DE3334854C2 - - Google Patents
Info
- Publication number
- DE3334854C2 DE3334854C2 DE3334854A DE3334854A DE3334854C2 DE 3334854 C2 DE3334854 C2 DE 3334854C2 DE 3334854 A DE3334854 A DE 3334854A DE 3334854 A DE3334854 A DE 3334854A DE 3334854 C2 DE3334854 C2 DE 3334854C2
- Authority
- DE
- Germany
- Prior art keywords
- phenol
- hydrogen peroxide
- water
- solution
- solutions
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 93
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 29
- 150000002989 phenols Chemical group 0.000 claims abstract description 23
- 238000005805 hydroxylation reaction Methods 0.000 claims abstract description 15
- 238000009835 boiling Methods 0.000 claims abstract description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims abstract description 5
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052714 tellurium Inorganic materials 0.000 claims abstract description 4
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 230000033444 hydroxylation Effects 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Chemical group 0.000 claims description 3
- 238000010533 azeotropic distillation Methods 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- 239000011877 solvent mixture Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 238000004821 distillation Methods 0.000 abstract description 3
- 238000007254 oxidation reaction Methods 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 150000008379 phenol ethers Chemical class 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- 229960003742 phenol Drugs 0.000 description 28
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 18
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 12
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 12
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 10
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 8
- 150000002978 peroxides Chemical class 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 6
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 3
- 229940011051 isopropyl acetate Drugs 0.000 description 3
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- CHLICZRVGGXEOD-UHFFFAOYSA-N 1-Methoxy-4-methylbenzene Chemical compound COC1=CC=C(C)C=C1 CHLICZRVGGXEOD-UHFFFAOYSA-N 0.000 description 2
- FNYDIAAMUCQQDE-UHFFFAOYSA-N 4-methylbenzene-1,3-diol Chemical compound CC1=CC=C(O)C=C1O FNYDIAAMUCQQDE-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical class COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000000640 hydroxylating effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- -1 -tert-butyl pyrocatechin Chemical compound 0.000 description 1
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- GJYCVCVHRSWLNY-UHFFFAOYSA-N 2-butylphenol Chemical class CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 1
- RMGHERXMTMUMMV-UHFFFAOYSA-N 2-methoxypropane Chemical compound COC(C)C RMGHERXMTMUMMV-UHFFFAOYSA-N 0.000 description 1
- ZBCATMYQYDCTIZ-UHFFFAOYSA-N 4-methylcatechol Chemical compound CC1=CC=C(O)C(O)=C1 ZBCATMYQYDCTIZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000003118 aryl group Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- UBXYXCRCOKCZIT-UHFFFAOYSA-N biphenyl-3-ol Chemical group OC1=CC=CC(C=2C=CC=CC=2)=C1 UBXYXCRCOKCZIT-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- FSLSJTZWDATVTK-UHFFFAOYSA-N tris(6-methylheptyl) phosphate Chemical compound CC(C)CCCCCOP(=O)(OCCCCCC(C)C)OCCCCCC(C)C FSLSJTZWDATVTK-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/013—Separation; Purification; Concentration
- C01B15/017—Anhydrous hydrogen peroxide; Anhydrous solutions or gaseous mixtures containing hydrogen peroxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833334854 DE3334854A1 (de) | 1983-09-27 | 1983-09-27 | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
| DE8484110595T DE3469718D1 (en) | 1983-09-27 | 1984-09-06 | Process for the hydroxylation of the aromatic nucleus of phenol or phenol-derivatives |
| AT84110595T ATE32869T1 (de) | 1983-09-27 | 1984-09-06 | Verfahren zur kernhydroxylierung von phenol oder phenolderivaten. |
| EP84110595A EP0139194B1 (de) | 1983-09-27 | 1984-09-06 | Verfahren zur Kernhydroxylierung von Phenol oder Phenolderivaten |
| US06/648,137 US4686010A (en) | 1983-09-27 | 1984-09-07 | Process for the production of non-aqueous hydrogen peroxide solutions and their use |
| CA000464083A CA1198127A (en) | 1983-09-27 | 1984-09-26 | Process for producing nonaqueous hydrogen peroxide solutions and their use |
| ES536241A ES8505617A1 (es) | 1983-09-27 | 1984-09-26 | Procedimiento para preparar soluciones anhidras de peroxido de hidrogeno en fenol o derivados fenolicos |
| JP59200707A JPS6090803A (ja) | 1983-09-27 | 1984-09-27 | 非水性過酸化水素溶液の製造法及びその使用法 |
| US07/081,366 US4760199A (en) | 1983-09-27 | 1987-08-04 | Process for the production of non-aqueous hydrogen peroxide solutions and their use |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833334854 DE3334854A1 (de) | 1983-09-27 | 1983-09-27 | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3334854A1 DE3334854A1 (de) | 1985-04-11 |
| DE3334854C2 true DE3334854C2 (cg-RX-API-DMAC7.html) | 1988-06-01 |
Family
ID=6210144
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833334854 Granted DE3334854A1 (de) | 1983-09-27 | 1983-09-27 | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
| DE8484110595T Expired DE3469718D1 (en) | 1983-09-27 | 1984-09-06 | Process for the hydroxylation of the aromatic nucleus of phenol or phenol-derivatives |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484110595T Expired DE3469718D1 (en) | 1983-09-27 | 1984-09-06 | Process for the hydroxylation of the aromatic nucleus of phenol or phenol-derivatives |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4686010A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0139194B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6090803A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE32869T1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1198127A (cg-RX-API-DMAC7.html) |
| DE (2) | DE3334854A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES8505617A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3334854A1 (de) * | 1983-09-27 | 1985-04-11 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
| CN102805954A (zh) * | 2012-08-08 | 2012-12-05 | 天津大学 | 一种苯酚羟化液脱焦油塔用深蒸方法 |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3326928A (en) * | 1951-01-28 | 1967-06-20 | Minnesota Mining & Mfg | Process for preparing fluorinated compounds |
| US3092587A (en) * | 1959-07-22 | 1963-06-04 | Bergwerksgesellschaft Hibernia | Process for the production of high percentage solutions of organic peroxides |
| GB931119A (en) * | 1960-03-22 | 1963-07-10 | Ciba Ltd | Improvements in processes for the production of peracids |
| US3341297A (en) * | 1964-02-26 | 1967-09-12 | Celanese Corp | Production and recovery of aqueous hydrogen peroxide solutions |
| DE1262982B (de) * | 1966-03-02 | 1968-03-14 | Bayer Ag | Wasserstoffperoxidloesungen in fluessigen Estern |
| US3427229A (en) * | 1967-05-22 | 1969-02-11 | Halcon International Inc | Recovery of tertiary-butyl hydroperoxide by fractionation in the presence of a refluxing agent |
| US3707444A (en) * | 1968-09-16 | 1972-12-26 | Degussa | Process for the recovery of nonaqueous hydrogen peroxide |
| CH563944A5 (cg-RX-API-DMAC7.html) * | 1970-05-23 | 1975-07-15 | Degussa | |
| DE2038320C3 (de) * | 1970-08-01 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Nichtwäßrige Wasserstoffperpxid-Lösungen |
| DE2038319C3 (de) * | 1970-08-01 | 1980-09-04 | Bayer Ag, 5090 Leverkusen | Nichtwäßrige Wasserstoffperoxid-Lösungen |
| NL171693C (nl) * | 1971-05-21 | 1983-05-02 | Degussa | Werkwijze voor het overbrengen van waterstofperoxyde uit een waterige oplossing in een dampvormig of vloeibaar mengsel met organische verbindingen. |
| US3767779A (en) * | 1971-07-06 | 1973-10-23 | Oxysynthese | Process for manufacturing hydrogen peroxide |
| JPS49101342A (cg-RX-API-DMAC7.html) * | 1973-02-06 | 1974-09-25 | ||
| JPS4930330A (cg-RX-API-DMAC7.html) * | 1973-03-23 | 1974-03-18 | ||
| US4002573A (en) * | 1973-09-13 | 1977-01-11 | Phillips Petroleum Company | Azeotropes of 1,2-dichloro-1,1,2-trifluoroethane |
| DE2410742C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol |
| US4174460A (en) * | 1974-03-06 | 1979-11-13 | Bayer Aktiengesellschaft | Process for the hydroxylation of phenols and phenol ethers in the nucleus |
| DE2462990C3 (de) * | 1974-03-06 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von zweiwertigen substituierten Phenolen bzw. Monoäthern zweiwertiger Phenole durch Kernhydroxylierung von Phenolen bzw. Phenoläthern |
| DE2410758C3 (de) * | 1974-03-06 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern |
| DE2462957C2 (de) * | 1974-03-06 | 1982-02-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol |
| JPS5134398A (cg-RX-API-DMAC7.html) * | 1974-09-18 | 1976-03-24 | Hitachi Ltd | |
| DE2904831A1 (de) * | 1979-02-08 | 1980-08-14 | Bayer Ag | Verfahren zur abtrennung von phenol aus einem kresolgemisch |
| DE2928743A1 (de) * | 1979-07-17 | 1981-02-05 | Bayer Ag | Verfahren zur herstellung mehrwertiger phenole |
| US4354046A (en) * | 1981-05-26 | 1982-10-12 | The Dow Chemical Company | Process for obtaining high purity bisphenol A |
| DE3225307A1 (de) * | 1982-07-07 | 1984-01-12 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung wasserfreier, organischer wasserstoffperoxidloesungen |
| US4564514A (en) * | 1982-07-07 | 1986-01-14 | Degussa Aktiengesellschaft | Process for the production of water-free organic hydrogen peroxide solution |
| DE3308763C2 (de) * | 1983-03-11 | 1985-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihydroxybenzolen |
| DE3308726C2 (de) * | 1983-03-11 | 1991-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihydroxybenzolen |
| DE3308737C2 (de) * | 1983-03-11 | 1985-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Brenzcatechin und Hydrochinon |
| DE3308769C2 (de) * | 1983-03-11 | 1985-01-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Dihydroxybenzolen |
| JPS604145A (ja) * | 1983-06-23 | 1985-01-10 | Central Glass Co Ltd | 4−フルオロフエノ−ルの精製方法 |
| DE3334854A1 (de) * | 1983-09-27 | 1985-04-11 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen und deren verwendung |
-
1983
- 1983-09-27 DE DE19833334854 patent/DE3334854A1/de active Granted
-
1984
- 1984-09-06 EP EP84110595A patent/EP0139194B1/de not_active Expired
- 1984-09-06 AT AT84110595T patent/ATE32869T1/de not_active IP Right Cessation
- 1984-09-06 DE DE8484110595T patent/DE3469718D1/de not_active Expired
- 1984-09-07 US US06/648,137 patent/US4686010A/en not_active Expired - Fee Related
- 1984-09-26 CA CA000464083A patent/CA1198127A/en not_active Expired
- 1984-09-26 ES ES536241A patent/ES8505617A1/es not_active Expired
- 1984-09-27 JP JP59200707A patent/JPS6090803A/ja active Pending
-
1987
- 1987-08-04 US US07/081,366 patent/US4760199A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES536241A0 (es) | 1985-06-01 |
| ES8505617A1 (es) | 1985-06-01 |
| DE3469718D1 (en) | 1988-04-14 |
| ATE32869T1 (de) | 1988-03-15 |
| DE3334854A1 (de) | 1985-04-11 |
| US4760199A (en) | 1988-07-26 |
| EP0139194A1 (de) | 1985-05-02 |
| JPS6090803A (ja) | 1985-05-22 |
| CA1198127A (en) | 1985-12-17 |
| EP0139194B1 (de) | 1988-03-09 |
| US4686010A (en) | 1987-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2410742C3 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol | |
| DE2410758C3 (de) | Verfahren zur Herstellung von mehrwertigen substituierten Phenolen bzw. Monoäthern mehrwertiger Phenole durch Kernhydroxylierung von Phenolen oder Phenoläthern | |
| DE2633302A1 (de) | Verfahren zur hydroxylierung von aromatischen verbindungen | |
| DE3308769C2 (de) | Verfahren zur Herstellung von Dihydroxybenzolen | |
| DE2526381B2 (de) | Verfahren zur Herstellung von Glykolsäure oder deren Gemische mit Diglykolsäure | |
| DE69920491T2 (de) | Verfahren zum abtrennen und entfernen von ungewünschtem wasser aus einer chemischen reaktion | |
| DE3334854C2 (cg-RX-API-DMAC7.html) | ||
| DE3308726C2 (de) | Verfahren zur Herstellung von Dihydroxybenzolen | |
| EP0121693B1 (de) | Verfahren zur selektiven Herstellung von Dihydroxybenzolen | |
| DE2364181C3 (de) | Verfahren zur Herstellung von aromatischen Dihydroxyverbindungen oder deren Monoäthern | |
| DE3339266A1 (de) | Verfahren zur herstellung von etherverbindungen | |
| CH630590A5 (de) | Verfahren zur herstellung eines gemisches von brenzcatechin und hydrochinon. | |
| DE2638559C2 (de) | Verfahren zur Herstellung von zweiwertigen Phenolen oder deren Monoethern | |
| DE1668848A1 (de) | Verfahren zur Herstellung von AEtherperoxyden aus alpha-substituierten Vinylaethern und neue AEtherperoxyde | |
| DE3308737A1 (de) | Verfahren zur herstellung von brenzcatechin und hydrochinon | |
| DE2462957C2 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon durch Kernhydroxylierung von Phenol | |
| EP0302331B1 (de) | Ester von Arylbisperfluoralkylcarbinolen, Verfahren zur Herstellung dieser Verbindungen und der zugrundeliegenden Arylbisperfluoralkylcarbinole | |
| DE2462990C3 (de) | Verfahren zur Herstellung von zweiwertigen substituierten Phenolen bzw. Monoäthern zweiwertiger Phenole durch Kernhydroxylierung von Phenolen bzw. Phenoläthern | |
| DE1950434C3 (de) | Verfahren zur kontinuierlichen Herstellung von 1-Methyl-3-phenylindanen | |
| DE3048349C2 (de) | Verfahren zur ortho-Methylierung von Phenolen | |
| DE3228385C2 (cg-RX-API-DMAC7.html) | ||
| EP0667334B1 (de) | Verfahren zur Herstellung von 4-Alkoxy-3,5,6-trifluorphthalsäuren und 3-Alkoxy-2,4,5-trifluorbenzoesäuren | |
| DE3100517C2 (de) | Verfahren und Katalysator zur o-Alkylierung von Phenolen | |
| DE1812602A1 (de) | Verfahren zur Herstellung von Arylvinylaethern | |
| DE1567486C (de) | Verfahren zur Herstellung von phosphonger Saure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |