DE279193C - - Google Patents
Info
- Publication number
- DE279193C DE279193C DENDAT279193D DE279193DA DE279193C DE 279193 C DE279193 C DE 279193C DE NDAT279193 D DENDAT279193 D DE NDAT279193D DE 279193D A DE279193D A DE 279193DA DE 279193 C DE279193 C DE 279193C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- hydrogen
- percent
- hydrochloric acid
- aminomethylquinoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002825 nitriles Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JBSAUEMFOKUWTP-UHFFFAOYSA-N quinoline-4-carbonitrile Chemical compound C1=CC=C2C(C#N)=CC=NC2=C1 JBSAUEMFOKUWTP-UHFFFAOYSA-N 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000012295 chemical reaction liquid Substances 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 150000003248 quinolines Chemical class 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- HGHPGHVNTQSTNM-UHFFFAOYSA-N quinolin-2-ylmethanamine Chemical compound C1=CC=CC2=NC(CN)=CC=C21 HGHPGHVNTQSTNM-UHFFFAOYSA-N 0.000 description 2
- BVQGQPVMVBOTID-UHFFFAOYSA-N quinolin-4-ylmethanamine Chemical compound C1=CC=C2C(CN)=CC=NC2=C1 BVQGQPVMVBOTID-UHFFFAOYSA-N 0.000 description 2
- WDXARTMCIRVMAE-UHFFFAOYSA-N quinoline-2-carbonitrile Chemical class C1=CC=CC2=NC(C#N)=CC=C21 WDXARTMCIRVMAE-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- FNLVEUOYGPHYAK-UHFFFAOYSA-N 6-ethoxyquinoline-4-carbonitrile Chemical compound N1=CC=C(C#N)C2=CC(OCC)=CC=C21 FNLVEUOYGPHYAK-UHFFFAOYSA-N 0.000 description 1
- HWZUVHWTAXHZHG-UHFFFAOYSA-N 6-methoxyquinoline-4-carbonitrile Chemical compound N1=CC=C(C#N)C2=CC(OC)=CC=C21 HWZUVHWTAXHZHG-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- -1 quinaldinic acid nitrile Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003530 tetrahydroquinolines Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Quinoline Compounds (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE279193C true DE279193C (enExample) |
Family
ID=535129
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT279193D Active DE279193C (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE279193C (enExample) |
-
0
- DE DENDAT279193D patent/DE279193C/de active Active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68913586T2 (de) | Fluorescierende intrazellulare Ca-Indikatoren. | |
| DE2402398C3 (de) | Aromatische Carbonsäureamid-Derivate, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE1220425B (de) | Verfahren zur Herstellung des lokalanaesthetisch wirksamen N-[1'-Benzyl-piperidyl-(4')]-naphthalin-1, 8-dicarbonsaeureimids | |
| DE1793841C2 (de) | trans-4-Aminomethylcyclohexan-1 carbonsäure und Verfahren zur Herstellung | |
| DE279193C (enExample) | ||
| DE2537289C2 (de) | Aminoalkansulfonsäure-Derivate, Verfahren zu deren Herstellung und deren Verwendung | |
| AT209895B (de) | Verfahren zur Herstellung von 3-Amino-2,4,6-trijodbenzoylverbindungen | |
| DE2131153A1 (de) | Wasserloesliche antibakterielle Verbindungen unterirdischer Stollen | |
| DE2256979C3 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE292819C (enExample) | ||
| DE852855C (de) | Verfahren zur Herstellung von neuen diquartaeren Salzen von Pyrimidylaminochinolinen | |
| DE4302013C1 (de) | Verfahren zur Herstellung reiner Phenothiazinfarbstoffe | |
| DE1445494C3 (de) | Eckige Klammer auf 2 (5 Nitro 2 furyl) vinyl eckige Klammer zu pyndin Derivate und Verfahren zu ihrer Herstellung | |
| DE650706C (de) | Verfahren zur UEberfuehrung von Carbonsaeuren in ihre naechsthoeheren Homologen bzw.deren Derivate | |
| AT226702B (de) | Verfahren zur Herstellung von neuen Flavon-7-oxy-essigsäureamiden | |
| DE1026301B (de) | Verfahren zur Herstellung von antimykotisch wirksamen 4-Halogensalicylsaeureamiden | |
| DE964861C (de) | Verfahren zur Herstellung von (Bz)-Oxy-chinolonen-(4) | |
| DE935667C (de) | Verfahren zur Herstellung von Phenanthridiniumsalzen | |
| DE1468926A1 (de) | Verfahren zur Herstellung von neuen Acetamidinderivaten | |
| DE956226C (de) | Verfahren zur Herstellung von biologisch wirksamen Verbindungen des <<Desacetylthiolutins>> | |
| DE1768787C3 (de) | (o-Carboxy-phenyl)-acetamidine, Verfahren zu deren Herstellung und (o-CarboxyphenyO-acetamidine enthaltende Präparate | |
| AT212470B (de) | Verfahren zur Herstellung von neuen Oxydationsfarbstoffen | |
| DE871897C (de) | Verfahren zur Herstellung von heterocyclischen Aminoverbindungen | |
| DE1620190C (de) | 4-(2-Carbo-alpha-glyceryloxyphenylamino)-8-chlorchinolin, seine Salze und ein Verfahren zu ihrer Herstellung | |
| DE953125C (de) | Mittel zur Bekaempfung von Mikroorganismen, wie Pilzen (Fungi), Bakterien und Protozoen |