiertem p Phenylendiaminderivat als lichtempfindlische Substanz | |
| DE1229844B (de) | Verfahren zur Herstellung von Lichtpausen | |
| DE1447733C3 (de) | 2-(3,5-DihydroxyphenyI)-benzimidazolderivate | |
| DE1522422A1 (de) | Verbessertes farbphotographisches Material | |
| DE1572108C3 (de) | Einkomponenten-Diazotypiematerial | |
| DE1572106C3 (de) | Einkomponenten-Diazotypiematerial | |
| DE881446C (de) | Lichtempfindliche Schichten mit Diazoverbindungen | |
| DE1927595C (de) | Zweikomponentendiazotypiematenal | |
| DE881754C (de) | Lichtempfindliche Schichten |