DE3500773C2 - - Google Patents
Info
- Publication number
- DE3500773C2 DE3500773C2 DE3500773A DE3500773A DE3500773C2 DE 3500773 C2 DE3500773 C2 DE 3500773C2 DE 3500773 A DE3500773 A DE 3500773A DE 3500773 A DE3500773 A DE 3500773A DE 3500773 C2 DE3500773 C2 DE 3500773C2
- Authority
- DE
- Germany
- Prior art keywords
- formamide
- acid
- reaction
- acetaldehyde
- alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 128
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 110
- 238000006243 chemical reaction Methods 0.000 claims description 74
- 238000000034 method Methods 0.000 claims description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 38
- DTBGILDKBIBTGE-UHFFFAOYSA-N n-(1-hydroxyethyl)formamide Chemical compound CC(O)NC=O DTBGILDKBIBTGE-UHFFFAOYSA-N 0.000 claims description 38
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 36
- 239000003054 catalyst Substances 0.000 claims description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 27
- -1 N-substituted formamide Chemical class 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 8
- 239000003377 acid catalyst Substances 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 150000003333 secondary alcohols Chemical class 0.000 claims description 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 6
- 150000001447 alkali salts Chemical class 0.000 claims description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 6
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 5
- 150000003138 primary alcohols Chemical class 0.000 claims description 5
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 4
- KBPLFHHGFOOTCA-UHFFFAOYSA-N caprylic alcohol Natural products CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 claims description 4
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 claims description 4
- 125000000075 primary alcohol group Chemical group 0.000 claims description 4
- 150000003839 salts Chemical group 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 claims description 4
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 claims description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 claims description 3
- 229940093475 2-ethoxyethanol Drugs 0.000 claims description 3
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229940035429 isobutyl alcohol Drugs 0.000 claims description 3
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 claims description 3
- 229940005642 polystyrene sulfonic acid Drugs 0.000 claims description 3
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 claims description 2
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 claims description 2
- YEYKMVJDLWJFOA-UHFFFAOYSA-N 2-propoxyethanol Chemical compound CCCOCCO YEYKMVJDLWJFOA-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004327 boric acid Substances 0.000 claims description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 claims description 2
- ZJIPHXXDPROMEF-UHFFFAOYSA-N dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O ZJIPHXXDPROMEF-UHFFFAOYSA-N 0.000 claims description 2
- 150000004679 hydroxides Chemical class 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 claims description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 claims description 2
- 229910017604 nitric acid Inorganic materials 0.000 claims description 2
- 150000002989 phenols Chemical class 0.000 claims description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 claims description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910000160 potassium phosphate Inorganic materials 0.000 claims description 2
- 235000011009 potassium phosphates Nutrition 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims description 2
- 239000001488 sodium phosphate Substances 0.000 claims description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 claims description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 claims description 2
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 2
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 claims description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 claims description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 claims 1
- 150000003254 radicals Chemical group 0.000 claims 1
- 125000003198 secondary alcohol group Chemical group 0.000 claims 1
- 239000013078 crystal Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- 239000007795 chemical reaction product Substances 0.000 description 14
- 238000001816 cooling Methods 0.000 description 12
- 239000007788 liquid Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 9
- 239000007789 gas Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- ZQXSMRAEXCEDJD-UHFFFAOYSA-N n-ethenylformamide Chemical compound C=CNC=O ZQXSMRAEXCEDJD-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 238000004811 liquid chromatography Methods 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229920002313 fluoropolymer Polymers 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229940057995 liquid paraffin Drugs 0.000 description 4
- OBSOFSUMTBYDCT-UHFFFAOYSA-N n-(1-methoxyethyl)formamide Chemical compound COC(C)NC=O OBSOFSUMTBYDCT-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 150000003334 secondary amides Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229920006317 cationic polymer Polymers 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- 239000011344 liquid material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- QWELSYQNDFTISP-UHFFFAOYSA-N 1-chloro-1-methoxyethane Chemical compound COC(C)Cl QWELSYQNDFTISP-UHFFFAOYSA-N 0.000 description 1
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 1
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- BOOMOFPAGCSKKE-UHFFFAOYSA-N butane-2-sulfonic acid;prop-2-enamide Chemical compound NC(=O)C=C.CCC(C)S(O)(=O)=O BOOMOFPAGCSKKE-UHFFFAOYSA-N 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000003411 electrode reaction Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Inorganic materials Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical group 0.000 description 1
- WOFDVDFSGLBFAC-UHFFFAOYSA-N lactonitrile Chemical compound CC(O)C#N WOFDVDFSGLBFAC-UHFFFAOYSA-N 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical compound NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 1
- KZRAAPTWXAMZHQ-UHFFFAOYSA-N methoxymethanamine Chemical compound COCN KZRAAPTWXAMZHQ-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- BRFLFNOIUJZMOK-UHFFFAOYSA-N n,n-bis(1-methoxyethyl)formamide Chemical compound COC(C)N(C=O)C(C)OC BRFLFNOIUJZMOK-UHFFFAOYSA-N 0.000 description 1
- ONONIESHMTZAKB-UHFFFAOYSA-N n-(1-cyanoethyl)formamide Chemical compound N#CC(C)NC=O ONONIESHMTZAKB-UHFFFAOYSA-N 0.000 description 1
- OYFXZONQZDQAMM-UHFFFAOYSA-N n-(1-formamidoethyl)formamide Chemical compound O=CNC(C)NC=O OYFXZONQZDQAMM-UHFFFAOYSA-N 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007524 organic acids Chemical group 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/22—Separation; Purification; Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/16—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
- C07C233/17—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/18—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP59005232A JPS60149551A (ja) | 1984-01-14 | 1984-01-14 | Ν−(α−ヒドロキシエチル)ホルムアミドの製造方法 |
| JP4796784A JPS60193953A (ja) | 1984-03-13 | 1984-03-13 | Ν−(α−アルコキシエチル)ホルムアミドの製造方法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3500773A1 DE3500773A1 (de) | 1985-07-25 |
| DE3500773C2 true DE3500773C2 (Direct) | 1991-04-11 |
Family
ID=26339144
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853500773 Granted DE3500773A1 (de) | 1984-01-14 | 1985-01-11 | Verfahren zur herstellung von n-substituierten formamiden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4567300A (Direct) |
| AU (1) | AU572619B2 (Direct) |
| CA (1) | CA1230347A (Direct) |
| DE (1) | DE3500773A1 (Direct) |
| FR (1) | FR2558156B1 (Direct) |
| GB (2) | GB2152929B (Direct) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4973751A (en) * | 1985-03-02 | 1990-11-27 | Basf Aktiengesellschaft | Preparation of unsaturated compounds by elimination reaction |
| DE3520829A1 (de) * | 1985-06-11 | 1986-12-11 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von n-(alpha)-alkoxy-ethyl-formamiden |
| DE3622013A1 (de) * | 1986-07-01 | 1988-01-07 | Basf Ag | Verfahren zur herstellung von n-substituierten formamiden |
| US4921621A (en) * | 1986-10-01 | 1990-05-01 | Air Products And Chemicals, Inc. | Hydrolyzed co-polymers of N-vinylamide and acrylamide for use as waterloss control additives in drilling mud |
| MX168601B (es) * | 1986-10-01 | 1993-06-01 | Air Prod & Chem | Procedimiento para la preparacion de un homopolimero de vinilamina de alto peso molecular |
| US4798871A (en) * | 1986-10-01 | 1989-01-17 | Air Products And Chemicals, Inc. | Compositions containing high molecular weight poly(vinylamines) for enhanced oil recovery |
| US4828725A (en) * | 1986-10-01 | 1989-05-09 | Air Products And Chemicals, Inc. | Completion fluids containing high molecular weight poly(vinylamines) |
| US4804793A (en) * | 1986-10-01 | 1989-02-14 | Air Products And Chemicals, Inc. | Drilling mud compositions containing high molecular weight poly (vinylamines) |
| US4795770A (en) * | 1986-10-01 | 1989-01-03 | Air Products And Chemicals, Inc. | Cement composition for oil well drilling holes containing high molecular weight poly (vinylamines) |
| US5144074A (en) * | 1988-02-24 | 1992-09-01 | Air Products And Chemicals, Inc. | Process for the synthesis of carboxamides |
| US5136094A (en) * | 1988-03-10 | 1992-08-04 | Air Products And Chemicals, Inc. | Process for the synthesis of secondary formamides |
| US4906777A (en) * | 1988-10-19 | 1990-03-06 | Air Products And Chemicals, Inc. | Synthesis of ethylidene bis-formamide using formic acid |
| US4996322A (en) * | 1989-05-15 | 1991-02-26 | Air Products And Chemicals, Inc. | Separation of amides with molecular sieves |
| US4968841A (en) * | 1989-11-14 | 1990-11-06 | Air Products And Chemicals, Inc. | Synthesis of ethylidene bisformamide from vinyl acetate |
| US4997984A (en) * | 1989-12-19 | 1991-03-05 | Shawa Denko K.K. | Process for preparation of N-(α-alkoxyethyl)-carboxylic acid amide |
| US5023375A (en) * | 1990-01-17 | 1991-06-11 | Air Products And Chemicals, Inc. | Process for the synthesis of amides from vinyl acetate |
| US5117056A (en) * | 1990-12-21 | 1992-05-26 | Air Products And Chemicals, Inc. | Preparation of N-(1-alkoxyalkyl)formamide and bis formamides |
| US5180851A (en) * | 1991-03-21 | 1993-01-19 | Air Products And Chemicals Inc. | Preparation of n-(l-alkoxyalkyl)formamide and alkylidene bisformamides using amine neutralized ion exchange resins |
| JP3318992B2 (ja) * | 1992-12-18 | 2002-08-26 | ダイヤニトリックス株式会社 | N−(α−アルコキシエチル)ホルムアミドの製造方法 |
| DE4428901A1 (de) * | 1994-08-19 | 1996-02-22 | Basf Ag | Verfahren zur Herstellung von N-Alkenylcarbonsäureamiden |
| JP2660169B2 (ja) | 1994-09-19 | 1997-10-08 | 株式会社日本触媒 | 3級n−アルケニルカルボン酸アミド類の製造用触媒及び3級n−アルケニルカルボン酸アミド類の製造方法 |
| US5625076A (en) * | 1994-09-19 | 1997-04-29 | Nippon Shokubai Co., Ltd. | Catalyst for production of tertiary N-alkenyl carboxylic acid amide, and process for production of tertiary N-alkenyl carboxylic acid amide using said catalyst |
| DE4438366A1 (de) * | 1994-10-27 | 1996-05-02 | Basf Ag | Verfahren zur Herstellung von N-Alkenylcarbonsäureamiden |
| US7026511B2 (en) * | 2002-08-30 | 2006-04-11 | University Of Pittsburgh | Synthesis of N-vinylformamide |
| US6965052B2 (en) | 2002-08-30 | 2005-11-15 | University Of Pittsburgh | Synthesis of N-vinyl formamide |
| DE102005053559A1 (de) * | 2005-11-08 | 2007-05-10 | Basf Ag | Verfahren zur Herstellung von Vinylformamid-Einheiten enthaltenden Polymerpulvern |
| US7993749B2 (en) * | 2005-12-16 | 2011-08-09 | University Of Kansas | Nanoparticles comprising a nanoparticle template and a polymer shell having an amide side chain, and method of making thereof |
| US10696622B2 (en) * | 2016-08-29 | 2020-06-30 | Eastman Chemical Company | Synthesis of N-vinyl carboxylic acid amides |
| CN109912438A (zh) * | 2019-03-29 | 2019-06-21 | 青岛科技大学 | 一种n-乙烯基甲酰胺的合成方法 |
| CN112047854B (zh) * | 2020-10-20 | 2021-07-02 | 中国科学院长春应用化学研究所 | 一种n-乙烯基烷基酰胺的制备方法 |
| FR3125041A1 (fr) | 2021-07-09 | 2023-01-13 | Snf Sa | Procédé d’obtention de N-vinylformamide biosourcé |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2603661A (en) * | 1952-07-15 | Letjckart synthesis x | ||
| US2361185A (en) * | 1941-12-30 | 1944-10-24 | Du Pont | Process of making ether compounds |
| US2760977A (en) * | 1953-06-03 | 1956-08-28 | Research Corp | N-alkylol unsaturated amides |
| GB1092632A (en) * | 1964-03-03 | 1967-11-29 | British Celanese | Improved process for the production of n-methylol formamide |
| DE1224304B (de) * | 1965-03-06 | 1966-09-08 | Bayer Ag | Verfahren zur Herstellung eines N-Acyl-Monovinylamins |
| DE1228246B (de) * | 1965-03-06 | 1966-11-10 | Bayer Ag | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins |
| DE1545798C3 (de) * | 1965-03-20 | 1975-11-20 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von N-Vinylverbindungen |
| US3526620A (en) * | 1966-08-26 | 1970-09-01 | Hoechst Ag | Process for the preparation of n-vinyl-carboxylic acid amides |
| BE757107A (fr) * | 1969-10-06 | 1971-04-06 | Basf Ag | Procede de preparation de derives d'alpha-n-formylamino- acides |
| DE2336977A1 (de) * | 1973-07-20 | 1975-02-13 | Hoechst Ag | Verfahren zur herstellung von sekundaeren n-vinylcarbonsaeureamiden |
| DE2336976A1 (de) * | 1973-07-20 | 1975-02-13 | Hoechst Ag | Verfahren zur herstellung von n-(alphaalkoxyaethyl)-carbonsaeureamiden |
| NL7600544A (nl) * | 1975-01-25 | 1976-07-27 | Hoechst Ag | Werkwijze voor de bereiding van n-(gamma-alkoxy- ethyl)-carbonzuuramiden. |
| DE2919755A1 (de) * | 1979-05-16 | 1980-11-27 | Hoechst Ag | Verfahren zur herstellung von n-vinyl- n-alkyl-carbonsaeureamiden |
| DE2944456C2 (de) * | 1979-11-03 | 1982-04-01 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von N-α -Alkoxyalkyl-carbonsäureamiden |
| DE3128478A1 (de) * | 1981-07-18 | 1983-02-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von linearen, basischen polymerisaten |
| DE3213873A1 (de) * | 1982-04-15 | 1983-10-27 | Basf Ag, 6700 Ludwigshafen | Flockungsmittel fuer schlaemme |
| EP0107441B1 (en) * | 1982-10-20 | 1986-09-17 | BP Chemicals Limited | Process for the preparation of formamides |
-
1985
- 1985-01-10 US US06/690,252 patent/US4567300A/en not_active Expired - Lifetime
- 1985-01-11 FR FR8500384A patent/FR2558156B1/fr not_active Expired
- 1985-01-11 GB GB08500669A patent/GB2152929B/en not_active Expired
- 1985-01-11 DE DE19853500773 patent/DE3500773A1/de active Granted
- 1985-01-14 AU AU37641/85A patent/AU572619B2/en not_active Ceased
- 1985-01-14 CA CA000472050A patent/CA1230347A/en not_active Expired
-
1987
- 1987-03-12 GB GB08705867A patent/GB2186876B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB2152929A (en) | 1985-08-14 |
| GB2152929B (en) | 1988-06-22 |
| GB8705867D0 (en) | 1987-04-15 |
| CA1230347A (en) | 1987-12-15 |
| FR2558156B1 (fr) | 1989-01-20 |
| AU3764185A (en) | 1985-07-18 |
| DE3500773A1 (de) | 1985-07-25 |
| AU572619B2 (en) | 1988-05-12 |
| GB2186876B (en) | 1988-06-22 |
| GB8500669D0 (en) | 1985-02-13 |
| US4567300A (en) | 1986-01-28 |
| GB2186876A (en) | 1987-08-26 |
| FR2558156A1 (fr) | 1985-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3500773C2 (Direct) | ||
| DE60124482T2 (de) | Verfahren zur Herstellung von Xylylendiamin | |
| DE69801154T2 (de) | Verfahren zur herstellung von caprolactam in abwesenheit von katalysatoren durch kontakt von 6-aminocapronsäurederivaten mit überhitztem dampf | |
| DE69623377T2 (de) | Verfahren zur Kondensation von Cyanwasserstoff mit einem Aldehyd | |
| DE10237380A1 (de) | Verfahren und Vorrichtung zur Herstellung von ameisensauren Formlaten und deren Verwendung | |
| DE3544134C2 (Direct) | ||
| DE69302557T2 (de) | Verfahren zur Herstellung von Fettsäureestern und -amiden von Sulfonsäuresalzen | |
| EP2785686A2 (de) | Verfahren zur herstellung und aufreinigung von salzen der acrylamido-2-methyl-propansulfonsäure | |
| DE3390062C2 (Direct) | ||
| DE68913672T2 (de) | N-substituierte Maleimid-Herstellungsverfahren. | |
| EP0251118B1 (de) | Verfahren zur Herstellung von N-substituierten Formamiden | |
| DE2924133C2 (Direct) | ||
| DE68913342T2 (de) | Verfahren zur Herstellung von Carbonsäureestern. | |
| DE69518027T2 (de) | Verfahren zur Herstellung von Acrylamid | |
| DE68910153T2 (de) | Verfahren zur Herstellung von sekundären Formamiden. | |
| EP0873302B1 (de) | Verfahren zur kontinuierlichen herstellung von n-acylaminocarbonsäuren und n-acylaminosulfonsäuren sowie deren alkalimetallsalzen | |
| DE69410197T2 (de) | Verfahren zur Reinigung von polaren Vinylverbindungen | |
| EP0045386A1 (de) | Verfahren zur Herstellung von Aminonitrilen | |
| EP3907217B1 (de) | Verbessertes verfahren zur herstellung von triacetonamin | |
| DE2553931C3 (de) | Verfahren und Vorrichtung zur Herstellung von Carbonsäureestern oder -salzen | |
| EP0275470B1 (de) | N-substituierte, Estergruppen enthaltende Acrylamide | |
| DE69014683T2 (de) | Verfahren zur Herstellung von Lithium-Diphenylphosphino-phenyl-m-sulfonat. | |
| DE68915810T2 (de) | Verfahren zur Synthese von Carboxamiden. | |
| DE69007706T2 (de) | Verfahren zur Herstellung von Carbonsäureestern und Formamid. | |
| EP0915085B1 (de) | Verfahren zur Herstellung von Kreatin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KADOR, U., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8127 | New person/name/address of the applicant |
Owner name: MITSUBISHI KASEI CORP., TOKIO/TOKYO, JP |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |