DE69324403T2 - Herbizide 2,6-substituierte Pyridine - Google Patents
Herbizide 2,6-substituierte PyridineInfo
- Publication number
- DE69324403T2 DE69324403T2 DE69324403T DE69324403T DE69324403T2 DE 69324403 T2 DE69324403 T2 DE 69324403T2 DE 69324403 T DE69324403 T DE 69324403T DE 69324403 T DE69324403 T DE 69324403T DE 69324403 T2 DE69324403 T2 DE 69324403T2
- Authority
- DE
- Germany
- Prior art keywords
- compound
- formula
- composition according
- groups
- hydrogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 23
- 150000003222 pyridines Chemical class 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 64
- 239000000203 mixture Substances 0.000 claims abstract description 38
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 239000004480 active ingredient Substances 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 8
- 125000005843 halogen group Chemical group 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims abstract description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 4
- -1 trifluoromethylphenyl group Chemical group 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 15
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 229910052801 chlorine Chemical group 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 239000004009 herbicide Substances 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 3
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 230000008635 plant growth Effects 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 125000003118 aryl group Chemical group 0.000 abstract description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 238000002360 preparation method Methods 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- 241000196324 Embryophyta Species 0.000 description 14
- 239000002689 soil Substances 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 10
- 239000012312 sodium hydride Substances 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000007921 spray Substances 0.000 description 7
- IREZYNKPQCIUME-UHFFFAOYSA-N 2,6-bis(phenylmethoxy)pyridine Chemical compound C=1C=CC=CC=1COC(N=1)=CC=CC=1OCC1=CC=CC=C1 IREZYNKPQCIUME-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 description 4
- HNMMGGMSQSKUMF-UHFFFAOYSA-N 2,6-diphenoxypyridine Chemical compound C=1C=CC(OC=2C=CC=CC=2)=NC=1OC1=CC=CC=C1 HNMMGGMSQSKUMF-UHFFFAOYSA-N 0.000 description 4
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 238000000638 solvent extraction Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- LFVNBAYLMRRFQM-UHFFFAOYSA-N 2-chloro-6-[3-(trifluoromethyl)phenoxy]pyridine Chemical compound FC(F)(F)C1=CC=CC(OC=2N=C(Cl)C=CC=2)=C1 LFVNBAYLMRRFQM-UHFFFAOYSA-N 0.000 description 3
- OSKQRHCKRSMITJ-UHFFFAOYSA-N 2-chloro-6-phenylmethoxypyridine Chemical compound ClC1=CC=CC(OCC=2C=CC=CC=2)=N1 OSKQRHCKRSMITJ-UHFFFAOYSA-N 0.000 description 3
- BIEWMZXVPNOGIQ-UHFFFAOYSA-N 2-phenylmethoxy-6-[3-(trifluoromethyl)phenoxy]pyridine Chemical compound FC(F)(F)C1=CC=CC(OC=2N=C(OCC=3C=CC=CC=3)C=CC=2)=C1 BIEWMZXVPNOGIQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 229910000323 aluminium silicate Inorganic materials 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 159000000000 sodium salts Chemical group 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- UBVJPWCFQOCCQA-UHFFFAOYSA-N 2,6-dichloro-4-methylsulfanylpyridine Chemical compound CSC1=CC(Cl)=NC(Cl)=C1 UBVJPWCFQOCCQA-UHFFFAOYSA-N 0.000 description 2
- 150000004793 2,6-dihydroxypyridines Chemical class 0.000 description 2
- LPRDINOHRIKRKL-UHFFFAOYSA-N 2-(4-fluorophenoxy)-6-[3-(trifluoromethyl)phenoxy]pyridine Chemical compound C1=CC(F)=CC=C1OC1=CC=CC(OC=2C=C(C=CC=2)C(F)(F)F)=N1 LPRDINOHRIKRKL-UHFFFAOYSA-N 0.000 description 2
- UIJDAXLPWQJIPE-UHFFFAOYSA-N 3-chloro-2,6-bis(phenylmethoxy)pyridine Chemical compound N1=C(OCC=2C=CC=CC=2)C(Cl)=CC=C1OCC1=CC=CC=C1 UIJDAXLPWQJIPE-UHFFFAOYSA-N 0.000 description 2
- IRFWNUACMUWMBA-UHFFFAOYSA-N 4-methyl-2,6-bis[3-(trifluoromethyl)phenoxy]pyridine Chemical compound N=1C(OC=2C=C(C=CC=2)C(F)(F)F)=CC(C)=CC=1OC1=CC=CC(C(F)(F)F)=C1 IRFWNUACMUWMBA-UHFFFAOYSA-N 0.000 description 2
- ZVOVCKZTTAEMOR-UHFFFAOYSA-N 4-methylsulfanyl-2,6-bis[3-(trifluoromethyl)phenoxy]pyridine Chemical compound N=1C(OC=2C=C(C=CC=2)C(F)(F)F)=CC(SC)=CC=1OC1=CC=CC(C(F)(F)F)=C1 ZVOVCKZTTAEMOR-UHFFFAOYSA-N 0.000 description 2
- ABYCTYJDRLQBMT-UHFFFAOYSA-N 6-bromo-4-methylpyridin-2-amine Chemical compound CC1=CC(N)=NC(Br)=C1 ABYCTYJDRLQBMT-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 240000006240 Linum usitatissimum Species 0.000 description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical group C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 235000004426 flaxseed Nutrition 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000012669 liquid formulation Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- YXJHZIOEJRCYHK-UHFFFAOYSA-N 2,3,6-trihydroxypyridine Chemical compound OC1=CC=C(O)C(O)=N1 YXJHZIOEJRCYHK-UHFFFAOYSA-N 0.000 description 1
- FKBLXSTVQUPYIR-UHFFFAOYSA-N 2,3-bis(phenylmethoxy)pyridine Chemical class C=1C=CC=CC=1COC1=CC=CN=C1OCC1=CC=CC=C1 FKBLXSTVQUPYIR-UHFFFAOYSA-N 0.000 description 1
- YNVKVCDQCIHNLW-UHFFFAOYSA-N 2,6-bis(3-methylphenoxy)pyridine Chemical compound CC1=CC=CC(OC=2N=C(OC=3C=C(C)C=CC=3)C=CC=2)=C1 YNVKVCDQCIHNLW-UHFFFAOYSA-N 0.000 description 1
- JJTGYEDGIFGBDL-UHFFFAOYSA-N 2,6-bis[2-chloro-4-(trifluoromethyl)phenoxy]-3-nitropyridine Chemical compound N1=C(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)C([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl JJTGYEDGIFGBDL-UHFFFAOYSA-N 0.000 description 1
- UOKRTJBRZGGTIM-UHFFFAOYSA-N 2,6-bis[3-(trifluoromethoxy)phenoxy]pyridine Chemical compound FC(F)(F)OC1=CC=CC(OC=2N=C(OC=3C=C(OC(F)(F)F)C=CC=3)C=CC=2)=C1 UOKRTJBRZGGTIM-UHFFFAOYSA-N 0.000 description 1
- IYEFRPSUUBRKLB-UHFFFAOYSA-N 2,6-bis[3-(trifluoromethoxy)phenoxy]pyridine;2-phenoxypyridine Chemical compound C=1C=CC=NC=1OC1=CC=CC=C1.FC(F)(F)OC1=CC=CC(OC=2N=C(OC=3C=C(OC(F)(F)F)C=CC=3)C=CC=2)=C1 IYEFRPSUUBRKLB-UHFFFAOYSA-N 0.000 description 1
- OHBIPNNTWKNAGC-UHFFFAOYSA-N 2,6-dibromo-4-methylpyridine Chemical compound CC1=CC(Br)=NC(Br)=C1 OHBIPNNTWKNAGC-UHFFFAOYSA-N 0.000 description 1
- BZYQSSVTQJTUDD-UHFFFAOYSA-N 2,6-dichloro-4-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Cl)=NC(Cl)=C1 BZYQSSVTQJTUDD-UHFFFAOYSA-N 0.000 description 1
- ULYRXZUVFDTKCZ-UHFFFAOYSA-N 2-(4-fluorophenoxy)-6-[3-(trifluoromethyl)phenoxy]pyridine;2-phenoxypyridine Chemical compound C=1C=CC=NC=1OC1=CC=CC=C1.C1=CC(F)=CC=C1OC1=CC=CC(OC=2C=C(C=CC=2)C(F)(F)F)=N1 ULYRXZUVFDTKCZ-UHFFFAOYSA-N 0.000 description 1
- VVHFXJOCUKBZFS-UHFFFAOYSA-N 2-(chloromethyl)-2-methyloxirane Chemical compound ClCC1(C)CO1 VVHFXJOCUKBZFS-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- DGXRGGUNBXNJRI-UHFFFAOYSA-N 2-methyl-4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C(C)=C1 DGXRGGUNBXNJRI-UHFFFAOYSA-N 0.000 description 1
- UWLJERQTLRORJN-UHFFFAOYSA-N 3-(trifluoromethoxy)phenol Chemical compound OC1=CC=CC(OC(F)(F)F)=C1 UWLJERQTLRORJN-UHFFFAOYSA-N 0.000 description 1
- BHPOOUUMRGOCIR-UHFFFAOYSA-N 3-bromo-2,6-bis(phenylmethoxy)pyridine Chemical compound N1=C(OCC=2C=CC=CC=2)C(Br)=CC=C1OCC1=CC=CC=C1 BHPOOUUMRGOCIR-UHFFFAOYSA-N 0.000 description 1
- JMYCGBHPZNFSLX-UHFFFAOYSA-N 3-hydroxy-3-methylpentanedinitrile Chemical compound N#CCC(O)(C)CC#N JMYCGBHPZNFSLX-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- TYGHHXCOTIUZQO-UHFFFAOYSA-N 6-bromo-4-methyl-1h-pyridin-2-one Chemical compound CC1=CC(O)=NC(Br)=C1 TYGHHXCOTIUZQO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001133184 Colletotrichum agaves Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 229920013817 TRITON X-155 Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008051 alkyl sulfates Chemical group 0.000 description 1
- 125000003368 amide group Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- FIMJSWFMQJGVAM-UHFFFAOYSA-N chloroform;hydrate Chemical compound O.ClC(Cl)Cl FIMJSWFMQJGVAM-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000006052 feed supplement Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- VYQNWZOUAUKGHI-UHFFFAOYSA-N monobenzone Chemical compound C1=CC(O)=CC=C1OCC1=CC=CC=C1 VYQNWZOUAUKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP92304795 | 1992-05-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69324403D1 DE69324403D1 (de) | 1999-05-20 |
| DE69324403T2 true DE69324403T2 (de) | 1999-09-02 |
Family
ID=8211380
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69324403T Expired - Fee Related DE69324403T2 (de) | 1992-05-27 | 1993-05-26 | Herbizide 2,6-substituierte Pyridine |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5374604A (enExample) |
| EP (1) | EP0572093B1 (enExample) |
| JP (1) | JPH0640813A (enExample) |
| KR (1) | KR930022947A (enExample) |
| CN (1) | CN1039183C (enExample) |
| AT (1) | ATE178894T1 (enExample) |
| BR (1) | BR9302077A (enExample) |
| DE (1) | DE69324403T2 (enExample) |
| DK (1) | DK0572093T3 (enExample) |
| ES (1) | ES2132172T3 (enExample) |
| GR (1) | GR3029959T3 (enExample) |
| SG (1) | SG50501A1 (enExample) |
| TW (1) | TW231258B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL109104A (en) * | 1993-03-26 | 1998-08-16 | Shell Int Research | History of pyridine from wool - 2,6 Preparation and use as herbicides containing them |
| EP0692474B1 (en) | 1994-07-14 | 1997-10-29 | Kureha Kagaku Kogyo Kabushiki Kaisha | 2- (unsubstituted or substituted) (benzyloxy or phenoxy)-4-substituted-6-(meta-substituted phenoxy) pyridine, process for producing the same, and herbicidal composition |
| JP3886173B2 (ja) * | 1994-07-14 | 2007-02-28 | 株式会社クレハ | 新規な2−(無置換または置換)(ベンジルオキシ又はフェノキシ)−4−置換−6−メタ置換フェノキシピリジン、その製造方法および除草剤 |
| DE69504599T2 (de) * | 1994-07-18 | 1999-01-28 | Kureha Kagaku Kogyo K.K., Tokio/Tokyo | 2-Phenoxy-6-thienylmethyloxy pyridin-Derivate, Verfahren zu deren Herstellung und diese enthaltende Herbizide Zubereitungen |
| CZ290330B6 (cs) * | 1995-01-26 | 2002-07-17 | American Cyanamid Company | 2,6-Disubstituované pyridinové a 2,4-disubstituované pyrimidinové deriváty, způsob a meziprodukty pro jejich výrobu, jejich pouľití a herbicidní prostředky na jejich bázi a způsob potlačování růstu neľádoucích rostlin |
| US5849758A (en) * | 1995-05-30 | 1998-12-15 | American Cyanamid Company | Herbicidal 2, 6-disubstituted pyridines and 2, 4-disubstituted pyrimidines |
| EP0723960B1 (en) * | 1995-01-26 | 2003-04-02 | Basf Aktiengesellschaft | Herbicidal 2,6-disubstituted pyridines and 2,4-disubstituted pyrimidines |
| US6008161A (en) * | 1995-05-30 | 1999-12-28 | American Cyanamid Company | Herbicidal 2-(hetero)aryloxy-6-arylpyridines and 2-aryl-4-(hetero) aryloxypyrimidines |
| US5807804A (en) * | 1996-02-22 | 1998-09-15 | American Cyanamid Company | Substituted pyridine herbicidal agents |
| US5677303A (en) * | 1996-06-20 | 1997-10-14 | American Cyanamid Company | Enolethers and their use as a fungicide |
| US5747423A (en) * | 1996-07-15 | 1998-05-05 | American Cyanamid Company | Herbicidal 6-thienyl and 4-thienyl pyrimidines |
| US5981437A (en) * | 1996-07-30 | 1999-11-09 | American Cyanamid Company | Herbicidal substituted pyridine compounds |
| AU3816997A (en) * | 1996-07-30 | 1998-02-20 | American Cyanamid Company | Herbicidal substituted pyridine compounds |
| US5922738A (en) * | 1996-07-30 | 1999-07-13 | American Cyanamid Company | Heteroarylpyridine herbicides |
| AU734339B2 (en) * | 1996-07-30 | 2001-06-14 | American Cyanamid Company | Trisubstituted pyridine compounds for herbicidal use |
| US5977026A (en) * | 1996-07-30 | 1999-11-02 | American Cyanamid | Herbicidal mixtures |
| FR2753450B1 (fr) * | 1996-09-19 | 1999-01-15 | American Cyanamid Co | Heteroaryloxypyridines herbicides |
| AU725548B2 (en) * | 1997-03-11 | 2000-10-12 | E.I. Du Pont De Nemours And Company | Heteroaryl azole herbicides |
| US6110645A (en) * | 1997-03-13 | 2000-08-29 | Kodak Polychrome Graphics Llc | Method of imaging lithographic printing plates with high intensity laser |
| US6121202A (en) * | 1997-11-07 | 2000-09-19 | American Cyanamid Company | Thienyloxypyridines and-pyrimidines useful as herbicidal agents |
| EP1028959B1 (en) * | 1997-11-07 | 2007-06-27 | Basf Aktiengesellschaft | Herbicidal furanyl- and thienyloxyazines |
| US5851952A (en) * | 1997-11-07 | 1998-12-22 | American Cyanamid Company | Herbicidal thienyloxyazines |
| CA2459360A1 (en) * | 2001-09-07 | 2003-03-20 | Basf Aktiengesellschaft | 4-alkyl-substitute thienyloxy-pyridines |
| JP6957084B2 (ja) * | 2016-12-05 | 2021-11-02 | 株式会社日本触媒 | 縮合多環式化合物の製造方法 |
| KR102705300B1 (ko) | 2020-09-30 | 2024-09-11 | 다이킨 고교 가부시키가이샤 | 밀봉 부재 및 축전체 |
| WO2022181843A1 (ja) | 2021-02-26 | 2022-09-01 | ダイキン工業株式会社 | 含フッ素共重合体 |
| EP4506383A1 (en) | 2022-03-30 | 2025-02-12 | Daikin Industries, Ltd. | Fluorine-containing copolymer |
| EP4506386A1 (en) | 2022-03-30 | 2025-02-12 | Daikin Industries, Ltd. | Fluorine-containing copolymer |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1527714A (fr) * | 1966-07-01 | 1968-06-07 | Inst Francais Du Petrole | Polyéthers dérivés de la pyridine |
| US3535328A (en) * | 1967-09-01 | 1970-10-20 | Exxon Research Engineering Co | Certain substituted aminothioethoxy pyridines |
| US3687959A (en) * | 1970-05-28 | 1972-08-29 | Exxon Research Engineering Co | Alkaryl-alkoxy, aryl-amido derivatives of pyridine |
| JPS54163582A (en) * | 1978-06-09 | 1979-12-26 | Ishihara Mining & Chemical Co | 22phenoxyy55 trifluoromethypiridine compound |
| DE3062601D1 (en) * | 1979-06-20 | 1983-05-11 | Ici Plc | Pyridine derivatives, processes for preparing them, herbicidal compositions containing them and methods of killing plants therewith |
| US4371537A (en) * | 1981-08-13 | 1983-02-01 | The Dow Chemical Company | Sulfur-substituted phenoxypyridines having antiviral activity |
| JPS5931761A (ja) * | 1982-08-13 | 1984-02-20 | Ishihara Sangyo Kaisha Ltd | フエノキシピリジン系化合物及びそれらを含有する除草剤 |
| JPS5931758A (ja) * | 1982-08-17 | 1984-02-20 | Kanesho Kk | 選択性除草剤 |
| US4493730A (en) * | 1982-09-10 | 1985-01-15 | Ishihara Sangyo Kaisha, Ltd. | Phenoxypyridine useful as a herbicide |
| EP0180188B1 (en) * | 1984-10-30 | 1992-04-15 | Otsuka Pharmaceutical Co., Ltd. | A composition for increasing the anti-cancer activity of an anti-cancer compound |
| US4849011A (en) * | 1986-09-16 | 1989-07-18 | Sumitomo Chemical Company, Ltd. | 4-substituted-2,6-diphenylpyridine compounds and herbicide containing the same as an active ingredient |
| JP2531952B2 (ja) * | 1987-04-06 | 1996-09-04 | 大塚製薬株式会社 | フオスホリラ−ゼ阻害剤 |
| US4830846A (en) * | 1988-01-29 | 1989-05-16 | The Dow Chemical Company | Separation process for anhydrous HCl and HBr by thermal cleavage |
| US5322845A (en) * | 1991-10-02 | 1994-06-21 | Sumitomo Chemical Company, Limited | Acrylic acid derivatives, a fungicide containing them as an active ingredient, and intermediate compounds thereof |
-
1993
- 1993-05-24 TW TW082104085A patent/TW231258B/zh active
- 1993-05-26 DK DK93201519T patent/DK0572093T3/da active
- 1993-05-26 BR BR9302077A patent/BR9302077A/pt not_active IP Right Cessation
- 1993-05-26 AT AT93201519T patent/ATE178894T1/de active
- 1993-05-26 DE DE69324403T patent/DE69324403T2/de not_active Expired - Fee Related
- 1993-05-26 EP EP93201519A patent/EP0572093B1/en not_active Expired - Lifetime
- 1993-05-26 US US08/067,655 patent/US5374604A/en not_active Expired - Lifetime
- 1993-05-26 SG SG1996002885A patent/SG50501A1/en unknown
- 1993-05-26 KR KR1019930009182A patent/KR930022947A/ko not_active Ceased
- 1993-05-26 ES ES93201519T patent/ES2132172T3/es not_active Expired - Lifetime
- 1993-05-27 CN CN93106025A patent/CN1039183C/zh not_active Expired - Fee Related
- 1993-05-27 JP JP5146765A patent/JPH0640813A/ja active Pending
-
1999
- 1999-04-16 GR GR990400391T patent/GR3029959T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR3029959T3 (en) | 1999-07-30 |
| ATE178894T1 (de) | 1999-04-15 |
| KR930022947A (ko) | 1993-12-18 |
| US5374604A (en) | 1994-12-20 |
| CN1079220A (zh) | 1993-12-08 |
| BR9302077A (pt) | 1993-11-30 |
| JPH0640813A (ja) | 1994-02-15 |
| EP0572093A1 (en) | 1993-12-01 |
| TW231258B (enExample) | 1994-10-01 |
| DE69324403D1 (de) | 1999-05-20 |
| ES2132172T3 (es) | 1999-08-16 |
| SG50501A1 (en) | 1998-07-20 |
| EP0572093B1 (en) | 1999-04-14 |
| CN1039183C (zh) | 1998-07-22 |
| DK0572093T3 (da) | 1999-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69324403T2 (de) | Herbizide 2,6-substituierte Pyridine | |
| DE69128804T2 (de) | Herbizide Carboxamidderivate | |
| DE69407770T2 (de) | Herbizide heterozyklisch-substituierte pyridine | |
| DE69132989T2 (de) | Herbizide Carboxamidderivate | |
| DE2822304C3 (de) | Substituierte Cyclohexan-13-dion-Derivate, Herstellungsverfahren und herbizides Mittel | |
| DE68916459T2 (de) | Triazin-Herbizide. | |
| DE69932628T2 (de) | Herbizide | |
| EP0353187A2 (de) | Neue Herbizide | |
| BG61516B2 (bg) | Пропинилов естер на 2-/4-(5-хлоро-3-флуоропиридин-2-илокси) фенокси/-пропионовата киселина и приложението й | |
| DE2531643A1 (de) | Herbizide verbindungen, unkrautvertilgungsmittel, worin diese enthalten sind, und verfahren zu ihrer anwendung | |
| DE69211015T2 (de) | Herbizide acylierte amino-(phenyl-oder-pyridinyl-oder thienyl-)phenyl derivate | |
| DE3877802T2 (de) | Phenoxypropionsaeure-derivate, anwendbar als herbizide. | |
| DE2911865A1 (de) | N-halogenacetyl-phenylamino-carbonyl- oxime und ihre verwendung zur unkrautbekaempfung und zur regulierung oder verzoegerung des pflanzenwachstums | |
| EP0066195B1 (de) | Cyclohexan-1,3-dionderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| DD272069A5 (de) | Herstellung von (r)-2-[4-(5-chlor-3-flourpyridin-2-yloxy)-phenoxyl]-propionsaeurepropinylester mit herbizider wirkung | |
| DE69104425T2 (de) | Herbizide Verbindungen. | |
| DE69018404T2 (de) | Herbizide Acrylonitrilderivate. | |
| DE3688110T2 (de) | Pyridinderivate und herbizide Zusammensetzung. | |
| DE2611695A1 (de) | Herbizide mittel | |
| DE69504599T2 (de) | 2-Phenoxy-6-thienylmethyloxy pyridin-Derivate, Verfahren zu deren Herstellung und diese enthaltende Herbizide Zubereitungen | |
| DE69500950T2 (de) | 2-(Unsubstituierte oder substituierte)(Benzyloxy oder Phenoxy)-4-substituierte-6-(meta-substituierte Phenoxy)Pyridin, Verfahren zur Herstellung und herbizide Zusammensetzungen | |
| DE69014756T2 (de) | Herbizide Sulfonamide. | |
| DE69406483T2 (de) | Oximetherverbindungen, Verfahren zur Herstellung derselben und Fungizide, die sie enthalten | |
| DE68922145T2 (de) | Herbizide Acrylonitrilderivate. | |
| DE69013427T2 (de) | Glyoxyl-Cyclohexendione. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |