DE3604827A1 - Elektrophotographische toner - Google Patents
Elektrophotographische tonerInfo
- Publication number
- DE3604827A1 DE3604827A1 DE19863604827 DE3604827A DE3604827A1 DE 3604827 A1 DE3604827 A1 DE 3604827A1 DE 19863604827 DE19863604827 DE 19863604827 DE 3604827 A DE3604827 A DE 3604827A DE 3604827 A1 DE3604827 A1 DE 3604827A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- single bond
- ethyl
- alkylene
- represents methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 carbamoylmethyl Chemical group 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 19
- 150000001450 anions Chemical class 0.000 claims description 11
- 239000000654 additive Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000002245 particle Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 229920005989 resin Polymers 0.000 claims description 6
- 239000011347 resin Substances 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000002091 cationic group Chemical group 0.000 claims description 5
- 230000000996 additive effect Effects 0.000 claims description 4
- 150000008052 alkyl sulfonates Chemical class 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 229940077388 benzenesulfonate Drugs 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 230000002708 enhancing effect Effects 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 150000003949 imides Chemical class 0.000 claims 1
- 239000000126 substance Substances 0.000 description 13
- 239000004793 Polystyrene Substances 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 229920005992 thermoplastic resin Polymers 0.000 description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- ZLXYCAQGOXUPPI-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)NCCCN(C)C)=CC=CC2=C1 ZLXYCAQGOXUPPI-UHFFFAOYSA-N 0.000 description 3
- 108091008695 photoreceptors Proteins 0.000 description 3
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- AQXYVFBSOOBBQV-UHFFFAOYSA-N 1-amino-4-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2N AQXYVFBSOOBBQV-UHFFFAOYSA-N 0.000 description 1
- FKNIDKXOANSRCS-UHFFFAOYSA-N 2,3,4-trinitrofluoren-1-one Chemical compound C1=CC=C2C3=C([N+](=O)[O-])C([N+]([O-])=O)=C([N+]([O-])=O)C(=O)C3=CC2=C1 FKNIDKXOANSRCS-UHFFFAOYSA-N 0.000 description 1
- FBNAYEYTRHHEOB-UHFFFAOYSA-N 2,3,5-triphenyl-1,3-dihydropyrazole Chemical compound N1N(C=2C=CC=CC=2)C(C=2C=CC=CC=2)C=C1C1=CC=CC=C1 FBNAYEYTRHHEOB-UHFFFAOYSA-N 0.000 description 1
- QAHMKHHCOXNIHO-UHFFFAOYSA-N 2,4-diphenylquinazoline Chemical compound C1=CC=CC=C1C1=NC(C=2C=CC=CC=2)=C(C=CC=C2)C2=N1 QAHMKHHCOXNIHO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- USZXSOMZYDRNPS-UHFFFAOYSA-N 2-benzylidenecarbazol-1-amine Chemical compound NC1=C2N=C3C=CC=CC3=C2C=CC1=CC1=CC=CC=C1 USZXSOMZYDRNPS-UHFFFAOYSA-N 0.000 description 1
- LPMANECYGPQBOX-UHFFFAOYSA-N 2-chloro-n-(2-methylphenyl)acetamide Chemical compound CC1=CC=CC=C1NC(=O)CCl LPMANECYGPQBOX-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- WYCOJIVDCGJKDB-UHFFFAOYSA-N 3,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1C WYCOJIVDCGJKDB-UHFFFAOYSA-N 0.000 description 1
- NLWWHMRHFRTAII-UHFFFAOYSA-N 4-(1,3-benzoxazol-2-yl)-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C1=NC2=CC=CC=C2O1 NLWWHMRHFRTAII-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WUMNREMXKHAYJQ-UHFFFAOYSA-N 5-methyl-2,3-diphenyl-1,3-dihydropyrazole Chemical compound N1C(C)=CC(C=2C=CC=CC=2)N1C1=CC=CC=C1 WUMNREMXKHAYJQ-UHFFFAOYSA-N 0.000 description 1
- XCKGFJPFEHHHQA-UHFFFAOYSA-N 5-methyl-2-phenyl-4-phenyldiazenyl-4h-pyrazol-3-one Chemical compound CC1=NN(C=2C=CC=CC=2)C(=O)C1N=NC1=CC=CC=C1 XCKGFJPFEHHHQA-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920002449 FKM Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004425 Makrolon Substances 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000001825 Polyoxyethene (8) stearate Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- WBFMCDAQUDITAS-UHFFFAOYSA-N arsenic triselenide Chemical compound [Se]=[As][Se][As]=[Se] WBFMCDAQUDITAS-UHFFFAOYSA-N 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical class C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 229920006026 co-polymeric resin Polymers 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- MOUPNEIJQCETIW-UHFFFAOYSA-N lead chromate Chemical compound [Pb+2].[O-][Cr]([O-])(=O)=O MOUPNEIJQCETIW-UHFFFAOYSA-N 0.000 description 1
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- XLGSXVUJWBCURQ-UHFFFAOYSA-N n-(4-bromophenyl)-1-(2-nitrophenyl)methanimine Chemical compound [O-][N+](=O)C1=CC=CC=C1C=NC1=CC=C(Br)C=C1 XLGSXVUJWBCURQ-UHFFFAOYSA-N 0.000 description 1
- DWXAPYADWDBIII-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methylideneamino]benzamide Chemical compound C1=CC(N(C)C)=CC=C1C=NNC(=O)C1=CC=CC=C1 DWXAPYADWDBIII-UHFFFAOYSA-N 0.000 description 1
- VKWNTWQXVLKCSG-UHFFFAOYSA-N n-ethyl-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine Chemical compound CCNC1=CC=C2C=CC=CC2=C1N=NC(C=C1)=CC=C1N=NC1=CC=CC=C1 VKWNTWQXVLKCSG-UHFFFAOYSA-N 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- GJVFBWCTGUSGDD-UHFFFAOYSA-L pentamethonium bromide Chemical compound [Br-].[Br-].C[N+](C)(C)CCCCC[N+](C)(C)C GJVFBWCTGUSGDD-UHFFFAOYSA-L 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- XOSXWYQMOYSSKB-LDKJGXKFSA-L water blue Chemical compound CC1=CC(/C(\C(C=C2)=CC=C2NC(C=C2)=CC=C2S([O-])(=O)=O)=C(\C=C2)/C=C/C\2=N\C(C=C2)=CC=C2S([O-])(=O)=O)=CC(S(O)(=O)=O)=C1N.[Na+].[Na+] XOSXWYQMOYSSKB-LDKJGXKFSA-L 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/097—Plasticisers; Charge controlling agents
- G03G9/09733—Organic compounds
- G03G9/09741—Organic compounds cationic
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
- Indole Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863604827 DE3604827A1 (de) | 1986-02-15 | 1986-02-15 | Elektrophotographische toner |
| US07/010,364 US4812379A (en) | 1986-02-15 | 1987-02-03 | Electrophotographic toners containing an additive reinforcing the cationic charge |
| DE87101463T DE3787297D1 (de) | 1986-02-15 | 1987-02-03 | Elektrophotographische Toner. |
| EP87101463A EP0233544B1 (de) | 1986-02-15 | 1987-02-03 | Elektrophotographische Toner |
| JP62030718A JPS62192755A (ja) | 1986-02-15 | 1987-02-14 | 電子写真用トナ− |
| US07/225,329 US4841052A (en) | 1986-02-15 | 1988-07-28 | Naphthalic acid imides electrophotographic toners |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863604827 DE3604827A1 (de) | 1986-02-15 | 1986-02-15 | Elektrophotographische toner |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3604827A1 true DE3604827A1 (de) | 1987-08-20 |
Family
ID=6294171
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863604827 Withdrawn DE3604827A1 (de) | 1986-02-15 | 1986-02-15 | Elektrophotographische toner |
| DE87101463T Expired - Fee Related DE3787297D1 (de) | 1986-02-15 | 1987-02-03 | Elektrophotographische Toner. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE87101463T Expired - Fee Related DE3787297D1 (de) | 1986-02-15 | 1987-02-03 | Elektrophotographische Toner. |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US4812379A (OSRAM) |
| EP (1) | EP0233544B1 (OSRAM) |
| JP (1) | JPS62192755A (OSRAM) |
| DE (2) | DE3604827A1 (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3738948A1 (de) * | 1987-11-17 | 1989-05-24 | Bayer Ag | Farblose salze von heteropolysaeuren und kationischen aromatischen imiden als ladungskontrollsubstanzen in tonern |
| JPH0814721B2 (ja) * | 1988-02-09 | 1996-02-14 | 株式会社巴川製紙所 | 正帯電性カラートナー |
| DE3828193A1 (de) * | 1988-08-19 | 1990-02-22 | Bayer Ag | Elektrophotographische toner |
| DE68915431T2 (de) * | 1989-03-24 | 1994-11-17 | Agfa Gevaert Nv | Teilchenförmiges Tonermaterial. |
| US5086059A (en) * | 1990-06-07 | 1992-02-04 | Du Pont Merck Pharmaceutical Company | Bis-naphthalimides as anticancer agents |
| DE4106122A1 (de) * | 1991-02-27 | 1992-09-03 | Bayer Ag | Neue naphthalimide, diese enthaltende toner und die verwendung der neuen naphthalimide als additive fuer toner |
| US5206250A (en) * | 1991-03-27 | 1993-04-27 | Du Pont Merck Pharmaceutical Company | Bis-naphthalimides containing amide and thioamide linkers as anticancer agents |
| US5329048A (en) * | 1991-03-27 | 1994-07-12 | The Dupont Merck Pharmaceutical Company | Process of preparing tetraamino intermediates |
| US5162188A (en) * | 1991-07-18 | 1992-11-10 | Eastman Kodak Company | Toners and developers containing amide-containing quaternary ammonium salts as charge control agents |
| AU3241593A (en) * | 1991-12-11 | 1993-07-19 | Du Pont Merck Pharmaceutical Company, The | Highly water soluble bis-naphthalimides useful as anticancer agents |
| US5376664A (en) * | 1992-07-27 | 1994-12-27 | The Du Pont Merck Pharmaceutical Company | Unsymmetrical mono-3-nitro bis-naphthalimides as anticancer agents |
| DE4232739A1 (de) * | 1992-09-30 | 1994-03-31 | Knoll Ag | Neue asymmetrisch substituierte bis-Naphthalimide |
| DE4237661A1 (de) * | 1992-11-07 | 1994-05-11 | Basf Ag | Elektrostatische Toner, enthaltend amphiphile Flüssigkristalle |
| US5359070A (en) * | 1993-02-11 | 1994-10-25 | The Du Pont Merck Pharmaceutical Company | Unsymmetrical bis-imides as anticancer agents |
| US5416089A (en) * | 1993-06-24 | 1995-05-16 | The Du Pont Merck Pharmaceutical Company | Polycyclic and heterocyclic chromophores for bis-imide tumoricidals |
| US5358817A (en) * | 1993-08-31 | 1994-10-25 | Eastman Kodak Company | Toner compositions containing as a negative charge-controlling agent the calcium salt of ortho-benzoic sulfimide |
| US5358814A (en) * | 1993-08-31 | 1994-10-25 | Eastman Kodak Company | Toner compositions containing as a negative charge-controlling agent a mixture of ortho-benzoic sulfimide and para-anisic acid |
| US5358818A (en) * | 1993-08-31 | 1994-10-25 | Eastman Kodak Company | Ortho-benzoic sulfimide as charge-controlling agent |
| US5358815A (en) * | 1993-08-31 | 1994-10-25 | Eastman Kodak Company | Toner compositions containing negative charge-controlling additive |
| US5332637A (en) * | 1993-08-31 | 1994-07-26 | Eastman Kodak Company | Electrostatographic dry toner and developer compositions with hydroxyphthalimide |
| US5358816A (en) * | 1993-08-31 | 1994-10-25 | Eastman Kodak Company | Zinc salt of ortho-benzoic sulfimide as negative charge-controlling additive for toner and developer compositions |
| US5561042A (en) * | 1994-07-22 | 1996-10-01 | Cancer Therapy And Research Center | Diamine platinum naphthalimide complexes as antitumor agents |
| US5604095A (en) * | 1994-07-22 | 1997-02-18 | Cancer Therapy & Research Center | Unsymmetrically linked bisnaphthalimides as antitumor agents |
| US5641782A (en) * | 1995-02-16 | 1997-06-24 | The Dupont Merck Pharmaceutical Company | 3-aromatic and 3-heteroaromatic substituted bisnaphthalimides |
| EP3338756B1 (de) | 2016-12-21 | 2020-02-26 | VOCO GmbH | Lagerstabiler kunststoffmodifizierter glasionomerzement |
| CN117247353A (zh) * | 2023-08-11 | 2023-12-19 | 浙江传化华洋化工有限公司 | 荧光淬灭剂及其制备方法和应用 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3880859A (en) * | 1971-06-03 | 1975-04-29 | Basf Ag | N-substituted-4-alkoxynaphthalimides |
| CH560235A5 (OSRAM) * | 1972-02-18 | 1975-03-27 | Ciba Geigy Ag | |
| US3953451A (en) * | 1972-06-28 | 1976-04-27 | Basf Aktiengesellschaft | Compounds of the naphthalimide series |
| US3940398A (en) * | 1975-01-23 | 1976-02-24 | E. R. Squibb & Sons, Inc. | 2-[[4-(Azine or diazine or triazine)-1-piperazinyl]alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones |
| US4007191A (en) * | 1975-10-14 | 1977-02-08 | E. R. Squibb & Sons, Inc. | 2-(Piperidinyl or tetrahydropyridinyl)-alkyl)-2,3-dihydro-3-hydroxy-1H-benz(DE)isoquinolin-1-ones |
| US4139532A (en) * | 1976-05-14 | 1979-02-13 | Basf Aktiengesellschaft | N-Acylaminonaphthalimides |
| ES459497A1 (es) * | 1977-06-04 | 1978-04-16 | Made Labor Sa | Un metodo para la preparacion industrial de naftalimidas y sus derivados. |
| DE2753152A1 (de) * | 1977-11-29 | 1979-06-07 | Basf Ag | Naphthalimidderivate |
| DE2944867A1 (de) * | 1979-11-07 | 1981-05-27 | Hoechst Ag, 6000 Frankfurt | Kationische verbindungen der naphthalimid-reihe, verfahren zu deren herstellung und deren verwendung |
| US4508900A (en) * | 1980-11-03 | 1985-04-02 | Hoechst Aktiengesellschaft | Cationic compounds of the naphthalimide series, process for their preparation and their use |
| JPS59114546A (ja) * | 1982-12-22 | 1984-07-02 | Nippon Kayaku Co Ltd | 電子写真印刷用トナ− |
| US4614820A (en) * | 1983-04-01 | 1986-09-30 | Warner-Lambert Co. | 3,6-disubstituted-1,8-naphthalimides |
| US4499266A (en) * | 1983-04-01 | 1985-02-12 | Warner-Lambert Company | 3,6-Dinitro-1,8-naphthalimides |
| DE3413833A1 (de) * | 1983-04-12 | 1984-10-18 | Canon K.K., Tokio/Tokyo | Entwicklungsverfahren und entwickler dafuer |
| JPH0625874B2 (ja) * | 1983-04-23 | 1994-04-06 | キヤノン株式会社 | 静電荷像現像用摩擦帯電性トナー |
| US4665071A (en) * | 1984-02-21 | 1987-05-12 | Warner-Lambert Company | 3,6-disubstituted-1,8-naphthalimides and methods for their production and use |
| US4493883A (en) * | 1984-02-21 | 1985-01-15 | Xerox Corporation | Electrophotographic toner compositions containing novel imide charge control _additives |
| DE3535496A1 (de) * | 1985-10-04 | 1987-04-16 | Bayer Ag | Verfahren zur fluoreszenzloeschung und neue kationische naphthalin-peri-dicarbonsaeureimid-derivate |
| US4686166A (en) * | 1985-10-07 | 1987-08-11 | Hitachi Chemical Co. | Electrophoto toner comprising imido group monomer unit in polymer |
| US4782064A (en) * | 1986-07-21 | 1988-11-01 | American Cyanamid Co. | 2-heteroaryl-alkyl-1H-benz[de]-isoquinoline-1,3(2H)-diones |
-
1986
- 1986-02-15 DE DE19863604827 patent/DE3604827A1/de not_active Withdrawn
-
1987
- 1987-02-03 US US07/010,364 patent/US4812379A/en not_active Expired - Fee Related
- 1987-02-03 EP EP87101463A patent/EP0233544B1/de not_active Expired - Lifetime
- 1987-02-03 DE DE87101463T patent/DE3787297D1/de not_active Expired - Fee Related
- 1987-02-14 JP JP62030718A patent/JPS62192755A/ja active Granted
-
1988
- 1988-07-28 US US07/225,329 patent/US4841052A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4812379A (en) | 1989-03-14 |
| DE3787297D1 (de) | 1993-10-14 |
| JPS62192755A (ja) | 1987-08-24 |
| US4841052A (en) | 1989-06-20 |
| EP0233544B1 (de) | 1993-09-08 |
| EP0233544A2 (de) | 1987-08-26 |
| JPH0431584B2 (OSRAM) | 1992-05-26 |
| EP0233544A3 (en) | 1990-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0233544B1 (de) | Elektrophotographische Toner | |
| DE3218758C2 (OSRAM) | ||
| DE3750969T2 (de) | Photoleitfähige Phthalocyaninpigmente, sie enthaltende elektrophotographische Elemente und Verfahren zu deren Verwendung. | |
| GB2084605A (en) | Phthalocyanine pigments | |
| DE69119106T2 (de) | Dicyanoimidazolderivat, Magentatoner, gefärbtes Harz, geformtes Element aus gefärbtem Harz und dieses Element umfassender Farbfilter | |
| DE3788024T2 (de) | Toner für elektrophotographische Verfahren, die eine Phenolverbindung enthalten. | |
| DE3148069A1 (de) | Toner zum entwickeln elektrostatischer bilder | |
| DE69828267T2 (de) | Zirkoniumverbindung und diese enthaltender elektrophotographischer toner | |
| DE69405750T2 (de) | Farbtoner | |
| EP0355006B1 (de) | Elektrophotographischer Toner | |
| DE69521662T2 (de) | Calixarene als Ladungsstabilisatoren und Toner | |
| DE3716982A1 (de) | Fotoempfindliches element | |
| DE68915431T2 (de) | Teilchenförmiges Tonermaterial. | |
| EP0656131B1 (de) | Elektrostatische toner, enthaltend einen metallkomplexfarbstoff als ladungsstabilisator | |
| DE2627130A1 (de) | Random-copolymere sowie ein dieses copolymere enthaltendes elektrophotographisches abbildungselement | |
| DE3887565T2 (de) | Farbstoffe, geeignet für die Sensibilisierung photoleitfähiger Systeme. | |
| EP0371360B1 (de) | Elektrophotographische Toner | |
| DE3738948A1 (de) | Farblose salze von heteropolysaeuren und kationischen aromatischen imiden als ladungskontrollsubstanzen in tonern | |
| CH675165A5 (OSRAM) | ||
| DE69309542T2 (de) | Phthalocyanine enthaltendes elektrophotographisches Aufreichenungsmaterial | |
| DE68916107T2 (de) | Positiv aufladbarer Toner. | |
| CH637668A5 (de) | Anthrachinocycloalkan- und dianthrachinoethen-farbstoffe sowie ein diese farbstoffe enthaltendes organisches, polymeres lichtleitendes bindemittel. | |
| DE68919071T2 (de) | Für elektrophotographische Zwecke geeignetes Aufzeichnungsmaterial. | |
| DE69403977T2 (de) | Elektrostatischer bildentwickelnder Toner | |
| EP0680627B1 (de) | Elektrostatische toner, enthaltend aminodiessigsäurederivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |