DE2835493C2 - Chromkomplexfarbstoffe - Google Patents
ChromkomplexfarbstoffeInfo
- Publication number
- DE2835493C2 DE2835493C2 DE19782835493 DE2835493A DE2835493C2 DE 2835493 C2 DE2835493 C2 DE 2835493C2 DE 19782835493 DE19782835493 DE 19782835493 DE 2835493 A DE2835493 A DE 2835493A DE 2835493 C2 DE2835493 C2 DE 2835493C2
- Authority
- DE
- Germany
- Prior art keywords
- dyes
- dye
- pyrazolone
- alkyl
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 38
- 239000011651 chromium Substances 0.000 title claims description 19
- 229910052804 chromium Inorganic materials 0.000 title claims description 15
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 description 30
- 239000000987 azo dye Substances 0.000 description 19
- 125000000217 alkyl group Chemical group 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- -1 alkyl sulfone Chemical class 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 229940124530 sulfonamide Drugs 0.000 description 6
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 150000003456 sulfonamides Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 4
- 125000005521 carbonamide group Chemical group 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 2
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- RHPXYZMDLOJTFF-UHFFFAOYSA-N 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC([N+]([O-])=O)=C1O RHPXYZMDLOJTFF-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 125000005362 aryl sulfone group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 229960003742 phenol Drugs 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- HKFAMUCGCCUZMC-UHFFFAOYSA-N 2-(2-ethylphenyl)-5-methyl-4h-pyrazol-3-one Chemical compound CCC1=CC=CC=C1N1C(=O)CC(C)=N1 HKFAMUCGCCUZMC-UHFFFAOYSA-N 0.000 description 1
- MHAFRUMLQZZSIN-UHFFFAOYSA-N 2-amino-4-chloro-6-nitrophenol Chemical compound NC1=CC(Cl)=CC([N+]([O-])=O)=C1O MHAFRUMLQZZSIN-UHFFFAOYSA-N 0.000 description 1
- AJWIWEGQLDDWQC-UHFFFAOYSA-N 2-amino-4-methyl-6-nitrophenol Chemical compound CC1=CC(N)=C(O)C([N+]([O-])=O)=C1 AJWIWEGQLDDWQC-UHFFFAOYSA-N 0.000 description 1
- HCPJEHJGFKWRFM-UHFFFAOYSA-N 2-amino-5-methylphenol Chemical compound CC1=CC=C(N)C(O)=C1 HCPJEHJGFKWRFM-UHFFFAOYSA-N 0.000 description 1
- IOQOLGUXWSBWHR-UHFFFAOYSA-N 5-methyl-2-(4-methylphenyl)-4h-pyrazol-3-one Chemical compound O=C1CC(C)=NN1C1=CC=C(C)C=C1 IOQOLGUXWSBWHR-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 238000004532 chromating Methods 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009963 fulling Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
- C09B45/16—Monoazo compounds containing chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782835493 DE2835493C2 (de) | 1978-08-12 | 1978-08-12 | Chromkomplexfarbstoffe |
| NL7906018A NL7906018A (nl) | 1978-08-12 | 1979-08-06 | Chroomcomplexkleurstoffen. |
| GB7927462A GB2027734B (en) | 1978-08-12 | 1979-08-07 | Chromium complex dyestuffs |
| BR7905148A BR7905148A (pt) | 1978-08-12 | 1979-08-10 | Corantes complexos de cromo,sua preparacao e seu emprego |
| FR7920518A FR2433036A1 (fr) | 1978-08-12 | 1979-08-10 | Colorants complexes de chrome |
| CH737879A CH643581A5 (de) | 1978-08-12 | 1979-08-10 | Chromkomplexfarbstoffe. |
| JP10139079A JPS5525493A (en) | 1978-08-12 | 1979-08-10 | Chromium chelated dyestuff |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782835493 DE2835493C2 (de) | 1978-08-12 | 1978-08-12 | Chromkomplexfarbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2835493A1 DE2835493A1 (de) | 1980-02-28 |
| DE2835493C2 true DE2835493C2 (de) | 1983-05-19 |
Family
ID=6046963
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782835493 Expired DE2835493C2 (de) | 1978-08-12 | 1978-08-12 | Chromkomplexfarbstoffe |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5525493A (en:Method) |
| BR (1) | BR7905148A (en:Method) |
| CH (1) | CH643581A5 (en:Method) |
| DE (1) | DE2835493C2 (en:Method) |
| FR (1) | FR2433036A1 (en:Method) |
| GB (1) | GB2027734B (en:Method) |
| NL (1) | NL7906018A (en:Method) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3262844D1 (en) | 1981-03-23 | 1985-05-09 | Ciba Geigy Ag | Use of 1:2-chrome or cobalt complex dyes for dyeing leather or furs |
| DE3631752A1 (de) * | 1986-09-18 | 1988-03-31 | Bayer Ag | Asymmetrische 1:2-chromkomplexfarbstoffe |
| DE4130806A1 (de) * | 1991-09-17 | 1993-03-18 | Bayer Ag | Unsymmetrische 1:2-chromkomplexfarbstoffe |
| DE102005012730A1 (de) * | 2005-03-19 | 2006-09-21 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Metallkomplexfarbstoffmischungen |
| CN102634230B (zh) * | 2012-03-23 | 2014-04-16 | 上海雅运纺织化工股份有限公司 | 红色1:2铬络合酸性染料组合物及其合成与染色应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB765355A (en) * | 1953-06-08 | 1957-01-09 | Ciba Ltd | Mixed complexes of metalliferous mono-azo-dyestuffs and process for making them |
| CH511929A (de) * | 1969-04-24 | 1971-08-31 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen chromhaltigen Komplexfarbstoffen |
| JPS529215B2 (en:Method) * | 1973-03-30 | 1977-03-15 | ||
| CH583285A5 (en:Method) * | 1974-01-15 | 1976-12-31 | Ciba Geigy Ag | |
| DE2408224A1 (de) * | 1974-02-21 | 1975-10-02 | Bayer Ag | Azochrommischkomplex-farbstoffe |
-
1978
- 1978-08-12 DE DE19782835493 patent/DE2835493C2/de not_active Expired
-
1979
- 1979-08-06 NL NL7906018A patent/NL7906018A/nl not_active Application Discontinuation
- 1979-08-07 GB GB7927462A patent/GB2027734B/en not_active Expired
- 1979-08-10 FR FR7920518A patent/FR2433036A1/fr active Granted
- 1979-08-10 JP JP10139079A patent/JPS5525493A/ja active Granted
- 1979-08-10 BR BR7905148A patent/BR7905148A/pt unknown
- 1979-08-10 CH CH737879A patent/CH643581A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB2027734B (en) | 1982-08-11 |
| DE2835493A1 (de) | 1980-02-28 |
| FR2433036B1 (en:Method) | 1983-05-13 |
| FR2433036A1 (fr) | 1980-03-07 |
| GB2027734A (en) | 1980-02-27 |
| NL7906018A (nl) | 1980-02-14 |
| BR7905148A (pt) | 1980-05-13 |
| JPS6147174B2 (en:Method) | 1986-10-17 |
| CH643581A5 (de) | 1984-06-15 |
| JPS5525493A (en) | 1980-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2835493C2 (de) | Chromkomplexfarbstoffe | |
| DE1544539A1 (de) | Verfahren zur Herstellung von Disazofarbstoffen und deren Metallkomplexverbindungen | |
| DE2531445B2 (de) | Sulfogruppenfreie wasserloesliche azofarbstoffe und deren verwendung zum faerben und/oder bedrucken von synthetischen textilfasern | |
| EP0532994B1 (de) | Unsymmetrische 1:2-chrom-komplexfarbstoffe | |
| EP0072515B1 (de) | Schädlingsbekämpfungsmittel, ihre Herstellung und Verwendung | |
| DE2501449C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE2500550C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE2501039C2 (de) | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung | |
| DE951750C (de) | Verfahren zur Herstellung von braunen, chromhaltigen Azofarbstoffen | |
| DE955800C (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffe der Pyrazolonreihe | |
| DE1644219C3 (de) | 2 zu 1-Metallkomplexmonoazofarbstoffe Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH324391A (de) | Verfahren zur Herstellung neuer kobalthaltiger Azofarbstoffe | |
| DE1769398B2 (de) | Wasserlösliche Phthalocyanin-Azofarbstoffe sowie Verfahren zu deren Herstellung und deren Verwendung | |
| DE2019827C3 (de) | Chromhaltige Komplexfarbstoffe und Verfahren zu deren Herstellung | |
| DE2429524C2 (de) | Chromhaltige Azofarbstoffe, deren Herstellung und Verwendung | |
| EP0073377B1 (de) | Asymmetrische 1:2-Chromkomplexfarbstoffe und Verfahren zu ihrer Herstellung und zum Färben | |
| DE957507C (de) | Verfahren zur Herstellung von chromhaltigen Azofarbstoffen | |
| DE1233518B (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe | |
| DE1644192A1 (de) | Chrom-Mischkomplex-Azofarbstoffe | |
| DE2840651A1 (de) | Chromkomplexfarbstoffe | |
| DE2347124A1 (de) | Azoverbindungen | |
| AT224778B (de) | Verfahren zur Herstellung neuer 1:2-Chromkomplexfarbstoffe | |
| DE2022453C3 (de) | Azofarbstoffe und ihre 1 zu 1 Metallkomplexe, deren Herstellung und Verwendung | |
| CH615210A5 (en:Method) | ||
| EP0043794A2 (de) | Neue Chromkomplexfarbstoffe, ihre Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8126 | Change of the secondary classification |
Free format text: D06P 1/10 D06P 3/02 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |