DE3502935A1 - 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung - Google Patents
3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellungInfo
- Publication number
- DE3502935A1 DE3502935A1 DE19853502935 DE3502935A DE3502935A1 DE 3502935 A1 DE3502935 A1 DE 3502935A1 DE 19853502935 DE19853502935 DE 19853502935 DE 3502935 A DE3502935 A DE 3502935A DE 3502935 A1 DE3502935 A1 DE 3502935A1
- Authority
- DE
- Germany
- Prior art keywords
- benzoyl
- acrylic acid
- halogen
- dichloro
- fluoro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- DIRFIAXLTZSXFX-UHFFFAOYSA-N 3-amino-2-benzoylprop-2-enoic acid Chemical class NC=C(C(O)=O)C(=O)C1=CC=CC=C1 DIRFIAXLTZSXFX-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 238000000034 method Methods 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 17
- 150000002367 halogens Chemical group 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 8
- 125000004429 atom Chemical group 0.000 claims abstract description 4
- 125000004185 ester group Chemical group 0.000 claims abstract description 4
- 125000002560 nitrile group Chemical group 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims abstract 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims abstract 2
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 claims description 12
- -1 2,4-dichloro-5-fluoro-benzoyl Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 5
- YTLYLLTVENPWFT-UPHRSURJSA-N (Z)-3-aminoacrylic acid Chemical class N\C=C/C(O)=O YTLYLLTVENPWFT-UPHRSURJSA-N 0.000 claims description 4
- ZKKBIZXAEDFPNL-HWKANZROSA-N (e)-3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)\C=C\C#N ZKKBIZXAEDFPNL-HWKANZROSA-N 0.000 claims description 3
- 229940124350 antibacterial drug Drugs 0.000 claims description 3
- 239000000543 intermediate Substances 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- MVUMJYQUKKUOHO-AATRIKPKSA-N ethyl (e)-3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)\C=C\N(C)C MVUMJYQUKKUOHO-AATRIKPKSA-N 0.000 claims description 2
- DJRMXRPIBLNZHF-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl DJRMXRPIBLNZHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 2
- 239000012312 sodium hydride Substances 0.000 claims description 2
- 238000003786 synthesis reaction Methods 0.000 claims description 2
- OOYUDIUHADUBQU-UHFFFAOYSA-N 3-(dimethylamino)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enenitrile Chemical compound CN(C)C=C(C#N)C(=O)C1=CC(F)=C(F)C(F)=C1F OOYUDIUHADUBQU-UHFFFAOYSA-N 0.000 claims 1
- TYCHBDHDMFEQMC-UHFFFAOYSA-N 3-(dimethylamino)-2-methylprop-2-enoic acid Chemical compound CN(C)C=C(C)C(O)=O TYCHBDHDMFEQMC-UHFFFAOYSA-N 0.000 claims 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims 1
- 150000002825 nitriles Chemical class 0.000 claims 1
- 150000007530 organic bases Chemical class 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- MVPDNJQLPITPIX-UHFFFAOYSA-N methyl 3-(dimethylamino)prop-2-enoate Chemical compound COC(=O)C=CN(C)C MVPDNJQLPITPIX-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 1
- OEWWJZAULLIKCF-UHFFFAOYSA-N 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)-N,N-dimethylprop-2-enamide Chemical compound CN(C)C=C(C(=O)N(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl OEWWJZAULLIKCF-UHFFFAOYSA-N 0.000 description 1
- KIRNFSAHNUCFLV-UHFFFAOYSA-N 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)C=C(C#N)C(=O)C1=CC(F)=C(Cl)C=C1Cl KIRNFSAHNUCFLV-UHFFFAOYSA-N 0.000 description 1
- GCSHFLICMVGYIB-UHFFFAOYSA-N 2-(3-aminobenzoyl)prop-2-enoic acid Chemical class NC1=CC=CC(C(=O)C(=C)C(O)=O)=C1 GCSHFLICMVGYIB-UHFFFAOYSA-N 0.000 description 1
- MDDTUQMEJPHYCI-UHFFFAOYSA-N 2-benzoyl-3-(cyclopropylamino)prop-2-enoic acid Chemical class C=1C=CC=CC=1C(=O)C(C(=O)O)=CNC1CC1 MDDTUQMEJPHYCI-UHFFFAOYSA-N 0.000 description 1
- OUIMZYIYOUVAEG-UHFFFAOYSA-N 3-(dimethylamino)prop-2-enamide Chemical compound CN(C)C=CC(N)=O OUIMZYIYOUVAEG-UHFFFAOYSA-N 0.000 description 1
- NKNBYFBSHOGEKE-UHFFFAOYSA-N 3-(dimethylamino)prop-2-enoic acid Chemical compound CN(C)C=CC(O)=O NKNBYFBSHOGEKE-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZEOSLMAUCLJTPH-UHFFFAOYSA-N CC(NC1CC1)=C(C(C(C=C(C(Cl)=C1)F)=C1Cl)=O)C(O)=O Chemical compound CC(NC1CC1)=C(C(C(C=C(C(Cl)=C1)F)=C1Cl)=O)C(O)=O ZEOSLMAUCLJTPH-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- HXELGNKCCDGMMN-UHFFFAOYSA-N [F].[Cl] Chemical compound [F].[Cl] HXELGNKCCDGMMN-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- OFULWOHHSSJLTJ-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(diethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(CC)CC)C(=O)C1=CC(F)=C(Cl)C=C1Cl OFULWOHHSSJLTJ-UHFFFAOYSA-N 0.000 description 1
- UYJWKMILOGUYTL-UHFFFAOYSA-N ethyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1CC1 UYJWKMILOGUYTL-UHFFFAOYSA-N 0.000 description 1
- ANTPVARYELNKNQ-UHFFFAOYSA-N ethyl 3-(diethylamino)prop-2-enoate Chemical compound CCOC(=O)C=CN(CC)CC ANTPVARYELNKNQ-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- YCDBNUJZSAFBIY-UHFFFAOYSA-N methyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OC)=CNC1CC1 YCDBNUJZSAFBIY-UHFFFAOYSA-N 0.000 description 1
- NUKQGQGCRCXGMN-UHFFFAOYSA-N methyl 3-pyrrolidin-1-ylprop-2-enoate Chemical compound COC(=O)C=CN1CCCC1 NUKQGQGCRCXGMN-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Paints Or Removers (AREA)
- Dental Preparations (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Materials For Medical Uses (AREA)
- Adhesives Or Adhesive Processes (AREA)
Priority Applications (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853502935 DE3502935A1 (de) | 1984-09-29 | 1985-01-30 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
| CN85101686A CN85101686B (zh) | 1985-01-30 | 1985-04-01 | 3-氨基-2-苯甲酰基—丙烯酸衍生物和它的一个制造方法 |
| UA4028029A UA8023A1 (uk) | 1984-09-29 | 1985-09-09 | Спосіб отримання похідних акрилової кислоти |
| US06/775,202 US4699992A (en) | 1984-09-29 | 1985-09-12 | 3-amino-2-benzoylacrylic acid derivatives |
| NO853604A NO170150C (no) | 1984-09-29 | 1985-09-13 | 3-amino-2-benzoyl-akrylsyrederivater og fremgangsmaate forfremstilling av disse |
| EP85111670A EP0176846B1 (de) | 1984-09-29 | 1985-09-16 | 3-Amino-2-benzoyl-acrylsäurederivate und ein Verfahren zu ihrer Herstellung |
| DE8585111670T DE3572345D1 (en) | 1984-09-29 | 1985-09-16 | 3-amino-2-benzoyl-acrylic-acid derivatives and process for their preparation |
| AT85111670T ATE45565T1 (de) | 1984-09-29 | 1985-09-16 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung. |
| ES547253A ES8705098A1 (es) | 1984-09-29 | 1985-09-24 | Procedimiento para la obtencion de derivados del acido 3-amino-2-benzoil-acrilico. |
| FI853717A FI87765C (fi) | 1984-09-29 | 1985-09-26 | 3-amino-2-benzoyl-akrylsyraderivat, foerfarande foer deras framstaellning och deras anvaendning som mellanprodukter vid framstaellning av antibakteriella kinolonkarboxylsyror |
| GR852344A GR852344B (enExample) | 1984-09-29 | 1985-09-26 | |
| IL76521A IL76521A (en) | 1984-09-29 | 1985-09-27 | 3-amino-2-benzoylacrylic acid derivatives and their preparation |
| CA000491695A CA1255678A (en) | 1984-09-29 | 1985-09-27 | 3-amino-2-benzoylacrylic acid derivatives and a process for their preparation |
| HU853743A HU193346B (en) | 1984-09-29 | 1985-09-27 | Process for preparing 3-amino-2-benzoyl-acrylic acid derivatives |
| PT81214A PT81214B (pt) | 1984-09-29 | 1985-09-27 | Processo de preparacao de derivados de acido 3-amino-2-benzoilacrilico |
| DK438885A DK170638B1 (da) | 1984-09-29 | 1985-09-27 | Fremgangsmåde til fremstilling af 3-amino-2-benzoylacrylsyrederivater |
| KR1019850007204A KR870001999B1 (ko) | 1984-09-29 | 1985-09-28 | 3-아미노-2-벤조일아크릴산 유도체의 제조 방법 |
| SU864028029A SU1590039A3 (ru) | 1984-09-29 | 1986-08-27 | Способ получени производных акриловой кислоты |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3435930 | 1984-09-29 | ||
| DE19853502935 DE3502935A1 (de) | 1984-09-29 | 1985-01-30 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3502935A1 true DE3502935A1 (de) | 1986-04-10 |
Family
ID=25825268
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853502935 Withdrawn DE3502935A1 (de) | 1984-09-29 | 1985-01-30 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
| DE8585111670T Expired DE3572345D1 (en) | 1984-09-29 | 1985-09-16 | 3-amino-2-benzoyl-acrylic-acid derivatives and process for their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8585111670T Expired DE3572345D1 (en) | 1984-09-29 | 1985-09-16 | 3-amino-2-benzoyl-acrylic-acid derivatives and process for their preparation |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4699992A (enExample) |
| EP (1) | EP0176846B1 (enExample) |
| KR (1) | KR870001999B1 (enExample) |
| AT (1) | ATE45565T1 (enExample) |
| CA (1) | CA1255678A (enExample) |
| DE (2) | DE3502935A1 (enExample) |
| DK (1) | DK170638B1 (enExample) |
| ES (1) | ES8705098A1 (enExample) |
| FI (1) | FI87765C (enExample) |
| GR (1) | GR852344B (enExample) |
| HU (1) | HU193346B (enExample) |
| IL (1) | IL76521A (enExample) |
| NO (1) | NO170150C (enExample) |
| PT (1) | PT81214B (enExample) |
| SU (1) | SU1590039A3 (enExample) |
| UA (1) | UA8023A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3821798A1 (de) * | 1988-06-09 | 1990-02-22 | Lentia Gmbh | Verfahren zur herstellung von substituierten 3-amino-2-(benzoyl)-acrylsaeureestern, sowie ein verfahren zur herstellung von zwischenprodukten fuer antibakterielle wirkstoffe aus diesen verbindungen |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4772706A (en) * | 1986-01-13 | 1988-09-20 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| DE3615767A1 (de) * | 1986-05-10 | 1987-11-12 | Bayer Ag | Verfahren zur herstellung von 4-hydroxy-chinolin-3-carbonsaeuren |
| US5591744A (en) * | 1987-04-16 | 1997-01-07 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| KR910003634B1 (ko) * | 1988-06-17 | 1991-06-07 | 한국과학기술원 | 니트로벤조일-3-시클로프로필아미노아크릴레이트 및 그 제조방법 |
| US5138088A (en) * | 1988-06-17 | 1992-08-11 | Korea Advanced Institute Of Science And Technology | Nitrobenzoyl-3-cyclopropylaminoacrylates and a process for the preparation thereof |
| GB8814881D0 (en) * | 1988-06-22 | 1988-07-27 | Shell Int Research | Herbicidal acrylonitrile derivatives |
| IL91418A (en) * | 1988-09-01 | 1997-11-20 | Rhone Poulenc Agrochimie | (hetero) cyclic amide derivatives, process for their preparation and fungicidal compositions containing them |
| FR2649699A1 (fr) * | 1989-07-13 | 1991-01-18 | Rhone Poulenc Agrochimie | 4-phenyl pyrimidine fongicides |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
| DE4015299A1 (de) * | 1990-05-12 | 1991-11-14 | Bayer Ag | Verfahren zur herstellung von 3-amino-2-(het)-aroyl-acrylsaeurederivaten |
| US5059709A (en) * | 1990-11-13 | 1991-10-22 | American Cyanamid Company | Process for the synthesis of α-[(dialkylamino)substituted-methylene]-β-oxo-(substituted)propanentriles |
| DE19826050A1 (de) * | 1998-06-12 | 1999-12-16 | Bayer Ag | Verfahren zur Herstellung von Chinolon- und Naphthyridoncarbonsäuren und deren Ester |
| US6531624B1 (en) | 1998-11-18 | 2003-03-11 | Asahi Glass Company Ltd. | Aminoacrylic acid derivatives and process for producing the same |
| DE10021900A1 (de) * | 2000-05-08 | 2001-11-15 | Bayer Ag | Phenyl-substituierte 2-Enamino-Ketonitrile |
| CN104292159B (zh) * | 2014-10-10 | 2016-12-07 | 浙江同丰医药化工有限公司 | 一种诺氟沙星、环丙沙星及恩诺沙星的制备方法 |
| CN114436875B (zh) * | 2022-03-01 | 2023-05-12 | 江苏飞宇医药科技股份有限公司 | 一种环丙乙酯胺化物的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865863A (en) * | 1972-06-22 | 1975-02-11 | Hoffmann La Roche | 2-(Benzoyl)-3-dimethylaminoacrylonitriles |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| JPS55500866A (enExample) * | 1978-11-03 | 1980-10-30 | ||
| US4243406A (en) * | 1978-12-26 | 1981-01-06 | Monsanto Company | 5-Aryl-4-isoxazolecarboxylate-safening agents |
| DE3142854A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
| NZ208555A (en) * | 1983-06-23 | 1987-06-30 | American Cyanamid Co | (3-amino-1h-pyrazol-4-yl)-arylmethanone derivatives |
-
1985
- 1985-01-30 DE DE19853502935 patent/DE3502935A1/de not_active Withdrawn
- 1985-09-09 UA UA4028029A patent/UA8023A1/uk unknown
- 1985-09-12 US US06/775,202 patent/US4699992A/en not_active Expired - Lifetime
- 1985-09-13 NO NO853604A patent/NO170150C/no unknown
- 1985-09-16 EP EP85111670A patent/EP0176846B1/de not_active Expired
- 1985-09-16 AT AT85111670T patent/ATE45565T1/de not_active IP Right Cessation
- 1985-09-16 DE DE8585111670T patent/DE3572345D1/de not_active Expired
- 1985-09-24 ES ES547253A patent/ES8705098A1/es not_active Expired
- 1985-09-26 FI FI853717A patent/FI87765C/fi not_active IP Right Cessation
- 1985-09-26 GR GR852344A patent/GR852344B/el unknown
- 1985-09-27 DK DK438885A patent/DK170638B1/da not_active IP Right Cessation
- 1985-09-27 IL IL76521A patent/IL76521A/xx not_active IP Right Cessation
- 1985-09-27 HU HU853743A patent/HU193346B/hu not_active IP Right Cessation
- 1985-09-27 CA CA000491695A patent/CA1255678A/en not_active Expired
- 1985-09-27 PT PT81214A patent/PT81214B/pt not_active IP Right Cessation
- 1985-09-28 KR KR1019850007204A patent/KR870001999B1/ko not_active Expired
-
1986
- 1986-08-27 SU SU864028029A patent/SU1590039A3/ru active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3821798A1 (de) * | 1988-06-09 | 1990-02-22 | Lentia Gmbh | Verfahren zur herstellung von substituierten 3-amino-2-(benzoyl)-acrylsaeureestern, sowie ein verfahren zur herstellung von zwischenprodukten fuer antibakterielle wirkstoffe aus diesen verbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| DK438885D0 (da) | 1985-09-27 |
| EP0176846B1 (de) | 1989-08-16 |
| DK438885A (da) | 1986-03-30 |
| NO853604L (no) | 1986-04-01 |
| EP0176846A3 (en) | 1987-06-03 |
| EP0176846A2 (de) | 1986-04-09 |
| UA8023A1 (uk) | 1995-12-26 |
| DE3572345D1 (en) | 1989-09-21 |
| CA1255678A (en) | 1989-06-13 |
| HU193346B (en) | 1987-09-28 |
| NO170150C (no) | 1992-09-16 |
| ATE45565T1 (de) | 1989-09-15 |
| SU1590039A3 (ru) | 1990-08-30 |
| ES8705098A1 (es) | 1987-04-16 |
| KR870001999B1 (ko) | 1987-11-30 |
| US4699992A (en) | 1987-10-13 |
| DK170638B1 (da) | 1995-11-20 |
| IL76521A (en) | 1988-10-31 |
| IL76521A0 (en) | 1986-01-31 |
| HUT39148A (en) | 1986-08-28 |
| PT81214B (pt) | 1988-01-22 |
| NO170150B (no) | 1992-06-09 |
| ES547253A0 (es) | 1987-04-16 |
| KR860002453A (ko) | 1986-04-26 |
| FI87765B (fi) | 1992-11-13 |
| FI853717L (fi) | 1986-03-30 |
| FI87765C (fi) | 1993-02-25 |
| FI853717A0 (fi) | 1985-09-26 |
| GR852344B (enExample) | 1986-01-27 |
| PT81214A (en) | 1985-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3502935A1 (de) | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung | |
| DE69700321T2 (de) | Verfahren zur Herstellung Sildenafil | |
| EP0014409B1 (de) | Verfahren zur Herstellung von Alpha-Hydroxycarbonsäureamiden | |
| EP0034741B1 (de) | Verfahren zur Herstellung eines substituierten Bromfluorbenzols und 3-Brom-4-fluorbenzonitril | |
| CH597199A5 (en) | 3-Phenyl pyridaz-6-ones prodn. | |
| EP0380712A1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| DE2406881A1 (de) | Neue carbonsaeure-derivate und verfahren zu deren herstellung | |
| EP0299277B1 (de) | Verfahren zur Herstellung von substituierten Pyridylalkylketonen | |
| DE2733181B2 (de) | Verfahren zur Herstellung von N-substituierten a -Ketocarbonsäureamiden | |
| EP0008097B1 (de) | Verfahren zur Herstellung von Indoleninen | |
| EP0782991B1 (de) | Verfahren zur Herstellung von 2-substituierten 5-Chlorimidazol-4-carbaldehyden | |
| DE2708185C3 (de) | Verfahren zur Herstellung von α-Ketocarbonsäuren | |
| CH638525A5 (de) | 3-(tetrazol-5-yl)-1-azaxanthone und verfahren zu ihrer herstellung. | |
| EP0302227B1 (de) | 5-Halogen-6-amino-nikotin-säurehalogenide, ihre Herstellung und ihre Verwendung | |
| EP0137351B1 (de) | Verfahren zur enantioselektiven Herstellung von alpha-alkylierten, acyclischen alpha-Aminocarbonsäuren | |
| GB1571990A (en) | Process for the preparation of cyanoacetic acid anilide derivatives | |
| DE4408083C1 (de) | Verfahren zur Herstellung von 4-Fluoralkoxyzimtsäurenitrilen | |
| DE2943809A1 (de) | 1-mercaptoacylpiperazin-2-carbonsaeure-verbindungen und ihre salze, verfahren zu ihrer herstellung und ihre verwendung bei der bekaempfung von hypertonie | |
| EP0102520B1 (de) | Verfahren zur Umkehrung der Konfiguration optisch aktiver Verbindungen und optisch aktive Zwischenprodukte dieses Verfahrens | |
| DE2155406A1 (de) | 3-(2-Halogenphenyl-5-tetrazolyl)propionsäureamide | |
| DE2064096A1 (de) | Verfahren zur Herstellung von Pyrimidincarbonsäureestem | |
| EP0103749B1 (de) | Dialkoxymethyl-butyrolactone, Verfahren zu ihrer Herstellung, Zwischenprodukte dafür und ihre Verwendung | |
| EP0221494A1 (de) | Verfahren zur Herstellung von Glykolsäureamiden | |
| EP0238569B1 (de) | Verfahren zur herstellung von cycloalkancarbonsäuren | |
| DE2433071A1 (de) | Neue 2-amino-6-methyl-pyridin-derivate und verfahren zur herstellung derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |