NO170150C - 3-amino-2-benzoyl-akrylsyrederivater og fremgangsmaate forfremstilling av disse - Google Patents
3-amino-2-benzoyl-akrylsyrederivater og fremgangsmaate forfremstilling av disseInfo
- Publication number
- NO170150C NO170150C NO853604A NO853604A NO170150C NO 170150 C NO170150 C NO 170150C NO 853604 A NO853604 A NO 853604A NO 853604 A NO853604 A NO 853604A NO 170150 C NO170150 C NO 170150C
- Authority
- NO
- Norway
- Prior art keywords
- halogen
- benzoyl
- amino
- acrylic acid
- acid derivatives
- Prior art date
Links
- DIRFIAXLTZSXFX-UHFFFAOYSA-N 3-amino-2-benzoylprop-2-enoic acid Chemical class NC=C(C(O)=O)C(=O)C1=CC=CC=C1 DIRFIAXLTZSXFX-UHFFFAOYSA-N 0.000 title abstract 2
- 238000000034 method Methods 0.000 title 1
- 229910052736 halogen Inorganic materials 0.000 abstract 4
- 150000002367 halogens Chemical group 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 abstract 1
- 125000004185 ester group Chemical group 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 125000002560 nitrile group Chemical group 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Paints Or Removers (AREA)
- Dental Preparations (AREA)
- Materials For Medical Uses (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3435930 | 1984-09-29 | ||
| DE19853502935 DE3502935A1 (de) | 1984-09-29 | 1985-01-30 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO853604L NO853604L (no) | 1986-04-01 |
| NO170150B NO170150B (no) | 1992-06-09 |
| NO170150C true NO170150C (no) | 1992-09-16 |
Family
ID=25825268
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO853604A NO170150C (no) | 1984-09-29 | 1985-09-13 | 3-amino-2-benzoyl-akrylsyrederivater og fremgangsmaate forfremstilling av disse |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4699992A (enExample) |
| EP (1) | EP0176846B1 (enExample) |
| KR (1) | KR870001999B1 (enExample) |
| AT (1) | ATE45565T1 (enExample) |
| CA (1) | CA1255678A (enExample) |
| DE (2) | DE3502935A1 (enExample) |
| DK (1) | DK170638B1 (enExample) |
| ES (1) | ES8705098A1 (enExample) |
| FI (1) | FI87765C (enExample) |
| GR (1) | GR852344B (enExample) |
| HU (1) | HU193346B (enExample) |
| IL (1) | IL76521A (enExample) |
| NO (1) | NO170150C (enExample) |
| PT (1) | PT81214B (enExample) |
| SU (1) | SU1590039A3 (enExample) |
| UA (1) | UA8023A1 (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4772706A (en) * | 1986-01-13 | 1988-09-20 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| DE3615767A1 (de) * | 1986-05-10 | 1987-11-12 | Bayer Ag | Verfahren zur herstellung von 4-hydroxy-chinolin-3-carbonsaeuren |
| US5591744A (en) * | 1987-04-16 | 1997-01-07 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| AT391863B (de) * | 1988-06-09 | 1990-12-10 | Chemie Linz Gmbh | Verfahren zur herstellung von substituierten 3-amino-2-(benzoyl)-acrylsaeureestern, sowie ein verfahren zur herstellung von zwischenprodukten fuer antibakterielle wirkstoffe |
| KR910003634B1 (ko) * | 1988-06-17 | 1991-06-07 | 한국과학기술원 | 니트로벤조일-3-시클로프로필아미노아크릴레이트 및 그 제조방법 |
| US5138088A (en) * | 1988-06-17 | 1992-08-11 | Korea Advanced Institute Of Science And Technology | Nitrobenzoyl-3-cyclopropylaminoacrylates and a process for the preparation thereof |
| GB8814881D0 (en) * | 1988-06-22 | 1988-07-27 | Shell Int Research | Herbicidal acrylonitrile derivatives |
| IL91418A (en) * | 1988-09-01 | 1997-11-20 | Rhone Poulenc Agrochimie | (hetero) cyclic amide derivatives, process for their preparation and fungicidal compositions containing them |
| FR2649699A1 (fr) * | 1989-07-13 | 1991-01-18 | Rhone Poulenc Agrochimie | 4-phenyl pyrimidine fongicides |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
| DE4015299A1 (de) * | 1990-05-12 | 1991-11-14 | Bayer Ag | Verfahren zur herstellung von 3-amino-2-(het)-aroyl-acrylsaeurederivaten |
| US5059709A (en) * | 1990-11-13 | 1991-10-22 | American Cyanamid Company | Process for the synthesis of α-[(dialkylamino)substituted-methylene]-β-oxo-(substituted)propanentriles |
| DE19826050A1 (de) * | 1998-06-12 | 1999-12-16 | Bayer Ag | Verfahren zur Herstellung von Chinolon- und Naphthyridoncarbonsäuren und deren Ester |
| US6531624B1 (en) | 1998-11-18 | 2003-03-11 | Asahi Glass Company Ltd. | Aminoacrylic acid derivatives and process for producing the same |
| DE10021900A1 (de) * | 2000-05-08 | 2001-11-15 | Bayer Ag | Phenyl-substituierte 2-Enamino-Ketonitrile |
| CN104292159B (zh) * | 2014-10-10 | 2016-12-07 | 浙江同丰医药化工有限公司 | 一种诺氟沙星、环丙沙星及恩诺沙星的制备方法 |
| CN114436875B (zh) * | 2022-03-01 | 2023-05-12 | 江苏飞宇医药科技股份有限公司 | 一种环丙乙酯胺化物的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865863A (en) * | 1972-06-22 | 1975-02-11 | Hoffmann La Roche | 2-(Benzoyl)-3-dimethylaminoacrylonitriles |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| JPS55500866A (enExample) * | 1978-11-03 | 1980-10-30 | ||
| US4243406A (en) * | 1978-12-26 | 1981-01-06 | Monsanto Company | 5-Aryl-4-isoxazolecarboxylate-safening agents |
| DE3142854A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
| NZ208555A (en) * | 1983-06-23 | 1987-06-30 | American Cyanamid Co | (3-amino-1h-pyrazol-4-yl)-arylmethanone derivatives |
-
1985
- 1985-01-30 DE DE19853502935 patent/DE3502935A1/de not_active Withdrawn
- 1985-09-09 UA UA4028029A patent/UA8023A1/uk unknown
- 1985-09-12 US US06/775,202 patent/US4699992A/en not_active Expired - Lifetime
- 1985-09-13 NO NO853604A patent/NO170150C/no unknown
- 1985-09-16 EP EP85111670A patent/EP0176846B1/de not_active Expired
- 1985-09-16 AT AT85111670T patent/ATE45565T1/de not_active IP Right Cessation
- 1985-09-16 DE DE8585111670T patent/DE3572345D1/de not_active Expired
- 1985-09-24 ES ES547253A patent/ES8705098A1/es not_active Expired
- 1985-09-26 FI FI853717A patent/FI87765C/fi not_active IP Right Cessation
- 1985-09-26 GR GR852344A patent/GR852344B/el unknown
- 1985-09-27 DK DK438885A patent/DK170638B1/da not_active IP Right Cessation
- 1985-09-27 IL IL76521A patent/IL76521A/xx not_active IP Right Cessation
- 1985-09-27 HU HU853743A patent/HU193346B/hu not_active IP Right Cessation
- 1985-09-27 CA CA000491695A patent/CA1255678A/en not_active Expired
- 1985-09-27 PT PT81214A patent/PT81214B/pt not_active IP Right Cessation
- 1985-09-28 KR KR1019850007204A patent/KR870001999B1/ko not_active Expired
-
1986
- 1986-08-27 SU SU864028029A patent/SU1590039A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| DK438885D0 (da) | 1985-09-27 |
| EP0176846B1 (de) | 1989-08-16 |
| DK438885A (da) | 1986-03-30 |
| NO853604L (no) | 1986-04-01 |
| EP0176846A3 (en) | 1987-06-03 |
| EP0176846A2 (de) | 1986-04-09 |
| UA8023A1 (uk) | 1995-12-26 |
| DE3572345D1 (en) | 1989-09-21 |
| CA1255678A (en) | 1989-06-13 |
| HU193346B (en) | 1987-09-28 |
| ATE45565T1 (de) | 1989-09-15 |
| SU1590039A3 (ru) | 1990-08-30 |
| DE3502935A1 (de) | 1986-04-10 |
| ES8705098A1 (es) | 1987-04-16 |
| KR870001999B1 (ko) | 1987-11-30 |
| US4699992A (en) | 1987-10-13 |
| DK170638B1 (da) | 1995-11-20 |
| IL76521A (en) | 1988-10-31 |
| IL76521A0 (en) | 1986-01-31 |
| HUT39148A (en) | 1986-08-28 |
| PT81214B (pt) | 1988-01-22 |
| NO170150B (no) | 1992-06-09 |
| ES547253A0 (es) | 1987-04-16 |
| KR860002453A (ko) | 1986-04-26 |
| FI87765B (fi) | 1992-11-13 |
| FI853717L (fi) | 1986-03-30 |
| FI87765C (fi) | 1993-02-25 |
| FI853717A0 (fi) | 1985-09-26 |
| GR852344B (enExample) | 1986-01-27 |
| PT81214A (en) | 1985-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO170150C (no) | 3-amino-2-benzoyl-akrylsyrederivater og fremgangsmaate forfremstilling av disse | |
| IL66596A0 (en) | Antihypertensive substituted n-alkanoylheterocyclic carboxylic acid derivatives,compositions containing them and methods for their use | |
| DK135791A (da) | 1h-imidazooe4,5-caaquinolin-4-amin, farmaceutisk praeparat indeholdende en saadan forbindelse og fremga ngsmaade til fremstilling af forbindelsen | |
| GB1058984A (en) | Indolyl amides | |
| UA7228A1 (uk) | Спосіб одержання похідних n-(4-індолілпіперідиноалкіл )бензімідазолону або їх солей з кислотами | |
| ES2001389A6 (es) | Procedimiento para preparar derivados de o-toluidina | |
| BG40962A3 (en) | Method for preparing n- substituted n- (dichloracetyl)- glycinamides | |
| GB1210417A (en) | Photographic developer-coupler aminophenol compounds | |
| ES8506006A1 (es) | Procedimiento para la obtencion de derivados de azolil-tetrahidro-furan-2-iliden-metano sustituidos | |
| ES477970A1 (es) | Procedimiento para preparar derivados de la diamina del aci-do dicloromaleico. | |
| ES451217A1 (es) | Procedimiento para la obtencion de fenilureas de actividad herbicida. | |
| AT388164B (de) | Verfahren zur herstellung von neuen 2-thiacephemderivaten |