DE3423443C2 - - Google Patents
Info
- Publication number
- DE3423443C2 DE3423443C2 DE3423443A DE3423443A DE3423443C2 DE 3423443 C2 DE3423443 C2 DE 3423443C2 DE 3423443 A DE3423443 A DE 3423443A DE 3423443 A DE3423443 A DE 3423443A DE 3423443 C2 DE3423443 C2 DE 3423443C2
- Authority
- DE
- Germany
- Prior art keywords
- transesterification
- lithium
- acrylic
- esters
- trimethylolpropane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000005809 transesterification reaction Methods 0.000 claims description 24
- 239000003054 catalyst Substances 0.000 claims description 21
- 239000000292 calcium oxide Substances 0.000 claims description 11
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 11
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 10
- 150000005846 sugar alcohols Polymers 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 7
- 150000001298 alcohols Chemical class 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 5
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical group [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 4
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 4
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000002148 esters Chemical class 0.000 description 17
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 16
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 10
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- -1 lithium hydride Chemical class 0.000 description 6
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 4
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 description 2
- 229910001947 lithium oxide Inorganic materials 0.000 description 2
- 229910001386 lithium phosphate Inorganic materials 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000005691 triesters Chemical class 0.000 description 2
- TWQULNDIKKJZPH-UHFFFAOYSA-K trilithium;phosphate Chemical compound [Li+].[Li+].[Li+].[O-]P([O-])([O-])=O TWQULNDIKKJZPH-UHFFFAOYSA-K 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- KYNFOMQIXZUKRK-UHFFFAOYSA-N 2,2'-dithiodiethanol Chemical compound OCCSSCCO KYNFOMQIXZUKRK-UHFFFAOYSA-N 0.000 description 1
- XBFUGGOVPHCNEG-UHFFFAOYSA-N 2-ethyl-2-(hydroxymethyl)propane-1,3-diol Chemical compound CCC(CO)(CO)CO.CCC(CO)(CO)CO XBFUGGOVPHCNEG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- CVPVRHYNHFQLMR-UHFFFAOYSA-M Cl(=O)(=O)[O-].[Li+].[O-2].[Ca+2] Chemical compound Cl(=O)(=O)[O-].[Li+].[O-2].[Ca+2] CVPVRHYNHFQLMR-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GCNKJQRMNYNDBI-UHFFFAOYSA-N [2-(hydroxymethyl)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(CO)(CC)COC(=O)C(C)=C GCNKJQRMNYNDBI-UHFFFAOYSA-N 0.000 description 1
- GQCWURKKJXGABF-UHFFFAOYSA-M [Br-].[Li+].[O-2].[Ca+2] Chemical compound [Br-].[Li+].[O-2].[Ca+2] GQCWURKKJXGABF-UHFFFAOYSA-M 0.000 description 1
- QPXRSRBBIJFEHM-UHFFFAOYSA-M [I-].[Li+].[O-2].[Ca+2] Chemical compound [I-].[Li+].[O-2].[Ca+2] QPXRSRBBIJFEHM-UHFFFAOYSA-M 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000005815 base catalysis Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- XQPRBTXUXXVTKB-UHFFFAOYSA-M caesium iodide Chemical class [I-].[Cs+] XQPRBTXUXXVTKB-UHFFFAOYSA-M 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000000687 hydroquinonyl group Chemical class C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- VOENKAZJEHZUTB-UHFFFAOYSA-M lithium oxiran-2-ylmethyl 2-methylprop-2-enoate chloride Chemical compound C(C(=C)C)(=O)OCC1CO1.[Cl-].[Li+] VOENKAZJEHZUTB-UHFFFAOYSA-M 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/03—Preparation of carboxylic acid esters by reacting an ester group with a hydroxy group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423443 DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
| FR8508091A FR2566394B1 (fr) | 1984-06-26 | 1985-05-30 | Procede pour la preparation d'esters des acides acrylique et methacrylique par trans-esterification |
| US06/745,485 US4672105A (en) | 1984-06-26 | 1985-06-17 | Method for preparing esters of acrylic acid and methacrylic acid by transesterification |
| IT8567584A IT1183901B (it) | 1984-06-26 | 1985-06-25 | Procedimento per la produzione di esteri dell'acido acrilico e metacrilico mediante esterificazione |
| JP60138083A JPH07113004B2 (ja) | 1984-06-26 | 1985-06-26 | エステル交換によるアクリル酸―またはメタクリル酸エステルの製造法 |
| GB08516185A GB2163149B (en) | 1984-06-26 | 1985-06-26 | Process for the preparation of esters of acrylic and methacrylic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843423443 DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3423443A1 DE3423443A1 (de) | 1986-01-02 |
| DE3423443C2 true DE3423443C2 (cg-RX-API-DMAC10.html) | 1993-07-01 |
Family
ID=6239130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843423443 Granted DE3423443A1 (de) | 1984-06-26 | 1984-06-26 | Verfahren zur herstellung von estern der acryl- und methacrylsaeure durch umesterung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4672105A (cg-RX-API-DMAC10.html) |
| JP (1) | JPH07113004B2 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3423443A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2566394B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2163149B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1183901B (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005044250A1 (de) * | 2005-09-15 | 2007-03-29 | Röhm Gmbh | Verfahren zur Herstellung von Methacrylaten mit reaktiven Doppelbindungen |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3543115A1 (de) * | 1985-12-06 | 1987-06-11 | Degussa | Verfahren zur herstellung von tetrahydrofurfuryl-(2)-methacrylat und dazu geeigneter katalysator |
| GB9120584D0 (en) * | 1991-09-27 | 1991-11-06 | Bp Chem Int Ltd | Process for the preparation of acrylic acid and methacrylic acid esters |
| DE4217124A1 (de) * | 1992-05-23 | 1993-11-25 | Roehm Gmbh | Verfahren zur Herstellung von endständig Stickstoffheterocyclus-substituiertem (Meth)acrylsäureester |
| DE19602035C2 (de) * | 1996-01-20 | 1998-04-02 | Roehm Gmbh | Verfahren zur Herstellung von Alkoxypolyglycol(meth)acrylaten |
| US6215018B1 (en) * | 1997-08-11 | 2001-04-10 | Ciba Specialty Chemicals Corporation | Acrylate monomer preparation using alkali metal alkoxides as ester interchange catalysts and bromide salt polymerization inhibitors |
| DE19930721C2 (de) * | 1999-07-05 | 2001-12-20 | Roehm Gmbh | Verfahren zur Herstellung und Prozeßinhibierung von Isobornylmethacrylat |
| DE10106642A1 (de) * | 2001-02-12 | 2002-08-22 | Roehm Gmbh | Verfahren zur Herstellung von (Meth)acrylsäureestern durch Umesterung in Gegenwart von Alkalimetallcyanat enthaltenden Mischkatalysatoren |
| EP1727780A1 (de) * | 2004-02-20 | 2006-12-06 | Basf Aktiengesellschaft | Verfahren zur herstellung von (meth) acrylsäureestern |
| CN101088990B (zh) * | 2006-06-13 | 2011-08-03 | 罗门哈斯公司 | 用来制备(甲基)丙烯酸酯单体的酯交换法 |
| DE102007031473A1 (de) | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Ethylenglycoldimethacrylat |
| DE102007031470A1 (de) * | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von (Meth)acrylaten |
| DE102007031474A1 (de) * | 2007-07-05 | 2009-01-08 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Butandioldimethacrylaten |
| WO2009080380A2 (en) | 2007-12-19 | 2009-07-02 | Evonik Röhm Gmbh | Process for preparing (meth)acrylates |
| DE102009001217A1 (de) | 2009-02-27 | 2010-09-02 | Evonik Röhm Gmbh | Monomermischungen, Polymere sowie Beschichtungszusammensetzungen |
| DE102008002254A1 (de) | 2008-06-06 | 2010-01-21 | Evonik Röhm Gmbh | Monomermischungen, Polymere sowie Beschichtungszusammensetzungen |
| DE102008002257A1 (de) | 2008-06-06 | 2010-01-28 | Evonik Röhm Gmbh | Wässrige Dispersionen aufweisend mindestens ein Alkyd-Harz |
| DE102008040214A1 (de) | 2008-07-07 | 2010-01-14 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Polyalkylenglykoldi(meth)acrylaten |
| DE102008040221A1 (de) | 2008-07-07 | 2010-01-14 | Evonik Röhm Gmbh | Verfahren zur Herstellung von (Meth)acrylsäureestern |
| DE102008046075A1 (de) | 2008-09-08 | 2010-03-11 | Evonik Röhm Gmbh | (Meth)acrylatmonomer, Polymer sowie Beschichtungsmittel |
| DE102009026819A1 (de) | 2008-09-08 | 2010-03-11 | Evonik Röhm Gmbh | Monomermischung, Polymer, Beschichtungsmittel und Verfahren zur Herstellung einer Beschichtung |
| EP2383265B1 (en) | 2008-12-22 | 2015-03-11 | Honshu Chemical Industry Co., Ltd. | Method for manufacturing trimellitic anhydride aryl ester |
| DE102009001964A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Multifunktionales(Meth)acryl-Polymer, Beschichtungszusammensetzung, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009001970A1 (de) | 2009-03-30 | 2010-10-14 | Evonik Röhm Gmbh | (Meth)acrylat-Polymer, Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009001966A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Beschichtungszusammensetzung,(Meth)acryl-Polymer und Monomermischung zur Herstellung des(Meth)acryl-Polymers |
| DE102009001965A1 (de) | 2009-03-30 | 2010-10-07 | Evonik Röhm Gmbh | Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102009002888A1 (de) | 2009-05-07 | 2010-11-11 | Evonik Röhm Gmbh | Beschichtungsmittel, Verfahren zur Herstellung einer Beschichtung und beschichteter Gegenstand |
| DE102010000945A1 (de) | 2010-01-15 | 2011-07-21 | Evonik Röhm GmbH, 64293 | Verfahren zur Herstellung von (Meth)acrylsäureestern |
| DE102010030970A1 (de) | 2010-07-06 | 2012-01-12 | Evonik Röhm Gmbh | Zusammensetzung zur Herstellung von Polymeren, (Meth)acryl-Polymer, Beschichtungsmittel und Beschichtung |
| DE102010041272A1 (de) | 2010-09-23 | 2012-03-29 | Evonik Röhm Gmbh | Beschichtungsmittel mit (Meth)acryl-Polymeren und Koaleszenzhilfsmitteln |
| CA2837014A1 (en) | 2011-05-24 | 2012-11-29 | Evonik Rohm Gmbh | Reactive resins for cable sealing compounds |
| DE102011081649A1 (de) | 2011-08-26 | 2013-02-28 | Evonik Röhm Gmbh | Längerkettige Methacrylate aus nachwachsenden Rohstoffen |
| JP6678105B2 (ja) | 2013-12-26 | 2020-04-08 | ダウ グローバル テクノロジーズ エルエルシー | リチウム塩触媒エステル交換プロセスのための阻害剤の組み合わせ及びリチウム塩を除去する方法 |
| DE102017217620A1 (de) * | 2017-10-04 | 2019-04-04 | Evonik Röhm Gmbh | Verfahren zur Herstellung von Dimethylaminoalkyl(meth)acrylaten |
| SG11202011466WA (en) | 2018-05-23 | 2020-12-30 | Evonik Operations Gmbh | Method for preparing keto-functionalized aromatic (meth)acrylates |
| US11912648B2 (en) | 2018-07-17 | 2024-02-27 | Evonik Operations Gmbh | Method for preparing C-H acidic (meth)acrylates |
| EP3599232A1 (de) | 2018-07-26 | 2020-01-29 | Evonik Operations GmbH | Verfahren zur herstellung von n-methyl(meth)acrylamid |
| EP4148040B1 (en) | 2021-09-10 | 2023-11-01 | Evonik Operations GmbH | One pot synthesis of urea (meth)acrylates |
| ES2970697T3 (es) | 2021-09-10 | 2024-05-30 | Evonik Operations Gmbh | (Met)acrilatos de urea espaciados |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2469371A (en) * | 1946-08-14 | 1949-05-10 | Baker Castor Oil Co | Process of reacting glyceride oils |
| US2891991A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Process for preparing higher alkyl esters of methacrylic acid |
| US2891990A (en) * | 1956-09-28 | 1959-06-23 | California Research Corp | Preparation of higher alkyl methacrylates |
| GB1094998A (en) * | 1966-04-19 | 1967-12-13 | Vergier Chemical Company Ltd D | Process for the production of esters |
| CH464891A (de) * | 1966-11-16 | 1968-11-15 | Lonza Ag | Verfahren zur Herstellung von Acrylsäureestern |
| US3784578A (en) * | 1970-06-26 | 1974-01-08 | Bayer Ag | Process for the production of allyl esters |
| DE2364126A1 (de) * | 1972-12-27 | 1974-07-11 | Ciba Geigy Ag | Verfahren zur herstellung von hydroxyalkylphenylderivaten |
| JPS5653535B2 (cg-RX-API-DMAC10.html) * | 1974-05-13 | 1981-12-19 | ||
| JPS5441815A (en) * | 1977-09-02 | 1979-04-03 | Nitto Chem Ind Co Ltd | Preparation of acrylate or methacrylate |
| DE2744641B2 (de) * | 1977-10-04 | 1979-08-02 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Estern der Methacrylsäure |
| DE3013927A1 (de) * | 1980-04-11 | 1981-10-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von hydroxylgruppenhaltigen polmeren |
-
1984
- 1984-06-26 DE DE19843423443 patent/DE3423443A1/de active Granted
-
1985
- 1985-05-30 FR FR8508091A patent/FR2566394B1/fr not_active Expired
- 1985-06-17 US US06/745,485 patent/US4672105A/en not_active Expired - Lifetime
- 1985-06-25 IT IT8567584A patent/IT1183901B/it active
- 1985-06-26 GB GB08516185A patent/GB2163149B/en not_active Expired
- 1985-06-26 JP JP60138083A patent/JPH07113004B2/ja not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005044250A1 (de) * | 2005-09-15 | 2007-03-29 | Röhm Gmbh | Verfahren zur Herstellung von Methacrylaten mit reaktiven Doppelbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1183901B (it) | 1987-10-22 |
| FR2566394A1 (fr) | 1985-12-27 |
| GB8516185D0 (en) | 1985-07-31 |
| JPH07113004B2 (ja) | 1995-12-06 |
| FR2566394B1 (fr) | 1988-08-19 |
| JPS6156155A (ja) | 1986-03-20 |
| IT8567584A0 (it) | 1985-06-25 |
| DE3423443A1 (de) | 1986-01-02 |
| US4672105A (en) | 1987-06-09 |
| GB2163149A (en) | 1986-02-19 |
| GB2163149B (en) | 1988-07-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3423443C2 (cg-RX-API-DMAC10.html) | ||
| DE3423441C2 (cg-RX-API-DMAC10.html) | ||
| DE69434318T2 (de) | Organozinn katalysierte Transesterifizierung | |
| EP2294048B1 (de) | Verfahren zur herstellung von (meth)acrylsäureestern | |
| DE69210929T2 (de) | Verfahren zur Herstellung von Estern von Acryl- und Methacrylsäure | |
| DE69612471T2 (de) | Durch eine Organozinnverbindung katalysierte Transesterification | |
| WO2009003744A1 (de) | Verfahren zur herstellung von (meth)acrylaten | |
| EP2162419A1 (de) | Verfahren zur herstellung von ethylenglycoldimethacrylat | |
| DE2904822A1 (de) | Verfahren zur abtrennung von estern aus reaktionsgemischen | |
| EP0463434B1 (de) | Verfahren zur Herstellung von monoethylenisch ungesättigten Carbonsäureestern | |
| DE19940622C1 (de) | Verfahren zur Herstellung von Di(meth)acrylsäureestern | |
| DE102007031474A1 (de) | Verfahren zur Herstellung von Butandioldimethacrylaten | |
| DE4401132A1 (de) | Verfahren zur Umesterung von (Meth)acrylsäureestern | |
| DE10145228A1 (de) | Synthese von t-Butylaminoethylmethacrylat durch Umesterung des Alkohols mit MMA | |
| DE2423405C3 (de) | Verfahren zur Herstellung von Glycidylmethacrylat | |
| EP0197375B1 (de) | Verfahren zur Inversion der Konfigurationsekundärer Alkohole | |
| DE19652017A1 (de) | Verfahren zur Herstellung von omega-Hydroxyestern alpha,beta-ungesättigter Carbonsäuren | |
| DE1147938B (de) | Herstellung von AEthan-1, 2-diol- und Propan-1, 2-diolmonoacrylat und -monomethacrylat | |
| DE3126943C2 (cg-RX-API-DMAC10.html) | ||
| EP4519237A1 (de) | Herstellung terminal ungesättigter (meth)acrylat-vernetzer | |
| DE19716832C2 (de) | Enantiomerenangereicherte, durch einen tertiären Kohlenwasserstoffrest 2-substituierte 2-Hydroxymethylessigsäuren | |
| DE3728302A1 (de) | Verfahren zur herstellung von bisphenol-bisacrylaten | |
| DE4228397A1 (de) | Verfahren zur Herstellung von Hydroxyalkyl(meth)acrylsäureestern | |
| DE1643549C (de) | Verfahren zur Herstellung von Estern des 2-Methylol-2,6-epoxymethanonorbornans | |
| EP0706989A1 (de) | Verfahren zur Abtrennung eines (Meth)acrylsäurediesters eines C4- bis C6-Alkandiols aus einem Gemisch, das im wesentlichen aus dem C4- bis C6-Alkandiol, dem (Meth)acrylsäuremonoester des C4- bis C6-Alkandiols und dem (Meth)acrylsäurediester des C4- bis C6-Alkandiols besteht |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: ROEHM GMBH & CO. KG, 64293 DARMSTADT, DE |