DE2846931A1 - Tetrazol-derivate - Google Patents
Tetrazol-derivateInfo
- Publication number
- DE2846931A1 DE2846931A1 DE19782846931 DE2846931A DE2846931A1 DE 2846931 A1 DE2846931 A1 DE 2846931A1 DE 19782846931 DE19782846931 DE 19782846931 DE 2846931 A DE2846931 A DE 2846931A DE 2846931 A1 DE2846931 A1 DE 2846931A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- hydroxy
- carbon atoms
- carboxanilide
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000003536 tetrazoles Chemical class 0.000 title claims description 12
- 239000000203 mixture Substances 0.000 claims description 148
- 125000004432 carbon atom Chemical group C* 0.000 claims description 89
- -1 hydroxy, formyl Chemical group 0.000 claims description 86
- 150000001875 compounds Chemical class 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 41
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 24
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 21
- 125000001589 carboacyl group Chemical group 0.000 claims description 20
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 20
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 20
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 19
- 125000003435 aroyl group Chemical group 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 125000001424 substituent group Chemical group 0.000 claims description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 18
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 17
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 17
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 17
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 125000005843 halogen group Chemical group 0.000 claims description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 15
- 125000006239 protecting group Chemical group 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 13
- 125000004414 alkyl thio group Chemical group 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 13
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 12
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 12
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- MZAGXDHQGXUDDX-JSRXJHBZSA-N (e,2z)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enamide Chemical compound [O-][N+](=O)C(C)C(/CC)=C/C(=N/O)/C(N)=O MZAGXDHQGXUDDX-JSRXJHBZSA-N 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 claims description 3
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- NWFDSPIVNGDDGQ-UHFFFAOYSA-N chembl149630 Chemical compound OC1=CC=CC=C1NC(=O)C1=NN=NN1 NWFDSPIVNGDDGQ-UHFFFAOYSA-N 0.000 claims description 2
- PFTFGTKRWOAQCM-UHFFFAOYSA-N chembl155040 Chemical compound CCCC(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O PFTFGTKRWOAQCM-UHFFFAOYSA-N 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- BKAPZKSRERAYQD-UHFFFAOYSA-N chembl153613 Chemical compound CC(=O)C1=CC(F)=CC(NC(=O)C=2NN=NN=2)=C1O BKAPZKSRERAYQD-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- XBQVPIBLFFUIGR-UHFFFAOYSA-N n-ethyl-n-phenyl-2h-tetrazole-5-carboxamide Chemical compound C=1C=CC=CC=1N(CC)C(=O)C=1N=NNN=1 XBQVPIBLFFUIGR-UHFFFAOYSA-N 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 130
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 86
- 239000000243 solution Substances 0.000 description 82
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 73
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 69
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 53
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000007787 solid Substances 0.000 description 39
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000007858 starting material Substances 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- 239000003921 oil Substances 0.000 description 20
- 235000019198 oils Nutrition 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000003208 petroleum Substances 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 10
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 9
- JBEHAOGLPHSQSL-UHFFFAOYSA-N ethyl 2h-tetrazole-5-carboxylate Chemical compound CCOC(=O)C=1N=NNN=1 JBEHAOGLPHSQSL-UHFFFAOYSA-N 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 229910052763 palladium Inorganic materials 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000012258 stirred mixture Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- NLLYXOVHEQVWJF-UHFFFAOYSA-N 1-(3-amino-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(N)=C1O NLLYXOVHEQVWJF-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- RWPOMLCYWUMBNS-UHFFFAOYSA-N chembl347495 Chemical compound CC(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O RWPOMLCYWUMBNS-UHFFFAOYSA-N 0.000 description 5
- BDPVPSDZJZVQAN-UHFFFAOYSA-N ethyl 1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound CCOC(=O)C1=NN=NN1CC1=CC=C(OC)C=C1 BDPVPSDZJZVQAN-UHFFFAOYSA-N 0.000 description 5
- 239000003701 inert diluent Substances 0.000 description 5
- YIPWPAQKXFXRJV-UHFFFAOYSA-M potassium;1-benzyltetrazole-5-carboxylate Chemical compound [K+].[O-]C(=O)C1=NN=NN1CC1=CC=CC=C1 YIPWPAQKXFXRJV-UHFFFAOYSA-M 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- UFIFDZMJARCOCP-UHFFFAOYSA-N 1-(3-amino-2-hydroxy-5-methylphenyl)ethanone Chemical compound CC(=O)C1=CC(C)=CC(N)=C1O UFIFDZMJARCOCP-UHFFFAOYSA-N 0.000 description 4
- WRWCMPYYDXJESR-UHFFFAOYSA-N 1-benzyltetrazole-5-carbonyl chloride Chemical compound ClC(=O)C1=NN=NN1CC1=CC=CC=C1 WRWCMPYYDXJESR-UHFFFAOYSA-N 0.000 description 4
- IKNZBNHVVQIRTO-UHFFFAOYSA-N 2h-tetrazole-5-carboxylic acid Chemical compound OC(=O)C=1N=NNN=1 IKNZBNHVVQIRTO-UHFFFAOYSA-N 0.000 description 4
- CHWNEIVBYREQRF-UHFFFAOYSA-N 4-Ethyl-2-methoxyphenol Chemical compound CCC1=CC=C(O)C(OC)=C1 CHWNEIVBYREQRF-UHFFFAOYSA-N 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000013566 allergen Substances 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- MSMGXWFHBSCQFB-UHFFFAOYSA-N ethyl cyanoformate Chemical compound CCOC(=O)C#N MSMGXWFHBSCQFB-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000008247 solid mixture Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- MSXJXUUXMPMFJO-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)CC)O MSXJXUUXMPMFJO-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical compound C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- HGHGGPKMLBWNBI-UHFFFAOYSA-N (4-methylphenyl) 2,2,2-trifluoroacetate Chemical compound CC1=CC=C(OC(=O)C(F)(F)F)C=C1 HGHGGPKMLBWNBI-UHFFFAOYSA-N 0.000 description 2
- NACXKOQZXHRYPW-UHFFFAOYSA-N (4-methylphenyl) 4-chlorobutanoate Chemical compound CC1=CC=C(OC(=O)CCCCl)C=C1 NACXKOQZXHRYPW-UHFFFAOYSA-N 0.000 description 2
- WFRRNFGLVAZXAJ-UHFFFAOYSA-N 1-(2-hydroxy-5-methyl-3-nitrophenyl)-2-phenylethanone Chemical compound [O-][N+](=O)C1=CC(C)=CC(C(=O)CC=2C=CC=CC=2)=C1O WFRRNFGLVAZXAJ-UHFFFAOYSA-N 0.000 description 2
- IAKGGJYLHBHSQD-UHFFFAOYSA-N 1-(azidomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CN=[N+]=[N-])C=C1 IAKGGJYLHBHSQD-UHFFFAOYSA-N 0.000 description 2
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 2
- YDJJVPNLEJMCKY-UHFFFAOYSA-N 1-hydroxy-n-phenyltetrazole-5-carboxamide Chemical compound ON1N=NN=C1C(=O)NC1=CC=CC=C1 YDJJVPNLEJMCKY-UHFFFAOYSA-N 0.000 description 2
- KACLDPIVDMHOHS-UHFFFAOYSA-N 1-methoxy-5-methyl-3-nitro-2-phenylmethoxybenzene Chemical compound COC1=CC(C)=CC([N+]([O-])=O)=C1OCC1=CC=CC=C1 KACLDPIVDMHOHS-UHFFFAOYSA-N 0.000 description 2
- KMRAHZGVXRYCPS-UHFFFAOYSA-N 1-methyl-n-phenyltetrazole-5-carboxamide Chemical compound CN1N=NN=C1C(=O)NC1=CC=CC=C1 KMRAHZGVXRYCPS-UHFFFAOYSA-N 0.000 description 2
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Chemical compound C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 2
- GILWHMFYKTWDRN-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CN1N=C(C(O)=O)N=N1 GILWHMFYKTWDRN-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- RBECMMSIMITRHN-UHFFFAOYSA-N 2-benzyltetrazole-5-carbonyl chloride Chemical compound N1=C(C(=O)Cl)N=NN1CC1=CC=CC=C1 RBECMMSIMITRHN-UHFFFAOYSA-N 0.000 description 2
- PLPVLSBYYOWFKM-UHFFFAOYSA-N 2-phenylmethoxyaniline Chemical compound NC1=CC=CC=C1OCC1=CC=CC=C1 PLPVLSBYYOWFKM-UHFFFAOYSA-N 0.000 description 2
- PYXMIACNTYLQIK-UHFFFAOYSA-N 3-methoxy-5-methyl-2-phenylmethoxyaniline Chemical compound COC1=CC(C)=CC(N)=C1OCC1=CC=CC=C1 PYXMIACNTYLQIK-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- RPYBYIOJISGHNI-UHFFFAOYSA-N 4-bromo-2-methoxy-6-nitrophenol Chemical compound COC1=CC(Br)=CC([N+]([O-])=O)=C1O RPYBYIOJISGHNI-UHFFFAOYSA-N 0.000 description 2
- LQVDDIJGYUUSDS-UHFFFAOYSA-N 4-ethyl-2-methoxy-6-nitrophenol Chemical compound CCC1=CC(OC)=C(O)C([N+]([O-])=O)=C1 LQVDDIJGYUUSDS-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- VOCXDVGVYFKRKW-UHFFFAOYSA-N 5-bromo-1-methoxy-3-nitro-2-phenylmethoxybenzene Chemical compound COC1=CC(Br)=CC([N+]([O-])=O)=C1OCC1=CC=CC=C1 VOCXDVGVYFKRKW-UHFFFAOYSA-N 0.000 description 2
- UKLHSGDMFJNPGP-UHFFFAOYSA-N 5-ethyl-3-methoxy-2-phenylmethoxyaniline Chemical compound COC1=CC(CC)=CC(N)=C1OCC1=CC=CC=C1 UKLHSGDMFJNPGP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- CWPDGIMRGAUCNW-UHFFFAOYSA-N N-(3-acetyl-5-amino-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide hydrochloride Chemical compound Cl.C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)N)O CWPDGIMRGAUCNW-UHFFFAOYSA-N 0.000 description 2
- SHTNBNKDJYXBDX-UHFFFAOYSA-N N-(3-ethyl-2-hydroxyphenyl)-2H-tetrazole-5-carboxamide Chemical compound CCC1=CC=CC(NC(=O)C=2NN=NN=2)=C1O SHTNBNKDJYXBDX-UHFFFAOYSA-N 0.000 description 2
- LVDNTHLERREBRE-UHFFFAOYSA-N N-[2-hydroxy-5-methyl-3-(2-methylpropanoyl)phenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound OC1=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C=C1C(C(C)C)=O)C LVDNTHLERREBRE-UHFFFAOYSA-N 0.000 description 2
- 241001126259 Nippostrongylus brasiliensis Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 230000002009 allergenic effect Effects 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- RQDCAGMWPZALOJ-UHFFFAOYSA-N chembl149739 Chemical compound CC(=O)C1=CC(CC)=CC(NC(=O)C2=NNN=N2)=C1O RQDCAGMWPZALOJ-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- BUYFXNQLAQQSEN-UHFFFAOYSA-N ethyl 1-benzyltetrazole-5-carboxylate Chemical compound CCOC(=O)C1=NN=NN1CC1=CC=CC=C1 BUYFXNQLAQQSEN-UHFFFAOYSA-N 0.000 description 2
- BBNRTKYZDZMLEI-UHFFFAOYSA-N ethyl 2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound N1=C(C(=O)OCC)N=NN1CC1=CC=C(OC)C=C1 BBNRTKYZDZMLEI-UHFFFAOYSA-N 0.000 description 2
- JZPJXOPGWMQZEX-UHFFFAOYSA-N ethyl 2-benzyltetrazole-5-carboxylate Chemical compound N1=C(C(=O)OCC)N=NN1CC1=CC=CC=C1 JZPJXOPGWMQZEX-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- RLKPJTQKNVERIB-UHFFFAOYSA-N n-phenyl-2h-tetrazole-5-carboxamide Chemical compound N=1N=NNC=1C(=O)NC1=CC=CC=C1 RLKPJTQKNVERIB-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- TUGMKLVPTRKXOI-UHFFFAOYSA-M potassium;1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound [K+].C1=CC(OC)=CC=C1CN1C(C([O-])=O)=NN=N1 TUGMKLVPTRKXOI-UHFFFAOYSA-M 0.000 description 2
- KFOMIJHHFRXZJN-UHFFFAOYSA-M potassium;2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound [K+].C1=CC(OC)=CC=C1CN1N=C(C([O-])=O)N=N1 KFOMIJHHFRXZJN-UHFFFAOYSA-M 0.000 description 2
- JISUAASZSXABRO-UHFFFAOYSA-M potassium;2-benzyltetrazole-5-carboxylate Chemical compound [K+].N1=C(C(=O)[O-])N=NN1CC1=CC=CC=C1 JISUAASZSXABRO-UHFFFAOYSA-M 0.000 description 2
- 238000006748 scratching Methods 0.000 description 2
- 230000002393 scratching effect Effects 0.000 description 2
- WZODLFCLKIXWGA-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)C)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] WZODLFCLKIXWGA-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- XQZGSPSZLMKODN-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=CC([N+]([O-])=O)=C1O XQZGSPSZLMKODN-UHFFFAOYSA-N 0.000 description 1
- LKOPRDNSXNVRPS-UHFFFAOYSA-N 1-(2-hydroxy-5-methylphenyl)-2-phenylethanone Chemical compound CC1=CC=C(O)C(C(=O)CC=2C=CC=CC=2)=C1 LKOPRDNSXNVRPS-UHFFFAOYSA-N 0.000 description 1
- GSTOHKXQBZZTPF-UHFFFAOYSA-N 1-(5-ethyl-2-hydroxyphenyl)ethanone Chemical compound CCC1=CC=C(O)C(C(C)=O)=C1 GSTOHKXQBZZTPF-UHFFFAOYSA-N 0.000 description 1
- JJFFXMVCAPPKKL-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]tetrazole-5-carbonyl chloride Chemical compound C1=CC(OC)=CC=C1CN1C(C(Cl)=O)=NN=N1 JJFFXMVCAPPKKL-UHFFFAOYSA-N 0.000 description 1
- FVNGUMPCFMSEDR-UHFFFAOYSA-N 1-benzyl-N-(3-butanoyl-2-hydroxy-5-methylphenyl)tetrazole-5-carboxamide Chemical compound C(C1=CC=CC=C1)N1N=NN=C1C(=O)NC1=C(C(=CC(=C1)C)C(CCC)=O)O FVNGUMPCFMSEDR-UHFFFAOYSA-N 0.000 description 1
- ZDTWSHFIDYPACS-UHFFFAOYSA-N 1-benzyl-n-(2-phenylmethoxyphenyl)tetrazole-5-carboxamide Chemical compound N=1N=NN(CC=2C=CC=CC=2)C=1C(=O)NC1=CC=CC=C1OCC1=CC=CC=C1 ZDTWSHFIDYPACS-UHFFFAOYSA-N 0.000 description 1
- DQRQSGONBLXWBG-UHFFFAOYSA-N 1-benzyl-n-(3-methoxy-2-phenylmethoxyphenyl)tetrazole-5-carboxamide Chemical compound C=1C=CC=CC=1COC=1C(OC)=CC=CC=1NC(=O)C1=NN=NN1CC1=CC=CC=C1 DQRQSGONBLXWBG-UHFFFAOYSA-N 0.000 description 1
- XSHQMMIEZHWNAK-UHFFFAOYSA-N 2'-hydroxy-5'-methyl-3'-nitroacetophenone Chemical compound CC(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O XSHQMMIEZHWNAK-UHFFFAOYSA-N 0.000 description 1
- KZJRKRQSDZGHEC-UHFFFAOYSA-N 2,2,2-trifluoro-1-phenylethanone Chemical compound FC(F)(F)C(=O)C1=CC=CC=C1 KZJRKRQSDZGHEC-UHFFFAOYSA-N 0.000 description 1
- YSVNGBYVEJEXGO-UHFFFAOYSA-N 2-(4-cyanophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(C#N)C=C1 YSVNGBYVEJEXGO-UHFFFAOYSA-N 0.000 description 1
- SULGXWMEEJVIFD-UHFFFAOYSA-N 2-benzyltetrazole-5-carboxylic acid Chemical compound N1=C(C(=O)O)N=NN1CC1=CC=CC=C1 SULGXWMEEJVIFD-UHFFFAOYSA-N 0.000 description 1
- RWAKBGVDMQRDNA-UHFFFAOYSA-N 2-chloro-1-phenylbutan-1-one Chemical compound CCC(Cl)C(=O)C1=CC=CC=C1 RWAKBGVDMQRDNA-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- MAQGNTACXAOLNE-UHFFFAOYSA-N 2-hydroxy-5-methyl-3-nitrobenzoic acid Chemical compound CC1=CC(C(O)=O)=C(O)C([N+]([O-])=O)=C1 MAQGNTACXAOLNE-UHFFFAOYSA-N 0.000 description 1
- XCCSGOQCJPMXBK-UHFFFAOYSA-N 2-methoxy-4-methyl-6-nitrophenol Chemical compound COC1=CC(C)=CC([N+]([O-])=O)=C1O XCCSGOQCJPMXBK-UHFFFAOYSA-N 0.000 description 1
- HSZUUVJFZOGAMB-UHFFFAOYSA-N 3-acetyl-4-hydroxybenzonitrile Chemical compound CC(=O)C1=CC(C#N)=CC=C1O HSZUUVJFZOGAMB-UHFFFAOYSA-N 0.000 description 1
- JQNSYRHEKYOMEK-UHFFFAOYSA-N 3-amino-2-hydroxy-n,n,5-trimethylbenzamide Chemical compound CN(C)C(=O)C1=CC(C)=CC(N)=C1O JQNSYRHEKYOMEK-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- TVSWJWRBQLKCGN-UHFFFAOYSA-N 3-methoxy-2-phenylmethoxyaniline Chemical compound COC1=CC=CC(N)=C1OCC1=CC=CC=C1 TVSWJWRBQLKCGN-UHFFFAOYSA-N 0.000 description 1
- WHSIIJQOEGXWSN-UHFFFAOYSA-N 4-bromo-2-methoxyphenol Chemical compound COC1=CC(Br)=CC=C1O WHSIIJQOEGXWSN-UHFFFAOYSA-N 0.000 description 1
- GHEFQKHLHFXSBR-UHFFFAOYSA-N 4-chloro-1-phenylbutan-1-one Chemical compound ClCCCC(=O)C1=CC=CC=C1 GHEFQKHLHFXSBR-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- IJIBRSFAXRFPPN-UHFFFAOYSA-N 5-bromo-2-methoxybenzaldehyde Chemical compound COC1=CC=C(Br)C=C1C=O IJIBRSFAXRFPPN-UHFFFAOYSA-N 0.000 description 1
- CKZOCJSNNJJPRA-UHFFFAOYSA-N 5-bromo-3-methoxy-2-phenylmethoxyaniline Chemical compound COC1=CC(Br)=CC(N)=C1OCC1=CC=CC=C1 CKZOCJSNNJJPRA-UHFFFAOYSA-N 0.000 description 1
- KKHOFJIWRCNJFE-UHFFFAOYSA-N 5-ethyl-1-methoxy-3-nitro-2-phenylmethoxybenzene Chemical compound [O-][N+](=O)C1=CC(CC)=CC(OC)=C1OCC1=CC=CC=C1 KKHOFJIWRCNJFE-UHFFFAOYSA-N 0.000 description 1
- ZQGOQALTCFDIHN-UHFFFAOYSA-N 67191-44-0 Chemical compound COC(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O ZQGOQALTCFDIHN-UHFFFAOYSA-N 0.000 description 1
- TVSCFMXJYNZEER-UHFFFAOYSA-N 7-methoxy-11a-methyl-1,9b,10,11-tetrahydronaphtho[1,2-g]indole Chemical compound C1CC2(C)CC=NC2=C2C=CC3=CC(OC)=CC=C3C21 TVSCFMXJYNZEER-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000370092 Actiniopteris Species 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000195947 Lycopodium Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- VVZWLZVNSBCVBM-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)OC)O VVZWLZVNSBCVBM-UHFFFAOYSA-N 0.000 description 1
- NPDAKONSRXGQRX-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methylphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C)O NPDAKONSRXGQRX-UHFFFAOYSA-N 0.000 description 1
- MAQUXEKBJGAVDG-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methylphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=C(C1)C)O MAQUXEKBJGAVDG-UHFFFAOYSA-N 0.000 description 1
- CUBBDUDAPWYAJG-UHFFFAOYSA-N N-(3-acetyl-2-hydroxyphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=CC1)O CUBBDUDAPWYAJG-UHFFFAOYSA-N 0.000 description 1
- ZCFQUDRECGMFOC-UHFFFAOYSA-N N-(3-acetyl-5-amino-2-hydroxyphenyl)-2H-tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2)C=C(C1)N)O ZCFQUDRECGMFOC-UHFFFAOYSA-N 0.000 description 1
- DCPAMLIYYOIGEH-UHFFFAOYSA-N N-(3-acetyl-5-bromo-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)Br)O DCPAMLIYYOIGEH-UHFFFAOYSA-N 0.000 description 1
- JTKLKZOEZYJQBJ-UHFFFAOYSA-N N-(3-acetyl-5-cyano-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C#N)O JTKLKZOEZYJQBJ-UHFFFAOYSA-N 0.000 description 1
- LNWFHMWAIWPSAG-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=C(C1)CC)O LNWFHMWAIWPSAG-UHFFFAOYSA-N 0.000 description 1
- HGZMGMIXPODZDQ-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-2-benzyltetrazole-5-carboxamide Chemical compound CC(=O)C1=CC(CC)=CC(NC(=O)C2=NN(CC=3C=CC=CC=3)N=N2)=C1O HGZMGMIXPODZDQ-UHFFFAOYSA-N 0.000 description 1
- LNMVCHCECSLZBW-UHFFFAOYSA-N N-(3-acetyl-5-fluoro-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)F)O LNMVCHCECSLZBW-UHFFFAOYSA-N 0.000 description 1
- WEFRAALAVRPYGA-UHFFFAOYSA-N N-(5-acetamido-3-acetyl-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1CN1C(C(=O)NC=2C(=C(C(C)=O)C=C(NC(C)=O)C=2)O)=NN=N1 WEFRAALAVRPYGA-UHFFFAOYSA-N 0.000 description 1
- VQEOLSMWHLUUSC-UHFFFAOYSA-N N-(5-cyano-2-hydroxy-3-propanoylphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(#N)C=1C=C(C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C1)O)C(CC)=O VQEOLSMWHLUUSC-UHFFFAOYSA-N 0.000 description 1
- CBXVNXBSTMXBQL-UHFFFAOYSA-N N-[2-hydroxy-5-methyl-3-(2,2,2-trifluoroacetyl)phenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound OC1=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C=C1C(C(F)(F)F)=O)C CBXVNXBSTMXBQL-UHFFFAOYSA-N 0.000 description 1
- OJXVSYGIPRJRQX-UHFFFAOYSA-N N-[3-(cyclopropanecarbonyl)-2-hydroxy-5-methylphenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C1(CC1)C(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C)O OJXVSYGIPRJRQX-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 241001504097 Pellaea Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000278713 Theora Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 235000010986 ammonium phosphatide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WCOQKJSTSKMNKR-UHFFFAOYSA-N bis(3-cyclopropyl-2-hydroxy-5-methylphenyl)methanone Chemical compound C1(CC1)C=1C(=C(C=C(C=1)C)C(=O)C1=C(C(=CC(=C1)C)C1CC1)O)O WCOQKJSTSKMNKR-UHFFFAOYSA-N 0.000 description 1
- HGNSVRBWLGBYAG-UHFFFAOYSA-N bis[1-(3-amino-2-hydroxy-5-methylphenyl)cyclopropyl]methanone Chemical compound NC=1C(=C(C=C(C=1)C)C1(CC1)C(=O)C1(CC1)C1=C(C(=CC(=C1)C)N)O)O HGNSVRBWLGBYAG-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 210000003123 bronchiole Anatomy 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 230000004856 capillary permeability Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- OIKJIJFUQSAJBU-UHFFFAOYSA-N chembl150936 Chemical compound CC(=O)C1=CC=CC(NC(=O)C=2NN=NN=2)=C1O OIKJIJFUQSAJBU-UHFFFAOYSA-N 0.000 description 1
- YKHSDXDQTBUKDT-UHFFFAOYSA-N chembl151007 Chemical compound CC(=O)C1=CC(S(C)(=O)=O)=CC(NC(=O)C2=NNN=N2)=C1O YKHSDXDQTBUKDT-UHFFFAOYSA-N 0.000 description 1
- OZXMQUISYKBFKS-UHFFFAOYSA-N chembl153034 Chemical compound COC1=CC=CC(NC(=O)C=2NN=NN=2)=C1O OZXMQUISYKBFKS-UHFFFAOYSA-N 0.000 description 1
- VVQFHGALQRFUTJ-UHFFFAOYSA-N chembl153647 Chemical compound CC(C)C(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O VVQFHGALQRFUTJ-UHFFFAOYSA-N 0.000 description 1
- KDJZPTAUFWCVBE-UHFFFAOYSA-N chembl345707 Chemical compound COC1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O KDJZPTAUFWCVBE-UHFFFAOYSA-N 0.000 description 1
- YNBMCLZTGDMULZ-UHFFFAOYSA-N chembl346224 Chemical compound CC(=O)C1=CC(OC)=CC(NC(=O)C2=NNN=N2)=C1O YNBMCLZTGDMULZ-UHFFFAOYSA-N 0.000 description 1
- XAXLTYYAMCNPNG-UHFFFAOYSA-N chembl346612 Chemical compound COC1=CC(CC)=CC(NC(=O)C2=NNN=N2)=C1O XAXLTYYAMCNPNG-UHFFFAOYSA-N 0.000 description 1
- VTZCCDKZXZLZTR-UHFFFAOYSA-N chembl346873 Chemical compound CC(=O)C1=CC(C#N)=CC(NC(=O)C2=NNN=N2)=C1O VTZCCDKZXZLZTR-UHFFFAOYSA-N 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229940076286 cupric acetate Drugs 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZQXDUKMRLYGEHT-UHFFFAOYSA-N ethene hydrochloride Chemical compound Cl.C=C.C=C ZQXDUKMRLYGEHT-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- JFAYDUKFFSUDJK-UHFFFAOYSA-N ethyl 2-hydroxy-5-methyl-3-(2H-tetrazole-5-carbonylamino)benzoate Chemical compound C(C)OC(=O)C=1C(=C(NC(=O)C2=NN=NN2)C=C(C1)C)O JFAYDUKFFSUDJK-UHFFFAOYSA-N 0.000 description 1
- LNINTUZDCRRYHN-UHFFFAOYSA-N ethyl 3-amino-2-hydroxy-5-methylbenzoate Chemical compound CCOC(=O)C1=CC(C)=CC(N)=C1O LNINTUZDCRRYHN-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000010437 gem Substances 0.000 description 1
- 229910001751 gemstone Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 229960001317 isoprenaline Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- BYDBTYDCQJZXAT-UHFFFAOYSA-N methyl 3-amino-2-hydroxy-5-methylbenzoate Chemical compound COC(=O)C1=CC(C)=CC(N)=C1O BYDBTYDCQJZXAT-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- JSGHQDAEHDRLOI-UHFFFAOYSA-N oxomalononitrile Chemical compound N#CC(=O)C#N JSGHQDAEHDRLOI-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000008103 phosphatidic acids Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C205/60—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms in ortho-position to the carboxyl group, e.g. nitro-salicylic acids
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Immunology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Transplantation (AREA)
- Pulmonology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4509777 | 1977-10-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2846931A1 true DE2846931A1 (de) | 1979-05-10 |
| DE2846931C2 DE2846931C2 (enExample) | 1988-12-01 |
Family
ID=10435876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782846931 Granted DE2846931A1 (de) | 1977-10-28 | 1978-10-27 | Tetrazol-derivate |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4442115A (enExample) |
| JP (1) | JPS5470274A (enExample) |
| AU (1) | AU517502B2 (enExample) |
| BE (1) | BE871623A (enExample) |
| CA (1) | CA1118427A (enExample) |
| CH (1) | CH635832A5 (enExample) |
| DE (1) | DE2846931A1 (enExample) |
| DK (1) | DK476978A (enExample) |
| FR (1) | FR2407207A1 (enExample) |
| HK (1) | HK95784A (enExample) |
| HU (1) | HU177857B (enExample) |
| IE (1) | IE47960B1 (enExample) |
| IT (1) | IT1099538B (enExample) |
| LU (1) | LU80436A1 (enExample) |
| MY (1) | MY8600719A (enExample) |
| NL (1) | NL7810634A (enExample) |
| SG (1) | SG54284G (enExample) |
| SU (3) | SU1494866A3 (enExample) |
| ZA (1) | ZA786056B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0222962A1 (de) * | 1985-10-25 | 1987-05-27 | Ciba-Geigy Ag | Weitere neue Resorcinäther |
| US6455737B1 (en) | 1999-01-21 | 2002-09-24 | L'oreal S.A. | Cationic a -acylaminophenols, their use as coupler for oxidation dyeing, compositions containing them, and dyeing methods |
| US6544298B1 (en) | 1999-01-21 | 2003-04-08 | L'oreal | Compositions for oxidation dyeing keratin fibres comprising a cationic coupler novel cationic couplers their use for oxidation dyeing and dyeing methods |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0065874A1 (en) * | 1981-05-22 | 1982-12-01 | Ono Pharmaceutical Co., Ltd. | 2-Aminophenol derivatives, methods for their preparation and composition containing the same |
| GB8333665D0 (en) * | 1983-12-16 | 1984-01-25 | Lilly Industries Ltd | Organic compounds |
| DE3568773D1 (en) * | 1984-05-24 | 1989-04-20 | Ciba Geigy Ag | Resorcin ethers |
| CH665637A5 (fr) * | 1984-12-24 | 1988-05-31 | Wakamoto Pharma Co Ltd | 5-(3-n-butyloxalylaminophenyl)tetrazole comme agent antiasthmatique, composition le contenant et procede de preparation de la composition. |
| ZA865091B (en) * | 1985-07-22 | 1988-02-24 | Riker Laboratories Inc | Substituted di-t-butylphenols |
| PT81492B (pt) * | 1985-09-17 | 1988-03-03 | Ciba Geigy Ag | Processo para a preparacao de novos eteres de resorcina fluorados |
| US4808604A (en) * | 1985-10-03 | 1989-02-28 | Ciba-Geigy Corporation | N-(substituted phenyl) tetrazol-5-yl carboxamides and anti-allergic use thereof |
| JPS6344570A (ja) * | 1986-08-12 | 1988-02-25 | Wakamoto Pharmaceut Co Ltd | 3−(1h−テトラゾ−ル−5−イル)オキサニリツクアシツド及びその製造法 |
| JPH0175238U (enExample) * | 1987-11-06 | 1989-05-22 | ||
| JPH0271838U (enExample) * | 1988-11-18 | 1990-05-31 | ||
| JPH0273627U (enExample) * | 1988-11-24 | 1990-06-05 | ||
| GB9302331D0 (en) * | 1993-02-05 | 1993-03-24 | Smithkline Beecham Plc | Process |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207563A1 (es) * | 1973-03-23 | 1976-10-15 | American Home Prod | Procedimiento para preparar un nuevo ester de acido oxamico |
| US4039672A (en) * | 1975-01-11 | 1977-08-02 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | N-(1'-allypyrrolidinyl 2'-methyl) 2-methoxy 4,5-azimido benzamide and its pharmaceutically acceptable salts |
| GB1547564A (en) * | 1975-06-05 | 1979-06-20 | Lilly Industries Ltd | Acylated amino-heteroaryl compounds |
| US4069153A (en) * | 1975-10-28 | 1978-01-17 | American Sterilizer Company | Method of destroying pyrogens |
| GB1561350A (en) * | 1976-11-05 | 1980-02-20 | May & Baker Ltd | Benzamide derivatives |
| US4013647A (en) * | 1976-03-23 | 1977-03-22 | American Home Products Corporation | Morpholine containing tetrazole-5-carboxamide derivatives |
-
1978
- 1978-10-25 NL NL7810634A patent/NL7810634A/xx not_active Application Discontinuation
- 1978-10-26 ZA ZA00786056A patent/ZA786056B/xx unknown
- 1978-10-26 SU SU782680650A patent/SU1494866A3/ru active
- 1978-10-26 IE IE2118/78A patent/IE47960B1/en unknown
- 1978-10-26 HU HU78MA3049A patent/HU177857B/hu not_active IP Right Cessation
- 1978-10-26 IT IT29145/78A patent/IT1099538B/it active
- 1978-10-26 DK DK476978A patent/DK476978A/da not_active Application Discontinuation
- 1978-10-26 CA CA000314318A patent/CA1118427A/en not_active Expired
- 1978-10-26 AU AU41093/78A patent/AU517502B2/en not_active Expired
- 1978-10-26 JP JP13109278A patent/JPS5470274A/ja active Granted
- 1978-10-27 BE BE191422A patent/BE871623A/xx not_active IP Right Cessation
- 1978-10-27 DE DE19782846931 patent/DE2846931A1/de active Granted
- 1978-10-27 CH CH1114278A patent/CH635832A5/fr not_active IP Right Cessation
- 1978-10-27 FR FR7830626A patent/FR2407207A1/fr active Granted
- 1978-10-27 LU LU80436A patent/LU80436A1/xx unknown
-
1979
- 1979-04-26 SU SU792760899A patent/SU961560A3/ru active
- 1979-06-01 US US06/044,511 patent/US4442115A/en not_active Expired - Lifetime
- 1979-06-13 SU SU792775803A patent/SU1080745A3/ru active
-
1984
- 1984-08-03 SG SG54284A patent/SG54284G/en unknown
- 1984-12-06 HK HK957/84A patent/HK95784A/xx unknown
-
1986
- 1986-12-30 MY MY719/86A patent/MY8600719A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| J. Med. Chem., 18 (1975), S. 926 * |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0222962A1 (de) * | 1985-10-25 | 1987-05-27 | Ciba-Geigy Ag | Weitere neue Resorcinäther |
| US6455737B1 (en) | 1999-01-21 | 2002-09-24 | L'oreal S.A. | Cationic a -acylaminophenols, their use as coupler for oxidation dyeing, compositions containing them, and dyeing methods |
| US6544298B1 (en) | 1999-01-21 | 2003-04-08 | L'oreal | Compositions for oxidation dyeing keratin fibres comprising a cationic coupler novel cationic couplers their use for oxidation dyeing and dyeing methods |
Also Published As
| Publication number | Publication date |
|---|---|
| IE782118L (en) | 1979-04-28 |
| AU517502B2 (en) | 1981-08-06 |
| JPS6216949B2 (enExample) | 1987-04-15 |
| IE47960B1 (en) | 1984-08-08 |
| CH635832A5 (fr) | 1983-04-29 |
| SU1080745A3 (ru) | 1984-03-15 |
| FR2407207A1 (fr) | 1979-05-25 |
| SU1494866A3 (ru) | 1989-07-15 |
| LU80436A1 (fr) | 1979-06-15 |
| SG54284G (en) | 1985-03-08 |
| IT7829145A0 (it) | 1978-10-26 |
| US4442115A (en) | 1984-04-10 |
| DE2846931C2 (enExample) | 1988-12-01 |
| HU177857B (en) | 1981-12-28 |
| CA1118427A (en) | 1982-02-16 |
| DK476978A (da) | 1979-04-29 |
| NL7810634A (nl) | 1979-05-02 |
| IT1099538B (it) | 1985-09-18 |
| AU4109378A (en) | 1980-05-01 |
| BE871623A (fr) | 1979-04-27 |
| HK95784A (en) | 1984-12-14 |
| MY8600719A (en) | 1986-12-31 |
| FR2407207B1 (enExample) | 1981-12-18 |
| JPS5470274A (en) | 1979-06-05 |
| ZA786056B (en) | 1979-10-31 |
| SU961560A3 (ru) | 1982-09-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1668648C3 (de) | 3-Benzoylphenylessigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| EP0149242B1 (de) | 1-(2-Hydroxyaryl)-alkan-1-on-oxime, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2618694A1 (de) | Azapurinone | |
| DE2846931A1 (de) | Tetrazol-derivate | |
| DE2749518A1 (de) | Benzamidderivate | |
| DE2856753A1 (de) | N-substituierte omega -aminoalkanoyl- omega -aminoalkansaeuren, ihre verwendung und verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel | |
| DE2846891A1 (de) | Benzamidderivate | |
| CH616423A5 (enExample) | ||
| DE2310031A1 (de) | Substituierte 1-benzyl-indazol-3carbonsaeuren | |
| DE1620442C3 (de) | Verfahren zur Herstellung von 1-Acylindolverbindungen | |
| DE69021347T2 (de) | Isatinderivate, ihre Herstellung und Verwendung. | |
| DE2428486A1 (de) | Azapurinone | |
| DE1543639A1 (de) | Verfahren zur Herstellung von neuen substituierten Phenylessigsaeuren | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0087655A1 (de) | Verfahren zur Herstellung von Acemetacin | |
| EP0072960B1 (de) | 1,5-Diphenylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2929760C2 (enExample) | ||
| DE2502967A1 (de) | Carbonsaeuren, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH630885A5 (en) | Process for preparing tricyclic compounds, and the use of these compounds. | |
| DE2804293A1 (de) | Alpha-aryl-gamma-oxo-isovaleriansaeure-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2645865A1 (de) | 5-methoxy-6-halogentryptamine und verfahren zu ihrer herstellung | |
| DE2241027A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE2007700C2 (de) | Substituierte o-Anilino-phenäthylalkohole, Verfahren zu ihrer Herstellung und therapeutische Präparate | |
| DE3113087A1 (de) | Verfahren zur herstellung von piperazin-derivaten und damit in zusammenhang stehende pharmazeutische ansaetze | |
| DE2407631A1 (de) | Neue 2-carboxy-4-oxo-4h,6h- eckige klammer auf 2 eckige klammer zu -benzopyranoeckige klammer auf 3,4-f eckige klammer zu eckige klammer auf 1 eckige klammer zu -benzopyrane sowie ihre ester und salze und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR |
|
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: SEITE 4, ZEILE 1 MUSS ES RICHTIG HEISSEN: "....N,N-DIMETHYLCHLORMETHYLENIMMONIUMCHLORID..." |
|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |