DE764168A - - Google Patents
Info
- Publication number
- DE764168A DE764168A DE764168A DE 764168 A DE764168 A DE 764168A DE 764168 A DE764168 A DE 764168A
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- polymerization
- polymerizable
- lead
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000642 polymer Polymers 0.000 claims description 20
- 238000004519 manufacturing process Methods 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 238000006116 polymerization reaction Methods 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 12
- -1 Cellulose esters Chemical class 0.000 claims description 7
- 239000000178 monomer Substances 0.000 claims description 7
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 6
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 150000002605 large molecules Chemical class 0.000 claims description 3
- 238000000465 moulding Methods 0.000 claims description 3
- 150000002894 organic compounds Chemical class 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 150000002978 peroxides Chemical class 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 206010042674 Swelling Diseases 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 230000008961 swelling Effects 0.000 claims 1
- 239000000463 material Substances 0.000 description 31
- 230000000379 polymerizing effect Effects 0.000 description 7
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 238000004049 embossing Methods 0.000 description 6
- 239000002023 wood Substances 0.000 description 6
- 239000011521 glass Substances 0.000 description 5
- 239000004342 Benzoyl peroxide Substances 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229920001169 thermoplastic Polymers 0.000 description 3
- 239000004416 thermosoftening plastic Substances 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- 229920001342 Bakelite® Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004637 bakelite Substances 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000011120 plywood Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- GJIIAJVOYIPUPY-UHFFFAOYSA-N 2-methylidenebut-3-enoic acid Chemical compound OC(=O)C(=C)C=C GJIIAJVOYIPUPY-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VVBLNCFGVYUYGU-UHFFFAOYSA-N 4,4'-Bis(dimethylamino)benzophenone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1 VVBLNCFGVYUYGU-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical class CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- FFYWKOUKJFCBAM-UHFFFAOYSA-N ethenyl 2-methylprop-2-enoate Chemical class CC(=C)C(=O)OC=C FFYWKOUKJFCBAM-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011507 gypsum plaster Substances 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229920003217 poly(methylsilsesquioxane) Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1694726A1 (de) | Verfahren zur Herstellung von Erzeugnissen aus polymerem Methylmethacrylat | |
| DE2725133C2 (de) | Verfahren zur Herstellung einer festen oder halbfesten, gemusterten Formmasse oder Formfolie und deren Verwendung | |
| DE1929832B2 (de) | Zahnfuellmassen | |
| DE2141617A1 (de) | Verfahren zur Herstellung von modifiziertem Polyvinylidenfluorid | |
| DE2249023B2 (de) | Thermoplastische Formmassen | |
| DE2147582A1 (de) | Verfahren zur Herstellung von zelligen Gegenständen mit einer integralen Haut | |
| DE2339246B2 (de) | Gleichmaessig pigmentierte formkoerper und deren herstellung aus ungesaettigten polyesterharzen | |
| EP1180070B1 (de) | Kunststoffformkörper | |
| DE4425323A1 (de) | Hinterfütterter Sanitärartikel und Verfahren zu dessen Herstellung | |
| DE764168A (enExample) | ||
| DE2057745A1 (de) | Lithographisches und Offset-Druckverfahren sowie Material fuer ein solches Druckverfahren und Verfahren zu seiner Herstellung | |
| DE69635340T2 (de) | Formmasse, Verfahren zu ihrer Herstellung und Formteile daraus | |
| DE734828T1 (de) | Thermoformbare Acrylplatte, deren Herstellungsverfahren sowie daraus thermogeformte granitähnliche Gegenstände | |
| DE2349939A1 (de) | Waermehaertbare formmasse | |
| DE2504144A1 (de) | Verpressbarer schichtstoff, daraus hergestellter formkoerper, sowie verfahren zur herstellung beider | |
| DE69029975T2 (de) | Methacrylatharz-Zusammensetzungen mit verbesserter klebriger Adhäsion und Verfahren zu deren Herstellung | |
| DE1769334C3 (de) | Nicht schäumbares, durch Suspensionspolymerisation erhaltenes Polystyrol oder Polystyrolmischpolymerisat in Form von flachen Teilchen | |
| DE2335103A1 (de) | Verfahren zur herstellung eines zelligen gegenstands | |
| DE1912467A1 (de) | Verfahren und Gemische zur Herstellung von Formteilen mit Hilfe von Ruettelgeraeten | |
| DE4142251C2 (de) | Recyclingverfahren für nicht faserverstärkte duroplastische Kunststoffe, damit hergestelltes Granulat und seine Verwendung | |
| DE1808391A1 (de) | Formmassen und daraus hergestellte Press- und Druckformen zur Abformung von Ton-,Keramik- und Porzellanmassen | |
| AT220822B (de) | Thermoplastische Harzmischung, welche zu einem thermogehärteten Harz polymerisiert werden kann | |
| DE865203C (de) | Verfahren zur Herstellung eines Verbundpolymerisates, insbesondere fuer die zahnaerztliche Prothetik | |
| EP2583995B1 (de) | Metallgefülltes Gießharz zur Herstellung eines porösen, harzgebundenen Formkörpers | |
| DE2064148A1 (de) | Flussige, warmehartende, ungesattig te Polyesterharzformmassen und Verfahren zur Herstellung von Formstucken daraus |