DE3432170C2 - - Google Patents
Info
- Publication number
- DE3432170C2 DE3432170C2 DE19843432170 DE3432170A DE3432170C2 DE 3432170 C2 DE3432170 C2 DE 3432170C2 DE 19843432170 DE19843432170 DE 19843432170 DE 3432170 A DE3432170 A DE 3432170A DE 3432170 C2 DE3432170 C2 DE 3432170C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- mol
- iodide
- concentration
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 64
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 40
- 238000005810 carbonylation reaction Methods 0.000 claims description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 35
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 claims description 24
- 239000010948 rhodium Substances 0.000 claims description 14
- 230000006315 carbonylation Effects 0.000 claims description 13
- 229910052703 rhodium Inorganic materials 0.000 claims description 11
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 11
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 10
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 9
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 8
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 8
- 150000001351 alkyl iodides Chemical class 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 53
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 28
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 21
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 229910002092 carbon dioxide Inorganic materials 0.000 description 14
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 12
- 150000001350 alkyl halides Chemical class 0.000 description 10
- 239000012295 chemical reaction liquid Substances 0.000 description 10
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 10
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 10
- 150000003284 rhodium compounds Chemical class 0.000 description 10
- 238000007086 side reaction Methods 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 150000004694 iodide salts Chemical class 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- -1 of an iodide Chemical class 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229940107816 ammonium iodide Drugs 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 230000036632 reaction speed Effects 0.000 description 3
- LTPBRCUWZOMYOC-UHFFFAOYSA-N Beryllium oxide Chemical compound O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 229910001511 metal iodide Inorganic materials 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- 101100242814 Caenorhabditis elegans parg-1 gene Proteins 0.000 description 1
- FUJCRWPEOMXPAD-UHFFFAOYSA-N Li2O Inorganic materials [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 description 1
- 229910013594 LiOAc Inorganic materials 0.000 description 1
- 101100096112 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) snx-3 gene Proteins 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- CECABOMBVQNBEC-UHFFFAOYSA-K aluminium iodide Chemical compound I[Al](I)I CECABOMBVQNBEC-UHFFFAOYSA-K 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052811 halogen oxide Inorganic materials 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JNMIXMFEVJHFNY-UHFFFAOYSA-M methyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 JNMIXMFEVJHFNY-UHFFFAOYSA-M 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 1
- NOTVAPJNGZMVSD-UHFFFAOYSA-N potassium monoxide Inorganic materials [K]O[K] NOTVAPJNGZMVSD-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012495 reaction gas Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- HTDIUWINAKAPER-UHFFFAOYSA-N trimethylarsine Chemical compound C[As](C)C HTDIUWINAKAPER-UHFFFAOYSA-N 0.000 description 1
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 1
- MBYLVOKEDDQJDY-UHFFFAOYSA-N tris(2-aminoethyl)amine Chemical compound NCCN(CCN)CCN MBYLVOKEDDQJDY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/10—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide
- C07C51/12—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide on an oxygen-containing group in organic compounds, e.g. alcohols
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP16166983A JPS6054334A (ja) | 1983-09-02 | 1983-09-02 | カルボン酸の製造法 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE3432170A1 DE3432170A1 (de) | 1985-03-21 |
| DE3432170C2 true DE3432170C2 (enExample) | 1992-06-25 |
| DE3432170C3 DE3432170C3 (de) | 1999-05-20 |
Family
ID=15739583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3432170A Expired - Lifetime DE3432170C3 (de) | 1983-09-02 | 1984-08-31 | Verfahren zur Herstellung von Essigsäure durch Flüssigphasencarbonylierung |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS6054334A (enExample) |
| DE (1) | DE3432170C3 (enExample) |
| FR (1) | FR2551434B1 (enExample) |
| GB (1) | GB2146637B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH05140024A (ja) * | 1983-09-02 | 1993-06-08 | Daicel Chem Ind Ltd | 酢酸の製造法 |
| CA1231965A (en) * | 1983-12-02 | 1988-01-26 | David J. Schreck | Synergistic production of carboxylic acids from alcohols |
| US5001259A (en) * | 1984-05-03 | 1991-03-19 | Hoechst Celanese Corporation | Methanol carbonylation process |
| CA1228867A (en) * | 1984-05-03 | 1987-11-03 | Celanese Corporation | Methanol carbonylation process |
| US4628041A (en) * | 1986-02-10 | 1986-12-09 | Celanese Corporation | Rhodium and iodine recovery method |
| JPS62253431A (ja) * | 1986-04-28 | 1987-11-05 | Ube Ind Ltd | 一軸延伸架橋ポリエチレンフイルム |
| CA1299195C (en) * | 1986-06-16 | 1992-04-21 | G. Paull Torrence | Addition of hydrogen to carbon monoxide feed gas in producing acetic acid by carbonylation of methanol |
| GB9106298D0 (en) * | 1991-03-25 | 1991-05-08 | Bp Chem Int Ltd | Process |
| US5227519A (en) * | 1992-02-24 | 1993-07-13 | China Petrochemical Development Corporation | Production of carboxylic acids from carbonylation of alcohol |
| GB9211671D0 (en) * | 1992-06-02 | 1992-07-15 | Bp Chem Int Ltd | Process |
| GB9305902D0 (en) * | 1993-03-22 | 1993-05-12 | Bp Chem Int Ltd | Process |
| FR2703351A1 (fr) * | 1993-03-31 | 1994-10-07 | Rhone Poulenc Chimie | Procédé de préparation d'acides carboxyliques ou des esters correspondants en présence d'un catalyseur à base de rhodium et d'iridium. |
| NO942248L (no) * | 1993-06-30 | 1995-01-02 | Bp Chem Int Ltd | Fremgangsmåte for karbonylering av metanol eller et reaktivt derivat derav |
| KR960006546B1 (ko) * | 1993-07-28 | 1996-05-17 | 한국과학기술연구원 | 초산에스테르의 제조 방법 |
| JP3308392B2 (ja) | 1994-06-02 | 2002-07-29 | ダイセル化学工業株式会社 | カルボニル化反応方法 |
| JP3332594B2 (ja) * | 1994-08-12 | 2002-10-07 | ダイセル化学工業株式会社 | 酢酸の精製方法 |
| GB9512427D0 (en) * | 1995-06-19 | 1995-08-23 | Bp Chem Int Ltd | Process |
| US5760279A (en) * | 1995-06-19 | 1998-06-02 | Bp Chemicals Limited | Process for the carbonylation of alkyl alcohols |
| US5696284A (en) * | 1995-06-21 | 1997-12-09 | Bp Chemicals Limited | Process for the carbonylation of alkyl alcohols and/or reactive derivatives thereof |
| EP0933347A1 (en) * | 1997-12-29 | 1999-08-04 | Dsm N.V. | Process for the preparation of a carboxylic acid |
| GB0427821D0 (en) * | 2004-12-17 | 2005-01-19 | Bp Chem Int Ltd | Catalyst and process |
| JP5075336B2 (ja) | 2004-12-20 | 2012-11-21 | 株式会社ダイセル | 酢酸の製造方法 |
| JP4526381B2 (ja) | 2004-12-27 | 2010-08-18 | ダイセル化学工業株式会社 | 酢酸の製造方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE364255B (enExample) * | 1967-04-05 | 1974-02-18 | Monsanto Co | |
| DE1941449C3 (de) * | 1968-08-15 | 1979-07-26 | Monsanto Co., St. Louis, Mo. (V.St.A.) | Verfahren zur Herstellung von Monocarbonsäuren |
| US3769329A (en) * | 1970-03-12 | 1973-10-30 | Monsanto Co | Production of carboxylic acids and esters |
| US3845121A (en) * | 1971-11-10 | 1974-10-29 | Monsanto Co | Process for separating carbonylation products from reaction mixture without catalyst decomposition |
| JPS5547700B2 (enExample) * | 1972-06-27 | 1980-12-02 | ||
| SE413891B (sv) * | 1973-09-04 | 1980-06-30 | Halcon International Inc | Sett att framstella en anhydrid av en monokarbonsyra. |
| DE2450965C2 (de) * | 1974-10-26 | 1983-06-09 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von Essigsäureanhydrid |
| JPS5466614A (en) * | 1977-11-01 | 1979-05-29 | Mitsubishi Gas Chem Co Inc | Preparation of carboxylic acid or its ester |
| NL7907086A (nl) * | 1978-10-06 | 1980-04-09 | Halcon Res & Dev | Werkwijze voor de dehydratatie van methylacetaat. |
| FR2440349A1 (fr) * | 1978-10-31 | 1980-05-30 | Rhone Poulenc Ind | Procede de preparation de l'acide acetique ou de ses melanges avec l'acetate de methyle |
| JPS57134436A (en) * | 1980-12-29 | 1982-08-19 | Monsanto Co | Stabilization of carbonylation catalyst |
| DE3170215D1 (en) * | 1980-12-29 | 1985-05-30 | Monsanto Co | Carbonylation process employing a catalyst stabilised in soluble form |
-
1983
- 1983-09-02 JP JP16166983A patent/JPS6054334A/ja active Granted
-
1984
- 1984-08-31 GB GB08422015A patent/GB2146637B/en not_active Expired
- 1984-08-31 FR FR8413540A patent/FR2551434B1/fr not_active Expired
- 1984-08-31 DE DE3432170A patent/DE3432170C3/de not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3432170A1 (de) | 1985-03-21 |
| GB2146637A (en) | 1985-04-24 |
| DE3432170C3 (de) | 1999-05-20 |
| GB2146637B (en) | 1987-07-22 |
| JPH0469136B2 (enExample) | 1992-11-05 |
| JPS6054334A (ja) | 1985-03-28 |
| GB8422015D0 (en) | 1984-10-03 |
| FR2551434A1 (fr) | 1985-03-08 |
| FR2551434B1 (fr) | 1987-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3432170C2 (enExample) | ||
| DE69403838T2 (de) | Verfahren zur Herstellung von Carbonsäuren oder ihrer Ester in Gegenwart des auf Rhodium und Iridium basierten Katalysators | |
| DE2051766C3 (de) | Verfahren zur Herstellung von Saccharose-Fettsäureestern | |
| DE2334736C3 (de) | Verfahren zur Herstellung von Kohlensäureestern | |
| DE2940752C2 (de) | Verfahren zur Gewinnung der flüchtigen Komponenten und des Edelmetallkatalysators eines bei der Carbonylierung von Alkylestern anfallenden Reaktionsproduktes | |
| DE69407846T2 (de) | Verfahren zur Herstellung von Carbonsäuren oder ihrer Ester in gegenwart des auf Iridium basierten Katalysators | |
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE69608635T3 (de) | Verfahren zur Herstellung von Essigsäure durch Carbonylierung des Dimethyläthers | |
| DE69006045T2 (de) | Verfahren zur Herstellung von Carbonsäuren. | |
| DE2828041A1 (de) | Verfahren zur herstellung von arylbrenztraubensaeuren | |
| DE2709525A1 (de) | Verbessertes katalytisches verfahren | |
| DE2259072A1 (de) | Verfahren zur herstellung von arylessigsaeuren | |
| DE2749955C2 (de) | Verfahren zur Herstellung niedrigmolekularer Alkanmonocarbonsäuren | |
| DE2823660C2 (enExample) | ||
| DE3125982C2 (enExample) | ||
| DE69507822T2 (de) | Herstellung der carbonsäuren oder ihrer ester durch carbonylierung in gegenwart von iridium | |
| DE2124718A1 (enExample) | ||
| DE2415742A1 (de) | Verfahren zur herstellung von carbonsaeureestern | |
| DE3335595A1 (de) | Verfahren zur herstellung von carbonsaeuren | |
| DD150196A5 (de) | Verfahren zur herstellung von monocarbonsaeuren | |
| DD146944A5 (de) | Verfahren zur herstellung von essigsaeure,gegebenenfalls im gemisch mit methylacetat | |
| DE2324765C2 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| DE3512246C2 (de) | Verfahren zur Herstellung von Essigsäure | |
| EP0193801A2 (de) | Verfahren zur kontinuierlichen Homologisierung von Methanol | |
| DE1133720B (de) | Verfahren zur Herstellung von nicht konjugierten Polyencarbonsaeuren oder deren Estern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: GRUENECKER, A., DIPL.-ING. KINKELDEY, H., DIPL.-IN |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HOECHST CELANESE CORP., SOMERVILLE, N.J., US |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: VON KREISLER, A., DIPL.-CHEM. SELTING, G., DIPL.-ING. WERNER, H., DIPL.-CHEM. DR.RER.NAT. FUES, J.,DIPL.-CHEM. DR.RER.NAT., PAT.-ANWAELTE, 50667 KOELN |
|
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted |