DE3107565C2 - - Google Patents
Info
- Publication number
- DE3107565C2 DE3107565C2 DE3107565A DE3107565A DE3107565C2 DE 3107565 C2 DE3107565 C2 DE 3107565C2 DE 3107565 A DE3107565 A DE 3107565A DE 3107565 A DE3107565 A DE 3107565A DE 3107565 C2 DE3107565 C2 DE 3107565C2
- Authority
- DE
- Germany
- Prior art keywords
- charge
- hydrazone
- hydrazone compound
- formula
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 claims description 92
- -1 Hydrazone compounds Chemical class 0.000 claims description 90
- 239000002800 charge carrier Substances 0.000 claims description 37
- 238000000034 method Methods 0.000 claims description 9
- 239000011230 binding agent Substances 0.000 claims description 8
- 239000000758 substrate Substances 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 239000000049 pigment Substances 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 238000000862 absorption spectrum Methods 0.000 description 14
- 239000013078 crystal Substances 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 238000001816 cooling Methods 0.000 description 12
- 238000000921 elemental analysis Methods 0.000 description 12
- 238000010992 reflux Methods 0.000 description 11
- 238000003756 stirring Methods 0.000 description 10
- 229910052782 aluminium Inorganic materials 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 6
- 229910052711 selenium Inorganic materials 0.000 description 6
- 239000011669 selenium Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229920006267 polyester film Polymers 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000005611 electricity Effects 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920005668 polycarbonate resin Polymers 0.000 description 3
- 239000004431 polycarbonate resin Substances 0.000 description 3
- 229920001225 polyester resin Polymers 0.000 description 3
- 239000004645 polyester resin Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000007738 vacuum evaporation Methods 0.000 description 3
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 2
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 2
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000001023 inorganic pigment Substances 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- SXQCTESRRZBPHJ-UHFFFAOYSA-M lissamine rhodamine Chemical compound [Na+].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S([O-])(=O)=O)C=C1S([O-])(=O)=O SXQCTESRRZBPHJ-UHFFFAOYSA-M 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 2
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 125000006617 triphenylamine group Chemical group 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- NGQSLSMAEVWNPU-UHFFFAOYSA-N 1,2-bis(2-phenylethenyl)benzene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1C=CC1=CC=CC=C1 NGQSLSMAEVWNPU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical group C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- YIQGLTKAOHRZOL-UHFFFAOYSA-N 2-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(OC)=CC=C21 YIQGLTKAOHRZOL-UHFFFAOYSA-N 0.000 description 1
- YOPJQOLALJLPBS-UHFFFAOYSA-N 4,5-diphenyloxadiazole Chemical group C1=CC=CC=C1C1=C(C=2C=CC=CC=2)ON=N1 YOPJQOLALJLPBS-UHFFFAOYSA-N 0.000 description 1
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 1
- QGJXVBICNCIWEL-UHFFFAOYSA-N 9-ethylcarbazole-3-carbaldehyde Chemical compound O=CC1=CC=C2N(CC)C3=CC=CC=C3C2=C1 QGJXVBICNCIWEL-UHFFFAOYSA-N 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- KKVZAVRSVHUSPL-GQCTYLIASA-N Cassiastearoptene Chemical compound COC1=CC=CC=C1\C=C\C=O KKVZAVRSVHUSPL-GQCTYLIASA-N 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 235000000177 Indigofera tinctoria Nutrition 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 206010037867 Rash macular Diseases 0.000 description 1
- 229910001370 Se alloy Inorganic materials 0.000 description 1
- 229910001215 Te alloy Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- SRKRSWKCLVMJRZ-UHFFFAOYSA-N [S-2].S.[SeH2].[Cd+2] Chemical compound [S-2].S.[SeH2].[Cd+2] SRKRSWKCLVMJRZ-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000004840 adhesive resin Substances 0.000 description 1
- 229920006223 adhesive resin Polymers 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- YMNKUHIVVMFOFO-UHFFFAOYSA-N anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=CC2=C1 YMNKUHIVVMFOFO-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 229940097275 indigo Drugs 0.000 description 1
- COHYTHOBJLSHDF-UHFFFAOYSA-N indigo powder Natural products N1C2=CC=CC=C2C(=O)C1=C1C(=O)C2=CC=CC=C2N1 COHYTHOBJLSHDF-UHFFFAOYSA-N 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/86—Carbazoles; Hydrogenated carbazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0618—Acyclic or carbocyclic compounds containing oxygen and nitrogen
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0624—Heterocyclic compounds containing one hetero ring
- G03G5/0627—Heterocyclic compounds containing one hetero ring being five-membered
- G03G5/0629—Heterocyclic compounds containing one hetero ring being five-membered containing one hetero atom
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0624—Heterocyclic compounds containing one hetero ring
- G03G5/0635—Heterocyclic compounds containing one hetero ring being six-membered
- G03G5/0637—Heterocyclic compounds containing one hetero ring being six-membered containing one hetero atom
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0666—Dyes containing a methine or polymethine group
- G03G5/0668—Dyes containing a methine or polymethine group containing only one methine or polymethine group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2506980A JPS56120657A (en) | 1980-02-28 | 1980-02-28 | Novel hydrazone compound and its preparation |
| JP2557580A JPS56122039A (en) | 1980-02-29 | 1980-02-29 | Electrophotographic receptor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3107565A1 DE3107565A1 (de) | 1982-01-07 |
| DE3107565C2 true DE3107565C2 (enExample) | 1991-05-16 |
Family
ID=26362664
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813107565 Granted DE3107565A1 (de) | 1980-02-28 | 1981-02-27 | Hydrazonverbindungen, verfahren zu ihrer herstellung und sie enthaltende elektrophotographische elemente |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4385106A (enExample) |
| DE (1) | DE3107565A1 (enExample) |
Families Citing this family (70)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2114766B (en) * | 1982-02-05 | 1985-05-22 | Konishiroku Photo Ind | Electrophotographic photoreceptor |
| USRE35475E (en) * | 1987-10-07 | 1997-03-11 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography with thiophene containing moiety on charge transport compound |
| US4957837A (en) * | 1987-10-15 | 1990-09-18 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography containing hydrazone in charge transport layer |
| US4956277A (en) * | 1987-12-09 | 1990-09-11 | Fuji Electric Co., Ltd. | Photoconductor comprising charge transporting hydrazone compounds |
| DE3943468C2 (de) * | 1988-03-17 | 1995-03-16 | Fuji Electric Co Ltd | Elektrophotographisches Aufzeichnungsmaterial |
| JPH01237555A (ja) * | 1988-03-17 | 1989-09-22 | Fuji Electric Co Ltd | 電子写真用感光体 |
| US4956250A (en) * | 1988-03-23 | 1990-09-11 | Fuji Electric Co., Ltd. | Azulenium photoconductor for electrophotography |
| JPH01273049A (ja) * | 1988-04-26 | 1989-10-31 | Fuji Electric Co Ltd | 電子写真用感光体 |
| US4935323A (en) * | 1988-06-08 | 1990-06-19 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| JPH0212258A (ja) * | 1988-06-30 | 1990-01-17 | Fuji Electric Co Ltd | 電子写真用感光体 |
| JP2629885B2 (ja) * | 1988-09-17 | 1997-07-16 | 富士電機株式会社 | 電子写真用感光体 |
| JP2629929B2 (ja) * | 1989-01-19 | 1997-07-16 | 富士電機株式会社 | 電子写真用感光体 |
| JPH02254467A (ja) * | 1989-03-29 | 1990-10-15 | Fuji Electric Co Ltd | 電子写真用感光体 |
| US5198318A (en) * | 1989-06-06 | 1993-03-30 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5275898A (en) * | 1989-06-06 | 1994-01-04 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5266430A (en) * | 1989-06-06 | 1993-11-30 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| JP2803169B2 (ja) * | 1989-06-06 | 1998-09-24 | 富士電機株式会社 | 電子写真用感光体 |
| US4988594A (en) * | 1989-07-26 | 1991-01-29 | Fuji Electric, Co. Ltd. | Diazo photoconductor for electrophotography |
| US5132189A (en) * | 1989-09-07 | 1992-07-21 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| JPH03255453A (ja) * | 1990-01-17 | 1991-11-14 | Fuji Electric Co Ltd | 電子写真用感光体 |
| JP2770539B2 (ja) * | 1990-03-08 | 1998-07-02 | 富士電機株式会社 | 電子写真用感光体 |
| JPH05273772A (ja) * | 1991-03-28 | 1993-10-22 | Mita Ind Co Ltd | ヒドラゾン系化合物およびそれを用いた感光体 |
| US5316881A (en) * | 1991-12-27 | 1994-05-31 | Fuji Electric Co., Ltd. | Photoconductor for electrophotgraphy containing benzidine derivative |
| JPH05224439A (ja) * | 1992-02-12 | 1993-09-03 | Fuji Electric Co Ltd | 電子写真用感光体 |
| JP2817822B2 (ja) * | 1992-05-14 | 1998-10-30 | 富士電機株式会社 | 電子写真用感光体 |
| US5361148A (en) * | 1993-01-21 | 1994-11-01 | International Business Machines Corporation | Apparatus for photorefractive two beam coupling |
| US5925486A (en) * | 1997-12-11 | 1999-07-20 | Lexmark International, Inc. | Imaging members with improved wear characteristics |
| US7018756B2 (en) | 2003-09-05 | 2006-03-28 | Xerox Corporation | Dual charge transport layer and photoconductive imaging member including the same |
| US7541123B2 (en) * | 2005-06-20 | 2009-06-02 | Xerox Corporation | Imaging member |
| US7361440B2 (en) * | 2005-08-09 | 2008-04-22 | Xerox Corporation | Anticurl backing layer for electrostatographic imaging members |
| US7422831B2 (en) * | 2005-09-15 | 2008-09-09 | Xerox Corporation | Anticurl back coating layer electrophotographic imaging members |
| US7504187B2 (en) * | 2005-09-15 | 2009-03-17 | Xerox Corporation | Mechanically robust imaging member overcoat |
| US7455941B2 (en) * | 2005-12-21 | 2008-11-25 | Xerox Corporation | Imaging member with multilayer anti-curl back coating |
| US7462434B2 (en) * | 2005-12-21 | 2008-12-09 | Xerox Corporation | Imaging member with low surface energy polymer in anti-curl back coating layer |
| US7754404B2 (en) * | 2005-12-27 | 2010-07-13 | Xerox Corporation | Imaging member |
| US7517624B2 (en) * | 2005-12-27 | 2009-04-14 | Xerox Corporation | Imaging member |
| US7527906B2 (en) * | 2006-06-20 | 2009-05-05 | Xerox Corporation | Imaging member having adjustable friction anticurl back coating |
| US7582399B1 (en) | 2006-06-22 | 2009-09-01 | Xerox Corporation | Imaging member having nano polymeric gel particles in various layers |
| US7524597B2 (en) * | 2006-06-22 | 2009-04-28 | Xerox Corporation | Imaging member having nano-sized phase separation in various layers |
| US7767373B2 (en) * | 2006-08-23 | 2010-08-03 | Xerox Corporation | Imaging member having high molecular weight binder |
| US8084173B2 (en) * | 2008-04-07 | 2011-12-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8021812B2 (en) * | 2008-04-07 | 2011-09-20 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8026028B2 (en) * | 2008-04-07 | 2011-09-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US7998646B2 (en) * | 2008-04-07 | 2011-08-16 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8007970B2 (en) * | 2008-04-07 | 2011-08-30 | Xerox Corporation | Low friction electrostatographic imaging member |
| US7943278B2 (en) * | 2008-04-07 | 2011-05-17 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8173341B2 (en) * | 2009-05-01 | 2012-05-08 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US8168356B2 (en) * | 2009-05-01 | 2012-05-01 | Xerox Corporation | Structurally simplified flexible imaging members |
| US8124305B2 (en) * | 2009-05-01 | 2012-02-28 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US20100297544A1 (en) | 2009-05-22 | 2010-11-25 | Xerox Corporation | Flexible imaging members having a plasticized imaging layer |
| US8378972B2 (en) * | 2009-06-01 | 2013-02-19 | Apple Inc. | Keyboard with increased control of backlit keys |
| US8278017B2 (en) * | 2009-06-01 | 2012-10-02 | Xerox Corporation | Crack resistant imaging member preparation and processing method |
| US8003285B2 (en) | 2009-08-31 | 2011-08-23 | Xerox Corporation | Flexible imaging member belts |
| US8241825B2 (en) * | 2009-08-31 | 2012-08-14 | Xerox Corporation | Flexible imaging member belts |
| US20110136049A1 (en) * | 2009-12-08 | 2011-06-09 | Xerox Corporation | Imaging members comprising fluoroketone |
| US8232030B2 (en) | 2010-03-17 | 2012-07-31 | Xerox Corporation | Curl-free imaging members with a slippery surface |
| US8343700B2 (en) | 2010-04-16 | 2013-01-01 | Xerox Corporation | Imaging members having stress/strain free layers |
| US8541151B2 (en) | 2010-04-19 | 2013-09-24 | Xerox Corporation | Imaging members having a novel slippery overcoat layer |
| US8404413B2 (en) | 2010-05-18 | 2013-03-26 | Xerox Corporation | Flexible imaging members having stress-free imaging layer(s) |
| US8470505B2 (en) | 2010-06-10 | 2013-06-25 | Xerox Corporation | Imaging members having improved imaging layers |
| US8394560B2 (en) | 2010-06-25 | 2013-03-12 | Xerox Corporation | Imaging members having an enhanced charge blocking layer |
| US8475983B2 (en) | 2010-06-30 | 2013-07-02 | Xerox Corporation | Imaging members having a chemical resistive overcoat layer |
| US8263298B1 (en) | 2011-02-24 | 2012-09-11 | Xerox Corporation | Electrically tunable and stable imaging members |
| US8465892B2 (en) | 2011-03-18 | 2013-06-18 | Xerox Corporation | Chemically resistive and lubricated overcoat |
| US8877413B2 (en) | 2011-08-23 | 2014-11-04 | Xerox Corporation | Flexible imaging members comprising improved ground strip |
| US9017907B2 (en) | 2013-07-11 | 2015-04-28 | Xerox Corporation | Flexible imaging members having externally plasticized imaging layer(s) |
| US9046798B2 (en) | 2013-08-16 | 2015-06-02 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9091949B2 (en) | 2013-08-16 | 2015-07-28 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9017908B2 (en) | 2013-08-20 | 2015-04-28 | Xerox Corporation | Photoelectrical stable imaging members |
| US9075327B2 (en) | 2013-09-20 | 2015-07-07 | Xerox Corporation | Imaging members and methods for making the same |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4150987A (en) * | 1977-10-17 | 1979-04-24 | International Business Machines Corporation | Hydrazone containing charge transport element and photoconductive process of using same |
| JPS54150128A (en) * | 1978-05-17 | 1979-11-26 | Mitsubishi Chem Ind | Electrophotographic photosensitive member |
| JPS5584943A (en) * | 1978-12-21 | 1980-06-26 | Ricoh Co Ltd | Laminated type electrophotographic photoreceptor |
-
1981
- 1981-02-19 US US06/235,375 patent/US4385106A/en not_active Expired - Fee Related
- 1981-02-27 DE DE19813107565 patent/DE3107565A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3107565A1 (de) | 1982-01-07 |
| US4385106A (en) | 1983-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3107565C2 (enExample) | ||
| DE3046240C2 (enExample) | ||
| DE2954414C2 (enExample) | ||
| DE2935536C2 (enExample) | ||
| DE2737516C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3716981A1 (de) | Fotoempfindliches element | |
| DE3216738C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3019909A1 (de) | Hydrazonverbindungen und verfahren zu ihrer herstellung | |
| DE2846081A1 (de) | Elektrofotografischer fotoleiter | |
| DE3943602C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3716982A1 (de) | Fotoempfindliches element | |
| DE3148961C2 (enExample) | ||
| DE3439113C2 (enExample) | ||
| DE3541004C2 (enExample) | ||
| DE3921421C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2635887A1 (de) | Elektrophotographisches element zur bilderzeugung und verfahren zu seiner herstellung | |
| DE3908689C2 (enExample) | ||
| DE3219830C2 (enExample) | ||
| DE4025723C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE4130062C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2717006C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3019395A1 (de) | 9-aethylcarbazol-3-aldehyd-1-methyl- 1-phenylhydrazon und -1-benzyl-1-phenylhydrazon, verfahren zur herstellung dieser verbindungen und ihre verwendung | |
| DE3114650C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3222100C2 (enExample) | ||
| CH641282A5 (de) | Elektrophotographische platte vom komplex-typ und elektrophotographisches verfahren, das unter verwendung einer solchen platte durchgefuehrt wird. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BARZ, P., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 80803 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |