DE3405395A1 - Chromogene verbindungen und sie enthaltende farbentwicklerzusammensetzung und druck- oder waermeempfindliche aufzeichnungsblaetter - Google Patents
Chromogene verbindungen und sie enthaltende farbentwicklerzusammensetzung und druck- oder waermeempfindliche aufzeichnungsblaetterInfo
- Publication number
- DE3405395A1 DE3405395A1 DE19843405395 DE3405395A DE3405395A1 DE 3405395 A1 DE3405395 A1 DE 3405395A1 DE 19843405395 DE19843405395 DE 19843405395 DE 3405395 A DE3405395 A DE 3405395A DE 3405395 A1 DE3405395 A1 DE 3405395A1
- Authority
- DE
- Germany
- Prior art keywords
- quinolyl
- ethylene
- methoxy
- ethoxy
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 title claims description 25
- 239000003593 chromogenic compound Substances 0.000 title claims description 8
- 239000005977 Ethylene Substances 0.000 claims description 84
- -1 4-dodecyloxyphenyl Chemical group 0.000 claims description 82
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 71
- 150000001875 compounds Chemical class 0.000 claims description 43
- 125000004432 carbon atom Chemical group C* 0.000 claims description 29
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 24
- 239000000126 substance Substances 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 239000003094 microcapsule Substances 0.000 claims description 10
- 239000004927 clay Substances 0.000 claims description 7
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 229920001568 phenolic resin Polymers 0.000 claims description 5
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 4
- 108010010803 Gelatin Proteins 0.000 claims description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 4
- 229920000159 gelatin Polymers 0.000 claims description 4
- 239000008273 gelatin Substances 0.000 claims description 4
- 235000019322 gelatine Nutrition 0.000 claims description 4
- 235000011852 gelatine desserts Nutrition 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 2
- 229920002125 Sokalan® Polymers 0.000 claims description 2
- 229920002472 Starch Polymers 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 2
- 229920000609 methyl cellulose Polymers 0.000 claims description 2
- 239000001923 methylcellulose Substances 0.000 claims description 2
- 235000010981 methylcellulose Nutrition 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 229920002401 polyacrylamide Polymers 0.000 claims description 2
- 239000004584 polyacrylic acid Substances 0.000 claims description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 2
- 239000008107 starch Substances 0.000 claims description 2
- 235000019698 starch Nutrition 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims 1
- 229920001477 hydrophilic polymer Polymers 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 22
- 239000000243 solution Substances 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 239000000839 emulsion Substances 0.000 description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002775 capsule Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical class C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000002596 lactones Chemical group 0.000 description 4
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- QTKIQLNGOKOPOE-UHFFFAOYSA-N 1,1'-biphenyl;propane Chemical group CCC.C1=CC=CC=C1C1=CC=CC=C1 QTKIQLNGOKOPOE-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 241000978776 Senegalia senegal Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 125000005504 styryl group Chemical group 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- DNOUZCXUTYVRSR-UHFFFAOYSA-N 4-dodecoxy-3-methoxybenzaldehyde Chemical compound CCCCCCCCCCCCOC1=CC=C(C=O)C=C1OC DNOUZCXUTYVRSR-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001562 benzopyrans Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000005354 coacervation Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/323—Organic colour formers, e.g. leuco dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58027142A JPS59152891A (ja) | 1983-02-18 | 1983-02-18 | 発色性記録材料 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3405395A1 true DE3405395A1 (de) | 1984-08-23 |
| DE3405395C2 DE3405395C2 (enExample) | 1987-06-25 |
Family
ID=12212795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843405395 Granted DE3405395A1 (de) | 1983-02-18 | 1984-02-15 | Chromogene verbindungen und sie enthaltende farbentwicklerzusammensetzung und druck- oder waermeempfindliche aufzeichnungsblaetter |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US4598150A (enExample) |
| JP (1) | JPS59152891A (enExample) |
| DE (1) | DE3405395A1 (enExample) |
| GB (1) | GB2136823B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0206751A3 (en) * | 1985-06-18 | 1988-05-25 | Merck Frosst Canada Inc. | 2-substituted quinolines, their preparation and use |
| EP0181568A3 (en) * | 1984-10-30 | 1989-04-26 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Anti-inflammatory/anti-allergic compounds |
| EP0480276A3 (en) * | 1990-10-11 | 1992-05-13 | Bayer Ag | Carbonylaminostyrene derivatives as recording material |
| EP0490200A1 (de) * | 1990-12-10 | 1992-06-17 | BASF Aktiengesellschaft | Derivate von Chinolincarbonsäuren |
| WO1998045269A1 (fr) * | 1997-04-08 | 1998-10-15 | Centre National De La Recherche Scientifique (Cnrs) | Derives de quinoleines en tant qu'inhibiteurs de la vih integrase |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59152891A (ja) * | 1983-02-18 | 1984-08-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US4962203A (en) * | 1985-06-18 | 1990-10-09 | Merck Frost Canada, Inc. | 2-substituted quinolines useful as leukotriene antagonists |
| JPS6270081A (ja) * | 1985-09-24 | 1987-03-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US4851409A (en) * | 1986-02-14 | 1989-07-25 | Merck Frosst Canada Inc. | 2-substituted quinoline dioic acids and pharmaceutical compositions |
| JPS61189988A (ja) * | 1986-08-11 | 1986-08-23 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US5136034A (en) * | 1987-02-05 | 1992-08-04 | Merck Frosst Canada, Inc. | Synthesis of chiral thioacetals and thioethers |
| DE3905339A1 (de) * | 1989-02-22 | 1990-09-06 | Basf Ag | Chinolin-4-carbonsaeurederivate und deren verwendung |
| GB9522233D0 (en) * | 1995-10-31 | 1996-01-03 | Wiggins Teape Group The Limite | Pressure-sensitive copying paper |
| US6353770B1 (en) | 1999-05-26 | 2002-03-05 | Levi Strauss & Co. | Apparatus and method for the remote production of customized clothing |
| RU2462455C2 (ru) * | 2010-12-01 | 2012-09-27 | Учреждение Российской Академии Наук Институт Проблем Химической Физики Ран (Ипхф Ран) | Способ получения гидроксипроизводных стирилхинолинов |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4121033Y1 (enExample) * | 1965-04-12 | 1966-10-13 | ||
| JPS5127169B2 (enExample) * | 1972-10-20 | 1976-08-11 | ||
| JPS5127169A (ja) * | 1974-08-31 | 1976-03-06 | Ricoh Kk | Senzairyorenzokukyokyusochi |
| JPS584712B2 (ja) * | 1979-07-04 | 1983-01-27 | 工業技術院長 | アセタ−ル基をもつ含窒素複素環化合物及びその製造方法 |
| DE3219239A1 (de) * | 1981-05-22 | 1982-12-09 | CIBA-GEIGY AG, 4002 Basel | Druck- oder waermeempfindliches aufzeichnungsmaterial |
| JPS5841288B2 (ja) * | 1981-08-06 | 1983-09-10 | 工業技術院長 | 光不溶化性樹脂組成物 |
| JPS59152891A (ja) * | 1983-02-18 | 1984-08-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
-
1983
- 1983-02-18 JP JP58027142A patent/JPS59152891A/ja active Granted
-
1984
- 1984-02-15 DE DE19843405395 patent/DE3405395A1/de active Granted
- 1984-02-15 GB GB08403973A patent/GB2136823B/en not_active Expired
- 1984-02-16 US US06/580,604 patent/US4598150A/en not_active Expired - Fee Related
-
1986
- 1986-08-26 US US06/900,771 patent/US4820841A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT * |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0181568A3 (en) * | 1984-10-30 | 1989-04-26 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Anti-inflammatory/anti-allergic compounds |
| EP0206751A3 (en) * | 1985-06-18 | 1988-05-25 | Merck Frosst Canada Inc. | 2-substituted quinolines, their preparation and use |
| EP0480276A3 (en) * | 1990-10-11 | 1992-05-13 | Bayer Ag | Carbonylaminostyrene derivatives as recording material |
| EP0490200A1 (de) * | 1990-12-10 | 1992-06-17 | BASF Aktiengesellschaft | Derivate von Chinolincarbonsäuren |
| US5214146A (en) * | 1990-12-10 | 1993-05-25 | Basf Aktiengesellschaft | Derivatives of quinolinecarboxylic acids |
| WO1998045269A1 (fr) * | 1997-04-08 | 1998-10-15 | Centre National De La Recherche Scientifique (Cnrs) | Derives de quinoleines en tant qu'inhibiteurs de la vih integrase |
| US6670377B1 (en) | 1997-04-08 | 2003-12-30 | Centre National De La Recherche | Quinoline derivatives, having in particular antiviral properties, preparation and biological applications thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| GB8403973D0 (en) | 1984-03-21 |
| US4820841A (en) | 1989-04-11 |
| US4598150A (en) | 1986-07-01 |
| JPS59152891A (ja) | 1984-08-31 |
| DE3405395C2 (enExample) | 1987-06-25 |
| JPH0311279B2 (enExample) | 1991-02-15 |
| GB2136823B (en) | 1987-04-23 |
| GB2136823A (en) | 1984-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2834711C2 (de) | Chromogene Fluorane und diese Verbindungen enthaltende Farbentwicklerzusammensetzungen für druck- oder wärmeempfindliche Kopiermaterialien | |
| EP0016730B1 (de) | Farbentwicklermasse zur Herstellung eines druckempfindlichen Aufzeichnungsmaterials; Farbentwicklungsblatt für druckempfindliches Aufzeichnungsmaterial; druckempfindliches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE3405395A1 (de) | Chromogene verbindungen und sie enthaltende farbentwicklerzusammensetzung und druck- oder waermeempfindliche aufzeichnungsblaetter | |
| DE1695581B2 (de) | 33-Bis-<3-indolyl)-phthalide | |
| DE3407369A1 (de) | Chromogenes aufzeichnungsmaterial | |
| DE2422899A1 (de) | Diamino-substituierte fluoranverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbbildner in einem druckempfindlichen oder thermoreaktiven aufzeichnungsmaterial | |
| DE2618264C3 (de) | Druckempfindliches Aufzeichnungsmaterial und farbbildende Lösung zur Verwendung darin | |
| DE2025171B2 (de) | Druckempfindliches kopierpapier | |
| DE3438083C2 (enExample) | ||
| DE2163658A1 (de) | Druckempfindliches Kopierpapier | |
| DE2820462B2 (de) | Selbstaufzeichnendes druckempfindliches Papier | |
| DE2156371C3 (de) | Organische ölige Farbbildnermasse für druckempfindliche Aufzeichnung | |
| DE2150797C3 (de) | Basisch substituierte Fluoranverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende druck- oder wärmeempfindliche Aufzeichnungsmaterialien | |
| DE3116815C2 (enExample) | ||
| DE3225028A1 (de) | Fluoranderivate und diese enthaltende aufzeichnungsmaterialien | |
| DE2932004A1 (de) | Farbe entwickelndes blatt fuer druckempfindliche aufzeichnungsblaetter | |
| DE1543803C3 (de) | Basisch substituierte Fluorane und Verfahren zu ihrer Herstellung sowie deren Verwendung als Farbbildner für druckempfindliche Vervielfältigungsmaterialien | |
| DE2016371C3 (de) | 2,4-Disubstituierte-6-amino-fluorane und ein Verfahren zu ihrer Herstellung sowie deren Verwendung als Farbbildner fur druckempfindliche Kopierpapiere | |
| DE69131031T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial und Verfahren zu dessen Herstellung | |
| DE3804437C2 (de) | Leukofarbstoff und ihn enthaltendes Aufzeichnungsmaterial | |
| DE2245504C2 (de) | Basisch substituierte Fluoranverbindungen und diese Verbindungen enthaltende druck- bzw. wärmeempfindliche Aufzeichnungsmaterialien | |
| DE3783005T2 (de) | Aufzeichnungsmaterialblatt mit farbstoffbildner. | |
| DD151515A5 (de) | Druckempfindliche aufzeichnungsmaterialien | |
| DE3015655A1 (de) | Fluoranverbindungen, verfahren zu deren herstellung und deren anwendung in aufzeichnungsboegen | |
| DE2618271A1 (de) | Druckempfindliches aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: KADOR, U., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| 8125 | Change of the main classification |
Ipc: C09B 57/00 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |