DE3046240C2 - - Google Patents
Info
- Publication number
- DE3046240C2 DE3046240C2 DE3046240A DE3046240A DE3046240C2 DE 3046240 C2 DE3046240 C2 DE 3046240C2 DE 3046240 A DE3046240 A DE 3046240A DE 3046240 A DE3046240 A DE 3046240A DE 3046240 C2 DE3046240 C2 DE 3046240C2
- Authority
- DE
- Germany
- Prior art keywords
- charge
- recording material
- azo pigments
- layer
- charge generating
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 68
- 239000000049 pigment Substances 0.000 claims description 37
- -1 hydrazone compound Chemical class 0.000 claims description 15
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 8
- 239000011669 selenium Substances 0.000 claims description 8
- 229910052711 selenium Inorganic materials 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims description 3
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims description 3
- NGQSLSMAEVWNPU-UHFFFAOYSA-N 1,2-bis(2-phenylethenyl)benzene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1C=CC1=CC=CC=C1 NGQSLSMAEVWNPU-UHFFFAOYSA-N 0.000 claims description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 claims description 2
- 235000021286 stilbenes Nutrition 0.000 claims description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 2
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical group C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 claims 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 44
- 238000000034 method Methods 0.000 description 8
- 239000011230 binding agent Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 150000007857 hydrazones Chemical class 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012860 organic pigment Substances 0.000 description 3
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229910001370 Se alloy Inorganic materials 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000001023 inorganic pigment Substances 0.000 description 2
- SXQCTESRRZBPHJ-UHFFFAOYSA-M lissamine rhodamine Chemical compound [Na+].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S([O-])(=O)=O)C=C1S([O-])(=O)=O SXQCTESRRZBPHJ-UHFFFAOYSA-M 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920005668 polycarbonate resin Polymers 0.000 description 2
- 239000004431 polycarbonate resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- RNJIWICOCATEFH-WCWDXBQESA-N (2e)-2-(1-oxobenzo[e][1]benzothiol-2-ylidene)benzo[e][1]benzothiol-1-one Chemical compound C1=CC=CC2=C(C(C(=C3/C(C4=C5C=CC=CC5=CC=C4S3)=O)/S3)=O)C3=CC=C21 RNJIWICOCATEFH-WCWDXBQESA-N 0.000 description 1
- HYGLETVERPVXOS-UHFFFAOYSA-N 1-bromopyrene Chemical compound C1=C2C(Br)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 HYGLETVERPVXOS-UHFFFAOYSA-N 0.000 description 1
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000000177 Indigofera tinctoria Nutrition 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- JWGLGQHIGMBQRK-UHFFFAOYSA-N [3-(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-phenylmethanone Chemical compound C1=CC(Cl)=CC=C1C1N(C(=O)C=2C=CC=CC=2)N=C(C=2SC=CC=2)C1 JWGLGQHIGMBQRK-UHFFFAOYSA-N 0.000 description 1
- SRKRSWKCLVMJRZ-UHFFFAOYSA-N [S-2].S.[SeH2].[Cd+2] Chemical compound [S-2].S.[SeH2].[Cd+2] SRKRSWKCLVMJRZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 239000004840 adhesive resin Substances 0.000 description 1
- 229920006223 adhesive resin Polymers 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- MRQIXHXHHPWVIL-UHFFFAOYSA-N chembl1397023 Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=CC=C1 MRQIXHXHHPWVIL-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 235000016693 dipotassium tartrate Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 229940097275 indigo Drugs 0.000 description 1
- COHYTHOBJLSHDF-UHFFFAOYSA-N indigo powder Natural products N1C2=CC=CC=C2C(=O)C1=C1C(=O)C2=CC=CC=C2N1 COHYTHOBJLSHDF-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- AVTYONGGKAJVTE-OLXYHTOASA-L potassium L-tartrate Chemical compound [K+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O AVTYONGGKAJVTE-OLXYHTOASA-L 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 239000006163 transport media Substances 0.000 description 1
- 125000006617 triphenylamine group Chemical group 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0618—Acyclic or carbocyclic compounds containing oxygen and nitrogen
Landscapes
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15872579A JPS5681850A (en) | 1979-12-08 | 1979-12-08 | Electrophotographic receptor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3046240A1 DE3046240A1 (de) | 1981-09-17 |
| DE3046240C2 true DE3046240C2 (enExample) | 1989-12-07 |
Family
ID=15677966
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803046240 Granted DE3046240A1 (de) | 1979-12-08 | 1980-12-08 | Elektrophotographisches element |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4387147A (enExample) |
| JP (1) | JPS5681850A (enExample) |
| CA (1) | CA1147198A (enExample) |
| DE (1) | DE3046240A1 (enExample) |
| FR (1) | FR2471625B1 (enExample) |
| GB (1) | GB2068574B (enExample) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2088074B (en) * | 1980-09-26 | 1984-12-19 | Copyer Co | Electrophotographic photosensitive member |
| JPS58118658A (ja) * | 1982-01-07 | 1983-07-14 | Mitsubishi Paper Mills Ltd | 積層平版印刷版の製造法 |
| US4599287A (en) * | 1983-11-09 | 1986-07-08 | Konishiroku Photo Industry Co., Ltd. | Positive charging photorecptor |
| JPS61107248A (ja) * | 1984-10-31 | 1986-05-26 | Canon Inc | 積層型電子写真感光体 |
| GB8912279D0 (en) * | 1989-05-27 | 1989-07-12 | Ciba Geigy Japan Ltd | Electrophotographic sensitive materials |
| GB8925903D0 (en) * | 1989-10-16 | 1990-01-04 | Ici Plc | Organic photoconductor |
| JPH0990647A (ja) * | 1995-09-26 | 1997-04-04 | Fuji Electric Co Ltd | 電子写真感光体 |
| US5925486A (en) * | 1997-12-11 | 1999-07-20 | Lexmark International, Inc. | Imaging members with improved wear characteristics |
| JP2002014478A (ja) | 2000-06-30 | 2002-01-18 | Hodogaya Chem Co Ltd | 電子製品材料の精製方法 |
| US6824939B2 (en) | 2001-12-11 | 2004-11-30 | Ricoh Company Limited | Electrophotographic image forming method and apparatus |
| US7018756B2 (en) | 2003-09-05 | 2006-03-28 | Xerox Corporation | Dual charge transport layer and photoconductive imaging member including the same |
| US7541123B2 (en) * | 2005-06-20 | 2009-06-02 | Xerox Corporation | Imaging member |
| US7361440B2 (en) * | 2005-08-09 | 2008-04-22 | Xerox Corporation | Anticurl backing layer for electrostatographic imaging members |
| US7422831B2 (en) * | 2005-09-15 | 2008-09-09 | Xerox Corporation | Anticurl back coating layer electrophotographic imaging members |
| US7504187B2 (en) * | 2005-09-15 | 2009-03-17 | Xerox Corporation | Mechanically robust imaging member overcoat |
| US7455941B2 (en) * | 2005-12-21 | 2008-11-25 | Xerox Corporation | Imaging member with multilayer anti-curl back coating |
| US7462434B2 (en) * | 2005-12-21 | 2008-12-09 | Xerox Corporation | Imaging member with low surface energy polymer in anti-curl back coating layer |
| US7754404B2 (en) * | 2005-12-27 | 2010-07-13 | Xerox Corporation | Imaging member |
| US7517624B2 (en) * | 2005-12-27 | 2009-04-14 | Xerox Corporation | Imaging member |
| US7527906B2 (en) * | 2006-06-20 | 2009-05-05 | Xerox Corporation | Imaging member having adjustable friction anticurl back coating |
| US7524597B2 (en) * | 2006-06-22 | 2009-04-28 | Xerox Corporation | Imaging member having nano-sized phase separation in various layers |
| US7582399B1 (en) * | 2006-06-22 | 2009-09-01 | Xerox Corporation | Imaging member having nano polymeric gel particles in various layers |
| US7767373B2 (en) * | 2006-08-23 | 2010-08-03 | Xerox Corporation | Imaging member having high molecular weight binder |
| JP5214467B2 (ja) | 2006-12-26 | 2013-06-19 | 旭化成イーマテリアルズ株式会社 | 印刷版用樹脂組成物 |
| US8007970B2 (en) * | 2008-04-07 | 2011-08-30 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8021812B2 (en) * | 2008-04-07 | 2011-09-20 | Xerox Corporation | Low friction electrostatographic imaging member |
| US7943278B2 (en) * | 2008-04-07 | 2011-05-17 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8084173B2 (en) * | 2008-04-07 | 2011-12-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8026028B2 (en) | 2008-04-07 | 2011-09-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US7998646B2 (en) | 2008-04-07 | 2011-08-16 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8173341B2 (en) * | 2009-05-01 | 2012-05-08 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US8168356B2 (en) * | 2009-05-01 | 2012-05-01 | Xerox Corporation | Structurally simplified flexible imaging members |
| US8124305B2 (en) * | 2009-05-01 | 2012-02-28 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US20100297544A1 (en) | 2009-05-22 | 2010-11-25 | Xerox Corporation | Flexible imaging members having a plasticized imaging layer |
| US8378972B2 (en) * | 2009-06-01 | 2013-02-19 | Apple Inc. | Keyboard with increased control of backlit keys |
| US8278017B2 (en) * | 2009-06-01 | 2012-10-02 | Xerox Corporation | Crack resistant imaging member preparation and processing method |
| US8003285B2 (en) * | 2009-08-31 | 2011-08-23 | Xerox Corporation | Flexible imaging member belts |
| US8241825B2 (en) | 2009-08-31 | 2012-08-14 | Xerox Corporation | Flexible imaging member belts |
| US20110136049A1 (en) * | 2009-12-08 | 2011-06-09 | Xerox Corporation | Imaging members comprising fluoroketone |
| US8232030B2 (en) | 2010-03-17 | 2012-07-31 | Xerox Corporation | Curl-free imaging members with a slippery surface |
| US8343700B2 (en) | 2010-04-16 | 2013-01-01 | Xerox Corporation | Imaging members having stress/strain free layers |
| US8541151B2 (en) | 2010-04-19 | 2013-09-24 | Xerox Corporation | Imaging members having a novel slippery overcoat layer |
| US8404413B2 (en) | 2010-05-18 | 2013-03-26 | Xerox Corporation | Flexible imaging members having stress-free imaging layer(s) |
| US8470505B2 (en) | 2010-06-10 | 2013-06-25 | Xerox Corporation | Imaging members having improved imaging layers |
| US8394560B2 (en) | 2010-06-25 | 2013-03-12 | Xerox Corporation | Imaging members having an enhanced charge blocking layer |
| US8475983B2 (en) | 2010-06-30 | 2013-07-02 | Xerox Corporation | Imaging members having a chemical resistive overcoat layer |
| US8263298B1 (en) | 2011-02-24 | 2012-09-11 | Xerox Corporation | Electrically tunable and stable imaging members |
| US8465892B2 (en) | 2011-03-18 | 2013-06-18 | Xerox Corporation | Chemically resistive and lubricated overcoat |
| US8877413B2 (en) | 2011-08-23 | 2014-11-04 | Xerox Corporation | Flexible imaging members comprising improved ground strip |
| US9017907B2 (en) | 2013-07-11 | 2015-04-28 | Xerox Corporation | Flexible imaging members having externally plasticized imaging layer(s) |
| US9046798B2 (en) | 2013-08-16 | 2015-06-02 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9091949B2 (en) | 2013-08-16 | 2015-07-28 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9017908B2 (en) | 2013-08-20 | 2015-04-28 | Xerox Corporation | Photoelectrical stable imaging members |
| US9075327B2 (en) | 2013-09-20 | 2015-07-07 | Xerox Corporation | Imaging members and methods for making the same |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB930288A (en) * | 1961-04-19 | 1963-07-03 | Demag Ag | Rotary metallurgical furnaces |
| US4175960A (en) * | 1974-12-20 | 1979-11-27 | Eastman Kodak Company | Multi-active photoconductive element having an aggregate charge generating layer |
| US4150987A (en) * | 1977-10-17 | 1979-04-24 | International Business Machines Corporation | Hydrazone containing charge transport element and photoconductive process of using same |
| JPS54150128A (en) * | 1978-05-17 | 1979-11-26 | Mitsubishi Chem Ind | Electrophotographic photosensitive member |
-
1979
- 1979-12-08 JP JP15872579A patent/JPS5681850A/ja active Pending
-
1980
- 1980-12-03 US US06/212,306 patent/US4387147A/en not_active Expired - Lifetime
- 1980-12-05 CA CA000366206A patent/CA1147198A/en not_active Expired
- 1980-12-08 DE DE19803046240 patent/DE3046240A1/de active Granted
- 1980-12-08 GB GB8039259A patent/GB2068574B/en not_active Expired
- 1980-12-08 FR FR8026015A patent/FR2471625B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4387147A (en) | 1983-06-07 |
| CA1147198A (en) | 1983-05-31 |
| FR2471625B1 (fr) | 1986-07-18 |
| FR2471625A1 (fr) | 1981-06-19 |
| JPS5681850A (en) | 1981-07-04 |
| GB2068574A (en) | 1981-08-12 |
| GB2068574B (en) | 1983-12-21 |
| DE3046240A1 (de) | 1981-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3046240C2 (enExample) | ||
| DE3107565C2 (enExample) | ||
| DE3315437C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2954414C2 (enExample) | ||
| EP0046959B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2737516C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3020108A1 (de) | Elektrophotographisches element | |
| DE2905477A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2941509A1 (de) | Elektrophotographisches element | |
| DE4213620A1 (de) | Hydroxygalliumphthalocyaninkristalle, verfahren zur herstellung der kristalle, photoleitfaehiges material, das den kristall enthaelt und ein elektrophotographischer photorezeptor, der das material enthaelt | |
| DE3124396A1 (de) | Elektrophotographischer photorezeptor | |
| DE2160812C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3022545C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE69018020T2 (de) | Mit besonderer Aussenschicht versehenes photoleitendes Aufzeichnungsmaterial. | |
| DE3018871A1 (de) | Geschichteter elektrophotographischer photoleiter | |
| DE3810522C2 (de) | Aromatische Diethylverbindungen und elektrophotographische Photoleiter, die eine aromatische Diethylverbindung enthalten | |
| DE2810466A1 (de) | Fotosensitives medium fuer die elektrofotografie | |
| DE3249395C2 (enExample) | ||
| DE3110957A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE3236477C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3415608C2 (enExample) | ||
| DE3114650C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE4130062A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE3338204C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3247812A1 (de) | Verbindungen mit einem barbitursaeure- oder thiobarbitursaeurerest, photoleitfaehige zusammensetzungen und elektrophotographische aufzeichnungsmaterialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BARZ, P., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 80803 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |