DE3045916C2 - - Google Patents
Info
- Publication number
- DE3045916C2 DE3045916C2 DE3045916A DE3045916A DE3045916C2 DE 3045916 C2 DE3045916 C2 DE 3045916C2 DE 3045916 A DE3045916 A DE 3045916A DE 3045916 A DE3045916 A DE 3045916A DE 3045916 C2 DE3045916 C2 DE 3045916C2
- Authority
- DE
- Germany
- Prior art keywords
- mixture
- reaction
- bromination
- hydrogen bromide
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 93
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 52
- 239000000203 mixture Substances 0.000 claims description 51
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 44
- RARSHUDCJQSEFJ-UHFFFAOYSA-N p-Hydroxypropiophenone Chemical class CCC(=O)C1=CC=C(O)C=C1 RARSHUDCJQSEFJ-UHFFFAOYSA-N 0.000 claims description 43
- 239000011541 reaction mixture Substances 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 30
- UYNVMODNBIQBMV-UHFFFAOYSA-N 4-[1-hydroxy-2-[4-(phenylmethyl)-1-piperidinyl]propyl]phenol Chemical compound C1CC(CC=2C=CC=CC=2)CCN1C(C)C(O)C1=CC=C(O)C=C1 UYNVMODNBIQBMV-UHFFFAOYSA-N 0.000 claims description 28
- 238000005893 bromination reaction Methods 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 27
- 230000031709 bromination Effects 0.000 claims description 25
- 239000000126 substance Substances 0.000 claims description 22
- DBOLXXRVIFGDTI-UHFFFAOYSA-N 4-benzylpyridine Chemical compound C=1C=NC=CC=1CC1=CC=CC=C1 DBOLXXRVIFGDTI-UHFFFAOYSA-N 0.000 claims description 21
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 21
- 238000010992 reflux Methods 0.000 claims description 14
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000011261 inert gas Substances 0.000 claims description 8
- QGSKPWWTAMUBEO-UHFFFAOYSA-N 4-[2-(4-benzylpiperidin-1-yl)-1-hydroxypropyl]phenol;hydrobromide Chemical compound Br.C1CC(CC=2C=CC=CC=2)CCN1C(C)C(O)C1=CC=C(O)C=C1 QGSKPWWTAMUBEO-UHFFFAOYSA-N 0.000 claims description 7
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 claims description 7
- 229910003446 platinum oxide Inorganic materials 0.000 claims description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 6
- 229910000028 potassium bicarbonate Inorganic materials 0.000 claims description 6
- 235000015497 potassium bicarbonate Nutrition 0.000 claims description 6
- 239000011736 potassium bicarbonate Substances 0.000 claims description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims description 6
- 229940086066 potassium hydrogencarbonate Drugs 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 2
- 235000011181 potassium carbonates Nutrition 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 235000017550 sodium carbonate Nutrition 0.000 claims description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims 1
- 229960003998 ifenprodil Drugs 0.000 description 24
- 239000002904 solvent Substances 0.000 description 23
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 16
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 16
- 229910052794 bromium Inorganic materials 0.000 description 16
- 238000006482 condensation reaction Methods 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 9
- 238000005984 hydrogenation reaction Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 239000005909 Kieselgur Substances 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000007788 liquid Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- QQFSREJMXIMHQJ-UHFFFAOYSA-N 2-bromo-1-(4-hydroxyphenyl)propan-1-one Chemical compound CC(Br)C(=O)C1=CC=C(O)C=C1 QQFSREJMXIMHQJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- -1 alkali metal bicarbonate Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000011049 filling Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- HTQSDKSKYOPNAF-UHFFFAOYSA-N 1-(4-benzylphenyl)-2-bromopropan-1-one Chemical compound C1=CC(C(=O)C(Br)C)=CC=C1CC1=CC=CC=C1 HTQSDKSKYOPNAF-UHFFFAOYSA-N 0.000 description 1
- IKFGSOJYHVTNDV-UHFFFAOYSA-N 1-(4-phenylmethoxyphenyl)propan-1-one Chemical compound C1=CC(C(=O)CC)=CC=C1OCC1=CC=CC=C1 IKFGSOJYHVTNDV-UHFFFAOYSA-N 0.000 description 1
- NRSXDJVBULRMMH-UHFFFAOYSA-N 2-(4-benzylpyridin-1-ium-1-yl)-1-(4-hydroxyphenyl)propan-1-one;bromide Chemical compound [Br-].C=1C=C(CC=2C=CC=CC=2)C=C[N+]=1C(C)C(=O)C1=CC=C(O)C=C1 NRSXDJVBULRMMH-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DMPRDSPPYMZQBT-CEAXSRTFSA-N Ifenprodil tartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1CC(CC=2C=CC=CC=2)CCN1C(C)C(O)C1=CC=C(O)C=C1.C1CC(CC=2C=CC=CC=2)CCN1C(C)C(O)C1=CC=C(O)C=C1 DMPRDSPPYMZQBT-CEAXSRTFSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229960000204 ifenprodil tartrate Drugs 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 235000012254 magnesium hydroxide Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- BASFCYQUMIYNBI-BKFZFHPZSA-N platinum-200 Chemical compound [200Pt] BASFCYQUMIYNBI-BKFZFHPZSA-N 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- BJAARRARQJZURR-UHFFFAOYSA-N trimethylazanium;hydroxide Chemical compound O.CN(C)C BJAARRARQJZURR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15811279A JPS5681560A (en) | 1979-12-07 | 1979-12-07 | Preparation of 1-(4-hydroxyphenyl)-2-(4-benzylpiperidino)-1- propanol and its addition salt |
| JP17319879A JPS5697270A (en) | 1979-12-30 | 1979-12-30 | Preparation of 2- 4-benzylpiperidino -1- 4-hydroxyphenyl -1- propanol and addition salt thereof |
| JP3822980A JPS56135469A (en) | 1980-03-27 | 1980-03-27 | Preparation of 2- 4-benzylpiperidino -1- 4-hydroxyphenyl -1- propanol and addition salt thereof |
| JP3822880A JPS56135468A (en) | 1980-03-27 | 1980-03-27 | Preparation of 1- 4-hydroxyphenyl -2- 4-benzylpiperidino -1- propanol and addition salt thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3045916A1 DE3045916A1 (de) | 1981-09-03 |
| DE3045916C2 true DE3045916C2 (enExample) | 1989-11-30 |
Family
ID=27460552
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803045916 Granted DE3045916A1 (de) | 1979-12-07 | 1980-12-05 | Verfahren zur herstellung von 4-benzyl- (alpha) -(p-hydroxyphenyl)- (beta) -methyl-1-piperidinaethanol und seinen salzen mit saeuren |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4377691A (enExample) |
| AR (1) | AR229157A1 (enExample) |
| AT (1) | AT374181B (enExample) |
| BR (1) | BR8008020A (enExample) |
| CA (1) | CA1141387A (enExample) |
| CH (1) | CH648550A5 (enExample) |
| DE (1) | DE3045916A1 (enExample) |
| ES (1) | ES497527A0 (enExample) |
| FR (1) | FR2471374A1 (enExample) |
| GB (1) | GB2067187B (enExample) |
| IT (1) | IT1148744B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2534580A1 (fr) * | 1982-10-13 | 1984-04-20 | Synthelabo | Derives de phenyl-1 piperidino-2 propanol, leur preparation, et medicaments qui les contiennent |
| US5364943A (en) * | 1991-11-27 | 1994-11-15 | Pfizer Inc. | Preparation of substituted piperidines |
| CN101100453B (zh) * | 2006-07-07 | 2010-05-12 | 石药集团中奇制药技术(石家庄)有限公司 | 一种酒石酸艾芬地尔合成方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2695919A (en) * | 1952-04-30 | 1954-11-30 | Upjohn Co | Aminoalcohols |
| FR5733M (enExample) * | 1966-09-27 | 1968-01-22 | ||
| IE34545B1 (en) * | 1969-10-01 | 1975-06-11 | Continental Pharma | Amino-alcohols,their salts and process for preparing the same |
| FR2105119A1 (en) * | 1970-09-29 | 1972-04-28 | Synthelabo | Analgesic piperidino ethanol deriv - 1-parabenzyloxyphenyl -2-4-benzylpiperidinoethanol |
| FR2208901A1 (en) * | 1972-12-04 | 1974-06-28 | Rhone Poulenc Sa | Alpha-(4-substd pyridino)-4-benzyloxypropiophenones - as inters for cardiovascular 1-(4-hydroxy-phenyl)-2-(4-substd piperidino) propan-1-ols |
| JPS5643266A (en) * | 1979-09-17 | 1981-04-21 | Iwaki Seiyaku Kk | Production of piperidinopropanol derivative |
-
1980
- 1980-12-03 GB GB8038771A patent/GB2067187B/en not_active Expired
- 1980-12-04 US US06/213,033 patent/US4377691A/en not_active Expired - Lifetime
- 1980-12-04 CA CA000366167A patent/CA1141387A/en not_active Expired
- 1980-12-05 IT IT26487/80A patent/IT1148744B/it active
- 1980-12-05 ES ES497527A patent/ES497527A0/es active Granted
- 1980-12-05 AR AR283504A patent/AR229157A1/es active
- 1980-12-05 FR FR8025923A patent/FR2471374A1/fr active Granted
- 1980-12-05 DE DE19803045916 patent/DE3045916A1/de active Granted
- 1980-12-08 BR BR8008020A patent/BR8008020A/pt unknown
- 1980-12-08 CH CH9032/80A patent/CH648550A5/de not_active IP Right Cessation
- 1980-12-09 AT AT0597580A patent/AT374181B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2471374A1 (fr) | 1981-06-19 |
| GB2067187A (en) | 1981-07-22 |
| IT8026487A0 (it) | 1980-12-05 |
| AT374181B (de) | 1984-03-26 |
| IT1148744B (it) | 1986-12-03 |
| AR229157A1 (es) | 1983-06-30 |
| FR2471374B1 (enExample) | 1984-03-09 |
| ES8200342A1 (es) | 1981-11-01 |
| CA1141387A (en) | 1983-02-15 |
| BR8008020A (pt) | 1981-06-23 |
| CH648550A5 (de) | 1985-03-29 |
| ES497527A0 (es) | 1981-11-01 |
| DE3045916A1 (de) | 1981-09-03 |
| ATA597580A (de) | 1983-08-15 |
| GB2067187B (en) | 1983-11-30 |
| US4377691A (en) | 1983-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2031724A1 (de) | Neue Röntgenkontrastmittel | |
| CH633264A5 (de) | N-alkylpiperidin-derivate. | |
| DE1643296C3 (de) | l-Aryl-2-alkylaminoäthanole und deren physiologisch verträgliche Säureadditionssalze, Verfahren zu deren Herstellung und sie enthaltende Arzneimittel | |
| EP0574667A1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidin-N-oxyl und in seiner 4-Stellung substituierten Derivaten | |
| DE1593272A1 (de) | Verfahren zur Herstellung von Halogen-Tetracyclinen | |
| DE60100321T2 (de) | Verfahren zur Herstellung von 11-Amino-3-chlor-6,11-dihydro-5,5-dioxo-6-methyl-dibenzo[c,f][1,2]-thiazepin und Anwendung zur Synthese von Thianeptin | |
| DE2909650C2 (enExample) | ||
| EP0108374A1 (de) | Verfahren zur Herstellung von Hydroxy-phenoxy-alkancarbonsäuren | |
| DE3045916C2 (enExample) | ||
| DE887651C (de) | Verfahren zur Herstellung von Aminoketonen | |
| DE3102769A1 (de) | "bis-moranolinderivate" | |
| DE2352632B2 (de) | Berbinderivate, Verfahren zu deren Herstellung und Arzneimittel | |
| EP0019281A2 (de) | Verfahren zur Entfernung von Nitrosierungsmittel(n) aus nitrierten aromatischen Verbindungen | |
| DE2835450C3 (de) | Verfahren zur Herstellung von 3,3-Bis-(4-dimethylaminophenyl)-6-dimethylaminophthalid (Kristallviolettlacton) | |
| DE2558507C3 (de) | Verfahren zur Racemattrennung von dJ-l-Phenyl-2-amino-l-propanol | |
| DE3236765C2 (de) | Verfahren zur Abtrennung von Indol durch Destillation | |
| DE2902541C2 (enExample) | ||
| DE2034682A1 (de) | Herstellung von eis 1 Propenylphos phonsaure | |
| DE1935757B1 (de) | Verfahren zur Herstellung des N,N'-Bis-[2-(3',4'-dihydroxyphenyl)-2-hydroxyaethyl]-hexamethylendiamins,seiner optisch aktiven Formen und deren Salzen | |
| DE1215729B (de) | Verfahren zur Herstellung von neuen Bis-alkanolaminderivaten und deren Salzen | |
| DE2902292A1 (de) | Verfahren zur herstellung von 4-aminobuttersaeure und deren derivaten | |
| DE2331044A1 (de) | Diphenylmethan-derivate und verfahren zu deren herstellung | |
| DE3437220C2 (enExample) | ||
| DE3705410A1 (de) | Verfahren zur herstellung von 2,3,5,6-tetrafluorbenzoesaeure | |
| AT258480B (de) | Verfahren zur Herstellung von racemischen und optisch aktiven 2-Dehydro-emetinverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: FUNAI YAKUHIN KOGYO K.K., OSAKA, JP |
|
| 8128 | New person/name/address of the agent |
Representative=s name: VOSSIUS, V., DIPL.-CHEM. DR.RER.NAT. VOSSIUS, D., |
|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: VOSSIUS, V., DIPL.-CHEM. DR.RER.NAT. TAUCHNER, P., |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: TAUCHNER, P., DIPL.-CHEM. DR.RER.NAT. HEUNEMANN, D., DIPL.-PHYS. DR.RER.NAT. RAUH, P., DIPL.-CHEM. DR.RER.NAT. HERMANN, G., DIPL.-PHYS. DR.RER.NAT., PAT.-ANWAELTE, 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |