CH660590A5 - Verfahren zur herstellung von 2-chinoxalinol. - Google Patents
Verfahren zur herstellung von 2-chinoxalinol. Download PDFInfo
- Publication number
- CH660590A5 CH660590A5 CH2586/84A CH258684A CH660590A5 CH 660590 A5 CH660590 A5 CH 660590A5 CH 2586/84 A CH2586/84 A CH 2586/84A CH 258684 A CH258684 A CH 258684A CH 660590 A5 CH660590 A5 CH 660590A5
- Authority
- CH
- Switzerland
- Prior art keywords
- quinoxalinol
- hydroxide
- aqueous
- catalyst
- oxide
- Prior art date
Links
- FFRYUAVNPBUEIC-UHFFFAOYSA-N quinoxalin-2-ol Chemical compound C1=CC=CC2=NC(O)=CN=C21 FFRYUAVNPBUEIC-UHFFFAOYSA-N 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims description 26
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 20
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 239000007868 Raney catalyst Substances 0.000 claims description 14
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- XNSYCGZYOOUZKL-UHFFFAOYSA-N 4-oxido-1h-quinoxalin-4-ium-2-one Chemical compound C1=CC=C2[N+]([O-])=CC(=O)NC2=C1 XNSYCGZYOOUZKL-UHFFFAOYSA-N 0.000 claims description 9
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 239000000908 ammonium hydroxide Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 150000003464 sulfur compounds Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- SJAZZQLTKBYDHN-UHFFFAOYSA-N 6-chloro-1h-quinoxalin-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=CN=C21 SJAZZQLTKBYDHN-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000012670 alkaline solution Substances 0.000 description 4
- 229910017052 cobalt Inorganic materials 0.000 description 4
- 239000010941 cobalt Substances 0.000 description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 4
- 235000015927 pasta Nutrition 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- KDINSGBFCYLRRC-UHFFFAOYSA-N 6-chloro-4-oxido-1h-quinoxalin-4-ium-2-one Chemical compound C1=C(Cl)C=CC2=NC(O)=C[N+]([O-])=C21 KDINSGBFCYLRRC-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- -1 ammonium hydroxide 2-quinoxalinols Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- NJVNOTDYIAFKOP-UHFFFAOYSA-N 4-oxido-6-(trifluoromethyl)-1h-quinoxalin-4-ium-2-one Chemical compound C1=C(C(F)(F)F)C=CC2=NC(O)=C[N+]([O-])=C21 NJVNOTDYIAFKOP-UHFFFAOYSA-N 0.000 description 1
- DJEISFASDVIILC-UHFFFAOYSA-N 6-(trifluoromethyl)-1h-quinoxalin-2-one Chemical compound C1=C(C(F)(F)F)C=CC2=NC(O)=CN=C21 DJEISFASDVIILC-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 239000004285 Potassium sulphite Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-N dithionous acid Chemical class OS(=O)S(O)=O GRWZHXKQBITJKP-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- PTLRDCMBXHILCL-UHFFFAOYSA-M sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/44—Benzopyrazines with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58090771A JPS59216878A (ja) | 1983-05-25 | 1983-05-25 | 2−キノキサリノ−ル類の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH660590A5 true CH660590A5 (de) | 1987-05-15 |
Family
ID=14007864
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH2586/84A CH660590A5 (de) | 1983-05-25 | 1984-05-24 | Verfahren zur herstellung von 2-chinoxalinol. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4620003A (enExample) |
| JP (1) | JPS59216878A (enExample) |
| KR (1) | KR910004174B1 (enExample) |
| CH (1) | CH660590A5 (enExample) |
| DE (1) | DE3419471A1 (enExample) |
| GB (1) | GB2140420B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4814444A (en) * | 1987-06-19 | 1989-03-21 | Uniroyal Chemical Company, Inc. | Process for the selective reduction of 2-hydroxyquinoxaline-4-oxides |
| US5169955A (en) * | 1990-03-01 | 1992-12-08 | Nippon Kayaku Kabushiki Kaisha | Process for producing 2-hydroxyquinoxaline derivatives |
| CN101941947B (zh) * | 2010-08-27 | 2012-06-27 | 山东京博控股股份有限公司 | 一种6-氯-2-羟基喹喔啉的合成方法 |
| CN102180840A (zh) * | 2011-03-15 | 2011-09-14 | 安徽丰乐农化有限责任公司 | 6-氯-2-羟基喹喔啉的制备新工艺 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5748973A (en) * | 1980-09-09 | 1982-03-20 | Nissan Chem Ind Ltd | Preparation of 2-hydroxyquinoxaline derivative |
| JPS57188575A (en) * | 1981-05-12 | 1982-11-19 | Nissan Chem Ind Ltd | Preparation of 2-hydroxyquinoxaline derivative |
| JPS57197270A (en) * | 1981-05-27 | 1982-12-03 | Nissan Chem Ind Ltd | Production of 2-hydroxyquinoxaline derivative |
-
1983
- 1983-05-25 JP JP58090771A patent/JPS59216878A/ja active Granted
-
1984
- 1984-05-18 US US06/611,969 patent/US4620003A/en not_active Expired - Lifetime
- 1984-05-21 KR KR1019840002769A patent/KR910004174B1/ko not_active Expired
- 1984-05-24 DE DE19843419471 patent/DE3419471A1/de active Granted
- 1984-05-24 GB GB08413271A patent/GB2140420B/en not_active Expired
- 1984-05-24 CH CH2586/84A patent/CH660590A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH045022B2 (enExample) | 1992-01-30 |
| DE3419471C2 (enExample) | 1992-02-20 |
| GB2140420A (en) | 1984-11-28 |
| KR910004174B1 (ko) | 1991-06-24 |
| GB2140420B (en) | 1986-11-19 |
| KR840009301A (ko) | 1984-12-26 |
| GB8413271D0 (en) | 1984-06-27 |
| US4620003A (en) | 1986-10-28 |
| JPS59216878A (ja) | 1984-12-06 |
| DE3419471A1 (de) | 1984-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69504162T2 (de) | Verfahren zur Herstellung von 2-Methyl-1,4-naphthochinon | |
| DE69607921T2 (de) | Verfahren zur herstellung von halosubstituierter aromatischer säure | |
| CH660590A5 (de) | Verfahren zur herstellung von 2-chinoxalinol. | |
| DE68903367T2 (de) | Verfahren zur herstellung von alkali- oder erdalkali-ferraten durch ein verfahren in festem zustand. | |
| EP0413981B1 (de) | Dinatriumsalz des Trimercapto-s-triazin-hexahydrats, Verfahren zu seiner Herstellung und Verwendung | |
| EP0006156B1 (de) | Verfahren zur Herstellung von Dihydro-4,4-dimethyl-2,3-furandion | |
| DE3606920A1 (de) | Verfahren zur herstellung von kupferhydroxid | |
| DE2506348B2 (enExample) | ||
| DE2159127A1 (de) | Verfahren zur Herstellung von hochreinem Trimangantetroxyd | |
| DE69520879T2 (de) | Verfahren zur herstellung 6-substituierter 2(1h)-chinoxalinone | |
| EP0196592B1 (de) | Verfahren zur Herstellung von 2-Merkaptobenzoxazolen | |
| DE2820856A1 (de) | Festes natrium- oder kalium-p- hydroxymandelat-monohydrat und verfahren zu seiner herstellung | |
| DE2202204C2 (de) | Verfahren zur Herstellung von 2-Mercaptobenzimidazol | |
| EP0033099B1 (de) | Verfahren zur Herstellung von 2-Amino-4-nitrophenol | |
| AT232981B (de) | Verfahren zur Herstellung von aliphatischen oder aromatischen Diacylperoxyden | |
| DE1903968C3 (de) | Verfahren zur Herstellung von Thiophenolen | |
| DE1950671C3 (de) | Verfahren zur Herstellung von Alkalirhodanid | |
| AT214941B (de) | Verfahren zur Herstellung von neuen Bis-(dialkylamido)-chlorphenylphosphaten und -thiolphosphaten | |
| CH403747A (de) | Verfahren zur Herstellung von Tetracyclin-Verbindungen | |
| DE2302723A1 (de) | Verfahren zur entfernung von sechswertigem chrom aus chlorat enthaltenden fluessigkeiten | |
| DE2220265C3 (de) | Verfahren zur Abtrennung von Alkalinitrilotriacetaten durch Kristallisation | |
| AT237619B (de) | Verfahren zur Herstellung von 3-Chlor-6-merkaptopyridazin | |
| DE2806038C2 (de) | Verfahren zur Herstellung von Nitroguanidin | |
| DE1795190C (de) | Verfahren zur Herstellung von beta Lactamen | |
| DE10341864B4 (de) | Verfahren zur Herstellung hochreiner 2,3-Pyridindicarbonsäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |