DE3587671T2 - (Kondensierte) Benz(thio)amide. - Google Patents
(Kondensierte) Benz(thio)amide.Info
- Publication number
- DE3587671T2 DE3587671T2 DE85305802T DE3587671T DE3587671T2 DE 3587671 T2 DE3587671 T2 DE 3587671T2 DE 85305802 T DE85305802 T DE 85305802T DE 3587671 T DE3587671 T DE 3587671T DE 3587671 T2 DE3587671 T2 DE 3587671T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- amino
- tetrazolyl
- carbon atoms
- benzoyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000000446 sulfanediyl group Chemical group *S* 0.000 title description 3
- 150000001408 amides Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 172
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 161
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 87
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 57
- 125000005843 halogen group Chemical group 0.000 claims abstract description 38
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 33
- -1 aminophenyl Chemical class 0.000 claims abstract description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 30
- 150000003839 salts Chemical class 0.000 claims abstract description 30
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 23
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 22
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 16
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 15
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 15
- 125000003302 alkenyloxy group Chemical group 0.000 claims abstract description 13
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 13
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims abstract description 11
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 10
- 125000005133 alkynyloxy group Chemical group 0.000 claims abstract description 9
- 125000002837 carbocyclic group Chemical group 0.000 claims abstract description 8
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 7
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims abstract description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 6
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 claims abstract description 5
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 230000002265 prevention Effects 0.000 claims abstract description 4
- 229930192474 thiophene Natural products 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 53
- 159000000000 sodium salts Chemical class 0.000 claims description 32
- 230000008569 process Effects 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 18
- 230000015572 biosynthetic process Effects 0.000 claims description 17
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 14
- 125000004434 sulfur atom Chemical group 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 230000032050 esterification Effects 0.000 claims description 10
- 238000005886 esterification reaction Methods 0.000 claims description 10
- 238000007127 saponification reaction Methods 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 9
- 208000026935 allergic disease Diseases 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 208000019693 Lung disease Diseases 0.000 claims description 7
- 208000006673 asthma Diseases 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 208000014181 Bronchial disease Diseases 0.000 claims description 5
- 208000027515 Tracheal disease Diseases 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000001540 azides Chemical class 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000001326 naphthylalkyl group Chemical group 0.000 claims description 3
- 125000004043 oxo group Chemical group O=* 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000000464 thioxo group Chemical group S=* 0.000 claims description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical group C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- OTAFHZMPRISVEM-UHFFFAOYSA-N benzo-gamma-pyrone Natural products C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- ZWEXCGAOZKGTTH-UHFFFAOYSA-N 4-(6-chlorohexoxy)-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O ZWEXCGAOZKGTTH-UHFFFAOYSA-N 0.000 claims 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical group C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 claims 1
- LMTDPKYREUZYAO-UHFFFAOYSA-N 1,4-dioxepane Chemical group C1COCCOC1 LMTDPKYREUZYAO-UHFFFAOYSA-N 0.000 claims 1
- PTVKETGGKARVOF-UHFFFAOYSA-N 3-[4-(2-phenylethoxy)phenyl]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C=1C=C(OCCC=2C=CC=CC=2)C=CC=1C=CC(=O)NC(C=1O2)=CC=CC=1OCC2C=1N=NNN=1 PTVKETGGKARVOF-UHFFFAOYSA-N 0.000 claims 1
- RFDMOWAHWYSNHJ-UHFFFAOYSA-N 3-[4-(3-methylbutoxymethyl)phenyl]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=CC(COCCC(C)C)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 RFDMOWAHWYSNHJ-UHFFFAOYSA-N 0.000 claims 1
- FESHQIIVQAUQRI-UHFFFAOYSA-N 3-[4-(4-chlorobutoxy)phenyl]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=CC(OCCCCCl)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 FESHQIIVQAUQRI-UHFFFAOYSA-N 0.000 claims 1
- SUHVEZTZYHWCRM-UHFFFAOYSA-N 3-[4-(4-methylpentoxy)phenyl]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=CC(OCCCC(C)C)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 SUHVEZTZYHWCRM-UHFFFAOYSA-N 0.000 claims 1
- KHNCBHCSSMKOGE-UHFFFAOYSA-N 3-[4-(4-methylpentoxy)phenyl]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]prop-2-enamide Chemical compound C1=CC(OCCCC(C)C)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O KHNCBHCSSMKOGE-UHFFFAOYSA-N 0.000 claims 1
- HKYDZXLHEWRSQH-UHFFFAOYSA-N 3-[4-(5-chloropentoxy)phenyl]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=CC(OCCCCCCl)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 HKYDZXLHEWRSQH-UHFFFAOYSA-N 0.000 claims 1
- MABLMNSNHAJADZ-UHFFFAOYSA-N 3-[4-(5-chloropentoxy)phenyl]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]prop-2-enamide Chemical compound C1=CC(OCCCCCCl)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O MABLMNSNHAJADZ-UHFFFAOYSA-N 0.000 claims 1
- NEQWWRXAXBNZHN-UHFFFAOYSA-N 3-[4-(6-chlorohexoxy)phenyl]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]prop-2-enamide Chemical compound C1=CC(OCCCCCCCl)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O NEQWWRXAXBNZHN-UHFFFAOYSA-N 0.000 claims 1
- NCJGUBUYGGGFNF-UHFFFAOYSA-N 4-(3-phenoxypropoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C=1C=C(OCCCOC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1OCC2C1=NN=NN1 NCJGUBUYGGGFNF-UHFFFAOYSA-N 0.000 claims 1
- XEOHUSDYIHFREO-UHFFFAOYSA-N 4-(3-phenylsulfanylpropoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C=1C=C(OCCCSC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1OCC2C1=NN=NN1 XEOHUSDYIHFREO-UHFFFAOYSA-N 0.000 claims 1
- CVQJUWTWWPAEHI-UHFFFAOYSA-N 4-(4-chlorobutoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 CVQJUWTWWPAEHI-UHFFFAOYSA-N 0.000 claims 1
- VVVIQTZRQCJAAE-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[2-(2h-tetrazol-5-yl)-3,4-dihydro-2h-1,4-benzoxazin-8-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1NCC2C=1N=NNN=1 VVVIQTZRQCJAAE-UHFFFAOYSA-N 0.000 claims 1
- MAAKAIOIZFOZLM-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[2-(2h-tetrazol-5-yl)-3,4-dihydro-2h-chromen-8-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1CCC2C=1N=NNN=1 MAAKAIOIZFOZLM-UHFFFAOYSA-N 0.000 claims 1
- XTDWCGRQOXPPNV-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[2-(2h-tetrazol-5-yl)quinolin-8-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C1=N2)=CC=CC1=CC=C2C1=NN=NN1 XTDWCGRQOXPPNV-UHFFFAOYSA-N 0.000 claims 1
- CILFBYXDVWMEGJ-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1OCC2C=1N=NNN=1 CILFBYXDVWMEGJ-UHFFFAOYSA-N 0.000 claims 1
- QOJQXYPNTGJZGD-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[7-(2h-tetrazol-5-yl)naphthalen-1-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C1=C2)=CC=CC1=CC=C2C=1N=NNN=1 QOJQXYPNTGJZGD-UHFFFAOYSA-N 0.000 claims 1
- QOOUDMRQEBOAMO-UHFFFAOYSA-N 4-(5-azidopentoxy)-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound N(=[N+]=[N-])CCCCCOC1=CC=C(C(=O)NC2=CC=CC3=C2OC(CO3)C3=NN=NN3)C=C1 QOOUDMRQEBOAMO-UHFFFAOYSA-N 0.000 claims 1
- IRQJSLJXWBIJTJ-UHFFFAOYSA-N 4-(5-chloropentoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 IRQJSLJXWBIJTJ-UHFFFAOYSA-N 0.000 claims 1
- NDIFRYCOKOKEEF-UHFFFAOYSA-N 4-(5-chloropentoxy)-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O NDIFRYCOKOKEEF-UHFFFAOYSA-N 0.000 claims 1
- VYLBOKXSKJCFED-UHFFFAOYSA-N 4-(6-chlorohexoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 VYLBOKXSKJCFED-UHFFFAOYSA-N 0.000 claims 1
- REMJWGMCUDLAFS-UHFFFAOYSA-N 4-(6-methylheptoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCC(C)C)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 REMJWGMCUDLAFS-UHFFFAOYSA-N 0.000 claims 1
- DTWXSAZZRJBDDN-UHFFFAOYSA-N 4-(7-chloroheptoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 DTWXSAZZRJBDDN-UHFFFAOYSA-N 0.000 claims 1
- JJHAHFLJQODBHE-UHFFFAOYSA-N 4-(7-chloroheptoxy)-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O JJHAHFLJQODBHE-UHFFFAOYSA-N 0.000 claims 1
- PGTUMROLDUIVPT-UHFFFAOYSA-N 4-(7-chloroheptoxy)-n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C=12OC(C=3NN=NN=3)=CC(=O)C2=CC(C)=CC=1NC(=O)C1=CC=C(OCCCCCCCCl)C=C1 PGTUMROLDUIVPT-UHFFFAOYSA-N 0.000 claims 1
- YNXUCZHHAVPLBE-UHFFFAOYSA-N 4-(8-chlorooctoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 YNXUCZHHAVPLBE-UHFFFAOYSA-N 0.000 claims 1
- BUKXCUWHIHCUGF-UHFFFAOYSA-N 4-(8-chlorooctoxy)-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O BUKXCUWHIHCUGF-UHFFFAOYSA-N 0.000 claims 1
- XVABRLZCBHINGR-UHFFFAOYSA-N 4-(9-chlorononoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCCCCCl)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 XVABRLZCBHINGR-UHFFFAOYSA-N 0.000 claims 1
- DFVKZBJIWBRFMN-CSNJMMPQSA-N 4-[(1e,3e)-octa-1,3-dienoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O/C=C/C=C/CCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 DFVKZBJIWBRFMN-CSNJMMPQSA-N 0.000 claims 1
- QLGKJENFCAUWEO-NBVRZTHBSA-N 4-[(2e)-3,7-dimethylocta-2,6-dienoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OC/C=C(C)/CCC=C(C)C)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 QLGKJENFCAUWEO-NBVRZTHBSA-N 0.000 claims 1
- IGUMAVMJNOKXDU-NBVRZTHBSA-N 4-[(2e)-3,7-dimethylocta-2,6-dienoxy]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OC/C=C(C)/CCC=C(C)C)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O IGUMAVMJNOKXDU-NBVRZTHBSA-N 0.000 claims 1
- IJWVYAOWAPOUTD-MKMNVTDBSA-N 4-[(e)-hept-1-enoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O/C=C/CCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 IJWVYAOWAPOUTD-MKMNVTDBSA-N 0.000 claims 1
- IDUBHDZFLDQGKT-MKMNVTDBSA-N 4-[(e)-hept-1-enoxy]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(O/C=C/CCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O IDUBHDZFLDQGKT-MKMNVTDBSA-N 0.000 claims 1
- AOAFAEVHBAAJFJ-WLRTZDKTSA-N 4-[(e)-hex-1-enoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O/C=C/CCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 AOAFAEVHBAAJFJ-WLRTZDKTSA-N 0.000 claims 1
- KHTIFSYSFVLOLO-WLRTZDKTSA-N 4-[(e)-hex-1-enoxy]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(O/C=C/CCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O KHTIFSYSFVLOLO-WLRTZDKTSA-N 0.000 claims 1
- QYLMPBFAONMNTO-LZYBPNLTSA-N 4-[(e)-non-1-enoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O/C=C/CCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 QYLMPBFAONMNTO-LZYBPNLTSA-N 0.000 claims 1
- YUFCBLDERKXIFE-VIZOYTHASA-N 4-[(e)-oct-1-enoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O/C=C/CCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 YUFCBLDERKXIFE-VIZOYTHASA-N 0.000 claims 1
- AWRCOZVMMWSKOG-VIZOYTHASA-N 4-[(e)-oct-1-enoxy]-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(O/C=C/CCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)=CC2=O AWRCOZVMMWSKOG-VIZOYTHASA-N 0.000 claims 1
- YUFCBLDERKXIFE-CHHVJCJISA-N 4-[(z)-oct-1-enoxy]-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(O\C=C/CCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 YUFCBLDERKXIFE-CHHVJCJISA-N 0.000 claims 1
- JOVCMJZWLGTFAU-UHFFFAOYSA-N 4-butoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O JOVCMJZWLGTFAU-UHFFFAOYSA-N 0.000 claims 1
- NSSVDDDMPRVFAJ-UHFFFAOYSA-N 4-heptoxy-n-[2-(2h-tetrazol-5-yl)-1,3-benzodioxol-4-yl]benzamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)O2 NSSVDDDMPRVFAJ-UHFFFAOYSA-N 0.000 claims 1
- AIANCPCQGZTGKM-UHFFFAOYSA-N 4-heptoxy-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 AIANCPCQGZTGKM-UHFFFAOYSA-N 0.000 claims 1
- JKDIMKWWFZLDNF-UHFFFAOYSA-N 4-heptoxy-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzenecarbothioamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=S)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 JKDIMKWWFZLDNF-UHFFFAOYSA-N 0.000 claims 1
- JHKPLZCCMOGUEI-UHFFFAOYSA-N 4-heptoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O JHKPLZCCMOGUEI-UHFFFAOYSA-N 0.000 claims 1
- XVLAADANMNXMMH-UHFFFAOYSA-N 4-heptoxy-n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)NC1=CC(C)=CC2=C1OC(C=1NN=NN=1)=CC2=O XVLAADANMNXMMH-UHFFFAOYSA-N 0.000 claims 1
- XRFSMSFKKVTDDT-UHFFFAOYSA-N 4-heptyl-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzenecarbothioamide Chemical compound C1=CC(CCCCCCC)=CC=C1C(=S)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 XRFSMSFKKVTDDT-UHFFFAOYSA-N 0.000 claims 1
- ZAVSTDHOBGBUAC-UHFFFAOYSA-N 4-heptyl-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(CCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O ZAVSTDHOBGBUAC-UHFFFAOYSA-N 0.000 claims 1
- JRMPZUJDLLDLKO-UHFFFAOYSA-N 4-hexoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O JRMPZUJDLLDLKO-UHFFFAOYSA-N 0.000 claims 1
- QQZLHBYIEUHFBH-UHFFFAOYSA-N 4-nonoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O QQZLHBYIEUHFBH-UHFFFAOYSA-N 0.000 claims 1
- GYKCTIBPYOPSIN-UHFFFAOYSA-N 4-nonyl-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(CCCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O GYKCTIBPYOPSIN-UHFFFAOYSA-N 0.000 claims 1
- VOENOFDVFYQPAQ-UHFFFAOYSA-N 4-oct-2-ynoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCC#CCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O VOENOFDVFYQPAQ-UHFFFAOYSA-N 0.000 claims 1
- DKJWFOPJQMKRJT-UHFFFAOYSA-N 4-oct-7-enoxy-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCC=C)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 DKJWFOPJQMKRJT-UHFFFAOYSA-N 0.000 claims 1
- CSIBKBIBULLMDV-UHFFFAOYSA-N 4-oct-7-enoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCC=C)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O CSIBKBIBULLMDV-UHFFFAOYSA-N 0.000 claims 1
- GLLBVVYCVGHMLN-UHFFFAOYSA-N 4-octanoyl-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(C(=O)CCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 GLLBVVYCVGHMLN-UHFFFAOYSA-N 0.000 claims 1
- ZPNLVCLQVZRJJJ-UHFFFAOYSA-N 4-octoxy-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(OCCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O ZPNLVCLQVZRJJJ-UHFFFAOYSA-N 0.000 claims 1
- NWOCFLOMBOQAIR-UHFFFAOYSA-N 4-octyl-n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]benzamide Chemical compound C1=CC(CCCCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)=CC2=O NWOCFLOMBOQAIR-UHFFFAOYSA-N 0.000 claims 1
- CNXXPPUUXYYOAY-VIZOYTHASA-N 5-[[4-[(e)-oct-1-enoxy]benzoyl]amino]-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid Chemical compound C1=CC(O/C=C/CCCCCC)=CC=C1C(=O)NC1=CC=CC2=C1OC(C(O)=O)CO2 CNXXPPUUXYYOAY-VIZOYTHASA-N 0.000 claims 1
- 125000003627 8 membered carbocyclic group Chemical group 0.000 claims 1
- NBQKINXMPLXUET-UHFFFAOYSA-N Pranlukast Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC1=CC=CC(C(C=2)=O)=C1OC=2C=1N=NNN=1 NBQKINXMPLXUET-UHFFFAOYSA-N 0.000 claims 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- 238000000576 coating method Methods 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- WREDNSAXDZCLCP-UHFFFAOYSA-N methanedithioic acid Chemical compound SC=S WREDNSAXDZCLCP-UHFFFAOYSA-N 0.000 claims 1
- 150000004702 methyl esters Chemical class 0.000 claims 1
- DQXGABJTXKEKSO-UHFFFAOYSA-N n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]-4-(4-thiophen-2-ylbutoxy)benzamide Chemical compound C=1C=C(OCCCCC=2SC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1OCC2C=1N=NNN=1 DQXGABJTXKEKSO-UHFFFAOYSA-N 0.000 claims 1
- FVSFZNLYVLBLPX-UHFFFAOYSA-N n-[4-oxo-2-(2h-tetrazol-5-yl)-1h-quinolin-8-yl]-4-(4-phenylbutoxy)benzamide Chemical compound C1=CC=C2C(O)=CC(C=3NN=NN=3)=NC2=C1NC(=O)C(C=C1)=CC=C1OCCCCC1=CC=CC=C1 FVSFZNLYVLBLPX-UHFFFAOYSA-N 0.000 claims 1
- KBYYEZWFRXRCIU-UHFFFAOYSA-N n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-(3-phenylpropoxy)benzamide Chemical compound C=1C=C(OCCCC=2C=CC=CC=2)C=CC=1C(=O)NC1=CC=CC(C(C=2)=O)=C1OC=2C1=NN=NN1 KBYYEZWFRXRCIU-UHFFFAOYSA-N 0.000 claims 1
- UHEBOAKXRHMHMF-PJQLUOCWSA-N n-[4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-[(e)-3-phenylprop-1-enoxy]benzamide Chemical compound C=1C=C(O\C=C\CC=2C=CC=CC=2)C=CC=1C(=O)NC1=CC=CC(C(C=2)=O)=C1OC=2C=1N=NNN=1 UHEBOAKXRHMHMF-PJQLUOCWSA-N 0.000 claims 1
- YBOVFIBNLCMIKP-UHFFFAOYSA-N n-[6-fluoro-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-heptoxybenzamide Chemical compound C1=CC(OCCCCCCC)=CC=C1C(=O)NC1=CC(F)=CC2=C1OC(C=1NN=NN=1)=CC2=O YBOVFIBNLCMIKP-UHFFFAOYSA-N 0.000 claims 1
- NHNNCNBKKPJZKE-UHFFFAOYSA-N n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide Chemical compound C=12OC(C3=NNN=N3)=CC(=O)C2=CC(C)=CC=1NC(=O)C(C=C1)=CC=C1OCCCCC1=CC=CC=C1 NHNNCNBKKPJZKE-UHFFFAOYSA-N 0.000 claims 1
- ZNXFEDJVDQIABE-UHFFFAOYSA-N n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-(4-thiophen-2-ylbutoxy)benzamide Chemical compound C=12OC(C=3NN=NN=3)=CC(=O)C2=CC(C)=CC=1NC(=O)C(C=C1)=CC=C1OCCCCC1=CC=CS1 ZNXFEDJVDQIABE-UHFFFAOYSA-N 0.000 claims 1
- SUBWWPPJYPCVJL-MDWZMJQESA-N n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-[(e)-oct-1-enoxy]benzamide Chemical compound C1=CC(O/C=C/CCCCCC)=CC=C1C(=O)NC1=CC(C)=CC2=C1OC(C1=NNN=N1)=CC2=O SUBWWPPJYPCVJL-MDWZMJQESA-N 0.000 claims 1
- KUBMKQGGMMUZMM-UHFFFAOYSA-N n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-oct-7-enoxybenzamide Chemical compound C=12OC(C=3NN=NN=3)=CC(=O)C2=CC(C)=CC=1NC(=O)C1=CC=C(OCCCCCCC=C)C=C1 KUBMKQGGMMUZMM-UHFFFAOYSA-N 0.000 claims 1
- RVIJZOVAJBMHIE-UHFFFAOYSA-N n-[6-methyl-4-oxo-2-(2h-tetrazol-5-yl)chromen-8-yl]-4-octoxybenzamide Chemical compound C1=CC(OCCCCCCCC)=CC=C1C(=O)NC1=CC(C)=CC2=C1OC(C=1NN=NN=1)=CC2=O RVIJZOVAJBMHIE-UHFFFAOYSA-N 0.000 claims 1
- 239000008016 pharmaceutical coating Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract description 12
- 229910052799 carbon Inorganic materials 0.000 abstract description 12
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 6
- 241000282414 Homo sapiens Species 0.000 abstract description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 4
- 241000124008 Mammalia Species 0.000 abstract description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 3
- 201000010099 disease Diseases 0.000 abstract description 3
- 125000004423 acyloxy group Chemical group 0.000 abstract description 2
- 108010066551 Cholestenone 5 alpha-Reductase Proteins 0.000 abstract 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 abstract 2
- 239000005864 Sulphur Substances 0.000 abstract 1
- 230000002401 inhibitory effect Effects 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- 239000000843 powder Substances 0.000 description 152
- 238000004809 thin layer chromatography Methods 0.000 description 88
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- 238000005481 NMR spectroscopy Methods 0.000 description 79
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 75
- 239000002904 solvent Substances 0.000 description 73
- 125000001424 substituent group Chemical group 0.000 description 60
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- 239000000243 solution Substances 0.000 description 44
- 239000000203 mixture Substances 0.000 description 41
- 238000006243 chemical reaction Methods 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 23
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 21
- 239000000126 substance Substances 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 238000003786 synthesis reaction Methods 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 239000003960 organic solvent Substances 0.000 description 12
- 229940114079 arachidonic acid Drugs 0.000 description 11
- 235000021342 arachidonic acid Nutrition 0.000 description 11
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 11
- 150000002617 leukotrienes Chemical class 0.000 description 11
- 150000003180 prostaglandins Chemical class 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 230000009467 reduction Effects 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 230000009471 action Effects 0.000 description 8
- 238000004440 column chromatography Methods 0.000 description 8
- 230000037361 pathway Effects 0.000 description 8
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 230000003042 antagnostic effect Effects 0.000 description 7
- 239000012300 argon atmosphere Substances 0.000 description 7
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- GWNVDXQDILPJIG-NXOLIXFESA-N leukotriene C4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@@H](C(=O)NCC(O)=O)NC(=O)CC[C@H](N)C(O)=O GWNVDXQDILPJIG-NXOLIXFESA-N 0.000 description 6
- 101100545004 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) YSP2 gene Proteins 0.000 description 5
- 230000004075 alteration Effects 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical group C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- NNDIXBJHNLFJJP-UHFFFAOYSA-N 20-Hydroxyeicosatetraenoic acid Chemical compound OCCCCCC=CCC=CCC=CCC=CCCCC(O)=O NNDIXBJHNLFJJP-UHFFFAOYSA-N 0.000 description 4
- MGBKJKDRMRAZKC-UHFFFAOYSA-N 3-aminobenzene-1,2-diol Chemical compound NC1=CC=CC(O)=C1O MGBKJKDRMRAZKC-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- 206010020751 Hypersensitivity Diseases 0.000 description 4
- 102000003820 Lipoxygenases Human genes 0.000 description 4
- 108090000128 Lipoxygenases Proteins 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 230000000172 allergic effect Effects 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 208000010668 atopic eczema Diseases 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- VNYSSYRCGWBHLG-AMOLWHMGSA-N leukotriene B4 Chemical compound CCCCC\C=C/C[C@@H](O)\C=C\C=C\C=C/[C@@H](O)CCCC(O)=O VNYSSYRCGWBHLG-AMOLWHMGSA-N 0.000 description 4
- OTZRAYGBFWZKMX-JUDRUQEKSA-N leukotriene E4 Chemical compound CCCCCC=CCC=C\C=C\C=C\[C@@H](SC[C@H](N)C(O)=O)[C@@H](O)CCCC(O)=O OTZRAYGBFWZKMX-JUDRUQEKSA-N 0.000 description 4
- 210000004072 lung Anatomy 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000007911 parenteral administration Methods 0.000 description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CVVGJSFPJSTHSE-UHFFFAOYSA-N 3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride Chemical compound Cl.O1C=2C(N)=CC=CC=2OCC1C1=NN=NN1 CVVGJSFPJSTHSE-UHFFFAOYSA-N 0.000 description 3
- 206010002199 Anaphylactic shock Diseases 0.000 description 3
- 239000004475 Arginine Substances 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 101100455054 Homo sapiens LTA4H gene Proteins 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 3
- 102100022118 Leukotriene A-4 hydrolase Human genes 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 108010064785 Phospholipases Proteins 0.000 description 3
- 102000015439 Phospholipases Human genes 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 101100075025 Scheffersomyces stipitis (strain ATCC 58785 / CBS 6054 / NBRC 10063 / NRRL Y-11545) LTA4 gene Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- 125000005108 alkenylthio group Chemical group 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 125000005109 alkynylthio group Chemical group 0.000 description 3
- 230000007815 allergy Effects 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- UFPQIRYSPUYQHK-WAQVJNLQSA-N leukotriene A4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@@H]1O[C@H]1CCCC(O)=O UFPQIRYSPUYQHK-WAQVJNLQSA-N 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- KAQKFAOMNZTLHT-OZUDYXHBSA-N prostaglandin I2 Chemical compound O1\C(=C/CCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-OZUDYXHBSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- DEHGMURAIGQLHM-UHFFFAOYSA-N (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate;hydrochloride Chemical compound Cl.FC(F)(F)C(=O)OC(=O)C(F)(F)F DEHGMURAIGQLHM-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BFWYTORDSFIVKP-VAEKSGALSA-N 15(S)-HPETE Chemical compound CCCCC[C@H](OO)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O BFWYTORDSFIVKP-VAEKSGALSA-N 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- LZUMEVGHGKCPJK-UHFFFAOYSA-N 3-(4-pentylphenyl)prop-2-enoic acid Chemical compound CCCCCC1=CC=C(C=CC(O)=O)C=C1 LZUMEVGHGKCPJK-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- JNUUNUQHXIOFDA-XTDASVJISA-N 5-HPETE Chemical compound CCCCC\C=C/C\C=C/C\C=C/C=C/C(OO)CCCC(O)=O JNUUNUQHXIOFDA-XTDASVJISA-N 0.000 description 2
- YZXBAPSDXZZRGB-DOFZRALJSA-M Arachidonate Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC([O-])=O YZXBAPSDXZZRGB-DOFZRALJSA-M 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- 101000862089 Clarkia lewisii Glucose-6-phosphate isomerase, cytosolic 1A Proteins 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- 101710107035 Gamma-glutamyltranspeptidase Proteins 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 2
- 101710173228 Glutathione hydrolase proenzyme Proteins 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- SGUKUZOVHSFKPH-UHFFFAOYSA-N PGG2 Natural products C1C2OOC1C(C=CC(OO)CCCCC)C2CC=CCCCC(O)=O SGUKUZOVHSFKPH-UHFFFAOYSA-N 0.000 description 2
- 102000003992 Peroxidases Human genes 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 2
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- 229940114078 arachidonate Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 235000003704 aspartic acid Nutrition 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- 230000000975 bioactive effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000004227 calcium gluconate Substances 0.000 description 2
- 235000013927 calcium gluconate Nutrition 0.000 description 2
- 229960004494 calcium gluconate Drugs 0.000 description 2
- NEEHYRZPVYRGPP-UHFFFAOYSA-L calcium;2,3,4,5,6-pentahydroxyhexanoate Chemical compound [Ca+2].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O NEEHYRZPVYRGPP-UHFFFAOYSA-L 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 239000002642 cobra venom Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 2
- 229960002986 dinoprostone Drugs 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- QFLCJDVIKIUKCD-UHFFFAOYSA-N ethyl 4-oxo-8-[3-(4-pentylphenyl)prop-2-enoylamino]chromene-2-carboxylate Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C(=O)OCC)=CC2=O QFLCJDVIKIUKCD-UHFFFAOYSA-N 0.000 description 2
- IWKNQOGLOVBSDJ-UHFFFAOYSA-N ethyl 8-amino-4-oxochromene-2-carboxylate Chemical compound C1=CC(N)=C2OC(C(=O)OCC)=CC(=O)C2=C1 IWKNQOGLOVBSDJ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 102000006640 gamma-Glutamyltransferase Human genes 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000008105 immune reaction Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 230000037353 metabolic pathway Effects 0.000 description 2
- IBXXLOVERQZZPD-UHFFFAOYSA-N methyl 2-[5-[3-(4-pentylphenyl)prop-2-enoylamino]-2,3-dihydro-1,4-benzodioxin-3-yl]acetate Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(CC(=O)OC)CO2 IBXXLOVERQZZPD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- VAKHKENKNZYEBL-UHFFFAOYSA-N n-(2,3-dihydroxyphenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide Chemical compound C1=C(OC)C(OCCCCC)=CC=C1C=CC(=O)NC1=CC=CC(O)=C1O VAKHKENKNZYEBL-UHFFFAOYSA-N 0.000 description 2
- PQQHWKNBLCKGTR-UHFFFAOYSA-N n-[3-(2-amino-2-oxoethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]-3-(4-pentylphenyl)prop-2-enamide Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(CC(N)=O)CO2 PQQHWKNBLCKGTR-UHFFFAOYSA-N 0.000 description 2
- YYUSQTICCITYPZ-UHFFFAOYSA-N n-[3-(cyanomethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]-3-(4-pentylphenyl)prop-2-enamide Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(CC#N)CO2 YYUSQTICCITYPZ-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 108040007629 peroxidase activity proteins Proteins 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 2
- SGUKUZOVHSFKPH-YNNPMVKQSA-N prostaglandin G2 Chemical compound C1[C@@H]2OO[C@H]1[C@H](/C=C/[C@@H](OO)CCCCC)[C@H]2C\C=C/CCCC(O)=O SGUKUZOVHSFKPH-YNNPMVKQSA-N 0.000 description 2
- YIBNHAJFJUQSRA-YNNPMVKQSA-N prostaglandin H2 Chemical compound C1[C@@H]2OO[C@H]1[C@H](/C=C/[C@@H](O)CCCCC)[C@H]2C\C=C/CCCC(O)=O YIBNHAJFJUQSRA-YNNPMVKQSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- 239000007885 tablet disintegrant Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 230000008728 vascular permeability Effects 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- PXGPLTODNUVGFL-BRIYLRKRSA-N (E,Z)-(1R,2R,3R,5S)-7-(3,5-Dihydroxy-2-((3S)-(3-hydroxy-1-octenyl))cyclopentyl)-5-heptenoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O PXGPLTODNUVGFL-BRIYLRKRSA-N 0.000 description 1
- DCIDQCMMRAKNNR-UHFFFAOYSA-N 1,4-benzodithiine Chemical group C1=CC=C2SC=CSC2=C1 DCIDQCMMRAKNNR-UHFFFAOYSA-N 0.000 description 1
- ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 12(S)-HPETE Chemical compound CCCCC\C=C/C[C@H](OO)\C=C\C=C/C\C=C/CCCC(O)=O ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 0.000 description 1
- ZNHVWPKMFKADKW-UHFFFAOYSA-N 12-HETE Chemical compound CCCCCC=CCC(O)C=CC=CCC=CCCCC(O)=O ZNHVWPKMFKADKW-UHFFFAOYSA-N 0.000 description 1
- ZNHVWPKMFKADKW-ZYBDYUKJSA-N 12-HETE Natural products CCCCC\C=C/C[C@@H](O)\C=C\C=C/C\C=C/CCCC(O)=O ZNHVWPKMFKADKW-ZYBDYUKJSA-N 0.000 description 1
- JSFATNQSLKRBCI-VAEKSGALSA-N 15-HETE Natural products CCCCC[C@H](O)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O JSFATNQSLKRBCI-VAEKSGALSA-N 0.000 description 1
- BFWYTORDSFIVKP-USWFWKISSA-N 15-HPETE Chemical compound CCCCCC(OO)\C=C\C=C/C\C=C/C\C=C/CCCC(O)=O BFWYTORDSFIVKP-USWFWKISSA-N 0.000 description 1
- JSFATNQSLKRBCI-UHFFFAOYSA-N 15-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC(O)C=CC=CCC=CCC=CCCCC(O)=O JSFATNQSLKRBCI-UHFFFAOYSA-N 0.000 description 1
- QKEZQLPQGYXMIL-UHFFFAOYSA-N 2-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodithiin-5-amine;hydrochloride Chemical compound Cl.C1SC=2C(N)=CC=CC=2SC1C1=NN=NN1 QKEZQLPQGYXMIL-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- CWJSCIWGSUCULS-UHFFFAOYSA-N 2-hydroperoxyicosa-2,4,6,8-tetraenoic acid Chemical compound CCCCCCCCCCCC=CC=CC=CC=C(OO)C(O)=O CWJSCIWGSUCULS-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- WGTASENVNYJZBK-UHFFFAOYSA-N 3,4,5-trimethoxyamphetamine Chemical compound COC1=CC(CC(C)N)=CC(OC)=C1OC WGTASENVNYJZBK-UHFFFAOYSA-N 0.000 description 1
- UBIPKJBLXYYVAX-UHFFFAOYSA-N 3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodithiin-5-amine;hydrochloride Chemical compound Cl.S1C=2C(N)=CC=CC=2SCC1C1=NN=NN1 UBIPKJBLXYYVAX-UHFFFAOYSA-N 0.000 description 1
- YBABDDMQWBJFPH-UHFFFAOYSA-N 3-(3-methoxy-4-pentoxyphenyl)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=C(OC)C(OCCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 YBABDDMQWBJFPH-UHFFFAOYSA-N 0.000 description 1
- HGBUQTOGNIRVHU-UHFFFAOYSA-N 3-(4-pentylphenyl)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C1=NNN=N1)CO2 HGBUQTOGNIRVHU-UHFFFAOYSA-N 0.000 description 1
- HWVKYKWJVRHSCM-UHFFFAOYSA-N 3-(4-pentylphenyl)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]propanamide Chemical compound C1=CC(CCCCC)=CC=C1CCC(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 HWVKYKWJVRHSCM-UHFFFAOYSA-N 0.000 description 1
- HJXPTUVILZSZGP-UHFFFAOYSA-N 3-[4-(5-bromopentoxy)phenyl]-n-(2,3-dihydro-1,4-benzodioxin-5-yl)prop-2-enamide Chemical compound C1=CC(OCCCCCBr)=CC=C1C=CC(=O)NC1=CC=CC2=C1OCCO2 HJXPTUVILZSZGP-UHFFFAOYSA-N 0.000 description 1
- HVTHYMNEWWNSKM-UHFFFAOYSA-N 3-methoxy-4-pentoxybenzoic acid Chemical compound CCCCCOC1=CC=C(C(O)=O)C=C1OC HVTHYMNEWWNSKM-UHFFFAOYSA-N 0.000 description 1
- NZDABAMAZXUZBZ-UHFFFAOYSA-N 4-(4-phenylbutoxy)-n-[2-(2h-tetrazol-5-yl)-3,4-dihydro-1,2-benzoxazin-8-yl]benzamide Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1O2)=CC=CC=1CCN2C1=NN=NN1 NZDABAMAZXUZBZ-UHFFFAOYSA-N 0.000 description 1
- YNKGMCPQHSVJBM-UHFFFAOYSA-N 4-(6-hydroxyhexoxy)-n-[3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide Chemical compound C1=CC(OCCCCCCO)=CC=C1C(=O)NC1=CC=CC2=C1OC(C=1NN=NN=1)CO2 YNKGMCPQHSVJBM-UHFFFAOYSA-N 0.000 description 1
- HUNHHUAGWDAVDL-UHFFFAOYSA-N 4-oxo-8-[3-(4-pentylphenyl)prop-2-enoylamino]chromene-2-carboxylic acid Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OC(C(O)=O)=CC2=O HUNHHUAGWDAVDL-UHFFFAOYSA-N 0.000 description 1
- JWSWGVMVRLVNAA-UHFFFAOYSA-N 4h-thiochromene Chemical compound C1=CC=C2CC=CSC2=C1 JWSWGVMVRLVNAA-UHFFFAOYSA-N 0.000 description 1
- KGIJOOYOSFUGPC-CABOLEKPSA-N 5-HETE Natural products CCCCC\C=C/C\C=C/C\C=C/C=C/[C@H](O)CCCC(O)=O KGIJOOYOSFUGPC-CABOLEKPSA-N 0.000 description 1
- KGIJOOYOSFUGPC-MSFIICATSA-N 5-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC=CCC=CCC=C\C=C\[C@@H](O)CCCC(O)=O KGIJOOYOSFUGPC-MSFIICATSA-N 0.000 description 1
- IUUUNZQSMODJAV-UHFFFAOYSA-N 5-[(4-octoxybenzoyl)amino]-3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1C(=O)NC1=C(OC(CO2)C=3NN=NN=3)C2=CC=C1C(O)=O IUUUNZQSMODJAV-UHFFFAOYSA-N 0.000 description 1
- QRLFWVLMJYJYCQ-UHFFFAOYSA-N 8-amino-2-(2h-tetrazol-5-yl)chromen-4-one;hydrochloride Chemical compound Cl.NC1=CC=CC(C(C=2)=O)=C1OC=2C1=NN=NN1 QRLFWVLMJYJYCQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 102000011730 Arachidonate 12-Lipoxygenase Human genes 0.000 description 1
- 108010076676 Arachidonate 12-lipoxygenase Proteins 0.000 description 1
- 102000009515 Arachidonate 15-Lipoxygenase Human genes 0.000 description 1
- 108010048907 Arachidonate 15-lipoxygenase Proteins 0.000 description 1
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 description 1
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 1
- 102000007081 Arachidonate Lipoxygenases Human genes 0.000 description 1
- 108010047815 Arachidonate Lipoxygenases Proteins 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- PTHCMJGKKRQCBF-UHFFFAOYSA-N Cellulose, microcrystalline Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC)C(CO)O1 PTHCMJGKKRQCBF-UHFFFAOYSA-N 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102000005720 Glutathione transferase Human genes 0.000 description 1
- 108010070675 Glutathione transferase Proteins 0.000 description 1
- 201000005569 Gout Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- GWNVDXQDILPJIG-SHSCPDMUSA-N Leukotriene C4 Natural products CCCCCC=C/CC=C/C=C/C=C/C(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(O)CCCC(=O)O GWNVDXQDILPJIG-SHSCPDMUSA-N 0.000 description 1
- 102000017055 Lipoprotein Lipase Human genes 0.000 description 1
- 108010013563 Lipoprotein Lipase Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 102000005398 Monoacylglycerol Lipase Human genes 0.000 description 1
- 108020002334 Monoacylglycerol lipase Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000014384 Type C Phospholipases Human genes 0.000 description 1
- 108010079194 Type C Phospholipases Proteins 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 125000005091 alkenylcarbonylamino group Chemical group 0.000 description 1
- 125000005193 alkenylcarbonyloxy group Chemical group 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000005452 alkenyloxyalkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 230000009285 allergic inflammation Effects 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000005335 azido alkyl group Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XDLDASNSMGOEMX-UHFFFAOYSA-N benzene benzene Chemical compound C1=CC=CC=C1.C1=CC=CC=C1 XDLDASNSMGOEMX-UHFFFAOYSA-N 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000005569 butenylene group Chemical group 0.000 description 1
- 229960005069 calcium Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000003710 calcium ionophore Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 235000012255 calcium oxide Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000003399 chemotactic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000005366 cycloalkylthio group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- WOAZEKPXTXCPFZ-UHFFFAOYSA-N dimethyl(phenyl)azanium;chloride Chemical compound Cl.CN(C)C1=CC=CC=C1 WOAZEKPXTXCPFZ-UHFFFAOYSA-N 0.000 description 1
- 229960001342 dinoprost Drugs 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 210000003038 endothelium Anatomy 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- CJAONIOAQZUHPN-KKLWWLSJSA-N ethyl 12-[[2-[(2r,3r)-3-[2-[(12-ethoxy-12-oxododecyl)-methylamino]-2-oxoethoxy]butan-2-yl]oxyacetyl]-methylamino]dodecanoate Chemical compound CCOC(=O)CCCCCCCCCCCN(C)C(=O)CO[C@H](C)[C@@H](C)OCC(=O)N(C)CCCCCCCCCCCC(=O)OCC CJAONIOAQZUHPN-KKLWWLSJSA-N 0.000 description 1
- ATOWHLSQUFVNEN-UHFFFAOYSA-N ethyl 5-amino-2,3-dihydro-1,4-benzodioxine-3-carboxylate Chemical compound C1=CC(N)=C2OC(C(=O)OCC)COC2=C1 ATOWHLSQUFVNEN-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001867 hydroperoxy group Chemical group [*]OO[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 210000003405 ileum Anatomy 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003199 leukotriene receptor blocking agent Substances 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 108700025647 major vault Proteins 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- RWIKCBHOVNDESJ-NSCUHMNNSA-N methyl (e)-4-bromobut-2-enoate Chemical compound COC(=O)\C=C\CBr RWIKCBHOVNDESJ-NSCUHMNNSA-N 0.000 description 1
- OPFQMORVVYKGSV-UHFFFAOYSA-N methyl 5-[(4-octoxybenzoyl)amino]-3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxylate Chemical compound C1=CC(OCCCCCCCC)=CC=C1C(=O)NC1=C(C(=O)OC)C=CC2=C1OC(C=1NN=NN=1)CO2 OPFQMORVVYKGSV-UHFFFAOYSA-N 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IYTNYMQVCGTLSQ-UHFFFAOYSA-N n-(2,3-dihydro-1,4-benzodioxin-5-yl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide Chemical compound C1=C(OC)C(OCCCCC)=CC=C1C=CC(=O)NC1=CC=CC2=C1OCCO2 IYTNYMQVCGTLSQ-UHFFFAOYSA-N 0.000 description 1
- PVZATXIEOIUQHW-UHFFFAOYSA-N n-(2,3-dihydroxyphenyl)-3-(4-pentylphenyl)prop-2-enamide Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC=CC(O)=C1O PVZATXIEOIUQHW-UHFFFAOYSA-N 0.000 description 1
- LGHBQXYILNXKBW-UHFFFAOYSA-N n-[7-methyl-3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]-3-(4-pentylphenyl)prop-2-enamide Chemical compound C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC(C)=CC2=C1OC(C1=NNN=N1)CO2 LGHBQXYILNXKBW-UHFFFAOYSA-N 0.000 description 1
- LEEGDRLVXNPNGJ-UHFFFAOYSA-N n-[7-methyl-3-(2h-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]-3-(4-pentylphenyl)prop-2-enamide;sodium Chemical compound [Na].C1=CC(CCCCC)=CC=C1C=CC(=O)NC1=CC(C)=CC2=C1OC(C1=NNN=N1)CO2 LEEGDRLVXNPNGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000003905 phosphatidylinositols Chemical class 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PXGPLTODNUVGFL-YNNPMVKQSA-N prostaglandin F2alpha Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O PXGPLTODNUVGFL-YNNPMVKQSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/24—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/29—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/67—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/75—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/38—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/56—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/64—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/52—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/24—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/20—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring with substituents attached to the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Medicinal Preparation (AREA)
- Cosmetics (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP59172570A JPS6150977A (ja) | 1984-08-20 | 1984-08-20 | 新規な縮合ベンズ(チオ)アミド、それらの製造方法およびそれらを有効成分として含有する薬剤 |
| JP59243412A JPS61143371A (ja) | 1984-11-20 | 1984-11-20 | 新規な縮合ベンズ(チオ)アミド |
| JP59246363A JPS61126061A (ja) | 1984-11-22 | 1984-11-22 | アリールカルバモイル化合物 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3587671D1 DE3587671D1 (de) | 1994-01-13 |
| DE3587671T2 true DE3587671T2 (de) | 1994-04-21 |
Family
ID=27323644
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE85305802T Expired - Fee Related DE3587671T2 (de) | 1984-08-20 | 1985-08-15 | (Kondensierte) Benz(thio)amide. |
| DE3588025T Expired - Fee Related DE3588025T2 (de) | 1984-08-20 | 1985-08-15 | Aminophenylderivate. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3588025T Expired - Fee Related DE3588025T2 (de) | 1984-08-20 | 1985-08-15 | Aminophenylderivate. |
Country Status (16)
| Country | Link |
|---|---|
| US (5) | US4780469A (Direct) |
| EP (2) | EP0173516B1 (Direct) |
| KR (1) | KR920006237B1 (Direct) |
| AT (2) | ATE123019T1 (Direct) |
| AU (1) | AU579398B2 (Direct) |
| CA (1) | CA1261835A (Direct) |
| DE (2) | DE3587671T2 (Direct) |
| DK (1) | DK174022B1 (Direct) |
| ES (4) | ES8609217A1 (Direct) |
| FI (1) | FI87782C (Direct) |
| GR (1) | GR852014B (Direct) |
| HU (1) | HU208133B (Direct) |
| IE (1) | IE64552B1 (Direct) |
| NO (1) | NO159447C (Direct) |
| PT (1) | PT80986B (Direct) |
| YU (4) | YU45002B (Direct) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5571817A (en) * | 1984-02-27 | 1996-11-05 | Merck & Co., Inc. | Methods of treating androgenic alopecia with finasteride [17β-N-mono-substituted-carbamoyl-4-aza-5-α-androst-1-en-ones] |
| KR970006472B1 (ko) * | 1987-05-07 | 1997-04-28 | 오노 화아마슈티칼 캄파니 리미팃드 | 신규한 신나모일아미드 유도체, 그들의 제조방법, 그들을 함유하는 제약학적 조성물 및 그들의 사용 |
| US5191113A (en) * | 1987-05-07 | 1993-03-02 | Ono Pharmaceutical Co., Ltd. | Cinnamoylamide derivatives |
| ES2051843T3 (es) * | 1987-05-11 | 1994-07-01 | Ono Pharmaceutical Co | Un proceso para la preparacion de un derivado del acido benzoilaminofenoxibutanico. |
| ES2063756T3 (es) * | 1987-06-04 | 1995-01-16 | Ono Pharmaceutical Co | Derivados de acido benzoilaminofenoxibutanoico. |
| KR970006473B1 (ko) * | 1987-06-08 | 1997-04-28 | 오노 화아마슈티칼 캄파니 리미팃드 | 신나모일아미드 유도체, 그들의 제조방법, 그들을 함유하는 제약학적 조성물 및 그들의 사용 |
| US4950684A (en) * | 1988-05-20 | 1990-08-21 | G. D. Searle & Co. | 2,2-di-substituted benzopyran leukotriene-D4 antagonists |
| US5093353A (en) * | 1988-05-20 | 1992-03-03 | G. D. Searle & Co. | 2,2-di-substituted benzopyran leukotriene-D4 antagonists |
| EP0389607A1 (en) * | 1988-09-14 | 1990-10-03 | Biota Scientific Management Pty. Ltd. | Chromone derivatives |
| US4970205A (en) * | 1988-12-23 | 1990-11-13 | Smithkline Beecham Corporation | Sulfonic acid substituted aromatic steroids as inhibitors of steroid 5-α-reductase |
| US4937237A (en) * | 1988-12-23 | 1990-06-26 | Smithkline Beckman Corporation | Phosphinic acid substituted aromatic steroids as inhibitors of steroid 5-60 -reductase |
| JPH03204875A (ja) * | 1989-10-03 | 1991-09-06 | Wakamoto Pharmaceut Co Ltd | テトラゾール酢酸誘導体、及び該誘導体を有効成分とするアルドースレダクターゼ阻害剤 |
| JP3095413B2 (ja) * | 1990-12-28 | 2000-10-03 | 帝人株式会社 | ベンゾオキサ縮合環化合物 |
| CA2062587A1 (en) * | 1991-03-11 | 1992-09-12 | Toshiaki Kumazawa | Indole derivatives |
| IL101243A (en) * | 1991-03-20 | 1999-12-22 | Merck & Co Inc | Pharmaceutical preparations for the treatment of benign prostatic hyperplasia containing steroid history |
| HUT68636A (en) * | 1992-01-24 | 1995-07-28 | Teijin Ltd | Benzopyrane derivatives, process for producing them, and pharmaceutical compositions containing them |
| GB9224922D0 (en) * | 1992-11-27 | 1993-01-13 | Smithkline Beecham Plc | Process |
| AU7198794A (en) * | 1994-03-18 | 1995-10-09 | Smithkline Beecham Corporation | Treating cyclosporine-induced nephrotoxicity |
| GB9407335D0 (en) * | 1994-04-12 | 1994-06-08 | Smithkline Beecham Corp | Method of treatment |
| US5753700A (en) * | 1994-12-28 | 1998-05-19 | Ono Pharmaceutical Co., Ltd. | Naphthyloxyacetic acid derivatives |
| AR004029A1 (es) * | 1995-10-20 | 1998-09-30 | Smithkline Beecham Plc | Nuevas formulaciones farmaceuticas |
| DK0929809T3 (da) * | 1995-12-08 | 2000-08-28 | Martin Raithel | Fremgangsmåde og apparat til in vitro diagnose af allergiske lidelser |
| CZ248798A3 (cs) * | 1996-02-08 | 1999-01-13 | Merck And Co., Inc. | Farmaceutický prostředek |
| GB9616629D0 (en) * | 1996-08-08 | 1996-09-25 | Smithkline Beecham Plc | Carbonylation reaction |
| DE19723722A1 (de) * | 1997-05-30 | 1998-12-10 | Schering Ag | Nichtsteroidale Gestagene |
| US6245804B1 (en) | 1997-05-30 | 2001-06-12 | Schering Aktiengesellschaft | Nonsteroidal gestagens |
| US6300514B1 (en) | 1997-06-25 | 2001-10-09 | Ono Pharmaceutical Co., Ltd. | Aryl (sulfide, sulfoxide and sulfone) derivatives and drugs containing the same as the active ingredient |
| TWI245035B (en) | 1998-06-26 | 2005-12-11 | Ono Pharmaceutical Co | Amino acid derivatives and a pharmaceutical composition comprising the derivatives |
| US6262066B1 (en) | 1998-07-27 | 2001-07-17 | Schering Corporation | High affinity ligands for nociceptin receptor ORL-1 |
| DE19856475A1 (de) * | 1998-11-27 | 2000-05-31 | Schering Ag | Nichtsteroidale Entzündungshemmer |
| DE60045474D1 (de) | 1999-01-13 | 2011-02-17 | Univ New York State Res Found | Neues verfahren zum erschaffen von proteinkinase-inhibitoren |
| IT1320162B1 (it) | 2000-02-09 | 2003-11-18 | Rotta Research Lab | Derivati della tirosina ad attivita' anti leucotrienica, procedimentoper la loro preparazione e loro uso farmaceutico. |
| WO2002060446A1 (fr) | 2001-01-29 | 2002-08-08 | Shionogi & Co., Ltd. | Preparation medicamenteuse contenant du 5-methyle-1-phenyle-2-(1h)-pyridone en tant que principe actif |
| FR2827599A1 (fr) * | 2001-07-20 | 2003-01-24 | Neuro3D | Composes derives de quinoleine et quinoxaline,preparation et utilisations |
| US7005445B2 (en) | 2001-10-22 | 2006-02-28 | The Research Foundation Of State University Of New York | Protein kinase and phosphatase inhibitors and methods for designing them |
| EP1463714A4 (en) * | 2001-12-10 | 2005-10-19 | Amgen Inc | VANILLOID RECEPTOR LIGANDS AND THEIR USE IN TREATMENTS |
| EP2105431A1 (en) * | 2002-02-28 | 2009-09-30 | Sumitomo Chemical Company, Limited | Process for Producing Chromone Compound |
| US7148248B2 (en) * | 2002-11-29 | 2006-12-12 | Masako Nozaki | Method of treating or inhibiting the development of brain inflammation and sepsis |
| RU2387646C2 (ru) * | 2003-08-29 | 2010-04-27 | Рэнбакси Лабораториз Лимитед | Ингибиторы фосфодиэстеразы типа-iv |
| JP4720502B2 (ja) * | 2003-09-01 | 2011-07-13 | 小野薬品工業株式会社 | 縮環化合物およびその用途 |
| ITTO20030140U1 (it) * | 2003-09-16 | 2005-03-17 | Interfila Srl | Matita cosmetica |
| WO2005032544A1 (en) | 2003-09-19 | 2005-04-14 | Galileo Pharmaceuticals, Inc. | Treatment of mitochondrial diseases |
| US7196119B2 (en) * | 2003-10-21 | 2007-03-27 | The Regents Of The University Of California | Development of new selective estrogen receptor modulators |
| WO2005051931A2 (en) * | 2003-11-26 | 2005-06-09 | Ranbaxy Laboratories Limited | Phosphodiesterase inhibitors |
| KR100683274B1 (ko) * | 2004-02-12 | 2007-02-15 | 에스케이케미칼주식회사 | 치환된 벤조피란 화합물의 제조방법 |
| KR101213926B1 (ko) * | 2004-07-14 | 2012-12-18 | 인플러메이션 리서치 센터 컴퍼니 엘티디. | 종양 세포의 전이를 저해하는 방법 및 약제학적 조성물 |
| CA2585122A1 (en) | 2004-10-25 | 2006-05-04 | Schering Corporation | M1 and/or m3 receptor antagonists in combination with other actives for treating respiratory disorders |
| US20110092566A1 (en) * | 2004-11-19 | 2011-04-21 | Srivastava Satish K | Treatment of cancer with aldose reductase inhibitors |
| CA2589363A1 (en) | 2004-12-13 | 2006-06-22 | Eli Lilly And Company | Spiro derivatives as lipoxygenase inhibitors |
| US7968574B2 (en) | 2004-12-28 | 2011-06-28 | Kinex Pharmaceuticals, Llc | Biaryl compositions and methods for modulating a kinase cascade |
| CA2594345C (en) | 2004-12-28 | 2013-11-05 | Kinex Pharmaceuticals, Llc | Compositions and methods of treating cell proliferation disorders |
| US20080207588A1 (en) | 2005-02-25 | 2008-08-28 | Chu Daniel T W | Spiro-Heterocyclic Chromans, Thiochromans and Dihydroquinolines |
| EP1934219A1 (en) | 2005-09-16 | 2008-06-25 | Ranbaxy Laboratories Limited | Substituted pyrazolo [3,4-b] pyridines as phosphodiesterase inhibitors |
| WO2007045980A1 (en) * | 2005-10-19 | 2007-04-26 | Ranbaxy Laboratories Limited | Compositions of phosphodiesterase type iv inhibitors |
| US7838542B2 (en) | 2006-06-29 | 2010-11-23 | Kinex Pharmaceuticals, Llc | Bicyclic compositions and methods for modulating a kinase cascade |
| CA2656564C (en) | 2006-06-29 | 2015-06-16 | Kinex Pharmaceuticals, Llc | Biaryl compositions and methods for modulating a kinase cascade |
| BRPI0717058A2 (pt) * | 2006-09-22 | 2013-10-15 | Ranbaxy Lab Ltd | Composto, composição farmacêutica, método para tratar, prevenir, inibir ou suprimir uma condição inflamatória ou doença ou doenças do sistema nervoso central e método para a preparação de um composto |
| WO2008035316A2 (en) * | 2006-09-22 | 2008-03-27 | Ranbaxy Laboratories Limited | Phosphodiesterase inhibitors |
| TWI457336B (zh) | 2006-12-28 | 2014-10-21 | Kinex Pharmaceuticals Llc | 調節激酶級聯之組成物及方法 |
| US7939529B2 (en) | 2007-05-17 | 2011-05-10 | Kinex Pharmaceuticals, Llc | Process for the preparation of compositions for modulating a kinase cascade and methods of use thereof |
| US7935697B2 (en) | 2006-12-28 | 2011-05-03 | Kinex Pharmaceuticals, Llc | Compositions for modulating a kinase cascade and methods of use thereof |
| EP1958947A1 (en) | 2007-02-15 | 2008-08-20 | Ranbaxy Laboratories Limited | Inhibitors of phosphodiesterase type 4 |
| SI2124944T1 (sl) * | 2007-03-14 | 2012-05-31 | Ranbaxy Lab Ltd | Derivati pirazolo b piridina kot inhibitorji fosfodiesteraze |
| WO2008111009A1 (en) * | 2007-03-14 | 2008-09-18 | Ranbaxy Laboratories Limited | Pyrazolo [3, 4-b] pyridine derivatives as phosphodiesterase inhibitors |
| CA2685202C (en) * | 2007-03-23 | 2017-11-28 | The Board Of Regents Of The University Of Texas System | Methods for treating allergic asthma |
| US8124605B2 (en) | 2007-07-06 | 2012-02-28 | Kinex Pharmaceuticals, Llc | Compositions and methods for modulating a kinase cascade |
| EP2111861A1 (en) | 2008-04-21 | 2009-10-28 | Ranbaxy Laboratories Limited | Compositions of phosphodiesterase type IV inhibitors |
| JP2011519916A (ja) * | 2008-07-02 | 2011-07-14 | ファーマコステック カンパニー リミテッド | アミド誘導体の製造方法 |
| US8987258B2 (en) | 2008-09-29 | 2015-03-24 | Christopher Oalmann | Chromenone analogs as sirtuin modulators |
| WO2010147947A2 (en) | 2009-06-16 | 2010-12-23 | Schering Corporation | NOVEL [3,2-c] HETEROARYL STEROIDS AS GLUCOCORTICOID RECEPTOR AGONISTS, COMPOSITIONS AND USES THEREOF |
| WO2011129936A2 (en) | 2010-04-16 | 2011-10-20 | Kinex Pharmaceuticals, Llc | Compositions and methods for the prevention and treatment of cancer |
| US9156830B2 (en) | 2011-05-17 | 2015-10-13 | Shionogi & Co., Ltd. | Heterocyclic compounds |
| EP2890680B1 (en) | 2012-08-30 | 2018-02-28 | Athenex, Inc. | N-(3-fluorobenzyl)-2-(5-(4-morpholinophenyl)pyridin-2-yl) acetamide as protein tyrosine kinase modulators |
| WO2016032569A1 (en) * | 2014-08-29 | 2016-03-03 | Celladon Corporation | Quinolines and their use for treating endoplasmic reticulum stress-caused diseases |
| US20200347038A1 (en) | 2014-08-29 | 2020-11-05 | Russell Dahl | Quinolines that modulate serca and their use for treating disease |
| CA2937365C (en) | 2016-03-29 | 2018-09-18 | F. Hoffmann-La Roche Ag | Granulate formulation of 5-methyl-1-phenyl-2-(1h)-pyridone and method of making the same |
| US11730729B2 (en) | 2020-07-20 | 2023-08-22 | Neurodon Corporation | Quinolines that modulate SERCA and their use for treating disease |
| CN113549044B (zh) * | 2021-07-23 | 2024-01-23 | 中国药科大学 | 8-氮杂环取代色酮类衍生物及其制备方法与制药用途 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1077936A (en) * | 1964-09-08 | 1967-08-02 | Smith & Nephew | Substituted benzanilides |
| GB1080503A (en) * | 1965-07-02 | 1967-08-23 | Smith & Nephew | Substituted acetic acids and a process for their preparation |
| GB1088295A (en) * | 1965-07-10 | 1967-10-25 | Smith & Nephew | Derivatives of alkanoic acids and methods for their preparation |
| US3549689A (en) * | 1967-05-23 | 1970-12-22 | Sandoz Ag | Phenoxy-alkanoic acids |
| GB1185539A (en) * | 1967-11-03 | 1970-03-25 | Smith & Nephew | Substituted Tetrazoles |
| FR2164481A1 (en) * | 1971-12-21 | 1973-08-03 | Aries Robert | Phenylacylamino phenylalkanoic acids - antiinflammatories antipyretics analgesics and antirheumatics |
| GB1484413A (en) * | 1974-04-18 | 1977-09-01 | Kissei Pharmaceutical | Aromatic amidocarboxylic acid derivatives |
| US4205079A (en) * | 1978-10-16 | 1980-05-27 | Shell Oil Company | Benzodioxincarboxamides |
| NO174506B (no) * | 1984-10-30 | 1994-02-07 | Usv Pharma Corp | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
| WO1986005779A1 (en) * | 1985-04-03 | 1986-10-09 | Yamanouchi Pharmaceutical Co., Ltd. | Phenylene derivatives |
| ES2063756T3 (es) * | 1987-06-04 | 1995-01-16 | Ono Pharmaceutical Co | Derivados de acido benzoilaminofenoxibutanoico. |
-
1985
- 1985-08-14 CA CA000488741A patent/CA1261835A/en not_active Expired
- 1985-08-15 DE DE85305802T patent/DE3587671T2/de not_active Expired - Fee Related
- 1985-08-15 EP EP85305802A patent/EP0173516B1/en not_active Expired - Lifetime
- 1985-08-15 DE DE3588025T patent/DE3588025T2/de not_active Expired - Fee Related
- 1985-08-15 EP EP91114142A patent/EP0463638B1/en not_active Expired - Lifetime
- 1985-08-15 AT AT91114142T patent/ATE123019T1/de not_active IP Right Cessation
- 1985-08-15 AT AT85305802T patent/ATE97897T1/de not_active IP Right Cessation
- 1985-08-17 HU HU853184A patent/HU208133B/hu not_active IP Right Cessation
- 1985-08-19 PT PT80986A patent/PT80986B/pt not_active IP Right Cessation
- 1985-08-19 YU YU1321/85A patent/YU45002B/xx unknown
- 1985-08-19 ES ES546269A patent/ES8609217A1/es not_active Expired
- 1985-08-19 DK DK198503753A patent/DK174022B1/da not_active IP Right Cessation
- 1985-08-19 FI FI853178A patent/FI87782C/fi not_active IP Right Cessation
- 1985-08-19 KR KR1019850005970A patent/KR920006237B1/ko not_active Expired
- 1985-08-19 NO NO853261A patent/NO159447C/no not_active IP Right Cessation
- 1985-08-19 IE IE203585A patent/IE64552B1/en not_active IP Right Cessation
- 1985-08-20 US US06/767,538 patent/US4780469A/en not_active Expired - Lifetime
- 1985-08-20 AU AU46462/85A patent/AU579398B2/en not_active Ceased
- 1985-08-20 GR GR852014A patent/GR852014B/el unknown
-
1986
- 1986-03-06 ES ES552745A patent/ES8800211A1/es not_active Expired
- 1986-03-06 ES ES552747A patent/ES8704455A1/es not_active Expired
- 1986-03-06 ES ES552746A patent/ES8704476A1/es not_active Expired
-
1987
- 1987-07-31 YU YU01446/87A patent/YU144687A/xx unknown
- 1987-07-31 YU YU1447/87A patent/YU44955B/xx unknown
- 1987-08-31 YU YU01448/87A patent/YU144887A/xx unknown
-
1988
- 1988-06-17 US US07/207,994 patent/US4847275A/en not_active Expired - Lifetime
-
1989
- 1989-04-04 US US07/332,930 patent/US4939141A/en not_active Expired - Lifetime
-
1991
- 1991-11-29 US US07/800,253 patent/US5446058A/en not_active Expired - Fee Related
-
1994
- 1994-10-21 US US08/327,825 patent/US5459134A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3587671T2 (de) | (Kondensierte) Benz(thio)amide. | |
| DE69001342T2 (de) | Heterocyclische derivate mit lipoxygenase hemmender wirkung. | |
| EP0183159A2 (de) | 1-Heteroaryl-4-aryl-pyrazolin-5-one zur Verwendung als Arzneimittel | |
| DE69030202T2 (de) | Phenylalkan(en)-Säuren mit Leukotrien B4 antagonistischer Wirkung | |
| DD263287A5 (de) | Verfahren zur herstellung von phenoxyalkylcarbonsaeurederivaten | |
| DE69232046T2 (de) | 2,4-diaryl-1,3-dithiolane als platelet activating faktor rezeptorblocker und 5-lipoxygenasehemmer | |
| DE69708130T2 (de) | A-oxo-butansäuren enthaltende pharmazeutische zusammensetzung | |
| JPS6097946A (ja) | カルボキサミド誘導体 | |
| KR0129526B1 (ko) | (rs)-2-(2,3-디히드로-5-히드록시-4,6,7-트리메틸벤조푸라닐)아세트산 및 2-(2,3-디히드로-5-아실옥시-4,6,7-트리메틸벤조푸라닐)아세트산 및 이들의 에스테르, 점액 조절제 및 안티히스케믹 약제로서 이들의 용도, 그리고 이들의 제조방법 | |
| DE3326164A1 (de) | Neue p-oxibenzoesaeure-derivate, sowie verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| JPH0430955B2 (Direct) | ||
| DE3141387A1 (de) | 6-substituierte 6h-dibenzo(b,d)pyran-derivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel | |
| DE69720718T2 (de) | Als entzündungshemmende mittel nützliche dihydrobenzofurane und verwandte verbindungen | |
| DE3888394T2 (de) | Phenolische Thioäther, Sulfoxide und Disulfide als Hemmstoffe der 5-Lipoxigenase. | |
| DE3125059A1 (de) | Dioxybenzoletherderivate, diese enthaltende arzneimittel, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3872576T2 (de) | Leukotrienantagonisten. | |
| EP0419410A2 (de) | Weitere neue Alkanophenone | |
| DE3632893A1 (de) | 4-(r)-hydroxy-6(s)-arylthiomethyl-tetrahydropyran-2-one, deren entsprechende sulfoxide und sulfone, verfahren zu ihrer herstellung, ihre verwendung als arzneimittel, pharmazeutische praeparate und zwischenprodukte | |
| DE3874021T2 (de) | Leukotrien-antagonisten. | |
| DE69612416T2 (de) | Thiophenverbindungen, Verfahren zu deren Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| EP0371342B1 (de) | 2-Halogensubstituierte N-Indolylethyl-sulfonsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2632097C2 (de) | Cyclopentanderivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| AT363085B (de) | Verfahren zur herstellung von neuen substituierten thiazolidin-, thiazan- und verwandten carbonsaeuren und von deren salzen und isomeren | |
| EP0334147A1 (de) | Disubstituierte Pyrrole | |
| JPH0433785B2 (Direct) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |