DE2812573C2 - - Google Patents
Info
- Publication number
- DE2812573C2 DE2812573C2 DE2812573A DE2812573A DE2812573C2 DE 2812573 C2 DE2812573 C2 DE 2812573C2 DE 2812573 A DE2812573 A DE 2812573A DE 2812573 A DE2812573 A DE 2812573A DE 2812573 C2 DE2812573 C2 DE 2812573C2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- water
- peroxycarboxylic
- aqueous phase
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 47
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 44
- 239000002253 acid Substances 0.000 claims description 40
- 238000006243 chemical reaction Methods 0.000 claims description 40
- 239000002904 solvent Substances 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 claims description 17
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 15
- 150000007513 acids Chemical class 0.000 claims description 14
- 239000008346 aqueous phase Substances 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 12
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 230000008569 process Effects 0.000 claims description 8
- 150000001735 carboxylic acids Chemical class 0.000 claims description 7
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 claims description 6
- 238000010992 reflux Methods 0.000 claims description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Chemical compound OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 235000021314 Palmitic acid Nutrition 0.000 claims description 3
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 3
- WMRCTEPOPAZMMN-UHFFFAOYSA-N 2-undecylpropanedioic acid Chemical compound CCCCCCCCCCCC(C(O)=O)C(O)=O WMRCTEPOPAZMMN-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims 2
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 claims 1
- MMCOUVMKNAHQOY-UHFFFAOYSA-N carbonoperoxoic acid Chemical compound OOC(O)=O MMCOUVMKNAHQOY-UHFFFAOYSA-N 0.000 claims 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims 1
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 25
- 229960002163 hydrogen peroxide Drugs 0.000 description 18
- 238000004519 manufacturing process Methods 0.000 description 16
- JHUXOSATQXGREM-UHFFFAOYSA-N dodecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCC(=O)OO JHUXOSATQXGREM-UHFFFAOYSA-N 0.000 description 15
- -1 aliphatic peracids Chemical class 0.000 description 12
- 150000004965 peroxy acids Chemical class 0.000 description 12
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 10
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000003377 acid catalyst Substances 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 5
- 235000011149 sulphuric acid Nutrition 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- 150000002978 peroxides Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- DCQJDRNKCUQEMA-UHFFFAOYSA-N tetradecanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCCCCCC(=O)OO DCQJDRNKCUQEMA-UHFFFAOYSA-N 0.000 description 3
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PVNIQBQSYATKKL-UHFFFAOYSA-N Glycerol trihexadecanoate Natural products CCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC PVNIQBQSYATKKL-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000005505 Ziziphus oenoplia Nutrition 0.000 description 1
- 244000104547 Ziziphus oenoplia Species 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- LBAYFEDWGHXMSM-UHFFFAOYSA-N butaneperoxoic acid Chemical compound CCCC(=O)OO LBAYFEDWGHXMSM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- QSGDGGWTDYSGCY-UHFFFAOYSA-N hexadecaneperoxoic acid Chemical compound CCCCCCCCCCCCCCCC(=O)OO QSGDGGWTDYSGCY-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
- C07C409/30—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids a >C=O group being bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
- C07C407/006—Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/782,204 US4172086A (en) | 1977-03-28 | 1977-03-28 | Process for the manufacture of peroxycarboxylic acids |
| NL7804587A NL7804587A (nl) | 1977-03-28 | 1978-04-28 | Werkwijze voor de bereiding van kristallijne peroxy- carbonzuren. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2812573A1 DE2812573A1 (de) | 1978-10-05 |
| DE2812573C2 true DE2812573C2 (cg-RX-API-DMAC10.html) | 1988-11-03 |
Family
ID=26645411
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782812573 Granted DE2812573A1 (de) | 1977-03-28 | 1978-03-22 | Peroxycarbonsaeuren und verfahren zu deren herstellung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4172086A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS53119813A (cg-RX-API-DMAC10.html) |
| AT (1) | AT367400B (cg-RX-API-DMAC10.html) |
| AU (1) | AU519166B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE865205A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1105050A (cg-RX-API-DMAC10.html) |
| CH (1) | CH638493A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2812573A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2385697A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1580614A (cg-RX-API-DMAC10.html) |
| LU (1) | LU79327A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7804587A (cg-RX-API-DMAC10.html) |
| SE (1) | SE429859B (cg-RX-API-DMAC10.html) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2930546A1 (de) * | 1978-10-25 | 1980-05-08 | Degussa | Verfahren zur phlegmatisierung von wasserunloeslichen peroxycarbonsaeuren |
| US4233235A (en) * | 1979-02-26 | 1980-11-11 | The Procter & Gamble Company | Method for making diperoxyacids |
| US4370251A (en) * | 1980-07-25 | 1983-01-25 | Fmc Corporation | Continuous process for the production of peroxycarboxylic acid compositions |
| US4607052A (en) * | 1983-04-15 | 1986-08-19 | Roussel-Uclaf | Triglycerides, dietetic and therapeutical applications and compositions containing them |
| US4701469A (en) * | 1983-04-15 | 1987-10-20 | Roussel Uclaf | Triglycerides, process for therapeutical applications and compositions containing them |
| DE3320497A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von wasserunloeslichen peroxycarbonsaeuren |
| US4655781A (en) * | 1984-07-02 | 1987-04-07 | The Clorox Company | Stable bleaching compositions |
| US4659519A (en) * | 1984-07-02 | 1987-04-21 | The Clorox Company | Process for synthesizing alkyl monoperoxysuccinic acid bleaching compositions |
| US4680145A (en) * | 1984-09-04 | 1987-07-14 | Monsanto Company | Process for producing diperoxoic acids |
| EP0254331B1 (en) * | 1986-05-28 | 1990-05-09 | Akzo N.V. | Process for the preparation of agglomerates containing diperoxydodecanedioic acid, and their use in bleaching compositions |
| DE3628263A1 (de) * | 1986-08-25 | 1988-03-03 | Degussa | Verfahren zur phlegmatisierung von wasserunloeslichen peroxycarbonsaeuren |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| DE3822798A1 (de) * | 1988-07-06 | 1990-01-11 | Huels Chemische Werke Ag | Verfahren zur herstellung von phlegmatisierten aliphatischen diperoxidicarbonsaeuren |
| IT1245308B (it) * | 1990-12-13 | 1994-09-19 | Ausimont Spa | Processo per la produzione di un acido aril-immido-per-alcanoico |
| GB9027975D0 (en) * | 1990-12-22 | 1991-02-13 | Interox Chemicals Ltd | Peroxycarboxylic acid |
| IT1254619B (it) * | 1992-02-21 | 1995-09-28 | Ausimont Spa | Procedimento per la purificazione di acido ftalimmido-perossicaproico (pap) da impurezze di solventi clorurati |
| IT1254240B (it) * | 1992-03-10 | 1995-09-14 | Ausimont Spa | Procedimento per la separazione dell'acido ftalimmido perossicaproico da soluzioni di solventi organici |
| US5487818A (en) * | 1992-03-10 | 1996-01-30 | Ausimont S.P.A. | Process for separating phthalimido-peroxycaproic acid from solutions in organic solvents |
| US5380928A (en) * | 1993-08-18 | 1995-01-10 | Synergistics Industries, Inc. | Two step oxidation process for the production of carboxylic acids such as azelaic acid from unsaturated substrates |
| US6010729A (en) * | 1998-08-20 | 2000-01-04 | Ecolab Inc. | Treatment of animal carcasses |
| WO2011139364A1 (en) | 2010-05-05 | 2011-11-10 | Synergy Technologies | Synergy of strong acids and peroxy compounds |
| EP2917179B1 (de) * | 2012-11-08 | 2018-06-20 | Evonik Degussa GmbH | Verfahren zur herstellung von gleichgewichtsperessigsäure und mit dem verfahren erhältliche gleichgewichtsperessigsäure |
| CN111039776A (zh) * | 2019-12-31 | 2020-04-21 | 淄博广通化工有限责任公司 | 高纯度的混合长碳链二元羧酸及其制备方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2377038A (en) * | 1941-09-15 | 1945-05-29 | Du Pont | Manufacture of peracids |
| US2813896A (en) * | 1952-12-12 | 1957-11-19 | Bayer Ag | Process for preparing organic peracids |
| US2813885A (en) * | 1954-09-02 | 1957-11-19 | Swern Daniel | Process for making fatty peracids |
| US2814641A (en) * | 1956-07-31 | 1957-11-26 | Union Carbide Corp | Process for producing peracids from aliphatic carboxylic acids |
| GB803159A (en) * | 1956-07-31 | 1958-10-22 | Union Carbide Corp | Process for producing peracids from aliphatic carboxylic acids |
| US2877266A (en) * | 1957-06-04 | 1959-03-10 | Columbia Southern Chem Corp | Preparation of peracids |
| FR1317328A (fr) * | 1961-12-28 | 1963-02-08 | Air Liquide | Procédé de fabrication et de purification de peracides organiques |
| US3284491A (en) * | 1963-07-05 | 1966-11-08 | Pittsburgh Plate Glass Co | Preparation of a peracid in a single liquid phase |
| FR1390068A (fr) * | 1963-07-05 | 1965-02-19 | Pittsburgh Plate Glass Co | Procédé perfectionné de préparation d'acides percarboxyliques |
| US3367951A (en) * | 1964-04-10 | 1968-02-06 | U S Peroxygen Corp | Process for purifying solid peroxides |
| US3494898A (en) * | 1969-04-10 | 1970-02-10 | Heinz W Meyer | Polymerization of olefinic compounds and polymerization catalyst |
| DE2038318C3 (de) * | 1970-08-01 | 1978-08-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Percarbonsänrelösungen oder Percarbonsäuren |
| DE2125160C3 (de) * | 1971-05-21 | 1980-05-22 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von aliphatischen Percarbonsäuren mit 2 bis 5 Kohlenstoffatomen |
| GB1535313A (en) * | 1975-02-04 | 1978-12-13 | Interox Chemicals Ltd | Production of peracids and of epoxides |
| DE2519295C3 (de) * | 1975-04-30 | 1979-02-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen Herstellung von organischen Lösungen von 1 bis 4 Kohlenstoffatome enthaltenden Percarbonsäuren |
| US4085133A (en) * | 1976-11-24 | 1978-04-18 | Ppg Industries, Inc. | Preparation of monoperoxyphthalic acid |
-
1977
- 1977-03-28 US US05/782,204 patent/US4172086A/en not_active Expired - Lifetime
-
1978
- 1978-03-08 CA CA298,467A patent/CA1105050A/en not_active Expired
- 1978-03-22 DE DE19782812573 patent/DE2812573A1/de active Granted
- 1978-03-22 BE BE186196A patent/BE865205A/xx not_active IP Right Cessation
- 1978-03-23 GB GB11556/78A patent/GB1580614A/en not_active Expired
- 1978-03-23 AU AU34467/78A patent/AU519166B2/en not_active Expired
- 1978-03-23 AT AT0208678A patent/AT367400B/de not_active IP Right Cessation
- 1978-03-23 FR FR7808499A patent/FR2385697A1/fr active Granted
- 1978-03-28 CH CH329678A patent/CH638493A5/de not_active IP Right Cessation
- 1978-03-28 JP JP3491678A patent/JPS53119813A/ja active Pending
- 1978-03-28 SE SE7803503A patent/SE429859B/sv not_active IP Right Cessation
- 1978-03-28 LU LU79327A patent/LU79327A1/xx unknown
- 1978-04-28 NL NL7804587A patent/NL7804587A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE429859B (sv) | 1983-10-03 |
| GB1580614A (en) | 1980-12-03 |
| AU519166B2 (en) | 1981-11-12 |
| SE7803503L (sv) | 1978-09-29 |
| US4172086A (en) | 1979-10-23 |
| DE2812573A1 (de) | 1978-10-05 |
| CA1105050A (en) | 1981-07-14 |
| AT367400B (de) | 1982-06-25 |
| LU79327A1 (fr) | 1978-11-03 |
| FR2385697A1 (fr) | 1978-10-27 |
| ATA208678A (de) | 1981-11-15 |
| BE865205A (fr) | 1978-09-22 |
| CH638493A5 (de) | 1983-09-30 |
| AU3446778A (en) | 1979-09-27 |
| FR2385697B1 (cg-RX-API-DMAC10.html) | 1983-07-29 |
| NL7804587A (nl) | 1979-10-30 |
| JPS53119813A (en) | 1978-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2812573C2 (cg-RX-API-DMAC10.html) | ||
| DE2942375C2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| EP0254803A2 (de) | Verfahren zur Herstellung von wässrigen N-Methylmorpholin-N-oxid-Lösungen | |
| DE2627475B2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| US4147720A (en) | Process for preparing aliphatic diperoxydicarboxylic acids | |
| EP0023545B1 (de) | Verfahren zur Herstellung aromatischer Peroxycarbonsäuren | |
| DE2916572A1 (de) | Verfahren zur destillativen trennung von tert.-alkylhydroperoxiden und di- tert.-alkylperoxiden | |
| DE2605363C3 (de) | Verfahren zur Herstellung von Phthalsäure | |
| DE2603269C3 (de) | Verfahren zur Herstellung von Cyclohexanon und methylsubstituiertem oder unsubstituiertem Phenol | |
| DE3826572A1 (de) | Verfahren zur herstellung von hochreinem 5,5'-(2,2,2-trifluor-1-(trifluormethyl) -ethyliden) bis-1,3-isobenzofurandion, verwendung des verfahrensproduktes zur herstellung von polyimiden sowie deren verwendung in der mikroelektronik | |
| EP0212221A1 (de) | Verfahren zur Herstellung von 2,6-Naphthalindicarbonsäure | |
| DE3101459A1 (de) | Verfahren zur herstellung neuer peroxyester und neue peroxyester | |
| AT262954B (de) | Verfahren zur Herstellung von ɛ-Caprolacton und seiner Alkylderivate | |
| DE1418852C (cg-RX-API-DMAC10.html) | ||
| DD141304A5 (de) | Verfahren zur herstellung von aethyl-und isopropylestern | |
| AT233539B (de) | Verfahren zur Reinigung von Perestern und Acylperoxyden | |
| EP0483106B1 (de) | Verfahren zur Herstellung teilfluorierter Tetracarbonsäuren | |
| DE2355415B2 (de) | Verfahren zur herstellung von terephthalsaeure | |
| AT233557B (de) | Verfahren zur Oxydation aromatischer Kohlenwasserstoffe | |
| DEN0000698MA (de) | Verfahren zur Herstellung von Benzoldicarbonsäuren | |
| DE1618635A1 (de) | Verfahren zur Herstellung von Benzolcarbonsaeuren | |
| DE1668383C3 (de) | Verfahren zum Reinigen von rohem Dimethylterephthalat | |
| DE1643721C (cg-RX-API-DMAC10.html) | ||
| AT212328B (de) | Verfahren zur Herstellung von neuen Harnstoff-Inklusionsverbindungen | |
| DE2257084C3 (de) | Verfahren zur Herstellung von 1,1, 2-Triacetoxyäthan |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ASSMANN, E., DIPL.-CHEM. DR.RER.NAT. KLINGSEISEN, |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |