DE827554C - Verfahren zum Polymerisieren von Verbindungen vom Vinyltyp - Google Patents
Verfahren zum Polymerisieren von Verbindungen vom VinyltypInfo
- Publication number
- DE827554C DE827554C DEN818A DEN0000818A DE827554C DE 827554 C DE827554 C DE 827554C DE N818 A DEN818 A DE N818A DE N0000818 A DEN0000818 A DE N0000818A DE 827554 C DE827554 C DE 827554C
- Authority
- DE
- Germany
- Prior art keywords
- polymerization
- mixture
- monomer
- copolymer
- monomers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 36
- 230000000379 polymerizing effect Effects 0.000 title claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 title description 21
- 239000000178 monomer Substances 0.000 claims description 108
- 229920000642 polymer Polymers 0.000 claims description 48
- 238000006116 polymerization reaction Methods 0.000 claims description 43
- 229920001577 copolymer Polymers 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 34
- 239000011541 reaction mixture Substances 0.000 claims description 18
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 230000015572 biosynthetic process Effects 0.000 claims description 15
- 229920003214 poly(methacrylonitrile) Polymers 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 8
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 8
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N 3-Methyl-3-buten-2-one Chemical group CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 claims description 7
- 239000005977 Ethylene Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 229920001519 homopolymer Polymers 0.000 claims description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims 7
- 239000004926 polymethyl methacrylate Substances 0.000 claims 7
- 230000001678 irradiating effect Effects 0.000 claims 1
- 229920002689 polyvinyl acetate Polymers 0.000 claims 1
- 239000011118 polyvinyl acetate Substances 0.000 claims 1
- 229920002554 vinyl polymer Polymers 0.000 description 22
- -1 Butyl- Chemical group 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- 239000000839 emulsion Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- DNLWMXNFYAURFM-UHFFFAOYSA-N 4-methylidenenonanamide Chemical compound C(CCCC)C(CCC(=O)N)=C DNLWMXNFYAURFM-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- YIYBQIKDCADOSF-UHFFFAOYSA-N pent-2-enoic acid Chemical compound CCC=CC(O)=O YIYBQIKDCADOSF-UHFFFAOYSA-N 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229920001567 vinyl ester resin Polymers 0.000 description 3
- JESXATFQYMPTNL-UHFFFAOYSA-N 2-ethenylphenol Chemical compound OC1=CC=CC=C1C=C JESXATFQYMPTNL-UHFFFAOYSA-N 0.000 description 2
- IVKYUXHYUAMPMT-UHFFFAOYSA-N 2-methylprop-2-enyl acetate Chemical compound CC(=C)COC(C)=O IVKYUXHYUAMPMT-UHFFFAOYSA-N 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N 4-penten-2-one Chemical compound CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- TVEWFWSJSXPPDM-UHFFFAOYSA-N 6-methyl-4-methylideneheptanamide Chemical compound C(C(C)C)C(CCC(=O)N)=C TVEWFWSJSXPPDM-UHFFFAOYSA-N 0.000 description 2
- KIYGUWOGKAKFBF-UHFFFAOYSA-N 6-methyl-5-methylideneheptanenitrile Chemical compound C(C)(C)C(CCCC#N)=C KIYGUWOGKAKFBF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 230000008014 freezing Effects 0.000 description 2
- 238000007710 freezing Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- WPFVBOQKRVRMJB-UHFFFAOYSA-N hydroxycitronellal Chemical compound O=CCC(C)CCCC(C)(C)O WPFVBOQKRVRMJB-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- OJUGVDODNPJEEC-UHFFFAOYSA-N phenylglyoxal Chemical compound O=CC(=O)C1=CC=CC=C1 OJUGVDODNPJEEC-UHFFFAOYSA-N 0.000 description 2
- 239000003504 photosensitizing agent Substances 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- MRMOZBOQVYRSEM-UHFFFAOYSA-N tetraethyllead Chemical compound CC[Pb](CC)(CC)CC MRMOZBOQVYRSEM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid Chemical compound C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- XGKIEQIHXGGDTQ-UHFFFAOYSA-N 1-(1-chloroethenyl)-4-ethylbenzene Chemical compound CCC1=CC=C(C(Cl)=C)C=C1 XGKIEQIHXGGDTQ-UHFFFAOYSA-N 0.000 description 1
- PAOHAQSLJSMLAT-UHFFFAOYSA-N 1-butylperoxybutane Chemical group CCCCOOCCCC PAOHAQSLJSMLAT-UHFFFAOYSA-N 0.000 description 1
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- CISIJYCKDJSTMX-UHFFFAOYSA-N 2,2-dichloroethenylbenzene Chemical compound ClC(Cl)=CC1=CC=CC=C1 CISIJYCKDJSTMX-UHFFFAOYSA-N 0.000 description 1
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 1
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- VEGMVELYKJQPQW-UHFFFAOYSA-N 2-bromohept-1-en-3-one Chemical compound BrC(=C)C(CCCC)=O VEGMVELYKJQPQW-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- AUITUKWCKGNHMQ-UHFFFAOYSA-N 3-chlorobut-3-en-2-one Chemical compound CC(=O)C(Cl)=C AUITUKWCKGNHMQ-UHFFFAOYSA-N 0.000 description 1
- QPNJIYXWKHAJEW-UHFFFAOYSA-N 3-fluorobut-3-enenitrile Chemical compound FC(CC#N)=C QPNJIYXWKHAJEW-UHFFFAOYSA-N 0.000 description 1
- UPSCNXYDIMDWOI-UHFFFAOYSA-N 3-methylidenenon-4-enamide Chemical compound C(=CCCCC)C(CC(=O)N)=C UPSCNXYDIMDWOI-UHFFFAOYSA-N 0.000 description 1
- BTLMTXGWGXDULK-UHFFFAOYSA-N 3-methylidenenon-4-enenitrile Chemical compound C(=CCCCC)C(CC#N)=C BTLMTXGWGXDULK-UHFFFAOYSA-N 0.000 description 1
- UOTSYAILGSUTAC-UHFFFAOYSA-N 3-methylidenepentan-2-one Chemical compound CCC(=C)C(C)=O UOTSYAILGSUTAC-UHFFFAOYSA-N 0.000 description 1
- LIBMAGJXZHSEHA-UHFFFAOYSA-N 3-methylidenepentanamide Chemical compound CCC(=C)CC(N)=O LIBMAGJXZHSEHA-UHFFFAOYSA-N 0.000 description 1
- OPCGBNGQXIFAHZ-UHFFFAOYSA-N 4-chloro-2-methylpent-4-enoic acid Chemical compound C(=O)(O)C(CC(=C)Cl)C OPCGBNGQXIFAHZ-UHFFFAOYSA-N 0.000 description 1
- FTEINVAMSSVNGR-UHFFFAOYSA-N 4-chloropent-4-enamide Chemical compound NC(=O)CCC(Cl)=C FTEINVAMSSVNGR-UHFFFAOYSA-N 0.000 description 1
- JOQXGZWETVCGRZ-UHFFFAOYSA-N 4-chloropent-4-enoic acid Chemical compound OC(=O)CCC(Cl)=C JOQXGZWETVCGRZ-UHFFFAOYSA-N 0.000 description 1
- XEBGTWRUQFVRKX-UHFFFAOYSA-N 4-iodopent-4-enamide Chemical compound NC(=O)CCC(I)=C XEBGTWRUQFVRKX-UHFFFAOYSA-N 0.000 description 1
- LYVGZGRXQWDHMJ-UHFFFAOYSA-N 4-methoxypent-4-enamide Chemical compound COC(CCC(=O)N)=C LYVGZGRXQWDHMJ-UHFFFAOYSA-N 0.000 description 1
- SLXSYFSPLZPELJ-UHFFFAOYSA-N 4-methylidenehexanoic acid Chemical compound CCC(=C)CCC(O)=O SLXSYFSPLZPELJ-UHFFFAOYSA-N 0.000 description 1
- UKZKMRGYMWHKOD-UHFFFAOYSA-N 4-methylideneoctan-2-one Chemical compound CCCCC(=C)CC(C)=O UKZKMRGYMWHKOD-UHFFFAOYSA-N 0.000 description 1
- CEYHZIJUQROMNH-UHFFFAOYSA-N 4-methylideneoctanamide Chemical compound C(N)(=O)CCC(=C)CCCC CEYHZIJUQROMNH-UHFFFAOYSA-N 0.000 description 1
- OJEUMYNHRBQGPP-UHFFFAOYSA-N 4-methylideneoctanenitrile Chemical compound CCCCC(=C)CCC#N OJEUMYNHRBQGPP-UHFFFAOYSA-N 0.000 description 1
- ZUVXVCXXZLUIAR-UHFFFAOYSA-N 5-methyl-4-methylidenehexan-3-one Chemical compound CCC(=O)C(=C)C(C)C ZUVXVCXXZLUIAR-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000012905 Brassica oleracea var viridis Nutrition 0.000 description 1
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- AJCHRUXIDGEWDK-UHFFFAOYSA-N bis(ethenyl) butanedioate Chemical compound C=COC(=O)CCC(=O)OC=C AJCHRUXIDGEWDK-UHFFFAOYSA-N 0.000 description 1
- JZQAAQZDDMEFGZ-UHFFFAOYSA-N bis(ethenyl) hexanedioate Chemical compound C=COC(=O)CCCCC(=O)OC=C JZQAAQZDDMEFGZ-UHFFFAOYSA-N 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- CJSBUWDGPXGFGA-UHFFFAOYSA-N dimethyl-butadiene Natural products CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- BLZSRIYYOIZLJL-UHFFFAOYSA-N ethenyl pentanoate Chemical compound CCCCC(=O)OC=C BLZSRIYYOIZLJL-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229940105132 myristate Drugs 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- YHIXOVNFGQWPFW-UHFFFAOYSA-N octadecan-1-amine;hydrobromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[NH3+] YHIXOVNFGQWPFW-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- GAZQLDAHHKFOEX-UHFFFAOYSA-N pentyl 4-methylidenenonanoate Chemical compound C(CCCC)C(CCC(=O)OCCCCC)=C GAZQLDAHHKFOEX-UHFFFAOYSA-N 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 150000004968 peroxymonosulfuric acids Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LNIAEVLCVIKUGU-UHFFFAOYSA-M potassium;octadecane-1-sulfonate Chemical compound [K+].CCCCCCCCCCCCCCCCCCS([O-])(=O)=O LNIAEVLCVIKUGU-UHFFFAOYSA-M 0.000 description 1
- PFMVLFSAAABWQD-UHFFFAOYSA-M potassium;octadecyl sulfate Chemical compound [K+].CCCCCCCCCCCCCCCCCCOS([O-])(=O)=O PFMVLFSAAABWQD-UHFFFAOYSA-M 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- PNGBYKXZVCIZRN-UHFFFAOYSA-M sodium;hexadecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCCCCCS([O-])(=O)=O PNGBYKXZVCIZRN-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- TUNFSRHWOTWDNC-UHFFFAOYSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCCC(O)=O TUNFSRHWOTWDNC-UHFFFAOYSA-N 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/46—Polymerisation initiated by wave energy or particle radiation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F20/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride, ester, amide, imide or nitrile thereof
- C08F20/02—Monocarboxylic acids having less than ten carbon atoms, Derivatives thereof
- C08F20/42—Nitriles
- C08F20/50—Nitriles containing four or more carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US91022A US2666025A (en) | 1949-05-02 | 1949-05-02 | Process for polymerizing vinyl-type compounds by irradiation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE827554C true DE827554C (de) | 1952-01-10 |
Family
ID=22225431
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN818A Expired DE827554C (de) | 1949-05-02 | 1950-04-29 | Verfahren zum Polymerisieren von Verbindungen vom Vinyltyp |
Country Status (5)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046317B (de) * | 1956-06-06 | 1958-12-11 | Kalle & Co Ag | Verfahren zur UEberfuehrung von Acrylverbindungen in einen hoeheren Polymerisationsgrad durch Photopolymerisation in Gegenwart von Sensibilisatoren |
| US4571665A (en) * | 1982-04-02 | 1986-02-18 | Espe Fabrik Pharmazeutischer Praeparate Gmbh | Apparatus for treating dental materials |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2899405A (en) * | 1959-08-11 | Polymerization of vinyl chloride or | ||
| US3166539A (en) * | 1948-12-31 | 1965-01-19 | Degussa | Polymerization of acrylate mixtures of polymer/monomer using a catalyst system of a tertiary-amine and a quadrivalent sulfur compound |
| US2794793A (en) * | 1952-10-21 | 1957-06-04 | Eastman Kodak Co | Copolymerization of ethenoid monomers in the presence of polyacrylonitrile |
| US2879253A (en) * | 1954-02-03 | 1959-03-24 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer, in the presence of preformed homopolymers and products obtained thereby |
| US3238275A (en) * | 1953-09-30 | 1966-03-01 | Borg Warner | Polymerization of acrylonitrile-styrene mixtures in the presence of polybutadiene |
| US3069380A (en) * | 1953-12-07 | 1962-12-18 | Shell Oil Co | Process for preparing segmented copolymers |
| US3069381A (en) * | 1953-12-07 | 1962-12-18 | Shell Oil Co | Process for preparing segmented copolymers |
| US2838470A (en) * | 1954-02-03 | 1958-06-10 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer in the presence ofpreformed interpolymer |
| US2840447A (en) * | 1954-04-28 | 1958-06-24 | Du Pont | Process for preparing filaments from dispersions containing graft polymers obtained from ethylenically unsaturated monomers |
| US2842518A (en) * | 1954-09-13 | 1958-07-08 | Borg Warner | Product produced by polymerization of vinylidene chloride-acrylonitrile mixtures onto polychloroprene |
| US2850478A (en) * | 1954-11-15 | 1958-09-02 | Eastman Kodak Co | Mixtures comprising methacrylonitrile polymers with alkyl acrylate polymers |
| US3026289A (en) * | 1954-11-26 | 1962-03-20 | Eastman Kodak Co | Process of polymerizing vinyl chloride or vinylidene chloride in the presence of an acrylamide polymer |
| US2921044A (en) * | 1954-11-26 | 1960-01-12 | Eastman Kodak Co | Method of making modified interpolymers containing vinyl chloride or vinylidene chloride |
| US2879256A (en) * | 1954-11-26 | 1959-03-24 | Eastman Kodak Co | Continuous process for preparing vinyl or vinylidene chloride graft polymers of improved solubility |
| DE1049585B (de) * | 1955-02-18 | 1959-01-29 | Ronald GeorgeWreyford Norrish, Cambridge und The Distillers Company Limited, Edinburgh (Großbritannien) | Verfahren zur Herstellung von Pfropfmischpolymerisaten |
| LU34305A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-04-29 | |||
| BE559514A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-05-31 | |||
| US3089832A (en) * | 1955-12-01 | 1963-05-14 | Exxon Research Engineering Co | Polymeric lubricating oil additives |
| US3001922A (en) * | 1955-12-19 | 1961-09-26 | Gen Electric | Polymers |
| IT568611A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-01-13 | |||
| GB866069A (en) * | 1956-02-14 | 1961-04-26 | Ti Group Services Ltd | Improvements relating to the manufacture of plastics |
| NL92762C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-04-14 | |||
| US2955953A (en) * | 1956-06-05 | 1960-10-11 | Du Pont | Process of adhering an organic coating to a polymeric substrate |
| US2999056A (en) * | 1956-10-04 | 1961-09-05 | Du Pont | Irradiation bonding of acidic compounds to shaped polymeric structures |
| US3201336A (en) * | 1956-07-27 | 1965-08-17 | Ct Nat De La Rech Scient Minis | Graft polymerization utilizing ionizing radiation |
| DE1050056B (de) * | 1956-08-22 | 1959-02-05 | American Cyanamid Company, New York, N. Y. (V. St. A.) | Verfahren zur Herstellung; von Pfropfpolymeren |
| US2940912A (en) * | 1956-10-01 | 1960-06-14 | Du Pont | Initiation of polymerization by preirradiated solid carboxylic acids, amides and nitriles |
| BE561742A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1956-10-18 | |||
| US3079312A (en) * | 1956-11-06 | 1963-02-26 | Du Pont | Shaped polymeric articles |
| US2941934A (en) * | 1957-01-16 | 1960-06-21 | Gen Aniline & Film Corp | Polymerization by temperature controlled irradiation |
| US3012001A (en) * | 1957-03-06 | 1961-12-05 | Us Rubber Co | Composition of vinyl chloride polymer plus two unsaturated monomers |
| US3061531A (en) * | 1957-03-06 | 1962-10-30 | Us Rubber Co | Irradiation of vinyl chloride polymer plus two unsaturated monomers |
| US3006830A (en) * | 1957-05-31 | 1961-10-31 | Dow Chemical Co | Method for improving the dyeability of fiber-forming cellulose esters |
| US2986507A (en) * | 1957-10-30 | 1961-05-30 | Rohm & Haas | Preparation of acrylic-type polymers which are insolubilized in situ after polymerization and end product application |
| US3075904A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3082161A (en) * | 1958-01-06 | 1963-03-19 | Alelio Gaetano F D | Irradiated polymers |
| US3075905A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3074866A (en) * | 1958-01-06 | 1963-01-22 | Alelio Gaetano F D | Irradiated polymers |
| US3058949A (en) * | 1958-07-30 | 1962-10-16 | Eastman Kodak Co | Mixtures of methacrylonitrile copolymers with alkyl acrylate and methacrylate polymers |
| BE583166A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-10-01 | |||
| US3113912A (en) * | 1959-07-16 | 1963-12-10 | Phillips Petroleum Co | Preparation of vulcanizates by irradiation of block copolymers |
| US3188229A (en) * | 1961-10-03 | 1965-06-08 | Du Pont | Process of adhering an organic coating to a substrate |
| DE1495774C3 (de) * | 1964-02-08 | 1974-03-07 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zur Herstellung von Pfropfmischpolymerisaten |
| US3310605A (en) * | 1965-08-02 | 1967-03-21 | Grace W R & Co | Two step grafting using trapper radical system |
| US3408172A (en) * | 1966-03-01 | 1968-10-29 | Gen Electric | Diamond and cubic boron nitride grains coated with photopolymerized material |
| GB1445931A (en) * | 1973-05-04 | 1976-08-11 | Hercules Inc | Imidazole polymers and preparation thereof with radiation and chemical initiator |
| DE2831263A1 (de) * | 1978-07-15 | 1980-01-31 | Basf Ag | Benzoinderivate mit quartaerer ammoniumgruppe |
| US4273831A (en) * | 1978-09-01 | 1981-06-16 | Kemtec, Inc. | Powdered polymer compositions produced by electron beam polymerization of polymerizable compositions |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2160940A (en) * | 1938-04-01 | 1939-06-06 | Dow Chemical Co | Vinylidene chloride co-polymers |
| US2297351A (en) * | 1938-11-23 | 1942-09-29 | Pittsburgh Plate Glass Co | Conjoint polymerization of dicarboxylic acids and olefinic compounds |
| US2344785A (en) * | 1940-08-03 | 1944-03-21 | Dow Chemical Co | Photopolymerization method |
| US2370562A (en) * | 1941-05-06 | 1945-02-27 | Pittsburgh Plate Glass Co | Method of preparing a coated resin product |
| BE465271A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1941-12-31 | 1900-01-01 | ||
| US2460300A (en) * | 1944-06-29 | 1949-02-01 | Dow Chemical Co | Polymeric products derived from diolefins and vinyl aromatic compounds and method of making same |
| US2519092A (en) * | 1946-03-12 | 1950-08-15 | Standard Oil Dev Co | Compositions of different styreneisobutylene copolymers |
| US2504054A (en) * | 1947-11-04 | 1950-04-11 | Us Rubber Co | Plasticized acrylonitrile-isobutylene copolymer |
| US2480751A (en) * | 1948-01-22 | 1949-08-30 | Du Pont | Preparation of cast synthetic resin having integral sheen |
-
0
- NL NL74258D patent/NL74258C/xx active
-
1949
- 1949-05-02 US US91022A patent/US2666025A/en not_active Expired - Lifetime
-
1950
- 1950-04-29 DE DEN818A patent/DE827554C/de not_active Expired
- 1950-05-02 FR FR1018956D patent/FR1018956A/fr not_active Expired
- 1950-05-02 GB GB10809/50A patent/GB697289A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046317B (de) * | 1956-06-06 | 1958-12-11 | Kalle & Co Ag | Verfahren zur UEberfuehrung von Acrylverbindungen in einen hoeheren Polymerisationsgrad durch Photopolymerisation in Gegenwart von Sensibilisatoren |
| US4571665A (en) * | 1982-04-02 | 1986-02-18 | Espe Fabrik Pharmazeutischer Praeparate Gmbh | Apparatus for treating dental materials |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1018956A (fr) | 1953-01-15 |
| NL74258C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| US2666025A (en) | 1954-01-12 |
| GB697289A (en) | 1953-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE827554C (de) | Verfahren zum Polymerisieren von Verbindungen vom Vinyltyp | |
| DE1911882C3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE746788C (de) | Verfahren zur Herstellung von Polymerisationsprodukten aus Vinylestern | |
| DE1745945A1 (de) | Gummikunststoff-Mischung fuer Formkoerper und Schichtstoffe | |
| DE68915365T2 (de) | Pfropfung einer verhinderten C-nitro-Gruppe auf Polymere. | |
| DE3887551T2 (de) | Gebundene Antioxydationsvormischung. | |
| DE920147C (de) | Zur Verformung geeignete Loesungs- oder Diapersionsmischungen eines Acrylsaeurenitril-Polymeren | |
| EP0164663B1 (de) | Kunststoff mit hoher UV-Durchlässigkeit und Verfahren zu seiner Herstellung | |
| DE1161423B (de) | Verfahren zur Herstellung von Pfropf-polymerisaten | |
| DE975072C (de) | Verfahren zur Schnellpolymerisation von Gemischen aus monomeren und polymeren Vinylverbindungen | |
| DE2148185A1 (de) | Polymerisationsinhibitor fuer vinylgruppenhaltige aliphatische, aromatische und heterocyclische verbindungen | |
| DE912152C (de) | Verfahren zur Polymerisation oder Kopolymerisation polymerisierbarer ungesaettigter organischer Verbindungen | |
| DE2164482A1 (de) | Initatoren fuer radikalisch auszuloesende polymerisationsreaktionen | |
| DE700176C (de) | Herstellung von Kunststoffen hoher Haerte und Festigkeit | |
| DE1113572B (de) | Verfahren zur Herstellung von hydroxylgruppenhaltigen Mischpoly-merisaten aus Vinylchlorid und Vinylacetat | |
| DE1929166A1 (de) | Verfahren zur Herstellung von Styrol-Acrylnitril-Mischpolymerisaten | |
| DE1088718B (de) | Verfahren zur Herstellung vernetzter Mischpolymerer | |
| DE1296802B (de) | Thermoplastische Formmassen | |
| DE871366C (de) | Verfahren zum Polymerisieren ungesaettigter Verbindungen | |
| DE2437093A1 (de) | Verfahren zur verhinderung der vernetzung von copolymerisaten vinylchloridvinyltrialkoxysilanen | |
| DE966375C (de) | Verfahren zur Herstellung von Acrylnitrilharzen | |
| DE829222C (de) | Verfahren zum Polymerisieren mono-olefinischer Verbindungen | |
| DE1570855C3 (de) | Verfahren zur Herstellung eines Pfropfmischpolymerisats | |
| DE2050723B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1911465A1 (de) | Verfahren zur Herstellung von Pfropf-Co-Polymerisaten auf der Basis von Polyvinylchlorid |