DE3419471C2 - - Google Patents
Info
- Publication number
- DE3419471C2 DE3419471C2 DE3419471A DE3419471A DE3419471C2 DE 3419471 C2 DE3419471 C2 DE 3419471C2 DE 3419471 A DE3419471 A DE 3419471A DE 3419471 A DE3419471 A DE 3419471A DE 3419471 C2 DE3419471 C2 DE 3419471C2
- Authority
- DE
- Germany
- Prior art keywords
- quinoxalinol
- hydroxide
- catalyst
- aqueous
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 claims description 20
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 16
- 239000007868 Raney catalyst Substances 0.000 claims description 12
- -1 2-quinoxalinol compound Chemical class 0.000 claims description 8
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 8
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 4
- 239000000908 ammonium hydroxide Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- XNSYCGZYOOUZKL-UHFFFAOYSA-N 4-oxido-1h-quinoxalin-4-ium-2-one Chemical class C1=CC=C2[N+]([O-])=CC(=O)NC2=C1 XNSYCGZYOOUZKL-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- FFRYUAVNPBUEIC-UHFFFAOYSA-N quinoxalin-2-ol Chemical class C1=CC=CC2=NC(O)=CN=C21 FFRYUAVNPBUEIC-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- SJAZZQLTKBYDHN-UHFFFAOYSA-N 6-chloro-1h-quinoxalin-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=CN=C21 SJAZZQLTKBYDHN-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 235000011118 potassium hydroxide Nutrition 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000012670 alkaline solution Substances 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- 241000243251 Hydra Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- NJVNOTDYIAFKOP-UHFFFAOYSA-N 4-oxido-6-(trifluoromethyl)-1h-quinoxalin-4-ium-2-one Chemical compound C1=C(C(F)(F)F)C=CC2=NC(O)=C[N+]([O-])=C21 NJVNOTDYIAFKOP-UHFFFAOYSA-N 0.000 description 1
- DJEISFASDVIILC-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-quinoxalin-2-one Chemical compound C1=C(C(F)(F)F)C=CC2=NC(O)=CN=C21 DJEISFASDVIILC-UHFFFAOYSA-N 0.000 description 1
- KDINSGBFCYLRRC-UHFFFAOYSA-N 6-chloro-4-oxido-1h-quinoxalin-4-ium-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=C[N+]([O-])=C21 KDINSGBFCYLRRC-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229940079826 hydrogen sulfite Drugs 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PTLRDCMBXHILCL-UHFFFAOYSA-M sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- ZAPAMMDQEWCVAM-UHFFFAOYSA-N tin;hydrate Chemical compound O.[Sn] ZAPAMMDQEWCVAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58090771A JPS59216878A (ja) | 1983-05-25 | 1983-05-25 | 2−キノキサリノ−ル類の製法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3419471A1 DE3419471A1 (de) | 1984-11-29 |
| DE3419471C2 true DE3419471C2 (enExample) | 1992-02-20 |
Family
ID=14007864
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843419471 Granted DE3419471A1 (de) | 1983-05-25 | 1984-05-24 | Verfahren zur herstellung von 2-chinoxalinolen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4620003A (enExample) |
| JP (1) | JPS59216878A (enExample) |
| KR (1) | KR910004174B1 (enExample) |
| CH (1) | CH660590A5 (enExample) |
| DE (1) | DE3419471A1 (enExample) |
| GB (1) | GB2140420B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4814444A (en) * | 1987-06-19 | 1989-03-21 | Uniroyal Chemical Company, Inc. | Process for the selective reduction of 2-hydroxyquinoxaline-4-oxides |
| US5169955A (en) * | 1990-03-01 | 1992-12-08 | Nippon Kayaku Kabushiki Kaisha | Process for producing 2-hydroxyquinoxaline derivatives |
| CN101941947B (zh) * | 2010-08-27 | 2012-06-27 | 山东京博控股股份有限公司 | 一种6-氯-2-羟基喹喔啉的合成方法 |
| CN102180840A (zh) * | 2011-03-15 | 2011-09-14 | 安徽丰乐农化有限责任公司 | 6-氯-2-羟基喹喔啉的制备新工艺 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5748973A (en) * | 1980-09-09 | 1982-03-20 | Nissan Chem Ind Ltd | Preparation of 2-hydroxyquinoxaline derivative |
| JPS57188575A (en) * | 1981-05-12 | 1982-11-19 | Nissan Chem Ind Ltd | Preparation of 2-hydroxyquinoxaline derivative |
| JPS57197270A (en) * | 1981-05-27 | 1982-12-03 | Nissan Chem Ind Ltd | Production of 2-hydroxyquinoxaline derivative |
-
1983
- 1983-05-25 JP JP58090771A patent/JPS59216878A/ja active Granted
-
1984
- 1984-05-18 US US06/611,969 patent/US4620003A/en not_active Expired - Lifetime
- 1984-05-21 KR KR1019840002769A patent/KR910004174B1/ko not_active Expired
- 1984-05-24 DE DE19843419471 patent/DE3419471A1/de active Granted
- 1984-05-24 CH CH2586/84A patent/CH660590A5/de not_active IP Right Cessation
- 1984-05-24 GB GB08413271A patent/GB2140420B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB2140420A (en) | 1984-11-28 |
| US4620003A (en) | 1986-10-28 |
| JPS59216878A (ja) | 1984-12-06 |
| DE3419471A1 (de) | 1984-11-29 |
| GB2140420B (en) | 1986-11-19 |
| KR910004174B1 (ko) | 1991-06-24 |
| GB8413271D0 (en) | 1984-06-27 |
| CH660590A5 (de) | 1987-05-15 |
| JPH045022B2 (enExample) | 1992-01-30 |
| KR840009301A (ko) | 1984-12-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH502287A (de) | Verfahren zur Herstellung aromatischer Äther bzw. Polyäther | |
| DE943644C (de) | Verfahren zur Herstellung von Kalium-, Rubidium- oder Caesiumborhydrid | |
| DE3419471C2 (enExample) | ||
| DE2525174C3 (de) | Verfahren zur Herstellung von Formaldehyd | |
| EP0129832A1 (de) | Verfahren zur Verminderung von Nebenproduktanteilen bei der Herstellung von Carbendazim | |
| DE3606920A1 (de) | Verfahren zur herstellung von kupferhydroxid | |
| DE2625631C3 (de) | Verfahren zur Herstellung von Alkaligoldsulfit | |
| EP0180650B1 (de) | Verfahren zur Herstellung von Thiurampolysulfiden | |
| DE69520879T2 (de) | Verfahren zur herstellung 6-substituierter 2(1h)-chinoxalinone | |
| GB1146481A (en) | Improvements in or relating to a process for preparing mixed sulphides, solid solutions of simple and mixed sulphides and oxysulphides; and new compounds of this type | |
| DE69115958T2 (de) | Verfahren zur Herstellung von 5-Hydroxy-Hydantoin | |
| DE2425811C3 (de) | Verfahren zur Herstellung ungesättigter aromatischer Aminoverbindungen | |
| DE1950671C3 (de) | Verfahren zur Herstellung von Alkalirhodanid | |
| EP0230895B1 (de) | Verfahren zur Herstellung von hydroxylamin-O-sulfonsäure | |
| DE2723121C2 (de) | Verfahren zur Herstellung von Alkylthiosemicarbaziden | |
| AT214941B (de) | Verfahren zur Herstellung von neuen Bis-(dialkylamido)-chlorphenylphosphaten und -thiolphosphaten | |
| DE3149653A1 (de) | Verfahren zur herstellung von reinem 2,5-dihydroxy-1,4-dithian | |
| DE3305545C1 (de) | Verfahren zur Herstellung von Kupfer(I)-chlorid | |
| DE820000C (de) | Verfahren zur Herstellung schwefelhaltiger Reaktionsprodukte aus Formaldehyd und Schwefelwasserstoff | |
| DE1903968A1 (de) | Herstellung von Thiophenolen mit den Sulfiden oder Polysulfiden des Kobalts und Nickels aus wasserhaltigen Diaryldisulfiden | |
| DE1645472A1 (de) | Verfahren zur Herstellung von Polymethylensulfid | |
| DE2405477C3 (de) | Verfahren zur Herstellung von wasserfreiem Goldtrichlorid | |
| AT237619B (de) | Verfahren zur Herstellung von 3-Chlor-6-merkaptopyridazin | |
| DE2653834A1 (de) | 2-cyanamino-4,6-bis-alkyl(dialkyl) amino-sym.-triazine und verfahren zu deren herstellung | |
| US2268123A (en) | Process of manufacturing copper acetoarsenite |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KADOR, U., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |