DE3600712A1 - 5-halopyridin-3-carboxamidverbindungen - Google Patents
5-halopyridin-3-carboxamidverbindungenInfo
- Publication number
- DE3600712A1 DE3600712A1 DE19863600712 DE3600712A DE3600712A1 DE 3600712 A1 DE3600712 A1 DE 3600712A1 DE 19863600712 DE19863600712 DE 19863600712 DE 3600712 A DE3600712 A DE 3600712A DE 3600712 A1 DE3600712 A1 DE 3600712A1
- Authority
- DE
- Germany
- Prior art keywords
- oxo
- dihydro
- group
- pyridinecarboxamide
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- -1 2,6-diisopropylphenyl group Chemical group 0.000 claims description 164
- 150000001875 compounds Chemical class 0.000 claims description 33
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- HGVKLUDNUHJXPB-UHFFFAOYSA-N 2-benzylpyridine-3-carboxamide Chemical compound NC(=O)C1=CC=CN=C1CC1=CC=CC=C1 HGVKLUDNUHJXPB-UHFFFAOYSA-N 0.000 claims 1
- MQAHIBAADVMNRW-UHFFFAOYSA-N 5-bromo-1-butyl-n-(2,6-diethylphenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCCCN1C(C)=C(Br)C(=O)C(C(=O)NC=2C(=CC=CC=2CC)CC)=C1C MQAHIBAADVMNRW-UHFFFAOYSA-N 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 229960003966 nicotinamide Drugs 0.000 description 65
- 239000011570 nicotinamide Substances 0.000 description 65
- 238000000034 method Methods 0.000 description 20
- 125000001309 chloro group Chemical group Cl* 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 229910014265 BrCl Inorganic materials 0.000 description 5
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 5
- 150000003857 carboxamides Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 101150052863 THY1 gene Proteins 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000009036 growth inhibition Effects 0.000 description 4
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- PPPQBQDLGITEME-UHFFFAOYSA-N 2,5-dimethyl-4-oxo-3H-pyridine-3-carboxamide Chemical compound CC=1C(C(C(=NC=1)C)C(=O)N)=O PPPQBQDLGITEME-UHFFFAOYSA-N 0.000 description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 3
- VWDDLCDCDCQFOW-UHFFFAOYSA-N 4-oxo-1-(2-phenylethyl)pyridine-3-carboxamide Chemical compound O=C1C(=CN(C=C1)CCC1=CC=CC=C1)C(=O)N VWDDLCDCDCQFOW-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 240000007594 Oryza sativa Species 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000026030 halogenation Effects 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- IMWLUDRPZDQMCD-UHFFFAOYSA-N 1-benzyl-4-oxopyridine-3-carboxamide Chemical compound O=C1C(=CN(C=C1)CC1=CC=CC=C1)C(=O)N IMWLUDRPZDQMCD-UHFFFAOYSA-N 0.000 description 2
- IFWDWIZVKITCEB-UHFFFAOYSA-N 2,6-dimethyl-4-oxo-1h-pyridine-3-carboxamide Chemical compound CC1=CC(=O)C(C(N)=O)=C(C)N1 IFWDWIZVKITCEB-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- QNFKZTNRNNPTDS-UHFFFAOYSA-N 2-methyl-4-oxo-3h-pyridine-3-carboxamide Chemical compound CC1=NC=CC(=O)C1C(N)=O QNFKZTNRNNPTDS-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MXYGKRPIPBUXKG-UHFFFAOYSA-N N-(2,6-dimethylphenyl)-4-oxo-3H-pyridine-3-carboxamide Chemical compound CC1=C(C(=CC=C1)C)NC(=O)C1C=NC=CC1=O MXYGKRPIPBUXKG-UHFFFAOYSA-N 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 235000019057 Raphanus caudatus Nutrition 0.000 description 2
- 244000088415 Raphanus sativus Species 0.000 description 2
- 235000011380 Raphanus sativus Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- AYKHJJCJCUMZEP-UHFFFAOYSA-N 1-(2-methylpropyl)-4-oxopyridine-3-carboxamide Chemical compound CC(CN1C=C(C(C=C1)=O)C(=O)N)C AYKHJJCJCUMZEP-UHFFFAOYSA-N 0.000 description 1
- QCHVBMYVHVSEJH-UHFFFAOYSA-N 1-[bis(2-hydroxyethyl)amino]-3-(3,6-dibromocarbazol-9-yl)propan-2-ol Chemical compound BrC1=CC=C2N(CC(O)CN(CCO)CCO)C3=CC=C(Br)C=C3C2=C1 QCHVBMYVHVSEJH-UHFFFAOYSA-N 0.000 description 1
- PBTRKYYVNAUPNH-UHFFFAOYSA-N 1-benzyl-n-[2,6-di(propan-2-yl)phenyl]-5-fluoro-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CC(C)C1=CC=CC(C(C)C)=C1NC(=O)C(C(C(F)=C1C)=O)=C(C)N1CC1=CC=CC=C1 PBTRKYYVNAUPNH-UHFFFAOYSA-N 0.000 description 1
- CACLZWFGTBWKNY-UHFFFAOYSA-N 1-butyl-n-(2,6-diethylphenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCCCN1C(C)=CC(=O)C(C(=O)NC=2C(=CC=CC=2CC)CC)=C1C CACLZWFGTBWKNY-UHFFFAOYSA-N 0.000 description 1
- WTYGYIFVSDJJRX-UHFFFAOYSA-N 1-butyl-n-[2,6-di(propan-2-yl)phenyl]-5-fluoro-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCCCN1C(C)=C(F)C(=O)C(C(=O)NC=2C(=CC=CC=2C(C)C)C(C)C)=C1C WTYGYIFVSDJJRX-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 1
- HQVQCGYZMMXEAY-UHFFFAOYSA-N 2,6-dimethyl-4-oxo-3h-pyridine-3-carboxamide Chemical compound CC1=CC(=O)C(C(N)=O)C(C)=N1 HQVQCGYZMMXEAY-UHFFFAOYSA-N 0.000 description 1
- YIPUXCQCTQXDRG-UHFFFAOYSA-N 2-(3-methylbutyl)-4-oxo-3H-pyridine-3-carboxamide Chemical compound CC(CCC1=NC=CC(C1C(=O)N)=O)C YIPUXCQCTQXDRG-UHFFFAOYSA-N 0.000 description 1
- WMJOGWFFVGKWCF-UHFFFAOYSA-N 2-[(4-methylphenyl)methyl]-4-oxo-3H-pyridine-3-carboxamide Chemical compound CC1=CC=C(C=C1)CC1=NC=CC(C1C(=O)N)=O WMJOGWFFVGKWCF-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- HXQGJIWQHSTIHG-UHFFFAOYSA-N 3,7-bis(2-bromobenzoyl)-1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one Chemical compound C1C(C)(C2=O)CN(C(=O)C=3C(=CC=CC=3)Br)CC2(C)CN1C(=O)C1=CC=CC=C1Br HXQGJIWQHSTIHG-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- MZEKBGHCRMAIJI-UHFFFAOYSA-N 4-oxo-1-pentylpyridine-3-carboxamide Chemical compound CCCCCN1C=CC(=O)C(C(N)=O)=C1 MZEKBGHCRMAIJI-UHFFFAOYSA-N 0.000 description 1
- UZHSINIHRLRKKS-UHFFFAOYSA-N 4-oxo-1-propylpyridine-3-carboxamide Chemical compound O=C1C(=CN(C=C1)CCC)C(=O)N UZHSINIHRLRKKS-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- GWEUROXTXQBWTP-UHFFFAOYSA-N 5-bromo-n-(2,6-diethylphenyl)-2,6-dimethyl-1-[(4-methylphenyl)methyl]-4-oxopyridine-3-carboxamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)C(C(C(Br)=C1C)=O)=C(C)N1CC1=CC=C(C)C=C1 GWEUROXTXQBWTP-UHFFFAOYSA-N 0.000 description 1
- LJJMTVRYTQAPAK-UHFFFAOYSA-N 5-bromo-n-(2,6-dimethylphenyl)-1,2,6-trimethyl-4-oxopyridine-3-carboxamide Chemical compound CC1=CC=CC(C)=C1NC(=O)C1=C(C)N(C)C(C)=C(Br)C1=O LJJMTVRYTQAPAK-UHFFFAOYSA-N 0.000 description 1
- VWHVKHKGANBMRT-UHFFFAOYSA-N 5-bromo-n-(2,6-dimethylphenyl)-1-(2-methoxyethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound COCCN1C(C)=C(Br)C(=O)C(C(=O)NC=2C(=CC=CC=2C)C)=C1C VWHVKHKGANBMRT-UHFFFAOYSA-N 0.000 description 1
- ORUIHQIOWAHQKC-UHFFFAOYSA-N 5-bromo-n-(4-bromo-2-methylphenyl)-1-butyl-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCCCN1C(C)=C(Br)C(=O)C(C(=O)NC=2C(=CC(Br)=CC=2)C)=C1C ORUIHQIOWAHQKC-UHFFFAOYSA-N 0.000 description 1
- PKNKUDWCQUBUJC-UHFFFAOYSA-N 5-bromo-n-[2,6-di(propan-2-yl)phenyl]-2,6-dimethyl-4-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carboxamide Chemical compound CC(C)OCCCN1C(C)=C(Br)C(=O)C(C(=O)NC=2C(=CC=CC=2C(C)C)C(C)C)=C1C PKNKUDWCQUBUJC-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- VZHWHWBFKOWUJR-UHFFFAOYSA-N 5-chloro-N-(2,6-diethylphenyl)-2,6-dimethyl-4-oxo-1H-pyridine-3-carboxamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)C1=C(C)NC(C)=C(Cl)C1=O VZHWHWBFKOWUJR-UHFFFAOYSA-N 0.000 description 1
- UHWCBRGXMKBKFA-UHFFFAOYSA-N 5-chloro-N-(2,6-dimethylphenyl)-2,6-dimethyl-4-oxo-1-pentylpyridine-3-carboxamide Chemical compound CCCCCN1C(C)=C(Cl)C(=O)C(C(=O)NC=2C(=CC=CC=2C)C)=C1C UHWCBRGXMKBKFA-UHFFFAOYSA-N 0.000 description 1
- HVAMFGWHWGAGPI-UHFFFAOYSA-N 5-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-(2-ethoxyethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCOCCN1C(C)=C(Cl)C(=O)C(C(=O)NC=2C(=CC=CC=2C(C)C)C(C)C)=C1C HVAMFGWHWGAGPI-UHFFFAOYSA-N 0.000 description 1
- BLCJGMMMJMAVRA-UHFFFAOYSA-N 5-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-(3-ethoxypropyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound CCOCCCN1C(C)=C(Cl)C(=O)C(C(=O)NC=2C(=CC=CC=2C(C)C)C(C)C)=C1C BLCJGMMMJMAVRA-UHFFFAOYSA-N 0.000 description 1
- DGSSTVURYUJVSX-UHFFFAOYSA-N 5-chloro-n-(2,6-diethylphenyl)-1,2,6-trimethyl-4-oxopyridine-3-carboxamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)C1=C(C)N(C)C(C)=C(Cl)C1=O DGSSTVURYUJVSX-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- JCCACXJDDDKPHF-UHFFFAOYSA-N CC=1C=C(C=CC=1)CC1=NC=CC(C1C(=O)N)=O Chemical compound CC=1C=C(C=CC=1)CC1=NC=CC(C1C(=O)N)=O JCCACXJDDDKPHF-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 240000005783 Lathyrus sativus Species 0.000 description 1
- DIFXLYQXHHWURY-UHFFFAOYSA-N N-(2,6-dimethylphenyl)-5-fluoro-2,6-dimethyl-4-oxo-1-(2-phenylethyl)pyridine-3-carboxamide Chemical compound CC1=CC=CC(C)=C1NC(=O)C(C(C(F)=C1C)=O)=C(C)N1CCC1=CC=CC=C1 DIFXLYQXHHWURY-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000009422 growth inhibiting effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- VQURKQXZEBLXHC-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-5-fluoro-1-(2-methoxyethyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide Chemical compound COCCN1C(C)=C(F)C(=O)C(C(=O)NC=2C(=CC=CC=2C)C)=C1C VQURKQXZEBLXHC-UHFFFAOYSA-N 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N nicotinic acid amide Natural products NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP60007279A JPS61165372A (ja) | 1985-01-17 | 1985-01-17 | 5−ハロピリジン−3−カルボキサミド化合物 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3600712A1 true DE3600712A1 (de) | 1986-07-17 |
Family
ID=11661586
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863600712 Ceased DE3600712A1 (de) | 1985-01-17 | 1986-01-13 | 5-halopyridin-3-carboxamidverbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4777256A (https=) |
| JP (1) | JPS61165372A (https=) |
| DE (1) | DE3600712A1 (https=) |
| FR (1) | FR2576020B1 (https=) |
| GB (1) | GB2169897B (https=) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3600712A1 (de) | 1985-01-17 | 1986-07-17 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 5-halopyridin-3-carboxamidverbindungen |
| DE3601121A1 (de) * | 1985-01-18 | 1986-08-21 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 4-substituierte-oxy-3-pyridincarboxamide |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4844732A (en) * | 1985-10-24 | 1989-07-04 | Daicel Chemical Industries Ltd. | Pyridine-3-carboxamide derivatives |
| GB2185018B (en) * | 1985-12-27 | 1989-11-29 | Daicel Chem | Pyridine-3-carboxamide derivatives and their use as plant growth regulates |
| DE3712369A1 (de) * | 1987-04-11 | 1988-10-27 | Bayer Ag | Substituierte 5-nitro-1,4-dihydropyridine, verfahren zur herstellung und ihre verwendung |
| DE3712371A1 (de) * | 1987-04-11 | 1988-10-27 | Bayer Ag | Substituierte 1,4-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung |
| US4978663A (en) * | 1989-08-16 | 1990-12-18 | Hoechst-Roussel Pharmaceuticals Inc. | 5-(1-aminocyclohexyl)-2(1H)-pyridinone compounds which have pharmaceutical utility |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US437218A (en) * | 1890-09-30 | Air-brake | ||
| DE2414623A1 (de) * | 1973-03-08 | 1975-10-16 | Sigma Tau Ind Farmaceuti | Amidderivate von nicotinsaeure |
| DE2611601A1 (de) * | 1976-03-19 | 1977-09-22 | Basf Ag | Nicotinsaeureanilide |
| DE2655144A1 (de) * | 1976-12-06 | 1978-06-08 | Basf Ag | Substituierte nicotinsaeureamide |
| US4251263A (en) * | 1979-09-04 | 1981-02-17 | Stauffer Chemical Company | N-substituted, 2-phenoxynicotinamide compounds and the herbicidal use thereof |
| DE3100535A1 (de) * | 1981-01-10 | 1982-08-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neue carbonsaeure-derivate, ihre herstellung und ihre verwendung als arzneimittel" |
| US4493729A (en) * | 1980-07-16 | 1985-01-15 | Rhone-Poulenc Agrochimie | N-Phenylcarbamoyl-pyridine compounds |
| DE3600712A1 (de) | 1985-01-17 | 1986-07-17 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 5-halopyridin-3-carboxamidverbindungen |
| DE3808444A1 (de) * | 1987-03-13 | 1988-09-22 | Roussel Uclaf | Neue derivate des pyridins, verfahren zu ihrer herstellung und die erhaltenen neuen zwischenprodukte, ihre anwendung als arzneimittel und die sie enthaltenden zusammensetzungen |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3576814A (en) * | 1970-01-30 | 1971-04-27 | Rohm & Haas | N-aryl pyrid-2-ones |
| US4051142A (en) * | 1976-05-24 | 1977-09-27 | Rohm And Haas Company | 1-Aryl-4-pyridones |
| US4115101A (en) * | 1976-05-24 | 1978-09-19 | Rohm And Haas Company | 1-Aryl-4-pyridones |
| CA1115278A (en) * | 1979-01-10 | 1981-12-29 | Uniroyal Ltd. | Anti-inflammatory 4-pyridones and their preparation |
-
1985
- 1985-01-17 JP JP60007279A patent/JPS61165372A/ja active Granted
-
1986
- 1986-01-06 US US06/816,380 patent/US4777256A/en not_active Expired - Fee Related
- 1986-01-13 DE DE19863600712 patent/DE3600712A1/de not_active Ceased
- 1986-01-14 FR FR868600428A patent/FR2576020B1/fr not_active Expired
- 1986-01-16 GB GB08601007A patent/GB2169897B/en not_active Expired
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US437218A (en) * | 1890-09-30 | Air-brake | ||
| DE2414623A1 (de) * | 1973-03-08 | 1975-10-16 | Sigma Tau Ind Farmaceuti | Amidderivate von nicotinsaeure |
| DE2611601A1 (de) * | 1976-03-19 | 1977-09-22 | Basf Ag | Nicotinsaeureanilide |
| DE2655144A1 (de) * | 1976-12-06 | 1978-06-08 | Basf Ag | Substituierte nicotinsaeureamide |
| US4251263A (en) * | 1979-09-04 | 1981-02-17 | Stauffer Chemical Company | N-substituted, 2-phenoxynicotinamide compounds and the herbicidal use thereof |
| US4493729A (en) * | 1980-07-16 | 1985-01-15 | Rhone-Poulenc Agrochimie | N-Phenylcarbamoyl-pyridine compounds |
| DE3100535A1 (de) * | 1981-01-10 | 1982-08-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neue carbonsaeure-derivate, ihre herstellung und ihre verwendung als arzneimittel" |
| DE3600712A1 (de) | 1985-01-17 | 1986-07-17 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 5-halopyridin-3-carboxamidverbindungen |
| DE3808444A1 (de) * | 1987-03-13 | 1988-09-22 | Roussel Uclaf | Neue derivate des pyridins, verfahren zu ihrer herstellung und die erhaltenen neuen zwischenprodukte, ihre anwendung als arzneimittel und die sie enthaltenden zusammensetzungen |
Non-Patent Citations (2)
| Title |
|---|
| WEGLER, R.: Chemie der Pflanzenschutz- und Schädlingsbekämpfungsmittel, Bd. 2, 1970, S. 346-347, 296-297, Bd. 5, 1977, S. 220, 308-310, 632-637, Springer Verlag * |
| WEGLER, R.: Chemie der Pflanzenschutz- und Schädlingsbekämpfungsmittel, Bd. 5, 1977, S. 261, 639-640, Bd. 8, 1982, S. 397-399, Springer-Verlag * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3600712A1 (de) | 1985-01-17 | 1986-07-17 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 5-halopyridin-3-carboxamidverbindungen |
| DE3601121A1 (de) * | 1985-01-18 | 1986-08-21 | Daicel Chemical Industries, Ltd., Sakai, Osaka | 4-substituierte-oxy-3-pyridincarboxamide |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2169897A (en) | 1986-07-23 |
| JPH0576469B2 (https=) | 1993-10-22 |
| FR2576020A1 (fr) | 1986-07-18 |
| GB8601007D0 (en) | 1986-02-19 |
| US4777256A (en) | 1988-10-11 |
| FR2576020B1 (fr) | 1989-12-08 |
| GB2169897B (en) | 1988-09-01 |
| JPS61165372A (ja) | 1986-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE897405C (de) | Verfahren zur Herstellung substituierter Piperazine | |
| DE3636094A1 (de) | Pyridin-3-carboxamidderivate und ein pflanzenwachstumsinhibitor | |
| CH656383A5 (de) | 2-(4-(4-(4,4-dialkyl-2,6-piperidindion-1-yl)-butyl)-1-piperazinyl)pyrimidine. | |
| DE2514183A1 (de) | 1,1-diaryl-1-oxadiazol-alkylamine | |
| DE69022965T2 (de) | Aminopiperazinderivate. | |
| DE3600712A1 (de) | 5-halopyridin-3-carboxamidverbindungen | |
| CH633542A5 (de) | Verfahren zur herstellung von harnstoffderivaten. | |
| DE3852908T2 (de) | 4-Halogen-3-pyridincarboxamid-Verbindungen und herbizide Zusammensetzungen daraus. | |
| DE2749988A1 (de) | N-substituierte imidazolcarboxamide, verfahren zu deren herstellung und dieselben enthaltendes mittel | |
| EP0304534A1 (de) | Dihydropyridazinon-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1812768A1 (de) | Neue Benzodioxanderivate | |
| DE60226225T2 (de) | Phtalazine derivate mit angiogenesis inhibierender wirkung | |
| DE2707102A1 (de) | Verfahren zur regiospezifischen herstellung von o-aminophenylketonen | |
| DE3339943A1 (de) | 2-piperazinyl-chinazolin-derivate, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| EP0094038B1 (de) | 3-Amino-6-aryl-1,2,4-triazolo(4,3-b)-pyridazine, ihre Herstellung und ihre Verwendung | |
| EP0121490B1 (de) | Substituierte 6-Aryl-1,2,4-triazolo[4,3-b]pyridazine, ihre Herstellung und Verwendung | |
| DE1812231C3 (de) | Verfahren zur Herstellung von 3-Alkyl- 5-phenyl-1,3-dihydro-2H-1,4benzodiazepin-2-onderivaten | |
| DE3879378T2 (de) | Amid-verbindungen. | |
| DE69719071T2 (de) | Phenanthridiniumderivate | |
| DE69104155T2 (de) | 6-Alkylpyridazinderivate, Verfahren zu deren Herstellung und diese enthaltende Zusammensetzungen. | |
| CH653335A5 (de) | Verfahren zur herstellung von 9-amino-6,7dihydro-4h-pyrido (1,2-a)pyrimidin-4-on-derivaten. | |
| DE3539121A1 (de) | Pyridincarboxamidderivate | |
| DE2321530A1 (de) | 4,6-bis-(alkaryl)-s-triazine und verfahren zu deren herstellung | |
| CH432542A (de) | Verfahren zur Herstellung neuer Hydrazide | |
| DE3129718A1 (de) | 4-oximino-1,2,3,4-tetrahydrochinolinderivate und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |