CA1118427A - Tetrazole derivatives and processes for their preparation - Google Patents
Tetrazole derivatives and processes for their preparationInfo
- Publication number
- CA1118427A CA1118427A CA000314318A CA314318A CA1118427A CA 1118427 A CA1118427 A CA 1118427A CA 000314318 A CA000314318 A CA 000314318A CA 314318 A CA314318 A CA 314318A CA 1118427 A CA1118427 A CA 1118427A
- Authority
- CA
- Canada
- Prior art keywords
- group
- compound
- hydroxy
- carbon atoms
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003536 tetrazoles Chemical class 0.000 title claims abstract description 9
- 238000000034 method Methods 0.000 title claims description 76
- 230000008569 process Effects 0.000 title claims description 65
- 238000002360 preparation method Methods 0.000 title claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 82
- -1 hydroxy, formyl Chemical group 0.000 claims abstract description 66
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 35
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 22
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 22
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims abstract description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 20
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims abstract description 20
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims abstract description 19
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims abstract description 19
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims abstract description 18
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 17
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 16
- 125000005843 halogen group Chemical group 0.000 claims abstract description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 15
- 125000001424 substituent group Chemical group 0.000 claims abstract description 15
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 14
- 125000003118 aryl group Chemical group 0.000 claims abstract description 14
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 14
- 125000005236 alkanoylamino group Chemical group 0.000 claims abstract description 12
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims abstract description 12
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims abstract description 11
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 8
- 239000000203 mixture Substances 0.000 claims description 156
- 150000001875 compounds Chemical class 0.000 claims description 127
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 96
- 238000006243 chemical reaction Methods 0.000 claims description 55
- 150000003839 salts Chemical class 0.000 claims description 50
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 49
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 47
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 33
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 32
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- 239000007858 starting material Substances 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- 125000006239 protecting group Chemical group 0.000 claims description 23
- 239000003054 catalyst Substances 0.000 claims description 20
- 239000003960 organic solvent Substances 0.000 claims description 20
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical group ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 20
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 17
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims description 17
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 16
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 claims description 12
- IKNZBNHVVQIRTO-UHFFFAOYSA-N 2h-tetrazole-5-carboxylic acid Chemical compound OC(=O)C=1N=NNN=1 IKNZBNHVVQIRTO-UHFFFAOYSA-N 0.000 claims description 11
- 230000009471 action Effects 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- RQDCAGMWPZALOJ-UHFFFAOYSA-N chembl149739 Chemical compound CC(=O)C1=CC(CC)=CC(NC(=O)C2=NNN=N2)=C1O RQDCAGMWPZALOJ-UHFFFAOYSA-N 0.000 claims description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 8
- NLLYXOVHEQVWJF-UHFFFAOYSA-N 1-(3-amino-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(N)=C1O NLLYXOVHEQVWJF-UHFFFAOYSA-N 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 7
- UFIFDZMJARCOCP-UHFFFAOYSA-N 1-(3-amino-2-hydroxy-5-methylphenyl)ethanone Chemical compound CC(=O)C1=CC(C)=CC(N)=C1O UFIFDZMJARCOCP-UHFFFAOYSA-N 0.000 claims description 6
- 159000000013 aluminium salts Chemical class 0.000 claims description 6
- 229910000329 aluminium sulfate Inorganic materials 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- BKAPZKSRERAYQD-UHFFFAOYSA-N chembl153613 Chemical compound CC(=O)C1=CC(F)=CC(NC(=O)C=2NN=NN=2)=C1O BKAPZKSRERAYQD-UHFFFAOYSA-N 0.000 claims description 4
- YNBMCLZTGDMULZ-UHFFFAOYSA-N chembl346224 Chemical compound CC(=O)C1=CC(OC)=CC(NC(=O)C2=NNN=N2)=C1O YNBMCLZTGDMULZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 4
- OIKJIJFUQSAJBU-UHFFFAOYSA-N chembl150936 Chemical compound CC(=O)C1=CC=CC(NC(=O)C=2NN=NN=2)=C1O OIKJIJFUQSAJBU-UHFFFAOYSA-N 0.000 claims description 3
- FUQUSPXBKLWEQF-UHFFFAOYSA-N chembl153129 Chemical compound CC(=O)C1=CC(CCC)=CC(NC(=O)C2=NNN=N2)=C1O FUQUSPXBKLWEQF-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims 8
- 125000000623 heterocyclic group Chemical group 0.000 claims 8
- 229910052757 nitrogen Inorganic materials 0.000 claims 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 8
- RWPOMLCYWUMBNS-UHFFFAOYSA-N chembl347495 Chemical compound CC(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O RWPOMLCYWUMBNS-UHFFFAOYSA-N 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 abstract description 5
- 206010027654 Allergic conditions Diseases 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 136
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 91
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 73
- 239000000243 solution Substances 0.000 description 72
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 71
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000007787 solid Substances 0.000 description 38
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 238000000354 decomposition reaction Methods 0.000 description 33
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 235000011167 hydrochloric acid Nutrition 0.000 description 23
- 229960000443 hydrochloric acid Drugs 0.000 description 23
- 238000010992 reflux Methods 0.000 description 22
- 229960004132 diethyl ether Drugs 0.000 description 21
- 239000003921 oil Substances 0.000 description 19
- 235000019198 oils Nutrition 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 11
- 239000011591 potassium Substances 0.000 description 11
- 229910052700 potassium Inorganic materials 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 9
- MSXJXUUXMPMFJO-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)CC)O MSXJXUUXMPMFJO-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- JBEHAOGLPHSQSL-UHFFFAOYSA-N ethyl 2h-tetrazole-5-carboxylate Chemical compound CCOC(=O)C=1N=NNN=1 JBEHAOGLPHSQSL-UHFFFAOYSA-N 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- MSMGXWFHBSCQFB-UHFFFAOYSA-N ethyl cyanoformate Chemical compound CCOC(=O)C#N MSMGXWFHBSCQFB-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 239000003701 inert diluent Substances 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- CHWNEIVBYREQRF-UHFFFAOYSA-N 4-Ethyl-2-methoxyphenol Chemical compound CCC1=CC=C(O)C(OC)=C1 CHWNEIVBYREQRF-UHFFFAOYSA-N 0.000 description 4
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 239000013566 allergen Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 4
- 230000003292 diminished effect Effects 0.000 description 4
- BDPVPSDZJZVQAN-UHFFFAOYSA-N ethyl 1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound CCOC(=O)C1=NN=NN1CC1=CC=C(OC)C=C1 BDPVPSDZJZVQAN-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000008247 solid mixture Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- IAKGGJYLHBHSQD-UHFFFAOYSA-N 1-(azidomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CN=[N+]=[N-])C=C1 IAKGGJYLHBHSQD-UHFFFAOYSA-N 0.000 description 3
- ZDTWSHFIDYPACS-UHFFFAOYSA-N 1-benzyl-n-(2-phenylmethoxyphenyl)tetrazole-5-carboxamide Chemical compound N=1N=NN(CC=2C=CC=CC=2)C=1C(=O)NC1=CC=CC=C1OCC1=CC=CC=C1 ZDTWSHFIDYPACS-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- PYXMIACNTYLQIK-UHFFFAOYSA-N 3-methoxy-5-methyl-2-phenylmethoxyaniline Chemical compound COC1=CC(C)=CC(N)=C1OCC1=CC=CC=C1 PYXMIACNTYLQIK-UHFFFAOYSA-N 0.000 description 3
- RPYBYIOJISGHNI-UHFFFAOYSA-N 4-bromo-2-methoxy-6-nitrophenol Chemical compound COC1=CC(Br)=CC([N+]([O-])=O)=C1O RPYBYIOJISGHNI-UHFFFAOYSA-N 0.000 description 3
- ZQGOQALTCFDIHN-UHFFFAOYSA-N 67191-44-0 Chemical compound COC(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O ZQGOQALTCFDIHN-UHFFFAOYSA-N 0.000 description 3
- MAQUXEKBJGAVDG-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methylphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=C(C1)C)O MAQUXEKBJGAVDG-UHFFFAOYSA-N 0.000 description 3
- HGZMGMIXPODZDQ-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-2-benzyltetrazole-5-carboxamide Chemical compound CC(=O)C1=CC(CC)=CC(NC(=O)C2=NN(CC=3C=CC=CC=3)N=N2)=C1O HGZMGMIXPODZDQ-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- KDJZPTAUFWCVBE-UHFFFAOYSA-N chembl345707 Chemical compound COC1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O KDJZPTAUFWCVBE-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- FVOSOTJKWPDYBK-UHFFFAOYSA-N (4-cyanophenyl) propanoate Chemical compound CCC(=O)OC1=CC=C(C#N)C=C1 FVOSOTJKWPDYBK-UHFFFAOYSA-N 0.000 description 2
- HGHGGPKMLBWNBI-UHFFFAOYSA-N (4-methylphenyl) 2,2,2-trifluoroacetate Chemical compound CC1=CC=C(OC(=O)C(F)(F)F)C=C1 HGHGGPKMLBWNBI-UHFFFAOYSA-N 0.000 description 2
- NACXKOQZXHRYPW-UHFFFAOYSA-N (4-methylphenyl) 4-chlorobutanoate Chemical compound CC1=CC=C(OC(=O)CCCCl)C=C1 NACXKOQZXHRYPW-UHFFFAOYSA-N 0.000 description 2
- WFRRNFGLVAZXAJ-UHFFFAOYSA-N 1-(2-hydroxy-5-methyl-3-nitrophenyl)-2-phenylethanone Chemical compound [O-][N+](=O)C1=CC(C)=CC(C(=O)CC=2C=CC=CC=2)=C1O WFRRNFGLVAZXAJ-UHFFFAOYSA-N 0.000 description 2
- RLTHEGUZYYNXIU-UHFFFAOYSA-N 1-(3-amino-2-hydroxy-5-methylphenyl)-2-phenylethanone Chemical compound CC1=CC(N)=C(O)C(C(=O)CC=2C=CC=CC=2)=C1 RLTHEGUZYYNXIU-UHFFFAOYSA-N 0.000 description 2
- YVTPUCHIOSGVSH-UHFFFAOYSA-N 1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC(F)=CC([N+]([O-])=O)=C1O YVTPUCHIOSGVSH-UHFFFAOYSA-N 0.000 description 2
- KOFFXZYMDLWRHX-UHFFFAOYSA-N 1-(5-fluoro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(F)=CC=C1O KOFFXZYMDLWRHX-UHFFFAOYSA-N 0.000 description 2
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 2
- JJFFXMVCAPPKKL-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]tetrazole-5-carbonyl chloride Chemical compound C1=CC(OC)=CC=C1CN1C(C(Cl)=O)=NN=N1 JJFFXMVCAPPKKL-UHFFFAOYSA-N 0.000 description 2
- KACLDPIVDMHOHS-UHFFFAOYSA-N 1-methoxy-5-methyl-3-nitro-2-phenylmethoxybenzene Chemical compound COC1=CC(C)=CC([N+]([O-])=O)=C1OCC1=CC=CC=C1 KACLDPIVDMHOHS-UHFFFAOYSA-N 0.000 description 2
- GILWHMFYKTWDRN-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CN1N=C(C(O)=O)N=N1 GILWHMFYKTWDRN-UHFFFAOYSA-N 0.000 description 2
- RBECMMSIMITRHN-UHFFFAOYSA-N 2-benzyltetrazole-5-carbonyl chloride Chemical compound N1=C(C(=O)Cl)N=NN1CC1=CC=CC=C1 RBECMMSIMITRHN-UHFFFAOYSA-N 0.000 description 2
- SULGXWMEEJVIFD-UHFFFAOYSA-N 2-benzyltetrazole-5-carboxylic acid Chemical compound N1=C(C(=O)O)N=NN1CC1=CC=CC=C1 SULGXWMEEJVIFD-UHFFFAOYSA-N 0.000 description 2
- JQNSYRHEKYOMEK-UHFFFAOYSA-N 3-amino-2-hydroxy-n,n,5-trimethylbenzamide Chemical compound CN(C)C(=O)C1=CC(C)=CC(N)=C1O JQNSYRHEKYOMEK-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- LQVDDIJGYUUSDS-UHFFFAOYSA-N 4-ethyl-2-methoxy-6-nitrophenol Chemical compound CCC1=CC(OC)=C(O)C([N+]([O-])=O)=C1 LQVDDIJGYUUSDS-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- VOCXDVGVYFKRKW-UHFFFAOYSA-N 5-bromo-1-methoxy-3-nitro-2-phenylmethoxybenzene Chemical compound COC1=CC(Br)=CC([N+]([O-])=O)=C1OCC1=CC=CC=C1 VOCXDVGVYFKRKW-UHFFFAOYSA-N 0.000 description 2
- CKZOCJSNNJJPRA-UHFFFAOYSA-N 5-bromo-3-methoxy-2-phenylmethoxyaniline Chemical compound COC1=CC(Br)=CC(N)=C1OCC1=CC=CC=C1 CKZOCJSNNJJPRA-UHFFFAOYSA-N 0.000 description 2
- KKHOFJIWRCNJFE-UHFFFAOYSA-N 5-ethyl-1-methoxy-3-nitro-2-phenylmethoxybenzene Chemical compound [O-][N+](=O)C1=CC(CC)=CC(OC)=C1OCC1=CC=CC=C1 KKHOFJIWRCNJFE-UHFFFAOYSA-N 0.000 description 2
- UKLHSGDMFJNPGP-UHFFFAOYSA-N 5-ethyl-3-methoxy-2-phenylmethoxyaniline Chemical compound COC1=CC(CC)=CC(N)=C1OCC1=CC=CC=C1 UKLHSGDMFJNPGP-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- VVZWLZVNSBCVBM-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)OC)O VVZWLZVNSBCVBM-UHFFFAOYSA-N 0.000 description 2
- CUBBDUDAPWYAJG-UHFFFAOYSA-N N-(3-acetyl-2-hydroxyphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=CC1)O CUBBDUDAPWYAJG-UHFFFAOYSA-N 0.000 description 2
- CWPDGIMRGAUCNW-UHFFFAOYSA-N N-(3-acetyl-5-amino-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide hydrochloride Chemical compound Cl.C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)N)O CWPDGIMRGAUCNW-UHFFFAOYSA-N 0.000 description 2
- ZCFQUDRECGMFOC-UHFFFAOYSA-N N-(3-acetyl-5-amino-2-hydroxyphenyl)-2H-tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2)C=C(C1)N)O ZCFQUDRECGMFOC-UHFFFAOYSA-N 0.000 description 2
- UWASWRVHAITXJM-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C=2N=NN(N2)CC2=CC=C(C=C2)OC)C=C(C1)CC)O UWASWRVHAITXJM-UHFFFAOYSA-N 0.000 description 2
- SHTNBNKDJYXBDX-UHFFFAOYSA-N N-(3-ethyl-2-hydroxyphenyl)-2H-tetrazole-5-carboxamide Chemical compound CCC1=CC=CC(NC(=O)C=2NN=NN=2)=C1O SHTNBNKDJYXBDX-UHFFFAOYSA-N 0.000 description 2
- VQEOLSMWHLUUSC-UHFFFAOYSA-N N-(5-cyano-2-hydroxy-3-propanoylphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(#N)C=1C=C(C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C1)O)C(CC)=O VQEOLSMWHLUUSC-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- CBXVNXBSTMXBQL-UHFFFAOYSA-N N-[2-hydroxy-5-methyl-3-(2,2,2-trifluoroacetyl)phenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound OC1=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C=C1C(C(F)(F)F)=O)C CBXVNXBSTMXBQL-UHFFFAOYSA-N 0.000 description 2
- NERFVRMCXROHGY-UHFFFAOYSA-N N-[2-hydroxy-5-methyl-3-(2-phenylacetyl)phenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound OC1=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C=C1C(CC1=CC=CC=C1)=O)C NERFVRMCXROHGY-UHFFFAOYSA-N 0.000 description 2
- OJXVSYGIPRJRQX-UHFFFAOYSA-N N-[3-(cyclopropanecarbonyl)-2-hydroxy-5-methylphenyl]-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C1(CC1)C(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C)O OJXVSYGIPRJRQX-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- NWFDSPIVNGDDGQ-UHFFFAOYSA-N chembl149630 Chemical compound OC1=CC=CC=C1NC(=O)C1=NN=NN1 NWFDSPIVNGDDGQ-UHFFFAOYSA-N 0.000 description 2
- QKYWMFSRBQQNTK-UHFFFAOYSA-N chembl150763 Chemical compound OC=1C(C(=O)CC=2C=CC=CC=2)=CC(C)=CC=1NC(=O)C=1N=NNN=1 QKYWMFSRBQQNTK-UHFFFAOYSA-N 0.000 description 2
- YXFDCZUQPYKFEZ-UHFFFAOYSA-N chembl150781 Chemical compound CC(=O)C1=CC(Br)=CC(NC(=O)C2=NNN=N2)=C1O YXFDCZUQPYKFEZ-UHFFFAOYSA-N 0.000 description 2
- CGCGPAQEMKWKRP-UHFFFAOYSA-N chembl152992 Chemical compound OC=1C(C(=O)C2CC2)=CC(C)=CC=1NC(=O)C=1N=NNN=1 CGCGPAQEMKWKRP-UHFFFAOYSA-N 0.000 description 2
- NNZBZWOICKCYTI-UHFFFAOYSA-N chembl153053 Chemical compound CC(=O)C1=CC(NC(=O)C)=CC(NC(=O)C2=NNN=N2)=C1O NNZBZWOICKCYTI-UHFFFAOYSA-N 0.000 description 2
- VVQFHGALQRFUTJ-UHFFFAOYSA-N chembl153647 Chemical compound CC(C)C(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O VVQFHGALQRFUTJ-UHFFFAOYSA-N 0.000 description 2
- PFTFGTKRWOAQCM-UHFFFAOYSA-N chembl155040 Chemical compound CCCC(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O PFTFGTKRWOAQCM-UHFFFAOYSA-N 0.000 description 2
- XAXLTYYAMCNPNG-UHFFFAOYSA-N chembl346612 Chemical compound COC1=CC(CC)=CC(NC(=O)C2=NNN=N2)=C1O XAXLTYYAMCNPNG-UHFFFAOYSA-N 0.000 description 2
- VTZCCDKZXZLZTR-UHFFFAOYSA-N chembl346873 Chemical compound CC(=O)C1=CC(C#N)=CC(NC(=O)C2=NNN=N2)=C1O VTZCCDKZXZLZTR-UHFFFAOYSA-N 0.000 description 2
- DILFXJNBSNWFGI-UHFFFAOYSA-N chembl423218 Chemical compound CC(=O)C1=CC([N+]([O-])=O)=CC(NC(=O)C2=NNN=N2)=C1O DILFXJNBSNWFGI-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- AMVFTPKIDSALRM-UHFFFAOYSA-N cyclopropyl-(2-hydroxy-5-methyl-3-nitrophenyl)methanone Chemical compound [O-][N+](=O)C1=CC(C)=CC(C(=O)C2CC2)=C1O AMVFTPKIDSALRM-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- BBNRTKYZDZMLEI-UHFFFAOYSA-N ethyl 2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound N1=C(C(=O)OCC)N=NN1CC1=CC=C(OC)C=C1 BBNRTKYZDZMLEI-UHFFFAOYSA-N 0.000 description 2
- JZPJXOPGWMQZEX-UHFFFAOYSA-N ethyl 2-benzyltetrazole-5-carboxylate Chemical compound N1=C(C(=O)OCC)N=NN1CC1=CC=CC=C1 JZPJXOPGWMQZEX-UHFFFAOYSA-N 0.000 description 2
- JFAYDUKFFSUDJK-UHFFFAOYSA-N ethyl 2-hydroxy-5-methyl-3-(2H-tetrazole-5-carbonylamino)benzoate Chemical compound C(C)OC(=O)C=1C(=C(NC(=O)C2=NN=NN2)C=C(C1)C)O JFAYDUKFFSUDJK-UHFFFAOYSA-N 0.000 description 2
- LFPHQGWUFWTZOK-UHFFFAOYSA-N ethyl 2-hydroxy-5-methyl-3-nitrobenzoate Chemical compound CCOC(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O LFPHQGWUFWTZOK-UHFFFAOYSA-N 0.000 description 2
- YXTKJRSEOQIRNK-UHFFFAOYSA-N ethyl 3-[(1-benzyltetrazole-5-carbonyl)amino]-2-hydroxy-5-methylbenzoate Chemical compound C(C1=CC=CC=C1)N1N=NN=C1C(=O)NC1=C(C(=CC(=C1)C)C(=O)OCC)O YXTKJRSEOQIRNK-UHFFFAOYSA-N 0.000 description 2
- LNINTUZDCRRYHN-UHFFFAOYSA-N ethyl 3-amino-2-hydroxy-5-methylbenzoate Chemical compound CCOC(=O)C1=CC(C)=CC(N)=C1O LNINTUZDCRRYHN-UHFFFAOYSA-N 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- BLCSFULBHJQIIJ-UHFFFAOYSA-N methyl 2-hydroxy-5-methyl-3-(2H-tetrazole-5-carbonylamino)benzoate Chemical compound OC1=C(NC(=O)C2=NN=NN2)C=C(C=C1C(=O)OC)C BLCSFULBHJQIIJ-UHFFFAOYSA-N 0.000 description 2
- BYDBTYDCQJZXAT-UHFFFAOYSA-N methyl 3-amino-2-hydroxy-5-methylbenzoate Chemical compound COC(=O)C1=CC(C)=CC(N)=C1O BYDBTYDCQJZXAT-UHFFFAOYSA-N 0.000 description 2
- 239000006199 nebulizer Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- TUGMKLVPTRKXOI-UHFFFAOYSA-M potassium;1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound [K+].C1=CC(OC)=CC=C1CN1C(C([O-])=O)=NN=N1 TUGMKLVPTRKXOI-UHFFFAOYSA-M 0.000 description 2
- KFOMIJHHFRXZJN-UHFFFAOYSA-M potassium;2-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylate Chemical compound [K+].C1=CC(OC)=CC=C1CN1N=C(C([O-])=O)N=N1 KFOMIJHHFRXZJN-UHFFFAOYSA-M 0.000 description 2
- JISUAASZSXABRO-UHFFFAOYSA-M potassium;2-benzyltetrazole-5-carboxylate Chemical compound [K+].N1=C(C(=O)[O-])N=NN1CC1=CC=CC=C1 JISUAASZSXABRO-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000006748 scratching Methods 0.000 description 2
- 230000002393 scratching effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- WZODLFCLKIXWGA-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)C)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] WZODLFCLKIXWGA-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- QVGVSSPWGDBFJD-UHFFFAOYSA-N (3-amino-2-hydroxy-5-methylphenyl)-cyclopropylmethanone Chemical compound CC1=CC(N)=C(O)C(C(=O)C2CC2)=C1 QVGVSSPWGDBFJD-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- XQZGSPSZLMKODN-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=CC([N+]([O-])=O)=C1O XQZGSPSZLMKODN-UHFFFAOYSA-N 0.000 description 1
- LKOPRDNSXNVRPS-UHFFFAOYSA-N 1-(2-hydroxy-5-methylphenyl)-2-phenylethanone Chemical compound CC1=CC=C(O)C(C(=O)CC=2C=CC=CC=2)=C1 LKOPRDNSXNVRPS-UHFFFAOYSA-N 0.000 description 1
- GSTOHKXQBZZTPF-UHFFFAOYSA-N 1-(5-ethyl-2-hydroxyphenyl)ethanone Chemical compound CCC1=CC=C(O)C(C(C)=O)=C1 GSTOHKXQBZZTPF-UHFFFAOYSA-N 0.000 description 1
- UYPRLWMCXNTAIA-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxylic acid Chemical compound C1=CC(OC)=CC=C1CN1C(C(O)=O)=NN=N1 UYPRLWMCXNTAIA-UHFFFAOYSA-N 0.000 description 1
- FVNGUMPCFMSEDR-UHFFFAOYSA-N 1-benzyl-N-(3-butanoyl-2-hydroxy-5-methylphenyl)tetrazole-5-carboxamide Chemical compound C(C1=CC=CC=C1)N1N=NN=C1C(=O)NC1=C(C(=CC(=C1)C)C(CCC)=O)O FVNGUMPCFMSEDR-UHFFFAOYSA-N 0.000 description 1
- XSHQMMIEZHWNAK-UHFFFAOYSA-N 2'-hydroxy-5'-methyl-3'-nitroacetophenone Chemical compound CC(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O XSHQMMIEZHWNAK-UHFFFAOYSA-N 0.000 description 1
- KZJRKRQSDZGHEC-UHFFFAOYSA-N 2,2,2-trifluoro-1-phenylethanone Chemical compound FC(F)(F)C(=O)C1=CC=CC=C1 KZJRKRQSDZGHEC-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- ALSCZVUHVTYGDZ-UHFFFAOYSA-N 2-hydroxy-n,n,5-trimethyl-3-nitrobenzamide Chemical compound CN(C)C(=O)C1=CC(C)=CC([N+]([O-])=O)=C1O ALSCZVUHVTYGDZ-UHFFFAOYSA-N 0.000 description 1
- XCCSGOQCJPMXBK-UHFFFAOYSA-N 2-methoxy-4-methyl-6-nitrophenol Chemical compound COC1=CC(C)=CC([N+]([O-])=O)=C1O XCCSGOQCJPMXBK-UHFFFAOYSA-N 0.000 description 1
- PLPVLSBYYOWFKM-UHFFFAOYSA-N 2-phenylmethoxyaniline Chemical compound NC1=CC=CC=C1OCC1=CC=CC=C1 PLPVLSBYYOWFKM-UHFFFAOYSA-N 0.000 description 1
- HSZUUVJFZOGAMB-UHFFFAOYSA-N 3-acetyl-4-hydroxybenzonitrile Chemical compound CC(=O)C1=CC(C#N)=CC=C1O HSZUUVJFZOGAMB-UHFFFAOYSA-N 0.000 description 1
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 description 1
- WHSIIJQOEGXWSN-UHFFFAOYSA-N 4-bromo-2-methoxyphenol Chemical compound COC1=CC(Br)=CC=C1O WHSIIJQOEGXWSN-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- IJIBRSFAXRFPPN-UHFFFAOYSA-N 5-bromo-2-methoxybenzaldehyde Chemical compound COC1=CC=C(Br)C=C1C=O IJIBRSFAXRFPPN-UHFFFAOYSA-N 0.000 description 1
- CLNIBJASCGZXHH-UHFFFAOYSA-N 70978-54-0 Chemical compound CC(=O)C1=CC(Br)=CC([N+]([O-])=O)=C1O CLNIBJASCGZXHH-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229910000014 Bismuth subcarbonate Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000195947 Lycopodium Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- NPDAKONSRXGQRX-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methylphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C)O NPDAKONSRXGQRX-UHFFFAOYSA-N 0.000 description 1
- RFJGSMXIARGKII-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-methylsulfonylphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)S(=O)(=O)C)O RFJGSMXIARGKII-UHFFFAOYSA-N 0.000 description 1
- WTBONQJBGHBDAF-UHFFFAOYSA-N N-(3-acetyl-2-hydroxy-5-nitrophenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)[N+](=O)[O-])O WTBONQJBGHBDAF-UHFFFAOYSA-N 0.000 description 1
- DCPAMLIYYOIGEH-UHFFFAOYSA-N N-(3-acetyl-5-bromo-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)Br)O DCPAMLIYYOIGEH-UHFFFAOYSA-N 0.000 description 1
- JTKLKZOEZYJQBJ-UHFFFAOYSA-N N-(3-acetyl-5-cyano-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)C#N)O JTKLKZOEZYJQBJ-UHFFFAOYSA-N 0.000 description 1
- LNWFHMWAIWPSAG-UHFFFAOYSA-N N-(3-acetyl-5-ethyl-2-hydroxyphenyl)-1-benzyltetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=CC=C2)C=C(C1)CC)O LNWFHMWAIWPSAG-UHFFFAOYSA-N 0.000 description 1
- LNMVCHCECSLZBW-UHFFFAOYSA-N N-(3-acetyl-5-fluoro-2-hydroxyphenyl)-1-[(4-methoxyphenyl)methyl]tetrazole-5-carboxamide Chemical compound C(C)(=O)C=1C(=C(NC(=O)C2=NN=NN2CC2=CC=C(C=C2)OC)C=C(C1)F)O LNMVCHCECSLZBW-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000002009 allergenic effect Effects 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 235000010986 ammonium phosphatide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000002052 anaphylactic effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- MGLUJXPJRXTKJM-UHFFFAOYSA-L bismuth subcarbonate Chemical compound O=[Bi]OC(=O)O[Bi]=O MGLUJXPJRXTKJM-UHFFFAOYSA-L 0.000 description 1
- 229940036358 bismuth subcarbonate Drugs 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 210000003123 bronchiole Anatomy 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 230000004856 capillary permeability Effects 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- JCMFJKSJUNLSGM-UHFFFAOYSA-N chembl149516 Chemical compound FC(F)(F)C(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O JCMFJKSJUNLSGM-UHFFFAOYSA-N 0.000 description 1
- GBVDRUVQAMNNQI-UHFFFAOYSA-N chembl150304 Chemical compound CN(C)C(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O GBVDRUVQAMNNQI-UHFFFAOYSA-N 0.000 description 1
- ZABVSLOSCJCFMR-UHFFFAOYSA-N chembl151011 Chemical compound COC1=CC(Br)=CC(NC(=O)C2=NNN=N2)=C1O ZABVSLOSCJCFMR-UHFFFAOYSA-N 0.000 description 1
- OZXMQUISYKBFKS-UHFFFAOYSA-N chembl153034 Chemical compound COC1=CC=CC(NC(=O)C=2NN=NN=2)=C1O OZXMQUISYKBFKS-UHFFFAOYSA-N 0.000 description 1
- UPERCSOGEFZMDF-UHFFFAOYSA-N chembl153050 Chemical compound CCC(=O)C1=CC(CC)=CC(NC(=O)C2=NNN=N2)=C1O UPERCSOGEFZMDF-UHFFFAOYSA-N 0.000 description 1
- UMNCTJWKIZWASF-UHFFFAOYSA-N chembl153181 Chemical compound CCC(=O)C1=CC(C#N)=CC(NC(=O)C2=NNN=N2)=C1O UMNCTJWKIZWASF-UHFFFAOYSA-N 0.000 description 1
- CSBYYLOMXKCBLX-UHFFFAOYSA-N chembl153799 Chemical compound CCC(=O)C1=CC(C)=CC(NC(=O)C2=NNN=N2)=C1O CSBYYLOMXKCBLX-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 229940076286 cupric acetate Drugs 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- OOWXYSNUGDHGJZ-UHFFFAOYSA-N cyclopropyl-(2-hydroxy-5-methylphenyl)methanone Chemical compound CC1=CC=C(O)C(C(=O)C2CC2)=C1 OOWXYSNUGDHGJZ-UHFFFAOYSA-N 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- BUYFXNQLAQQSEN-UHFFFAOYSA-N ethyl 1-benzyltetrazole-5-carboxylate Chemical compound CCOC(=O)C1=NN=NN1CC1=CC=CC=C1 BUYFXNQLAQQSEN-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229960001317 isoprenaline Drugs 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- URMTUDYUAXKJMZ-UHFFFAOYSA-N methyl 3-[(1-benzyltetrazole-5-carbonyl)amino]-2-hydroxy-5-methylbenzoate Chemical compound C(C1=CC=CC=C1)N1N=NN=C1C(=O)NC1=C(C(=CC(=C1)C)C(=O)OC)O URMTUDYUAXKJMZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- JSGHQDAEHDRLOI-UHFFFAOYSA-N oxomalononitrile Chemical compound N#CC(=O)C#N JSGHQDAEHDRLOI-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008016 pharmaceutical coating Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 150000008103 phosphatidic acids Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- YIPWPAQKXFXRJV-UHFFFAOYSA-M potassium;1-benzyltetrazole-5-carboxylate Chemical compound [K+].[O-]C(=O)C1=NN=NN1CC1=CC=CC=C1 YIPWPAQKXFXRJV-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C205/60—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms in ortho-position to the carboxyl group, e.g. nitro-salicylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Immunology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Transplantation (AREA)
- Pulmonology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB45097/77 | 1977-10-28 | ||
| GB4509777 | 1977-10-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1118427A true CA1118427A (en) | 1982-02-16 |
Family
ID=10435876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000314318A Expired CA1118427A (en) | 1977-10-28 | 1978-10-26 | Tetrazole derivatives and processes for their preparation |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4442115A (enExample) |
| JP (1) | JPS5470274A (enExample) |
| AU (1) | AU517502B2 (enExample) |
| BE (1) | BE871623A (enExample) |
| CA (1) | CA1118427A (enExample) |
| CH (1) | CH635832A5 (enExample) |
| DE (1) | DE2846931A1 (enExample) |
| DK (1) | DK476978A (enExample) |
| FR (1) | FR2407207A1 (enExample) |
| HK (1) | HK95784A (enExample) |
| HU (1) | HU177857B (enExample) |
| IE (1) | IE47960B1 (enExample) |
| IT (1) | IT1099538B (enExample) |
| LU (1) | LU80436A1 (enExample) |
| MY (1) | MY8600719A (enExample) |
| NL (1) | NL7810634A (enExample) |
| SG (1) | SG54284G (enExample) |
| SU (3) | SU1494866A3 (enExample) |
| ZA (1) | ZA786056B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0065874A1 (en) * | 1981-05-22 | 1982-12-01 | Ono Pharmaceutical Co., Ltd. | 2-Aminophenol derivatives, methods for their preparation and composition containing the same |
| GB8333665D0 (en) * | 1983-12-16 | 1984-01-25 | Lilly Industries Ltd | Organic compounds |
| EP0165897B1 (de) * | 1984-05-24 | 1989-03-15 | Ciba-Geigy Ag | Neue Resorcinäther |
| GB2170403B (en) * | 1984-12-24 | 1989-08-09 | Wakamoto Pharma Co Ltd | Medicament for treatment of asthma and preparation thereof |
| ZA865091B (en) * | 1985-07-22 | 1988-02-24 | Riker Laboratories Inc | Substituted di-t-butylphenols |
| PT81492B (pt) * | 1985-09-17 | 1988-03-03 | Ciba Geigy Ag | Processo para a preparacao de novos eteres de resorcina fluorados |
| US4808604A (en) * | 1985-10-03 | 1989-02-28 | Ciba-Geigy Corporation | N-(substituted phenyl) tetrazol-5-yl carboxamides and anti-allergic use thereof |
| PT81374B (pt) * | 1985-10-25 | 1988-02-17 | Ciba Geigy Ag | Processo para a preparacao de novos eteres da resorcina |
| JPS6344570A (ja) * | 1986-08-12 | 1988-02-25 | Wakamoto Pharmaceut Co Ltd | 3−(1h−テトラゾ−ル−5−イル)オキサニリツクアシツド及びその製造法 |
| JPH0175238U (enExample) * | 1987-11-06 | 1989-05-22 | ||
| JPH0271838U (enExample) * | 1988-11-18 | 1990-05-31 | ||
| JPH0273627U (enExample) * | 1988-11-24 | 1990-06-05 | ||
| GB9302331D0 (en) * | 1993-02-05 | 1993-03-24 | Smithkline Beecham Plc | Process |
| FR2788768B1 (fr) | 1999-01-21 | 2001-02-16 | Oreal | Nouveaux 2-acylaminophenols cationiques, leur utilisation a titre de coupleur pour la teinture d'oxydation, compositions les comprenant, et procedes de teinture |
| FR2788691B1 (fr) | 1999-01-21 | 2002-06-14 | Oreal | Compositions pour la teinture d'oxydation des fibres keratiniques comprenant un coupleur cationique, nouveaux coupleurs cationiques, leur utilisation pour la teinture d'oxydation, et procedes de teinture |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207563A1 (es) * | 1973-03-23 | 1976-10-15 | American Home Prod | Procedimiento para preparar un nuevo ester de acido oxamico |
| US4039672A (en) * | 1975-01-11 | 1977-08-02 | Societe D'etudes Scientifiques Et Industrielles De L'ile-De-France | N-(1'-allypyrrolidinyl 2'-methyl) 2-methoxy 4,5-azimido benzamide and its pharmaceutically acceptable salts |
| GB1547564A (en) * | 1975-06-05 | 1979-06-20 | Lilly Industries Ltd | Acylated amino-heteroaryl compounds |
| US4069153A (en) * | 1975-10-28 | 1978-01-17 | American Sterilizer Company | Method of destroying pyrogens |
| GB1561350A (en) * | 1976-11-05 | 1980-02-20 | May & Baker Ltd | Benzamide derivatives |
| US4013647A (en) * | 1976-03-23 | 1977-03-22 | American Home Products Corporation | Morpholine containing tetrazole-5-carboxamide derivatives |
-
1978
- 1978-10-25 NL NL7810634A patent/NL7810634A/xx not_active Application Discontinuation
- 1978-10-26 SU SU782680650A patent/SU1494866A3/ru active
- 1978-10-26 HU HU78MA3049A patent/HU177857B/hu not_active IP Right Cessation
- 1978-10-26 DK DK476978A patent/DK476978A/da not_active Application Discontinuation
- 1978-10-26 AU AU41093/78A patent/AU517502B2/en not_active Expired
- 1978-10-26 JP JP13109278A patent/JPS5470274A/ja active Granted
- 1978-10-26 IT IT29145/78A patent/IT1099538B/it active
- 1978-10-26 ZA ZA00786056A patent/ZA786056B/xx unknown
- 1978-10-26 IE IE2118/78A patent/IE47960B1/en unknown
- 1978-10-26 CA CA000314318A patent/CA1118427A/en not_active Expired
- 1978-10-27 CH CH1114278A patent/CH635832A5/fr not_active IP Right Cessation
- 1978-10-27 BE BE191422A patent/BE871623A/xx not_active IP Right Cessation
- 1978-10-27 FR FR7830626A patent/FR2407207A1/fr active Granted
- 1978-10-27 LU LU80436A patent/LU80436A1/xx unknown
- 1978-10-27 DE DE19782846931 patent/DE2846931A1/de active Granted
-
1979
- 1979-04-26 SU SU792760899A patent/SU961560A3/ru active
- 1979-06-01 US US06/044,511 patent/US4442115A/en not_active Expired - Lifetime
- 1979-06-13 SU SU792775803A patent/SU1080745A3/ru active
-
1984
- 1984-08-03 SG SG54284A patent/SG54284G/en unknown
- 1984-12-06 HK HK957/84A patent/HK95784A/xx unknown
-
1986
- 1986-12-30 MY MY719/86A patent/MY8600719A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU961560A3 (ru) | 1982-09-23 |
| ZA786056B (en) | 1979-10-31 |
| FR2407207B1 (enExample) | 1981-12-18 |
| MY8600719A (en) | 1986-12-31 |
| BE871623A (fr) | 1979-04-27 |
| HU177857B (en) | 1981-12-28 |
| SU1080745A3 (ru) | 1984-03-15 |
| FR2407207A1 (fr) | 1979-05-25 |
| DK476978A (da) | 1979-04-29 |
| SU1494866A3 (ru) | 1989-07-15 |
| SG54284G (en) | 1985-03-08 |
| IE782118L (en) | 1979-04-28 |
| NL7810634A (nl) | 1979-05-02 |
| IT1099538B (it) | 1985-09-18 |
| HK95784A (en) | 1984-12-14 |
| IE47960B1 (en) | 1984-08-08 |
| DE2846931A1 (de) | 1979-05-10 |
| LU80436A1 (fr) | 1979-06-15 |
| CH635832A5 (fr) | 1983-04-29 |
| AU517502B2 (en) | 1981-08-06 |
| JPS5470274A (en) | 1979-06-05 |
| AU4109378A (en) | 1980-05-01 |
| IT7829145A0 (it) | 1978-10-26 |
| US4442115A (en) | 1984-04-10 |
| DE2846931C2 (enExample) | 1988-12-01 |
| JPS6216949B2 (enExample) | 1987-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1118427A (en) | Tetrazole derivatives and processes for their preparation | |
| CA1094565A (en) | Benzamide derivatives | |
| CA1101430A (en) | Derivatives of 4-amino 5-alkylsulphonyl ortho- anisamides, methods of preparing them | |
| US3987160A (en) | Pharmaceutical compositions comprising azapurinones useful in treating allergic respiratory disorders | |
| US3895026A (en) | Substituted 1-benzyl-1h-indazole-3-carboxylic acids and derivatives thereof | |
| GB1588242A (en) | N-(tetrazol-5-yl)-salicylamide derivatives | |
| US3933822A (en) | Azapurinones | |
| Kumar et al. | Syntheses and anthelmintic activity of alkyl 5 (6)-(substituted carbamoyl)-and 5 (6)-(disubstituted carbamoyl) benzimidazole-2-carbamates and related compounds | |
| Ballantyne | The acute mammalian toxicology of dibenz (b, f)-1, 4-oxazepine | |
| DE2740836A1 (de) | Anellierte indolderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| US4173577A (en) | Phenylacetohydroxamic acids | |
| US4544655A (en) | Antiinflammatory, analgesic, and antirheumatic 4-hydroxy-2-methyl-n-(2-pyridyl)-6-trifluoromethyl-2H-thieno[2,3-e]-1,2-thiazine-3-carboxamide 1,1-dioxide, corresponding compositions, and 3-carboxylic acid lower alkyl ester intermediates | |
| US4125625A (en) | Troponyl-oxamic acid derivatives | |
| FR2645743A1 (fr) | Compositions therapeutiques a base de derives di-substitues des n,n(prime)-ditrimethoxybenzoyle piperazines | |
| Nagarajan et al. | Central nervous system active 5-oxo-1, 4, 5, 6, 7, 8-hexahydrocinnolines | |
| CA1072087A (en) | Amides as ovulation inhibitors | |
| EP0152868A2 (de) | Isoxazol-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| JPH01228975A (ja) | ベンゾチアジン―1,1―ジオキシド誘導体及びそれを含有する医薬組成物 | |
| US4389416A (en) | Diphenyl ether, diphenyl thioether and diphenyl methane phenol mannich bases | |
| US4159278A (en) | Dioxamic acids and salts | |
| US4090020A (en) | Thienothiazine derivatives | |
| US4379792A (en) | Anti-inflammatory composition | |
| EP0222961B1 (de) | Neue fluorierte Resorcinether | |
| US3888829A (en) | N,n'-bis(3-hydroxy-2-(3,4-dihydroxy-phenyl)-1-propyl)-aliphatic-diamines | |
| US4454136A (en) | Substituted benzopyranotriazoles and antiallergic use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |