DE814152C - everkusen I Verfahren zur Herstellung von Estern der Phosphorsaure und Thiophosphor saure - Google Patents
everkusen I Verfahren zur Herstellung von Estern der Phosphorsaure und Thiophosphor saureInfo
- Publication number
- DE814152C DE814152C DENDAT814152D DE814152DA DE814152C DE 814152 C DE814152 C DE 814152C DE NDAT814152 D DENDAT814152 D DE NDAT814152D DE 814152D A DE814152D A DE 814152DA DE 814152 C DE814152 C DE 814152C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- esters
- phosphoric acid
- production
- thiophosphoric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title claims description 10
- 150000002148 esters Chemical class 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 6
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 title claims description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims 2
- -1 alkali metal salts Chemical class 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 150000002989 phenols Chemical class 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 4
- 150000003016 phosphoric acids Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 235000011007 phosphoric acid Nutrition 0.000 claims 2
- 150000001447 alkali salts Chemical class 0.000 claims 1
- 150000002823 nitrates Chemical class 0.000 claims 1
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical class OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 2
- IDYCKFALGSYOFN-UHFFFAOYSA-N ethyl 2-(4-nitrophenyl)ethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCCC1=CC=C([N+]([O-])=O)C=C1 IDYCKFALGSYOFN-UHFFFAOYSA-N 0.000 description 2
- YEPBJYBOGGIKGB-UHFFFAOYSA-N ethyl 2-phenylethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCCC1=CC=CC=C1 YEPBJYBOGGIKGB-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical class ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BUBWKNKRFRMZNS-UHFFFAOYSA-N (2-nitrophenyl) dihydrogen phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1[N+]([O-])=O BUBWKNKRFRMZNS-UHFFFAOYSA-N 0.000 description 1
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 1
- GZJIQNJINXQYTG-UHFFFAOYSA-N 2-nitrooxybenzoic acid Chemical class OC(=O)C1=CC=CC=C1O[N+]([O-])=O GZJIQNJINXQYTG-UHFFFAOYSA-N 0.000 description 1
- SCFXRRMXMMHURF-UHFFFAOYSA-N 2-nitrophenol;sodium Chemical compound [Na].OC1=CC=CC=C1[N+]([O-])=O SCFXRRMXMMHURF-UHFFFAOYSA-N 0.000 description 1
- XZKIHKMTEMTJQX-UHFFFAOYSA-N 4-Nitrophenyl Phosphate Chemical class OP(O)(=O)OC1=CC=C([N+]([O-])=O)C=C1 XZKIHKMTEMTJQX-UHFFFAOYSA-N 0.000 description 1
- UCQRPBLOYKRHFQ-UHFFFAOYSA-N CCOP(O)([ClH]CC)=S Chemical compound CCOP(O)([ClH]CC)=S UCQRPBLOYKRHFQ-UHFFFAOYSA-N 0.000 description 1
- ZMOGFQUYHKDQGZ-UHFFFAOYSA-N COP(O)([ClH]C)=S Chemical compound COP(O)([ClH]C)=S ZMOGFQUYHKDQGZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- CURNJKLCYZZBNJ-UHFFFAOYSA-M sodium;4-nitrophenolate Chemical compound [Na+].[O-]C1=CC=C([N+]([O-])=O)C=C1 CURNJKLCYZZBNJ-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000003580 thiophosphoric acid esters Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/22—Amides of acids of phosphorus
- C07F9/24—Esteramides
- C07F9/2404—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic
- C07F9/242—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic of hydroxyaryl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/08—Esters of oxyacids of phosphorus
- C07F9/09—Esters of phosphoric acids
- C07F9/12—Esters of phosphoric acids with hydroxyaryl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/18—Esters of thiophosphoric acids with hydroxyaryl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Description
- Verfahren zur Herstellung von Estern der Phosphorsäure und Thiophosphorsäure Phosphorsäureester und Thiophosphorsäureester negativ substituierter Phenole sind nicht bekannt. Es wurde gefunden, daß sich solche Ester leicht herstellen lassen, wenn man disubstituierte Phosphorsäure- bzw. Thiophosphorsäuremonochloride mit den Alkalisalzen negativ substituierter Phenole umsetzt. An Stelle der Alkaliphenolate kann man auch die freien Phenole in Gegenwart eines säurebindenden Mittels umsetzen. Vorzugsweise läßt man die Reaktion in einem geeigneten Verdünnungsmittel stattfinden. Für das Verfahren geeignete Monochloride der genannten Art sind z. B.
Dialkylphosphorsäurechloride: R0. 0(S) R0" Cl Als negativ substituierte Phenole seien u. a. genannt o-, m- oder p-Nitrophenole, Chlorphenole, Oxybenzoesäureester, Nitrooxybenzoesäureester, Oxybenzaldehyde usw. und deren weitere Substitutionsprodukte.Phosphorsäurealkylesterchlorid- dialkylamide : R O O (S) jp (CH3)2N " Cl Phosphorsäurechloridbis- dialkylamide : (C H3)2 N , O (S) /, p . (C H3)2 N " .,\ Cl Alkylphosphinsäureester- R10 ,1 1,0(S) chloride: \ p R / \ C1 - Es wurde weiter noch gefunden, daß sich die Nitrophenylphosphorsäureester auch in sehr einfacher Weise durch Nitrieren der entsprechenden Phenylester herstellen lassen.
- Die erhaltenen Ester sind hochsiedende, wenig wasserlösliche Öle, die durch Fraktionieren im Hochvakuum gereinigt werden können; sie eignen sich als Weichmacher, Schmiermittel, Olverbesserer und Emulgiermittel. Weiter können die Verbindungen auch für therapeutische Zwecke Verwendung finden; so zeigen insbesondere die erfindungsgemäßen Abkömmlinge der Phosphorsäure pupillenverengende Wirkung und sind deshalb wertvoll für die Augenheilkunde.
- Beispiel i 81 g p-Nitrophenolnatrium werden in 250 ccm Chlorbenzol angeschlämmt. In die Anschlämmung gibt man 95g Diäthylthiophosphorsäuremonochlorid (Kp" = 82') und erwärmt 12 Stunden auf 120'. Dann werden die Salze abgesaugt. Das Filtrat wird durch Destillation vom Chlorbenzol befreit. Man erhält 120 g an rohem p-Nitrophenyldiäthylthiophosphorsäureester (Ausbeute 86°/0). Der Ester siedet unter einem Druck von i mm bei i7o bis 171'. Der neue Ester ist ein gelbes, charakteristisch riechendes, wenig wasserlösliches 0l.
- An Stelle des Natriumsalzes des p-Nitrophenols kann auch eine tertiäre Base als Säurebindemittel Verwendung finden. So werden z. B. aus 28 g p-Nitrophenol, 24 g Triäthanolamin und 38 g Diäthylthiophosphorsäurechlorid 42 g des p-Nitrophenyldiäthylthiophosphorsäureesters erhalten(Ausbeute 71 °/.d.Th.) . Beispiel 2 81 g Dimethylthiophosphorsäuremonochlorid (Kps = 38 bis 391 gibt man unter Rühren zu einer Anschlämmung von 70 g p-Nitrophenol, 35 g calc. Soda und 250 ccm Chlorbenzol bei 70°. Dann hält man die Innentemperatur 3 Stunden auf iio bis 115'. Nach dem üblichen Aufarbeiten bekommt man iio g rohen p-Nitrophenyldimethylthiophosphorsäureester. Der neue Ester siedet unter einem Druck von 3 mm bei 172'. Beim Erkalten kristallisiert das 01 zu farblosen Nadeln, die sich aus Methanol umkristallisieren lassen und dann einen Schmelzpunkt von 36' zeigen.
- Beispiel 3 81 g Nitrophenolnatrium werden in 250 ccm Xylol angeschlämmt. Zu der Anschlämmung gibt man 86 g Diäthylphosphorsäurechlorid (Kp4 = 76') und erwärmt i Stunde auf i io °. Dann werden die Salze abfiltriert, und das Filtrat wird fraktioniert. Es werden 83 g p-Nitrophenyldiäthylphosphorsäureester vom Kpl =173 ° erhalten (Ausbeute 6o0/.).
- Die gleiche Substanz entsteht auch bei der Verwendung von Pyridin an Stelle des Natriumphenolats: 42 g p-Nitrophenol werden in 50 ccm wasserfreiem Pyridin gelöst. Zu der Lösung gibt man bei 55 bis 6o0, 52 g Diäthylphosphorsäurechlorid und ,erwärmt i Stunde auf 6o'. Dann wird abgekühlt und mit Wasser verdünnt. Das salzsaure Pyridin löst sich, das unlösliche Reaktionsprodukt wird in Äther aufgenommen. Nach dem üblichen Aufarbeiten werden 23 g p-Nitrophenyldiäthylphosphorsäureester vom Kpl 173' erhalten (Ausbeute 28°/o).
- Wird an Stelle von Pyridin Natriumcyanid als Säurebindemittel angewandt, so erhält man das p-Nitrophenylphosphorsäurederivat mit etwa 55°/o Ausbeute.
- In sehr guter Ausbeute entsteht der Nitrophenyldiäthylphosphorsäureester auch durch Nitrieren des Phenyldiäthylphosphorsäureesters. 138 g Phenyldiäthylphosphorsäureester werden unter Rühren bei o nicht übersteigender Temperatur langsam in 186 g rote, rauchende Salpetersäure eingetropft. Nach einstündigem Rühren wird das Reaktionsprodukt auf Eis gegeben. Der entstandene wasserunlösliche p-Nitrophenyldiäthylphosphorsäureester wird abgetrennt, zweimal mit Wasser gewaschen, in Äther aufgenommen, getrocknet und vom Lösungsmittel befreit. Es werden 158 g des p-Nitrophenyldiäthylphosphorsäureesters erhalten (Ausbeute 960,l. d. Th.).
- In ähnlicher Weise können folgende Verbindungen erhalten werden
Claims (3)
- PATENTANSPRÜCHE: i. Verfahren zur Herstellung von Estern der Phosphorsäure oder Thiophosphorsäure, dadurch gekennzeichnet, daB man die Alkalisalze negativ substituierter Phenole mit disubstituierten Phosphorsäure- bzw. Thiophosphorsäuremonochloriden umsetzt.
- 2. Verfahren nach Patentanspruch i, dadurch gekennzeichnet, daB man an Stelle der Alkalisalze die freien Phenole in Gegenwart säurebindender Mittel umsetzt.
- 3. Verfahren nach Patentanspruch i, dadurch gekennzeichnet, daB man zur Herstellung von Nitrophenylestern disubstituierter Phosphorsäuren zunächst die Phenylester disubstituierter Phosphorsäuren herstellt und dann nitriert.
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE814152C true DE814152C (de) | 1951-07-26 |
Family
ID=578621
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT814152D Expired DE814152C (de) | everkusen I Verfahren zur Herstellung von Estern der Phosphorsaure und Thiophosphor saure |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE814152C (de) |
Cited By (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE937956C (de) * | 1953-04-09 | 1956-01-19 | Anorgana G M B H | Verfahren zur Herstellung von Oxyaryl-dialkylphosphorsaeureestern |
| DE1025199B (de) * | 1950-03-30 | 1958-02-27 | Dow Chemical Co | Schaedlingsbekaempfungsmittel |
| US2836612A (en) * | 1956-04-02 | 1958-05-27 | Dow Chemical Co | Omicron-aryl omicron-methyl phosphoroamido-thioates |
| US2855425A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(2, 6-dicyclohexyl-4-methylphenyl) o-methyl n-alkyl phosphoroamidothioates |
| US2855426A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(cyclohexylphenyl) phosphoroamidothioates |
| US2862018A (en) * | 1956-07-30 | 1958-11-25 | Dow Chemical Co | O-aryl o-loweralkyl n-alkenyl phosphoroamidothioates |
| US2908706A (en) * | 1956-03-05 | 1959-10-13 | Dow Chemical Co | O-aryl o-methyl phosphoroamido-thioates |
| US2916509A (en) * | 1957-06-18 | 1959-12-08 | Bayer Ag | Phosphonic acid derivatives |
| DE1089209B (de) * | 1955-03-05 | 1960-09-15 | Rhone Poulenc Sa | Schaedlingsbekaempfungsmittel |
| US2988474A (en) * | 1960-07-28 | 1961-06-13 | Stauffer Chemical Co | Novel insecticides, acaricides and nematocides |
| US3032580A (en) * | 1959-07-02 | 1962-05-01 | Bayer Ag | Thiophosphonic acid esters and process for their production |
| DE1139119B (de) * | 1960-10-05 | 1962-11-08 | Bayer Ag | Verfahren zur Herstellung von Dithiophosphonsaeureesteramiden |
| US3082148A (en) * | 1961-03-06 | 1963-03-19 | Monsanto Chemicals | Insecticidal phosphonothioates |
| US3082239A (en) * | 1959-04-29 | 1963-03-19 | Bayer Ag | Thiophosphoric acid esters and process for their production |
| US3096238A (en) * | 1960-12-20 | 1963-07-02 | Monsanto Chemicals | Omicron-(halophenyl) phosphonothioates |
| DE1166790B (de) * | 1959-09-03 | 1964-04-02 | Sumitomo Chemical Co | Verfahren zur Herstellung von insektizid wirksamem O, O-Dimethyl-O-(3-methyl-4-nitrophenyl)-thionophosphorsaeureester |
| US3135780A (en) * | 1959-09-03 | 1964-06-02 | Sumitomo Chemical Co | O, o-dimethyl-o-(3-methyl-4-nitrophenyl) thionophosphate |
| DE1176653B (de) * | 1961-01-27 | 1964-08-27 | Bayer Ag | Verfahren zur Herstellung von (Thiono) Phosphon-(-in-)-saeureestern |
| US3149143A (en) * | 1959-12-24 | 1964-09-15 | Monsanto Co | O-ethyl s-(4-chlorophenyl) methylphosphonodithioate |
| US3165441A (en) * | 1961-03-01 | 1965-01-12 | Monsanto Co | Methylphosphonothioate insecticide |
| DE1196195B (de) * | 1963-02-14 | 1965-07-08 | Gelsenberg Benzin Ag | Verfahren zur Herstellung von Phosphonsaeureestern |
| DE1199251B (de) * | 1958-10-28 | 1965-08-26 | Dr Friedrich Cramer | Verfahren zur Herstellung von Saeureanhydriden und Phenylestern saurer Phosphorsaeureester |
| US3208903A (en) * | 1961-04-13 | 1965-09-28 | Monsanto Co | Phosphonothioates |
| US3253061A (en) * | 1959-01-07 | 1966-05-24 | Bayer Ag | Thionophosphonic acid esters and processes for their production |
| DE1217972B (de) * | 1962-12-22 | 1966-06-02 | Bayer Ag | Verfahren zur Herstellung von Thionophosphor-saeureestern |
| DE1219026B (de) * | 1961-03-28 | 1966-06-16 | Bayer Ag | Verfahren zur Herstellung von Thionophosphonsaeureestern |
| US3279983A (en) * | 1961-03-13 | 1966-10-18 | Monsanto Co | Halophenyl phosphonothioates |
| US3520957A (en) * | 1965-11-23 | 1970-07-21 | Sandoz Ag | O-(4-nitrophenyl)-o-alkyl-n-alkylamidophosphates |
| JPS5021464B1 (de) * | 1967-11-30 | 1975-07-23 | ||
| DE2920182A1 (de) | 1979-05-17 | 1981-04-09 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Salze von thiazolyliden-oxo-propionitrilen, insektizide mittel enthaltend diese salze sowie verfahren zu ihrer herstellung |
| US4428944A (en) | 1980-12-16 | 1984-01-31 | Basf Aktiengesellschaft | Trifluoromethoxyphenyl-(di) thiophosphoric acid esters and their use in pest control |
| US6818670B2 (en) | 1999-11-09 | 2004-11-16 | Bayer Aktiengesellschaft | Active ingredient combination having insecticidal and acaricidal characteristics |
| US6900190B2 (en) | 2000-03-28 | 2005-05-31 | Bayer Aktiengesellschaft | Active substance combinations having insecticidal and acaricidal properties |
| US7060692B2 (en) | 2000-08-31 | 2006-06-13 | Bayer Cropscience Ag | Active ingredient combinations comprising insecticidal and acaricidal properties |
| DE102007045955A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US8846567B2 (en) | 2009-03-25 | 2014-09-30 | Bayer Cropscience Ag | Active compound combinations having insecticidal and acaricidal properties |
-
0
- DE DENDAT814152D patent/DE814152C/de not_active Expired
Cited By (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1025199B (de) * | 1950-03-30 | 1958-02-27 | Dow Chemical Co | Schaedlingsbekaempfungsmittel |
| DE937956C (de) * | 1953-04-09 | 1956-01-19 | Anorgana G M B H | Verfahren zur Herstellung von Oxyaryl-dialkylphosphorsaeureestern |
| DE1089209B (de) * | 1955-03-05 | 1960-09-15 | Rhone Poulenc Sa | Schaedlingsbekaempfungsmittel |
| US2908706A (en) * | 1956-03-05 | 1959-10-13 | Dow Chemical Co | O-aryl o-methyl phosphoroamido-thioates |
| US2836612A (en) * | 1956-04-02 | 1958-05-27 | Dow Chemical Co | Omicron-aryl omicron-methyl phosphoroamido-thioates |
| US2855426A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(cyclohexylphenyl) phosphoroamidothioates |
| US2855425A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(2, 6-dicyclohexyl-4-methylphenyl) o-methyl n-alkyl phosphoroamidothioates |
| US2862018A (en) * | 1956-07-30 | 1958-11-25 | Dow Chemical Co | O-aryl o-loweralkyl n-alkenyl phosphoroamidothioates |
| US2916509A (en) * | 1957-06-18 | 1959-12-08 | Bayer Ag | Phosphonic acid derivatives |
| DE1199251B (de) * | 1958-10-28 | 1965-08-26 | Dr Friedrich Cramer | Verfahren zur Herstellung von Saeureanhydriden und Phenylestern saurer Phosphorsaeureester |
| US3253061A (en) * | 1959-01-07 | 1966-05-24 | Bayer Ag | Thionophosphonic acid esters and processes for their production |
| US3082239A (en) * | 1959-04-29 | 1963-03-19 | Bayer Ag | Thiophosphoric acid esters and process for their production |
| US3032580A (en) * | 1959-07-02 | 1962-05-01 | Bayer Ag | Thiophosphonic acid esters and process for their production |
| US3135780A (en) * | 1959-09-03 | 1964-06-02 | Sumitomo Chemical Co | O, o-dimethyl-o-(3-methyl-4-nitrophenyl) thionophosphate |
| DE1166790B (de) * | 1959-09-03 | 1964-04-02 | Sumitomo Chemical Co | Verfahren zur Herstellung von insektizid wirksamem O, O-Dimethyl-O-(3-methyl-4-nitrophenyl)-thionophosphorsaeureester |
| US3149143A (en) * | 1959-12-24 | 1964-09-15 | Monsanto Co | O-ethyl s-(4-chlorophenyl) methylphosphonodithioate |
| US2988474A (en) * | 1960-07-28 | 1961-06-13 | Stauffer Chemical Co | Novel insecticides, acaricides and nematocides |
| DE1139119B (de) * | 1960-10-05 | 1962-11-08 | Bayer Ag | Verfahren zur Herstellung von Dithiophosphonsaeureesteramiden |
| US3096238A (en) * | 1960-12-20 | 1963-07-02 | Monsanto Chemicals | Omicron-(halophenyl) phosphonothioates |
| DE1176653B (de) * | 1961-01-27 | 1964-08-27 | Bayer Ag | Verfahren zur Herstellung von (Thiono) Phosphon-(-in-)-saeureestern |
| US3165441A (en) * | 1961-03-01 | 1965-01-12 | Monsanto Co | Methylphosphonothioate insecticide |
| US3082148A (en) * | 1961-03-06 | 1963-03-19 | Monsanto Chemicals | Insecticidal phosphonothioates |
| US3279983A (en) * | 1961-03-13 | 1966-10-18 | Monsanto Co | Halophenyl phosphonothioates |
| DE1219026B (de) * | 1961-03-28 | 1966-06-16 | Bayer Ag | Verfahren zur Herstellung von Thionophosphonsaeureestern |
| US3208903A (en) * | 1961-04-13 | 1965-09-28 | Monsanto Co | Phosphonothioates |
| DE1217972B (de) * | 1962-12-22 | 1966-06-02 | Bayer Ag | Verfahren zur Herstellung von Thionophosphor-saeureestern |
| DE1196195B (de) * | 1963-02-14 | 1965-07-08 | Gelsenberg Benzin Ag | Verfahren zur Herstellung von Phosphonsaeureestern |
| US3520957A (en) * | 1965-11-23 | 1970-07-21 | Sandoz Ag | O-(4-nitrophenyl)-o-alkyl-n-alkylamidophosphates |
| JPS5021464B1 (de) * | 1967-11-30 | 1975-07-23 | ||
| DE2920182A1 (de) | 1979-05-17 | 1981-04-09 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Salze von thiazolyliden-oxo-propionitrilen, insektizide mittel enthaltend diese salze sowie verfahren zu ihrer herstellung |
| US4428944A (en) | 1980-12-16 | 1984-01-31 | Basf Aktiengesellschaft | Trifluoromethoxyphenyl-(di) thiophosphoric acid esters and their use in pest control |
| US6818670B2 (en) | 1999-11-09 | 2004-11-16 | Bayer Aktiengesellschaft | Active ingredient combination having insecticidal and acaricidal characteristics |
| US6900190B2 (en) | 2000-03-28 | 2005-05-31 | Bayer Aktiengesellschaft | Active substance combinations having insecticidal and acaricidal properties |
| US7060692B2 (en) | 2000-08-31 | 2006-06-13 | Bayer Cropscience Ag | Active ingredient combinations comprising insecticidal and acaricidal properties |
| DE102007045955A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US8846567B2 (en) | 2009-03-25 | 2014-09-30 | Bayer Cropscience Ag | Active compound combinations having insecticidal and acaricidal properties |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE814152C (de) | everkusen I Verfahren zur Herstellung von Estern der Phosphorsaure und Thiophosphor saure | |
| DE1047776B (de) | Verfahren zur Herstellung von Thionophosphorsaeureestern | |
| DE1290147B (de) | Verfahren zur Herstellung von 4, 4-Dinitrodiphenylaethern | |
| CH631181A5 (de) | Verfahren zur herstellung von 2,6-dimethoxy-4-(quaternaeren-alkyl)phenyl-disubstituierten-phosphaten. | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| DE1058992B (de) | Verfahren zur Herstellung von Thiophosphonsaeureestern | |
| EP0022546A2 (de) | Verfahren zur Herstellung von 1-Oxophospholan-chlorhydrinen sowie einige spezielle dieser Verbindungen | |
| EP0271695B1 (de) | Verfahren zur Herstellung von Phosphin- oder Phosphonsäurechloriden | |
| DE1216278B (de) | Verfahren zur Herstellung von unsymmetrischen Phosphorigsaeure-O, O-diestern | |
| DE551777C (de) | Verfahren zur Herstellung von nicht substituierten Carbaminsaeureestern disubstituierter Aminoalkohole | |
| DE1153373B (de) | Verfahren zur Herstellung von Pyrophosphorsaeureestern, Phosphorsaeureestern, -amiden oder -carbonsaeureanhydriden | |
| DE666134C (de) | Verfahren zur Herstellung von Kondensationsprodukten aus mehrwertigen Phenolen und Diisobutylen | |
| AT250334B (de) | Verfahren zur Herstellung von α-Carbalkoxy-β-arylamino-acrylsäureestern | |
| CH369446A (de) | Verfahren zur Herstellung von Thiophosphorsäureestern | |
| DE917424C (de) | Verfahren zur Herstellung von N-Acetyl-propargyl-arylaminen und ihrer p-staendigen Substitutionsprodukte | |
| AT214454B (de) | Verfahren zur Herstellung neuer Phosphinsäurederivate | |
| DE1011878B (de) | Verfahren zur Herstellung von azidogruppenhaltigen Thiophosphorsaeureestern | |
| DE2222578C3 (de) | Verfahren zur Herstellung von O1O-Dialkyl-O-phenylthionophosphorsäureestern | |
| DE955235C (de) | Verfahren zur Herstellung von Arylaethern des Glycerin-bis-chloralhemiacetals | |
| DE960722C (de) | Verfahren zur Herstellung von Serinen aus Glykokoll und Aldehyden | |
| AT227720B (de) | Verfahren zur Herstellung von neuen Phosphorsäureestern | |
| DE1768525A1 (de) | Phosphorsaeurederivate und Verfahren zu ihrer Herstellung | |
| DE1141990B (de) | Verfahren zur Herstellung von Thiophosphinsaeureestern | |
| DE1232160B (de) | Verfahren zur Herstellung von Tetrafluorhalogenphenolen | |
| DE1042582B (de) | Verfahren zur Herstellung von neuen Derivaten der Imidodiphosphorsaeure |