DE3405395C2 - - Google Patents
Info
- Publication number
- DE3405395C2 DE3405395C2 DE3405395A DE3405395A DE3405395C2 DE 3405395 C2 DE3405395 C2 DE 3405395C2 DE 3405395 A DE3405395 A DE 3405395A DE 3405395 A DE3405395 A DE 3405395A DE 3405395 C2 DE3405395 C2 DE 3405395C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- carbon atoms
- compound
- electron
- paper
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 claims description 43
- -1 aromatic hydroxy compound Chemical class 0.000 claims description 30
- 239000000126 substance Substances 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 17
- 239000003094 microcapsule Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 239000004927 clay Substances 0.000 claims description 5
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 239000003593 chromogenic compound Substances 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 26
- 239000005977 Ethylene Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000839 emulsion Substances 0.000 description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000002775 capsule Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 7
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical class C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000002596 lactones Chemical group 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- QTKIQLNGOKOPOE-UHFFFAOYSA-N 1,1'-biphenyl;propane Chemical group CCC.C1=CC=CC=C1C1=CC=CC=C1 QTKIQLNGOKOPOE-UHFFFAOYSA-N 0.000 description 2
- LLKFNPUXQZHIAE-UHFFFAOYSA-N 5-(3-aminopropyl)-8-bromo-3-methyl-2h-pyrazolo[4,3-c]quinolin-4-one Chemical compound O=C1N(CCCN)C2=CC=C(Br)C=C2C2=C1C(C)=NN2 LLKFNPUXQZHIAE-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 125000005504 styryl group Chemical group 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- OEIOKPQWHXSUCH-UHFFFAOYSA-N 3-amino-3h-2-benzofuran-1-one Chemical class C1=CC=C2C(N)OC(=O)C2=C1 OEIOKPQWHXSUCH-UHFFFAOYSA-N 0.000 description 1
- DNOUZCXUTYVRSR-UHFFFAOYSA-N 4-dodecoxy-3-methoxybenzaldehyde Chemical compound CCCCCCCCCCCCOC1=CC=C(C=O)C=C1OC DNOUZCXUTYVRSR-UHFFFAOYSA-N 0.000 description 1
- KVOWZHASDIKNFK-UHFFFAOYSA-N 4-octoxybenzaldehyde Chemical compound CCCCCCCCOC1=CC=C(C=O)C=C1 KVOWZHASDIKNFK-UHFFFAOYSA-N 0.000 description 1
- 244000171897 Acacia nilotica subsp nilotica Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000001562 benzopyrans Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000005354 coacervation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/323—Organic colour formers, e.g. leuco dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58027142A JPS59152891A (ja) | 1983-02-18 | 1983-02-18 | 発色性記録材料 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3405395A1 DE3405395A1 (de) | 1984-08-23 |
| DE3405395C2 true DE3405395C2 (OSRAM) | 1987-06-25 |
Family
ID=12212795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843405395 Granted DE3405395A1 (de) | 1983-02-18 | 1984-02-15 | Chromogene verbindungen und sie enthaltende farbentwicklerzusammensetzung und druck- oder waermeempfindliche aufzeichnungsblaetter |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US4598150A (OSRAM) |
| JP (1) | JPS59152891A (OSRAM) |
| DE (1) | DE3405395A1 (OSRAM) |
| GB (1) | GB2136823B (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59152891A (ja) * | 1983-02-18 | 1984-08-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| NO174506B (no) * | 1984-10-30 | 1994-02-07 | Usv Pharma Corp | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
| US4962203A (en) * | 1985-06-18 | 1990-10-09 | Merck Frost Canada, Inc. | 2-substituted quinolines useful as leukotriene antagonists |
| ES8801209A1 (es) * | 1985-06-18 | 1988-01-01 | Merck Frosst Canada Inc | Un procedimiento para la preparacion de quinolinas 2-sustituidas. |
| JPS6270081A (ja) * | 1985-09-24 | 1987-03-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US4851409A (en) * | 1986-02-14 | 1989-07-25 | Merck Frosst Canada Inc. | 2-substituted quinoline dioic acids and pharmaceutical compositions |
| JPS61189988A (ja) * | 1986-08-11 | 1986-08-23 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US5136034A (en) * | 1987-02-05 | 1992-08-04 | Merck Frosst Canada, Inc. | Synthesis of chiral thioacetals and thioethers |
| DE3905339A1 (de) * | 1989-02-22 | 1990-09-06 | Basf Ag | Chinolin-4-carbonsaeurederivate und deren verwendung |
| DE4032208A1 (de) * | 1990-10-11 | 1992-04-16 | Bayer Ag | Carbonylaminostyryle |
| DE4039298A1 (de) * | 1990-12-10 | 1992-06-11 | Basf Ag | Derivate von chinolincarbonsaeuren |
| GB9522233D0 (en) * | 1995-10-31 | 1996-01-03 | Wiggins Teape Group The Limite | Pressure-sensitive copying paper |
| FR2761687B1 (fr) * | 1997-04-08 | 2000-09-15 | Centre Nat Rech Scient | Derives de quinoleines, possedant notamment des proprietes antivirales, leurs preparations et leurs applications biologiques |
| US6353770B1 (en) | 1999-05-26 | 2002-03-05 | Levi Strauss & Co. | Apparatus and method for the remote production of customized clothing |
| RU2462455C2 (ru) * | 2010-12-01 | 2012-09-27 | Учреждение Российской Академии Наук Институт Проблем Химической Физики Ран (Ипхф Ран) | Способ получения гидроксипроизводных стирилхинолинов |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4121033Y1 (OSRAM) * | 1965-04-12 | 1966-10-13 | ||
| JPS5127169B2 (OSRAM) * | 1972-10-20 | 1976-08-11 | ||
| JPS5127169A (ja) * | 1974-08-31 | 1976-03-06 | Ricoh Kk | Senzairyorenzokukyokyusochi |
| JPS584712B2 (ja) * | 1979-07-04 | 1983-01-27 | 工業技術院長 | アセタ−ル基をもつ含窒素複素環化合物及びその製造方法 |
| DE3219239A1 (de) * | 1981-05-22 | 1982-12-09 | CIBA-GEIGY AG, 4002 Basel | Druck- oder waermeempfindliches aufzeichnungsmaterial |
| JPS5841288B2 (ja) * | 1981-08-06 | 1983-09-10 | 工業技術院長 | 光不溶化性樹脂組成物 |
| JPS59152891A (ja) * | 1983-02-18 | 1984-08-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
-
1983
- 1983-02-18 JP JP58027142A patent/JPS59152891A/ja active Granted
-
1984
- 1984-02-15 GB GB08403973A patent/GB2136823B/en not_active Expired
- 1984-02-15 DE DE19843405395 patent/DE3405395A1/de active Granted
- 1984-02-16 US US06/580,604 patent/US4598150A/en not_active Expired - Fee Related
-
1986
- 1986-08-26 US US06/900,771 patent/US4820841A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT * |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59152891A (ja) | 1984-08-31 |
| JPH0311279B2 (OSRAM) | 1991-02-15 |
| US4820841A (en) | 1989-04-11 |
| GB2136823B (en) | 1987-04-23 |
| GB8403973D0 (en) | 1984-03-21 |
| GB2136823A (en) | 1984-09-26 |
| US4598150A (en) | 1986-07-01 |
| DE3405395A1 (de) | 1984-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2834711C2 (de) | Chromogene Fluorane und diese Verbindungen enthaltende Farbentwicklerzusammensetzungen für druck- oder wärmeempfindliche Kopiermaterialien | |
| DE3405395C2 (OSRAM) | ||
| DE1671545C2 (de) | Druckempfindliches Kopierpapier | |
| EP0016730B1 (de) | Farbentwicklermasse zur Herstellung eines druckempfindlichen Aufzeichnungsmaterials; Farbentwicklungsblatt für druckempfindliches Aufzeichnungsmaterial; druckempfindliches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE3045022A1 (de) | Bildaufzeichnungsmaterialien | |
| DE2422899C3 (de) | Basisch-substituierte Furanverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbbildner für ein druck- oder wärmeempfindliches Aufzeichnungsmaterial | |
| DE3407369A1 (de) | Chromogenes aufzeichnungsmaterial | |
| DE2025171B2 (de) | Druckempfindliches kopierpapier | |
| DE3438083C2 (OSRAM) | ||
| DE2163658A1 (de) | Druckempfindliches Kopierpapier | |
| DE2618264A1 (de) | Druckempfindliches aufzeichnungsmaterial | |
| DE2820462B2 (de) | Selbstaufzeichnendes druckempfindliches Papier | |
| DE2150797C3 (de) | Basisch substituierte Fluoranverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende druck- oder wärmeempfindliche Aufzeichnungsmaterialien | |
| DE2932004C2 (de) | Farbe entwickelndes Blatt und dessen Verwendung für druckempfindliche Aufzeichnungsblätter | |
| DE2530464C3 (de) | Druckempfindliches Kopiermaterial | |
| DE3225028A1 (de) | Fluoranderivate und diese enthaltende aufzeichnungsmaterialien | |
| CH658864A5 (de) | Chromogenes fluoranderivat. | |
| DE1543803C3 (de) | Basisch substituierte Fluorane und Verfahren zu ihrer Herstellung sowie deren Verwendung als Farbbildner für druckempfindliche Vervielfältigungsmaterialien | |
| DE2016371C3 (de) | 2,4-Disubstituierte-6-amino-fluorane und ein Verfahren zu ihrer Herstellung sowie deren Verwendung als Farbbildner fur druckempfindliche Kopierpapiere | |
| DE69131031T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial und Verfahren zu dessen Herstellung | |
| DE3804437C2 (de) | Leukofarbstoff und ihn enthaltendes Aufzeichnungsmaterial | |
| DE2344092A1 (de) | Neue rhodaminlactam-derivate | |
| DE2245504C2 (de) | Basisch substituierte Fluoranverbindungen und diese Verbindungen enthaltende druck- bzw. wärmeempfindliche Aufzeichnungsmaterialien | |
| DE2132849C3 (de) | Verfahren zur Herstellung eines Entwicklerbogens für druckempfindliche Aufzeichnungspapiere | |
| DE3015655A1 (de) | Fluoranverbindungen, verfahren zu deren herstellung und deren anwendung in aufzeichnungsboegen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: KADOR, U., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8125 | Change of the main classification |
Ipc: C09B 57/00 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |