CA1255678A - 3-amino-2-benzoylacrylic acid derivatives and a process for their preparation - Google Patents
3-amino-2-benzoylacrylic acid derivatives and a process for their preparationInfo
- Publication number
- CA1255678A CA1255678A CA000491695A CA491695A CA1255678A CA 1255678 A CA1255678 A CA 1255678A CA 000491695 A CA000491695 A CA 000491695A CA 491695 A CA491695 A CA 491695A CA 1255678 A CA1255678 A CA 1255678A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- methyl
- fluorine
- chlorine
- dichloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- DIRFIAXLTZSXFX-UHFFFAOYSA-N 3-amino-2-benzoylprop-2-enoic acid Chemical class NC=C(C(O)=O)C(=O)C1=CC=CC=C1 DIRFIAXLTZSXFX-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 26
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 17
- 150000002367 halogens Chemical group 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 6
- 125000004185 ester group Chemical group 0.000 claims abstract description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 claims abstract description 4
- 125000002560 nitrile group Chemical group 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims abstract 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 36
- 239000000460 chlorine Substances 0.000 claims description 28
- 229910052731 fluorine Inorganic materials 0.000 claims description 22
- 239000011737 fluorine Substances 0.000 claims description 22
- 229910052801 chlorine Inorganic materials 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 12
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- -1 benzoyl halide Chemical class 0.000 claims description 8
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- RPZXUSJCSDQNTE-UHFFFAOYSA-N 2,4-dichloro-5-fluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(Cl)C=C1Cl RPZXUSJCSDQNTE-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 6
- 150000002825 nitriles Chemical class 0.000 claims description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 claims description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- 229960003405 ciprofloxacin Drugs 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- PZDBUCAGCYWAOF-UHFFFAOYSA-N methyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate Chemical compound COC(=O)C(=CN(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl PZDBUCAGCYWAOF-UHFFFAOYSA-N 0.000 claims description 4
- ZKKBIZXAEDFPNL-HWKANZROSA-N (e)-3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)\C=C\C#N ZKKBIZXAEDFPNL-HWKANZROSA-N 0.000 claims description 3
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 claims description 3
- KIRNFSAHNUCFLV-UHFFFAOYSA-N 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)C=C(C#N)C(=O)C1=CC(F)=C(Cl)C=C1Cl KIRNFSAHNUCFLV-UHFFFAOYSA-N 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- DJRMXRPIBLNZHF-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(C)C)C(=O)C1=CC(F)=C(Cl)C=C1Cl DJRMXRPIBLNZHF-UHFFFAOYSA-N 0.000 claims description 3
- MVUMJYQUKKUOHO-UHFFFAOYSA-N ethyl 3-(dimethylamino)prop-2-enoate Chemical compound CCOC(=O)C=CN(C)C MVUMJYQUKKUOHO-UHFFFAOYSA-N 0.000 claims description 3
- MVPDNJQLPITPIX-UHFFFAOYSA-N methyl 3-(dimethylamino)prop-2-enoate Chemical compound COC(=O)C=CN(C)C MVPDNJQLPITPIX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 3
- MDDTUQMEJPHYCI-UHFFFAOYSA-N 2-benzoyl-3-(cyclopropylamino)prop-2-enoic acid Chemical class C=1C=CC=CC=1C(=O)C(C(=O)O)=CNC1CC1 MDDTUQMEJPHYCI-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 2
- 239000012312 sodium hydride Substances 0.000 claims description 2
- 229940060037 fluorine Drugs 0.000 claims 18
- 235000019000 fluorine Nutrition 0.000 claims 18
- 125000001309 chloro group Chemical group Cl* 0.000 claims 13
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 11
- 125000001153 fluoro group Chemical group F* 0.000 claims 7
- 238000004519 manufacturing process Methods 0.000 claims 6
- OOYUDIUHADUBQU-UHFFFAOYSA-N 3-(dimethylamino)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enenitrile Chemical compound CN(C)C=C(C#N)C(=O)C1=CC(F)=C(F)C(F)=C1F OOYUDIUHADUBQU-UHFFFAOYSA-N 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 claims 2
- ISPVACVJFUIDPD-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ISPVACVJFUIDPD-UHFFFAOYSA-N 0.000 claims 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 4
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 47
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 229940073584 methylene chloride Drugs 0.000 description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 238000010992 reflux Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- YTLYLLTVENPWFT-UPHRSURJSA-N (Z)-3-aminoacrylic acid Chemical class N\C=C/C(O)=O YTLYLLTVENPWFT-UPHRSURJSA-N 0.000 description 3
- NKNBYFBSHOGEKE-UHFFFAOYSA-N 3-(dimethylamino)prop-2-enoic acid Chemical compound CN(C)C=CC(O)=O NKNBYFBSHOGEKE-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- UYJWKMILOGUYTL-UHFFFAOYSA-N ethyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1CC1 UYJWKMILOGUYTL-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- CTWDRRITAMBEPI-UHFFFAOYSA-N methyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-pyrrolidin-1-ylprop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OC)=CN1CCCC1 CTWDRRITAMBEPI-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- PLPDHGOODMBBGN-VOTSOKGWSA-N (e)-4-oxo-4-phenylbut-2-enoic acid Chemical class OC(=O)\C=C\C(=O)C1=CC=CC=C1 PLPDHGOODMBBGN-VOTSOKGWSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 1
- IROWIXYGGPOJFJ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl IROWIXYGGPOJFJ-UHFFFAOYSA-N 0.000 description 1
- BONFTDXNVIOQBZ-UHFFFAOYSA-N 2,4,5-trichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=C(Cl)C=C1Cl BONFTDXNVIOQBZ-UHFFFAOYSA-N 0.000 description 1
- GCSHFLICMVGYIB-UHFFFAOYSA-N 2-(3-aminobenzoyl)prop-2-enoic acid Chemical class NC1=CC=CC(C(=O)C(=C)C(O)=O)=C1 GCSHFLICMVGYIB-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- YCJIZVSZSOSLHO-UHFFFAOYSA-N 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enenitrile Chemical compound C1=C(Cl)C(F)=CC(C(=O)C(=CNC2CC2)C#N)=C1Cl YCJIZVSZSOSLHO-UHFFFAOYSA-N 0.000 description 1
- IEDMMCZBIKXEJP-UHFFFAOYSA-N 3-chloro-2,4,5-trifluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(Cl)=C1F IEDMMCZBIKXEJP-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- HXELGNKCCDGMMN-UHFFFAOYSA-N [F].[Cl] Chemical compound [F].[Cl] HXELGNKCCDGMMN-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Natural products C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical class C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- OFULWOHHSSJLTJ-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-5-fluorobenzoyl)-3-(diethylamino)prop-2-enoate Chemical compound CCOC(=O)C(=CN(CC)CC)C(=O)C1=CC(F)=C(Cl)C=C1Cl OFULWOHHSSJLTJ-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- YCDBNUJZSAFBIY-UHFFFAOYSA-N methyl 3-(cyclopropylamino)-2-(2,4-dichloro-5-fluorobenzoyl)prop-2-enoate Chemical compound C=1C(F)=C(Cl)C=C(Cl)C=1C(=O)C(C(=O)OC)=CNC1CC1 YCDBNUJZSAFBIY-UHFFFAOYSA-N 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Paints Or Removers (AREA)
- Dental Preparations (AREA)
- Materials For Medical Uses (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3435930.3 | 1984-09-29 | ||
| DE3435930 | 1984-09-29 | ||
| DEP3502935.8 | 1985-01-30 | ||
| DE19853502935 DE3502935A1 (de) | 1984-09-29 | 1985-01-30 | 3-amino-2-benzoyl-acrylsaeurederivate und ein verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1255678A true CA1255678A (en) | 1989-06-13 |
Family
ID=25825268
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000491695A Expired CA1255678A (en) | 1984-09-29 | 1985-09-27 | 3-amino-2-benzoylacrylic acid derivatives and a process for their preparation |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4699992A (enExample) |
| EP (1) | EP0176846B1 (enExample) |
| KR (1) | KR870001999B1 (enExample) |
| AT (1) | ATE45565T1 (enExample) |
| CA (1) | CA1255678A (enExample) |
| DE (2) | DE3502935A1 (enExample) |
| DK (1) | DK170638B1 (enExample) |
| ES (1) | ES8705098A1 (enExample) |
| FI (1) | FI87765C (enExample) |
| GR (1) | GR852344B (enExample) |
| HU (1) | HU193346B (enExample) |
| IL (1) | IL76521A (enExample) |
| NO (1) | NO170150C (enExample) |
| PT (1) | PT81214B (enExample) |
| SU (1) | SU1590039A3 (enExample) |
| UA (1) | UA8023A1 (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4772706A (en) * | 1986-01-13 | 1988-09-20 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| DE3615767A1 (de) * | 1986-05-10 | 1987-11-12 | Bayer Ag | Verfahren zur herstellung von 4-hydroxy-chinolin-3-carbonsaeuren |
| US5591744A (en) * | 1987-04-16 | 1997-01-07 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| DE3724466A1 (de) * | 1987-07-24 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von chinoloncarbonsaeuren |
| AT391863B (de) * | 1988-06-09 | 1990-12-10 | Chemie Linz Gmbh | Verfahren zur herstellung von substituierten 3-amino-2-(benzoyl)-acrylsaeureestern, sowie ein verfahren zur herstellung von zwischenprodukten fuer antibakterielle wirkstoffe |
| KR910003634B1 (ko) * | 1988-06-17 | 1991-06-07 | 한국과학기술원 | 니트로벤조일-3-시클로프로필아미노아크릴레이트 및 그 제조방법 |
| US5138088A (en) * | 1988-06-17 | 1992-08-11 | Korea Advanced Institute Of Science And Technology | Nitrobenzoyl-3-cyclopropylaminoacrylates and a process for the preparation thereof |
| GB8814881D0 (en) * | 1988-06-22 | 1988-07-27 | Shell Int Research | Herbicidal acrylonitrile derivatives |
| IL91418A (en) * | 1988-09-01 | 1997-11-20 | Rhone Poulenc Agrochimie | (hetero) cyclic amide derivatives, process for their preparation and fungicidal compositions containing them |
| FR2649699A1 (fr) * | 1989-07-13 | 1991-01-18 | Rhone Poulenc Agrochimie | 4-phenyl pyrimidine fongicides |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| GB8920519D0 (en) * | 1989-09-11 | 1989-10-25 | Rhone Poulenc Ltd | New compositions of matter |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
| DE4015299A1 (de) * | 1990-05-12 | 1991-11-14 | Bayer Ag | Verfahren zur herstellung von 3-amino-2-(het)-aroyl-acrylsaeurederivaten |
| US5059709A (en) * | 1990-11-13 | 1991-10-22 | American Cyanamid Company | Process for the synthesis of α-[(dialkylamino)substituted-methylene]-β-oxo-(substituted)propanentriles |
| DE19826050A1 (de) * | 1998-06-12 | 1999-12-16 | Bayer Ag | Verfahren zur Herstellung von Chinolon- und Naphthyridoncarbonsäuren und deren Ester |
| US6531624B1 (en) | 1998-11-18 | 2003-03-11 | Asahi Glass Company Ltd. | Aminoacrylic acid derivatives and process for producing the same |
| DE10021900A1 (de) * | 2000-05-08 | 2001-11-15 | Bayer Ag | Phenyl-substituierte 2-Enamino-Ketonitrile |
| CN104292159B (zh) * | 2014-10-10 | 2016-12-07 | 浙江同丰医药化工有限公司 | 一种诺氟沙星、环丙沙星及恩诺沙星的制备方法 |
| CN114436875B (zh) * | 2022-03-01 | 2023-05-12 | 江苏飞宇医药科技股份有限公司 | 一种环丙乙酯胺化物的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865863A (en) * | 1972-06-22 | 1975-02-11 | Hoffmann La Roche | 2-(Benzoyl)-3-dimethylaminoacrylonitriles |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| JPS55500866A (enExample) * | 1978-11-03 | 1980-10-30 | ||
| US4243406A (en) * | 1978-12-26 | 1981-01-06 | Monsanto Company | 5-Aryl-4-isoxazolecarboxylate-safening agents |
| DE3142854A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3142856A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoylchlorid |
| NZ208555A (en) * | 1983-06-23 | 1987-06-30 | American Cyanamid Co | (3-amino-1h-pyrazol-4-yl)-arylmethanone derivatives |
-
1985
- 1985-01-30 DE DE19853502935 patent/DE3502935A1/de not_active Withdrawn
- 1985-09-09 UA UA4028029A patent/UA8023A1/uk unknown
- 1985-09-12 US US06/775,202 patent/US4699992A/en not_active Expired - Lifetime
- 1985-09-13 NO NO853604A patent/NO170150C/no unknown
- 1985-09-16 EP EP85111670A patent/EP0176846B1/de not_active Expired
- 1985-09-16 AT AT85111670T patent/ATE45565T1/de not_active IP Right Cessation
- 1985-09-16 DE DE8585111670T patent/DE3572345D1/de not_active Expired
- 1985-09-24 ES ES547253A patent/ES8705098A1/es not_active Expired
- 1985-09-26 FI FI853717A patent/FI87765C/fi not_active IP Right Cessation
- 1985-09-26 GR GR852344A patent/GR852344B/el unknown
- 1985-09-27 DK DK438885A patent/DK170638B1/da not_active IP Right Cessation
- 1985-09-27 IL IL76521A patent/IL76521A/xx not_active IP Right Cessation
- 1985-09-27 HU HU853743A patent/HU193346B/hu not_active IP Right Cessation
- 1985-09-27 CA CA000491695A patent/CA1255678A/en not_active Expired
- 1985-09-27 PT PT81214A patent/PT81214B/pt not_active IP Right Cessation
- 1985-09-28 KR KR1019850007204A patent/KR870001999B1/ko not_active Expired
-
1986
- 1986-08-27 SU SU864028029A patent/SU1590039A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| DK438885D0 (da) | 1985-09-27 |
| EP0176846B1 (de) | 1989-08-16 |
| DK438885A (da) | 1986-03-30 |
| NO853604L (no) | 1986-04-01 |
| EP0176846A3 (en) | 1987-06-03 |
| EP0176846A2 (de) | 1986-04-09 |
| UA8023A1 (uk) | 1995-12-26 |
| DE3572345D1 (en) | 1989-09-21 |
| HU193346B (en) | 1987-09-28 |
| NO170150C (no) | 1992-09-16 |
| ATE45565T1 (de) | 1989-09-15 |
| SU1590039A3 (ru) | 1990-08-30 |
| DE3502935A1 (de) | 1986-04-10 |
| ES8705098A1 (es) | 1987-04-16 |
| KR870001999B1 (ko) | 1987-11-30 |
| US4699992A (en) | 1987-10-13 |
| DK170638B1 (da) | 1995-11-20 |
| IL76521A (en) | 1988-10-31 |
| IL76521A0 (en) | 1986-01-31 |
| HUT39148A (en) | 1986-08-28 |
| PT81214B (pt) | 1988-01-22 |
| NO170150B (no) | 1992-06-09 |
| ES547253A0 (es) | 1987-04-16 |
| KR860002453A (ko) | 1986-04-26 |
| FI87765B (fi) | 1992-11-13 |
| FI853717L (fi) | 1986-03-30 |
| FI87765C (fi) | 1993-02-25 |
| FI853717A0 (fi) | 1985-09-26 |
| GR852344B (enExample) | 1986-01-27 |
| PT81214A (en) | 1985-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1255678A (en) | 3-amino-2-benzoylacrylic acid derivatives and a process for their preparation | |
| US4280008A (en) | Chirally substituted 2-imidazolin-5-ones | |
| US4902796A (en) | 6-alkenyl and ethynyl derivatives of 2-amino-4-hydroxypyrido[2,3-d]pyrimidines | |
| JP2556722B2 (ja) | 新規なスルホンアミド化合物 | |
| CA1100959A (en) | Indolo (2,3-a) quinolizidines, preparation and therapeutic use | |
| EP0496692A1 (en) | 2-Methoxyphenylpiperazine derivatives | |
| EP0089065B1 (en) | Novel phenylpiperazine derivatives and process for producing the same | |
| HU182636B (en) | Process for producing pyrazolo-imidazol derivatives | |
| US4804760A (en) | Process for the preparation of 4-hydroxy-quinoline-3-carboxylic acids | |
| US4041077A (en) | N-benzyl-2,2-dimethoxy-acetamides | |
| US4353911A (en) | Indolo(2,3-a)quinolizidines, useful in increasing femoral and vertebral blood flow | |
| PL153592B1 (pl) | SPOSÓB OTRZYMYWANIA NOWEGO 2-/2'-ffYDROKSY-3'-/l"-KARBONYLOKSY-2"- KARBOBUTOKSY-E-ETENO/ACBTAMIDOMETYLO-5 *-METYLOFENYLO/-2H-BENZOTRlAZOLU-1, 2,3 | |
| IE45423B1 (en) | Process for hypotensive 2-(4-substituted piperazin-1-yl)-4-aminoquinazolines | |
| CA1054597A (en) | 1,6,7,8-tetrahydro-4-oxo-4h-pyrido (1,2-a) pyrimidine-9-carboalkoxy compounds | |
| US4160828A (en) | Analgesic phosphinyl compounds and compositions | |
| US4098791A (en) | Process for preparing 3-(cyanimino)-3-amino-propionitriles | |
| EP0345464B1 (de) | Verfahren zur Herstellung von substituierten 3-Amino-2(benzoyl)-acrylsäureestern sowie ein Verfahren zur Herstellung von Zwischenprodukten für antibakterielle Wirkstoffe aus diesen Verbindungen | |
| US4374067A (en) | Intermediates for the preparation of 4-phenyl-1,3-benzodiazepins and methods for preparing the intermediates | |
| GB2106512A (en) | Imidazole derivatives and a process for their preparation | |
| GB2092130A (en) | 4-Oximino-1,2,3,4- tetrahydroquinoline Derivatives | |
| CA1235706A (en) | (substituted-phenyl)-5-oxo-pyrrolidine-2-propanoic acids and derivatives as cognition activators | |
| USRE32975E (en) | 4-Pyridone-3-carboxylic acids and/or derivatives thereof | |
| US4461728A (en) | Preparation of 4-phenyl-1,3-benzodiazepins | |
| JPH037266A (ja) | 2―(4―フェニル―1―ピペラジニルアルキル)アミノ―5―エチニルピリミジン誘導体並びにその中間体及びその製造法 | |
| KR820000497B1 (ko) | 신규한 인돌로(2, 3-a)퀴놀리지딘류의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |