DE3238118C2 - - Google Patents
Info
- Publication number
- DE3238118C2 DE3238118C2 DE3238118A DE3238118A DE3238118C2 DE 3238118 C2 DE3238118 C2 DE 3238118C2 DE 3238118 A DE3238118 A DE 3238118A DE 3238118 A DE3238118 A DE 3238118A DE 3238118 C2 DE3238118 C2 DE 3238118C2
- Authority
- DE
- Germany
- Prior art keywords
- solution
- acid
- aqueous solution
- magnesium
- metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- 229910052751 metal Inorganic materials 0.000 claims abstract description 13
- 239000002184 metal Substances 0.000 claims abstract description 13
- -1 halogen ion Chemical class 0.000 claims abstract description 6
- 229910021645 metal ion Inorganic materials 0.000 claims abstract description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims abstract description 4
- 150000002500 ions Chemical class 0.000 claims abstract description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 3
- 239000002253 acid Substances 0.000 claims description 18
- 239000007864 aqueous solution Substances 0.000 claims description 16
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 14
- 239000011575 calcium Substances 0.000 claims description 10
- 239000011572 manganese Substances 0.000 claims description 10
- 238000001694 spray drying Methods 0.000 claims description 9
- 229910052712 strontium Inorganic materials 0.000 claims description 9
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 9
- 235000003704 aspartic acid Nutrition 0.000 claims description 8
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 claims description 8
- 239000011777 magnesium Substances 0.000 claims description 8
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 6
- 229910052749 magnesium Inorganic materials 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 5
- 229910052748 manganese Inorganic materials 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 4
- 239000007900 aqueous suspension Substances 0.000 claims description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 4
- 229910001507 metal halide Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 claims description 3
- 235000013922 glutamic acid Nutrition 0.000 claims description 3
- 239000004220 glutamic acid Substances 0.000 claims description 3
- 150000004679 hydroxides Chemical class 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims 2
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- 150000001805 chlorine compounds Chemical class 0.000 claims 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 claims 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 claims 1
- 150000004694 iodide salts Chemical class 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 16
- 150000004820 halides Chemical class 0.000 abstract description 3
- 229910052736 halogen Inorganic materials 0.000 abstract description 2
- 239000012736 aqueous medium Substances 0.000 abstract 2
- 150000002366 halogen compounds Chemical class 0.000 abstract 2
- 150000002736 metal compounds Chemical class 0.000 abstract 2
- 229910000039 hydrogen halide Inorganic materials 0.000 abstract 1
- 239000012433 hydrogen halide Substances 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 53
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 229960005261 aspartic acid Drugs 0.000 description 12
- 239000000126 substance Substances 0.000 description 11
- 239000000843 powder Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 8
- 239000007921 spray Substances 0.000 description 7
- CKLJMWTZIZZHCS-UHFFFAOYSA-N D-OH-Asp Natural products OC(=O)C(N)CC(O)=O CKLJMWTZIZZHCS-UHFFFAOYSA-N 0.000 description 6
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 229910044991 metal oxide Inorganic materials 0.000 description 6
- CKLJMWTZIZZHCS-UWTATZPHSA-N L-Aspartic acid Natural products OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 5
- 229960005069 calcium Drugs 0.000 description 5
- 239000008367 deionised water Substances 0.000 description 5
- 229910021641 deionized water Inorganic materials 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 235000001055 magnesium Nutrition 0.000 description 5
- 239000000395 magnesium oxide Substances 0.000 description 5
- 229940091250 magnesium supplement Drugs 0.000 description 5
- 150000004706 metal oxides Chemical class 0.000 description 5
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- QYOBXHXZJRPWDE-JIZZDEOASA-L magnesium;(2s)-2-amino-4-hydroxy-4-oxobutanoate;chloride Chemical compound [Mg+2].Cl.[O-]C(=O)[C@@H](N)CC([O-])=O QYOBXHXZJRPWDE-JIZZDEOASA-L 0.000 description 4
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229960002989 glutamic acid Drugs 0.000 description 3
- 229910000000 metal hydroxide Inorganic materials 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 229910001622 calcium bromide Inorganic materials 0.000 description 2
- 229940043430 calcium compound Drugs 0.000 description 2
- 150000001674 calcium compounds Chemical class 0.000 description 2
- WGEFECGEFUFIQW-UHFFFAOYSA-L calcium dibromide Chemical compound [Ca+2].[Br-].[Br-] WGEFECGEFUFIQW-UHFFFAOYSA-L 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 239000000920 calcium hydroxide Substances 0.000 description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 2
- LUUAAIHWKUJNKC-JIZZDEOASA-L calcium;(2s)-2-aminobutanedioate;hydrochloride Chemical compound Cl.[Ca+2].[O-]C(=O)[C@@H](N)CC([O-])=O LUUAAIHWKUJNKC-JIZZDEOASA-L 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229960001983 magnesium aspartate Drugs 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- RXMQCXCANMAVIO-CEOVSRFSSA-L magnesium;(2s)-2-amino-4-hydroxy-4-oxobutanoate Chemical compound [H+].[H+].[Mg+2].[O-]C(=O)[C@@H](N)CC([O-])=O.[O-]C(=O)[C@@H](N)CC([O-])=O RXMQCXCANMAVIO-CEOVSRFSSA-L 0.000 description 2
- IMSNBENJLMCAJL-QTNFYWBSSA-L magnesium;(2s)-2-aminopentanedioate;hydrobromide Chemical compound [Mg+2].Br.[O-]C(=O)[C@@H](N)CCC([O-])=O IMSNBENJLMCAJL-QTNFYWBSSA-L 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910001631 strontium chloride Inorganic materials 0.000 description 2
- AHBGXTDRMVNFER-UHFFFAOYSA-L strontium dichloride Chemical compound [Cl-].[Cl-].[Sr+2] AHBGXTDRMVNFER-UHFFFAOYSA-L 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229940062776 zinc aspartate Drugs 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- POEVDIARYKIEGF-CEOVSRFSSA-L zinc;(2s)-2-aminobutanedioate;hydron Chemical compound [Zn+2].[O-]C(=O)[C@@H](N)CC(O)=O.[O-]C(=O)[C@@H](N)CC(O)=O POEVDIARYKIEGF-CEOVSRFSSA-L 0.000 description 2
- GYUKEMYHXWICKF-DKWTVANSSA-N (2s)-2-aminobutanedioic acid;calcium Chemical compound [Ca].OC(=O)[C@@H](N)CC(O)=O GYUKEMYHXWICKF-DKWTVANSSA-N 0.000 description 1
- DWHMPBALQYTJFJ-DKWTVANSSA-N (2s)-2-aminobutanedioic acid;hydrochloride Chemical compound Cl.OC(=O)[C@@H](N)CC(O)=O DWHMPBALQYTJFJ-DKWTVANSSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 206010061216 Infarction Diseases 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 235000019730 animal feed additive Nutrition 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 229940034055 calcium aspartate Drugs 0.000 description 1
- LLSDKQJKOVVTOJ-UHFFFAOYSA-L calcium chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Ca+2] LLSDKQJKOVVTOJ-UHFFFAOYSA-L 0.000 description 1
- 229940052299 calcium chloride dihydrate Drugs 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- WDRWZVWLVBXVOI-QTNFYWBSSA-L dipotassium;(2s)-2-aminopentanedioate Chemical compound [K+].[K+].[O-]C(=O)[C@@H](N)CCC([O-])=O WDRWZVWLVBXVOI-QTNFYWBSSA-L 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- BDAGIHXWWSANSR-NJFSPNSNSA-N hydroxyformaldehyde Chemical compound O[14CH]=O BDAGIHXWWSANSR-NJFSPNSNSA-N 0.000 description 1
- 230000007574 infarction Effects 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- LGLXXNHIGIJYQQ-UHFFFAOYSA-L magnesium;dibromide;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].[Br-].[Br-] LGLXXNHIGIJYQQ-UHFFFAOYSA-L 0.000 description 1
- 239000011656 manganese carbonate Substances 0.000 description 1
- 235000006748 manganese carbonate Nutrition 0.000 description 1
- 229940093474 manganese carbonate Drugs 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229910000016 manganese(II) carbonate Inorganic materials 0.000 description 1
- XMWCXZJXESXBBY-UHFFFAOYSA-L manganese(ii) carbonate Chemical compound [Mn+2].[O-]C([O-])=O XMWCXZJXESXBBY-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 235000013919 monopotassium glutamate Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 229910002059 quaternary alloy Inorganic materials 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229910000018 strontium carbonate Inorganic materials 0.000 description 1
- 150000003438 strontium compounds Chemical class 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F13/00—Compounds containing elements of Groups 7 or 17 of the Periodic Table
- C07F13/005—Compounds without a metal-carbon linkage
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/003—Compounds containing elements of Groups 2 or 12 of the Periodic Table without C-Metal linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823249930 DE3249930C2 (https=) | 1982-10-14 | 1982-10-14 | |
| DE19823238118 DE3238118A1 (de) | 1982-10-14 | 1982-10-14 | Verfahren zur herstellung von komplexverbindungen aus aminodicarbonsaeuren, zweiwertigen metallionen und halogenidionen |
| CA000438286A CA1223879A (en) | 1982-10-14 | 1983-10-04 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
| ZA837455A ZA837455B (en) | 1982-10-14 | 1983-10-05 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
| US06/540,644 US4546195A (en) | 1982-10-14 | 1983-10-11 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and such complexes |
| AU20109/83A AU576736B2 (en) | 1982-10-14 | 1983-10-12 | Glutamic and aspartic acid - halogen - bivalent metal complexes as animal food additives |
| DE8383110226T DE3379041D1 (en) | 1982-10-14 | 1983-10-13 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
| PT77498A PT77498B (en) | 1982-10-14 | 1983-10-13 | Process for the preparation of amino-dicarboxylic acid-bivalent metal halogen complexes and novel such complexes |
| AT83110226T ATE40350T1 (de) | 1982-10-14 | 1983-10-13 | Verfahren zur herstellung von zweiwertigen aminodicarbonsaeuren und metallhalogen-komplexen und diese komplexe. |
| EP83110226A EP0108937B1 (en) | 1982-10-14 | 1983-10-13 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823238118 DE3238118A1 (de) | 1982-10-14 | 1982-10-14 | Verfahren zur herstellung von komplexverbindungen aus aminodicarbonsaeuren, zweiwertigen metallionen und halogenidionen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3238118A1 DE3238118A1 (de) | 1984-04-19 |
| DE3238118C2 true DE3238118C2 (https=) | 1988-07-28 |
Family
ID=6175723
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823238118 Granted DE3238118A1 (de) | 1982-10-14 | 1982-10-14 | Verfahren zur herstellung von komplexverbindungen aus aminodicarbonsaeuren, zweiwertigen metallionen und halogenidionen |
| DE8383110226T Expired DE3379041D1 (en) | 1982-10-14 | 1983-10-13 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383110226T Expired DE3379041D1 (en) | 1982-10-14 | 1983-10-13 | Process for the production of amino-dicarboxylic acid-bivalent metal-halogen complexes and novel such complexes |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4546195A (https=) |
| EP (1) | EP0108937B1 (https=) |
| AT (1) | ATE40350T1 (https=) |
| AU (1) | AU576736B2 (https=) |
| CA (1) | CA1223879A (https=) |
| DE (2) | DE3238118A1 (https=) |
| PT (1) | PT77498B (https=) |
| ZA (1) | ZA837455B (https=) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4764633A (en) * | 1987-08-31 | 1988-08-16 | Zinpro Corporation | Ferric ion catalyzed complexation of zinc and/or manganese with alpha amino acids |
| DE3809625A1 (de) * | 1988-03-22 | 1989-10-05 | Verla Pharm | Oral verabreichbares pharmazeutisches mittel, insbesondere zur eisen- und magnesiumsubstitutionstherapie |
| DE3814856A1 (de) * | 1988-05-02 | 1989-11-16 | Verla Pharm | Mittel zur prophylaxe des herzinfarkts und zur verhuetung des reinfarkts |
| FR2660653B1 (fr) * | 1990-04-05 | 1994-05-20 | Mayoly Spindler Lab | Sels equimolaires d'acide alpha-amine dicarboxylique et de metal divalent, leur procede de preparation et leur application pour l'obtention de compositions pharmaceutiques. |
| CN1297209C (zh) * | 2003-11-27 | 2007-01-31 | 中国科学院长春应用化学研究所 | 系列复合锌稀土配合物鱼饵料添加剂及其制备方法 |
| PT1627879E (pt) * | 2004-08-20 | 2006-12-29 | Verla Pharm | Processo para preparar complexos do metal do hydrohalogen do tamanho de partícula específico |
| US7523563B2 (en) | 2005-08-18 | 2009-04-28 | Verla-Pharm Arzneimittelfabrik Apotheker H.J.V. Ehrlich Gmbh & Co. Kg | Process for preparing certain hydrohalide metal complex compounds having a specific coarse structure |
| CA2571645A1 (en) | 2006-12-19 | 2008-06-19 | Apotex Technologies Inc. | Pharmaceutically acceptable salts of thymodepressin and processes for their manufacture |
| US8802180B2 (en) | 2011-09-08 | 2014-08-12 | Heritage Technologies, Llc | Micronutrient supplement |
| US9775792B2 (en) | 2012-12-19 | 2017-10-03 | Colgate-Palmolive Company | Oral care products comprising a tetrabasic zinc-amino acid-halide complex |
| US9498421B2 (en) | 2012-12-19 | 2016-11-22 | Colgate-Palmolive Company | Two component compositions containing tetrabasic zinc-amino acid halide complexes and cysteine |
| BR112015014478A2 (pt) * | 2012-12-19 | 2017-07-11 | Colgate Palmolive Co | complexo de haleto de aminoácido e zinco com cisteína |
| MX353167B (es) | 2012-12-19 | 2017-12-20 | Colgate Palmolive Co | Metodos de blanqueamiento dental, señales visualmente perceptibles y composiciones para ello que comprenden halogenuros de aminoacido de zinc. |
| AU2012397263B2 (en) * | 2012-12-19 | 2015-09-24 | Colgate-Palmolive Company | Zinc amino acid halide mouthwashes |
| WO2014098818A1 (en) | 2012-12-19 | 2014-06-26 | Colgate-Palmolive Company | Zinc-lysine complex |
| US9750670B2 (en) | 2012-12-19 | 2017-09-05 | Colgate-Palmolive Company | Zinc amino acid complex with cysteine |
| EP2934695B1 (en) | 2012-12-19 | 2016-11-30 | Colgate-Palmolive Company | Antiperspirant products with protein and antiperspirant salts |
| US10188112B2 (en) | 2012-12-19 | 2019-01-29 | Colgate-Palmolive Company | Personal cleansing compositions containing zinc amino acid/trimethylglycine halide |
| KR20150097492A (ko) | 2012-12-19 | 2015-08-26 | 콜게이트-파아므올리브캄파니 | 산화아연과 트리메틸글리신을 포함하는 구강 관리 용품 |
| MX355285B (es) * | 2012-12-19 | 2018-04-13 | Colgate Palmolive Co | Composicion con precursores de haluros de zinc aminoacidos/trimetilglicina. |
| US9763865B2 (en) * | 2012-12-19 | 2017-09-19 | Colgate-Palmolive Company | Oral gel comprising zinc-amino acid complex |
| US9504858B2 (en) | 2012-12-19 | 2016-11-29 | Colgate-Palmolive Company | Zinc amino acid halide complex with cysteine |
| KR20150095701A (ko) * | 2012-12-19 | 2015-08-21 | 콜게이트-파아므올리브캄파니 | 아연 아미노산 할라이드를 포함하는 구강 관리 조성물 |
| US9675823B2 (en) | 2012-12-19 | 2017-06-13 | Colgate-Palmolive Company | Two component compositions containing zinc amino acid halide complexes and cysteine |
| AU2012397254B2 (en) * | 2012-12-19 | 2015-09-17 | Colgate-Palmolive Company | Zinc amino acid/trimethylglycine halide |
| CA2892468C (en) | 2012-12-19 | 2019-10-08 | Colgate-Palmolive Company | Oral care products comprising tetrabasic zinc chloride and trimethylglycine |
| CN103739509B (zh) * | 2014-01-09 | 2015-12-30 | 山东祥维斯生物科技股份有限公司 | 一种甘氨酸螯合锰的工业化生产制备工艺 |
| US9669056B2 (en) | 2014-05-16 | 2017-06-06 | Micronutrients Usa Llc | Micronutrient supplement made from copper metal |
| CN105712895A (zh) * | 2014-12-04 | 2016-06-29 | 辽宁药联制药有限公司 | 盐酸门冬氨酸镁三水合物的制备方法 |
| CN106883135A (zh) * | 2015-12-16 | 2017-06-23 | 辽宁药联制药有限公司 | 一种制备盐酸门冬氨酸镁原料药的方法 |
| CN106916075A (zh) * | 2015-12-24 | 2017-07-04 | 辽宁药联制药有限公司 | 一种盐酸门冬氨酸镁原料药的制备方法 |
| EP3897864A1 (en) | 2018-12-21 | 2021-10-27 | Colgate-Palmolive Company | Zinc-arginine-halide complex |
| US11229591B2 (en) | 2018-12-21 | 2022-01-25 | Colgate-Palmolive Company | Methods for synthesizing zinc-lysine-chloride complex |
| US11117906B2 (en) | 2018-12-21 | 2021-09-14 | Colgate-Palmolive Company | Methods for synthesizing zinc-lysine-chloride complex |
| US11091502B2 (en) | 2018-12-21 | 2021-08-17 | Colgate-Palmolive Company | Methods for synthesizing zinc-lysine-chloride complex |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE357754C (de) * | 1919-08-08 | 1922-08-31 | Farbenfab Vorm Bayer F & Co | Verfahren zur Darstellung von Doppelverbindungen aus aliphatischen Aminodicarbonsaeuren |
| BE535350A (https=) * | 1954-02-01 | |||
| US2996490A (en) * | 1959-05-12 | 1961-08-15 | Firestone Tire & Rubber Co | Suspension polymerization process and novel compounds for use in said process |
| US3836668A (en) * | 1960-12-27 | 1974-09-17 | Ferrer Labor | Therapeutic composition and method of treating patients therewith |
| NL128181C (https=) * | 1964-01-06 | |||
| DE1809119C3 (de) * | 1968-11-15 | 1973-12-20 | Verla-Pharm Arzneimittelfabrik, Apotheker H.J.V.Ehrlich, 8132 Tutzing | Infarktprophylaktikum |
| DE1809118A1 (de) * | 1968-11-15 | 1970-06-04 | Verla Pharm Ph Mr H Josef V Eh | Magnesiummonoaspartathydrofluorid |
| DE1809120A1 (de) * | 1968-11-15 | 1970-06-11 | Verla Pharm | Magnesiummonoasparathydrojodid |
| DE1809121C3 (de) * | 1968-11-15 | 1978-04-27 | Verla-Pharm. Arzneimittelfabrik, Apotheker H.J.V. Ehrlich, 8132 Tutzing | Magnesiummonoaspartat-Hydrobromid und dieses enthaltende Arzneimittel |
| GB1283810A (en) * | 1970-12-30 | 1972-08-02 | Verla Pharm | Magnesium aspartate hydrohalides |
| DE2228101C3 (de) * | 1972-06-09 | 1979-07-05 | Verla-Pharm. Arzneimittelfabrik, Apotheker H.J. V. Ehrlich, Gmbh & Co Kg, 8132 Tutzing | Verfahren zur Gewinnung von Komplexverbindungen aus Aminodicarbonsäureionen, Magnesiumionen und Halogenidionen |
| US3950372A (en) * | 1974-07-03 | 1976-04-13 | Zinpro Corporation | 1:1 Manganese alpha amino acid complexes |
| US4137326A (en) * | 1975-04-11 | 1979-01-30 | Verla-Pharm Arzneimittelfabrik, Apotheker H.J.V. Ehrlich | Use of magnesium monospartate hydrochloride complex |
| DE2752287C3 (de) * | 1977-11-23 | 1980-06-26 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Gewinnung von Salzen der Asparaginsäure |
-
1982
- 1982-10-14 DE DE19823238118 patent/DE3238118A1/de active Granted
-
1983
- 1983-10-04 CA CA000438286A patent/CA1223879A/en not_active Expired
- 1983-10-05 ZA ZA837455A patent/ZA837455B/xx unknown
- 1983-10-11 US US06/540,644 patent/US4546195A/en not_active Expired - Fee Related
- 1983-10-12 AU AU20109/83A patent/AU576736B2/en not_active Ceased
- 1983-10-13 PT PT77498A patent/PT77498B/pt not_active IP Right Cessation
- 1983-10-13 DE DE8383110226T patent/DE3379041D1/de not_active Expired
- 1983-10-13 AT AT83110226T patent/ATE40350T1/de not_active IP Right Cessation
- 1983-10-13 EP EP83110226A patent/EP0108937B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1223879A (en) | 1987-07-07 |
| PT77498B (en) | 1986-02-12 |
| DE3379041D1 (en) | 1989-03-02 |
| ATE40350T1 (de) | 1989-02-15 |
| EP0108937A2 (en) | 1984-05-23 |
| PT77498A (en) | 1983-11-01 |
| AU576736B2 (en) | 1988-09-08 |
| ZA837455B (en) | 1984-06-27 |
| DE3238118A1 (de) | 1984-04-19 |
| EP0108937A3 (en) | 1984-09-26 |
| US4546195A (en) | 1985-10-08 |
| AU2010983A (en) | 1984-04-19 |
| EP0108937B1 (en) | 1989-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3238118C2 (https=) | ||
| DE3812653C2 (https=) | ||
| DE1567670A1 (de) | Verfahren zur Herstellung von Phosphatverbindungen | |
| DE68923093T2 (de) | Verfahren zur herstellung von 2,4,6-trijod-5-aminoisophthalsäureamid verbindungen. | |
| EP0080227B1 (de) | Verfahren zur Herstellung von Kupfer-II-hydroxid | |
| DE2802823A1 (de) | Verfahren zur herstellung von dibasischem magnesiumhypochlorit | |
| DE69707855T2 (de) | Synthese eines festen, pulverförmigen seltenerdcarboxylaten durch ein fällverfahren | |
| DE1543542A1 (de) | Chemisches Verfahren | |
| DE60029320T2 (de) | Nichtzusammenbackende natriumchloridkristalle, ein verfahren zu deren herstellung und deren verwendung in einem elektrolyseverfahren | |
| DE2431483C3 (de) | Verfahren zur Herstellung von Alkali- oder Ammoniumsalzen von Insulin | |
| DE69402270T2 (de) | Getrocknetes Aluminiumhydroxydgel, Verfahren zu seiner Herstellung und Antisäure | |
| US4418056A (en) | Process for making cupric hydroxide | |
| EP1359140B1 (de) | Herstellung und Verwendung von Iminodibernsteinsäureammoniummetallsalzen | |
| DE69619958T2 (de) | Kobaltkatalysator | |
| DE69506903T2 (de) | Erhöhte solubiliierung von komplexsalzen von methionin mit zink und mangan durch zusatz von ferriionen | |
| DE4129872C2 (de) | Verfahren zur Herstellung von Huminsäure-Metall-Verbindungen, deren Verwendung als Adsorptions- und/oder Entgiftungsmittel bzw. als Spurenelementquelle | |
| DE2340739C3 (de) | Verfahren zur Herstellung von im wesentlichen aus Rhenanit bestehenden und als Beifuttermittel verwendbaren Calcium-Natrium-Phosphaten | |
| DE1168441B (de) | Verfahren zur Herstellung einer Polyaminopolyessigsaeure und ihrer komplexen Metallverbindungen | |
| DE1810164C3 (de) | Verfahren zur Herstellung von monosubstituierten Hydrazinen | |
| DE4010930A1 (de) | Verfahren zur herstellung einer alkali- und/oder erdalkalihaltigen aluminiumtriformiatloesung, hochkonzentrierte alkali- und/oder erdalkalihaltige aluminiumtriformiatloesungen und ihre verwendung | |
| DE2228101B2 (de) | Verfahren zur Gewinnung von Komplexverbindungen aus Aminodicarbonsäureionen, Magnesiumionen und Halogenidionen | |
| DE2625631B2 (de) | Verfahren zur Herstellung von Alkaligoldsulfit | |
| DE1247354B (de) | Verfahren zur Herstellung fluessiger oder fester Duengemittel auf der Basis stabiler, waessriger Duengemittelloesungen oder -suspensionen von Harnstoff-Formaldehyd-Kondensationsprodukten | |
| EP3801492A1 (de) | Verfahren zur herstellung einer zusammensetzung enthaltend zumindest eine metall-aminosäure-verbindung sowie zusammensetzung erhältlich durch ein derartiges verfahren | |
| DE60222939T2 (de) | Festkörper-synthese von lithiummetaarsenat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3249930 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3249930 |
|
| AH | Division in |
Ref country code: DE Ref document number: 3249930 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AH | Division in |
Ref country code: DE Ref document number: 3249930 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |